Saved Bookmarks
This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.
| 1. |
Area of three adjacant |
| Answer» | |
| 2. |
Show that the square of any positive integer cannot of the form 6m+2, 6m+5 for any integer |
| Answer» Let a be the positive integer and b = 6.Then, by Euclid’s algorithm, a = 6q + r for some integer q ≥ 0 and r = 0, 1, 2, 3, 4, 5 because 0 ≤ r < 5.So,\xa0a = 6q or 6q + 1 or 6q + 2 or 6q + 3 or 6q + 4 or 6q + 5.(6q)2 = 36q2 = 6(6q2)= 6m, where m is any integer.(6q + 1)2 = 36q2 + 12q + 1= 6(6q2 + 2q) + 1= 6m + 1, where m is any integer.(6q + 2)2 = 36q2 + 24q + 4= 6(6q2 + 4q) + 4= 6m + 4, where m is any integer.(6q + 3)2 = 36q2 + 36q + 9= 6(6q2 + 6q + 1) + 3= 6m + 3, where m is any integer.(6q + 4)2 = 36q2 + 48q + 16= 6(6q2 + 7q + 2) + 4= 6m + 4, where m is any integer.(6q + 5)2 = 36q2 + 60q + 25= 6(6q2 + 10q + 4) + 1= 6m + 1, where m is any integer.Hence, The square of any positive integer is of the form 6m, 6m + 1, 6m + 3, 6m + 4 and cannot be of the form 6m + 2 or 6m + 5 for any integer m. | |
| 3. |
Solve for value of x , 2(2x+3/x-3)-25(x-3/2x+3)=5 pls give ans it is urgent |
|
Answer» Pls solution bhi dedo x=1 and x=6 No |
|
| 4. |
If sec +tan thitha=p, show that p2_1 by p2 +1 =sin thitha |
|
Answer» Thita khud Laga le na SeC+Tan=p1/cos+sin/cos=p1+sin/cos=pSqu. Both side(1+sin)2/cos2=P2(1+sin)2/1-sin2=p2(1+sin)2/(1-sin)(1+sin)=p21+sin/1-sin=p21+sin=p2-p2sinP2sin+sin=p2-1Sin(p2+1)=p2-1Sin=p2-1/p2+1 Kya kisi ko nhi aata |
|
| 5. |
If x=4 so tell y= |
| Answer» Give equations | |
| 6. |
Math ka depression ho gya h |
|
Answer» Maths is not so hard at the same time nit so easy..... Practice very well to get a full marks in maths..... ?be well ohh great by maths is my favourite subject Full form of mathsM - meri A - atmaT - tuje H - hmeshaS - staegi ?????? bhai?????? To maths se love kr lo Mujhe |
|
| 7. |
What is ethanol |
|
Answer» Lier Tum to nahi ho ladki What??? No i am girl .... Jessica Alcohol Tu ladka hai na Yrrrrr kunal..?????????????????????????????????????????????? |
|
| 8. |
If a1,a2,a3,......an be A.P. of non-Zero termsProve that :1/a1.a2+1/a2.a3+......an-1an=n-1/a1an |
| Answer» | |
| 9. |
cotA=3/4. prove secA |
|
Answer» hii That\'s right 5/3 Very simple dear |
|
| 10. |
Solve for x:1/2a+b+2x=1/2a+1/b+1/2x |
|
Answer» Mere Q. Nhi aarha samjh pata nhi kya likha hai Ya |
|
| 11. |
Sin theta plus cos theta=x then prove that sin8theta+cos8theta=4-3(x2-1)2÷4 |
| Answer» | |
| 12. |
Show that odd integer x2+y2 is not divisible by four |
| Answer» | |
| 13. |
the height of tower is half |
| Answer» | |
| 14. |
5+2 root3 is irrational P. T |
| Answer» Yes it is irrational | |
| 15. |
state and prove fundamental theorem of arithmetic |
| Answer» Every Composite number can be factorised as a product of primes and this prime factorisation is unique ,apart from the order in which the Prime factor occur | |
| 16. |
Find quadartic polynomial whose zero are -5and6 |
|
Answer» It\'s k( x2-x-30) , sum is 1 and product is -30 I think x^2-11x+30.not so sure..... The required quadratic polynomial is x2-x-30. From punjab X^2 -x + 30. Tum kaha sa ho Nancy would u be my friend Hiii Hi nancy X^2+5x+6 |
|
| 17. |
Riddhi chat Karne se tum ek baat bolo thi |
|
Answer» Riddhi ap kya puch r tha kal koi pic puch r tha vagi na pensi s ki Kya jaan wala |
|
| 18. |
