Explore topic-wise InterviewSolutions in Current Affairs.

This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