Show that for a odd positive integer to be a perfect square ,it should be of the form 8k+1 |
| Answer» Since, any odd positive integer n is of the form 4m\xa0+ 1 or 4m + 3.if n = 4m + 1n2 = (4m + 1)2= 16m2 + 8m + 1= 8(2m2 + m) + 1So n2 = 8q + 1 ........... (i)) (where q = 2m2 + m is a positive integer)If n = (4m + 3)n2 = (4m + 3)2= 16m2 + 24m + 9= 8(2m2 + 3m + 1) + 1So n2 = 8q + 1 ...... (ii) (where q = 2m2 + 3m + 1 is a positive integer)From (i) and (ii) we conclude that the square of an odd positive integer is of the form 8q + 1, for some integer q. | |
| 19. |
Riddhi I miss u too much plz my Jan plezzzzz????? |
|
Answer» Jaan mai hi hu Abhi vo padh rahi hogi sham ko try karna vo sham ko aane ke liiya bol rahi ti Kya hua suryakant |
|
| 20. |
Chapter 15 most important question |
| Answer» Name the part of human brain which perform the following : 1.Sensation of feeling full 2. Vomiting 3. Picking up a pencil 4. Riding a bicycle | |
| 21. |
Riddhi please chat with me I miss u too much:-|??????????????????? |
|
Answer» Mai fake id wali riddhi nhi huuu Riddhi kal konsa question puch r tha?? Kya tum riddhi ho ya fake id Hello |
|
| 22. |
Hai riddhi tumhare saat bat na kare raha nahin sakta I love u please come and chat with me my cuty ? |
|
Answer» ???? I know but kya kare riddhi ke saat kuch baat Karne he use bagar me ji nahin sakta I love her Ye Sab band kar aur padhai Karne baith APNI bakwaas band kar. Is app be ye function padhai k liye provide Kiya hai tumhari in Galti ki chats aur gossips k liye nhi. Thank-you bhai please aur koi bula please she is my lover Please riddhi come online I can\'t wait any more my sweet heart I have also coaching class at 3 pm please chat with me my riddhi So cute Jo bhe ho aaajjaaaooo bhai pareshan hai... !!....Lo bhai AAP ke taraf se maine v kh diya Omg |
|
| 23. |
Alas ....sridevi is no more????? |
|
Answer» Yea garcy Yaah What sridevi is dead |
|
| 24. |
I miss u too much????? |
| Answer» I also | |
| 25. |
x²-3x-m(m+3) |
| Answer» Find kya krna h | |
| 26. |
How can I get good marks in maths |
|
Answer» By solving last 10 years paper Only solve cbse question Practice |
|
| 27. |
If the volume of acube is 216 cmcube find its edge |
|
Answer» 6 cm 6cm Edge =6 cm |
|
| 28. |
If sec =2÷3 than find the value of tan |
|
Answer» base cannot be greater than hypo Bhai Q. Galat hai becoz sec=H/B but AAP ka Hypo. To base se jaada hai aur hypo. Sabse badi Side ho te hai so AAP ka question wrong hai Question galat hair Under root 5/3 |
|
| 29. |
x²-3x-m(m+3)solve this one.. It will be helpful if you show steps :)) |
|
Answer» x2+mx-(m+3)x-m(m+3)x(x+m)-(m+3)(x+m)(x-(m+3))(x+m)x=m+3 and -m Find Kya krna h |
|
| 30. |
Sec(90°-A)CosecA-tan(90°-A)CotA+cos²25°+cos²65°/3 tan27°×tan 63° |
|
Answer» 2/3 2/3 |
|
| 31. |
Riddhi apne dil se pichai? |
|
Answer» yaar mujhe kyu paresaan kr rhe ho fake Tum riddhi nahin ho kyo aisa likh rahe ho plz leave I am requesting please don\'t make anybody\'s fake id plzzzzzzzzzzz,,,,,,zzzzzzzzz yaaarrrrrrrr haat jodta he riddhi meri gf he please Suryakant kuch to bolo Kya love chal rhi he continue Krte h yrrr Sorry apne dil se tum puchi pyar karti ho Ki nahin plz? |
|
| 32. |
Riddhi thik he |
|
Answer» ??? Hm I am fine vo fake aa gai ha |
|
| 33. |
Thik he par abhii to ho na phir kaha chali jati ho? |
|
Answer» Bc Kya dialogue bola.... ????????? |
|
| 34. |
In triangle ABC AB²=2AC, prove that ∟c=90 |
| Answer» See ncert book chapter 6 | |
| 35. |
Find the common difference of an AP if it\'s nth term is (7n-1) |
|
Answer» 7 7 D==>13-6==>7 |
|
| 36. |
Taki mujhe pata chal sakta he kon riddhi bold ya fir fake plzzzzzzzzzzz write in bold |
|
Answer» yaar mai tmse real love krti hu Mai beekay public school cbse me padhti huu Bhaiyon dekha kitna time lag raha he school ka naam likne ke lie saiad neeche find kar raha hoga School ke bare me jadi batao mai huu suryakant Riddhi write in bold fast plzzz Jaldi answer do |
|
| 37. |
Baap ko nahi pichana?? |
| Answer» NAHI re bc | |
| 38. |
Kya riddhi me tumhare school ke bare me kuch jann sakta hoon |
|
Answer» yes pucho Par kese yaar Bhai agar Jaada personal Baat ho to personally chat ker lo.... .........agar AAP Ko ye fake lagti hain to.....!! |
|
| 39. |
4x^2+4bx-(a^2-b^2)=0 find value of x |
|
Answer» -b+a/2 and-b-a/2 a-b/2 or -a-b/2 |
|
| 40. |
Today I am not going to coaching class I have to find out my real riddhi |
| Answer» Bhai yr kaishe Aashiq ho apni real Gf Ko nhi Pehchan paye ............ Meri agar yahan ho te to uss ki chat style se he. Pehchan le ta | |
| 41. |
find five number in A.P. whose sum in 25/2 and the ratio of first to the last term is 2:3. |
| Answer» APis 2,9/4,5/2,11/4,3 | |
| 42. |
Hlwww |
|
Answer» Eagle v chal Riha e Market me fogg chal raha h Oh yes |
|
| 43. |
should we only follow ncert books |
|
Answer» Im not sure but ncert please give first preference u can score the best Because 90℅ concept will be ncert based Ya Ladoo aayega Yes Yes |
|
| 44. |
Which pen is best to write board exams |
|
Answer» Cello Pointec Linc glacier Xnxx Blue pen According to me techno tip Trimax |
|
| 45. |
Root of 8+2root8+2root8+........ Is Can anyone find the Answer...? |
|
Answer» Root sign is not in this keypad... Q. Dobara sahi se likkhooo .....samjh na aarha hai |
|
| 46. |
What is passing marks |
| Answer» 33 percent 27 | |
| 47. |
Which sources should we follow right now |
| Answer» | |
| 48. |
Two opposite vertices of a sq. are (-1,2)&(3,2).Find the coordinates of the other two vertices. |
| Answer» Let ABCD be a square and B (x, y) be the unknown vertex.AB = BC{tex} \\Rightarrow {/tex} AB2 = BC2\xa0{tex} \\Rightarrow {/tex}\xa0(x + 1)2 + (y - 2)2 = (x - 3)2 + (y - 2)2{tex} \\Rightarrow {/tex} x2 + 1 + 2x + y2 + 4 - 4x = x2 - 6x + 9 + y2 + 4 - 4x{tex} \\Rightarrow {/tex}\xa02x + 1 = - 6x + 9{tex} \\Rightarrow {/tex}\xa08x = 8{tex} \\Rightarrow {/tex}\xa0x = 1 ........ (i)In {tex}\\triangle{/tex}ABC, AB2 + BC2 = AC2{tex} \\Rightarrow {/tex}\xa0(x + 1)2 + (y - 2)2 + (x - 3)2 + (y - 2)2 = (3 + 1)2 + (2 - 2)2{tex} \\Rightarrow {/tex}x2 + 1 + 2x + y2 - 4x + 4 + x2 + 9 - 6x + y2 + 4 - 2y = 16 + 0{tex} \\Rightarrow {/tex}\xa02x2 + 2y2 + 2x - 4y - 6x - 4y + 1 + 4 + 9 + 4 = 16{tex} \\Rightarrow {/tex}\xa02x2 + 2y2 - 4x - 8y + 2 = 0{tex} \\Rightarrow {/tex}\xa0x2 + y2 - 2x - 4y + 1 = 0 ..... (ii)Putting the value of x in eq. (ii),1 + y2 - 2 - 4y + 1 = 0\xa0{tex} \\Rightarrow {/tex}\xa0y2 - 4y = 0\xa0{tex} \\Rightarrow {/tex}\xa0y(y - 4) = 0{tex} \\Rightarrow {/tex}\xa0y = 0 or 4Hence the other vertices are (1, 0) and (1, 4). | |
| 49. |
Plz tell something friends to fake riddhi |
| Answer» Ye jo yha hai ye real wali riddhi hai bhai belive kar | |
| 50. |
Find the 37th term of Ap 6,7_3divide by 4 9 1by 2 11 3by4 |
| Answer» | |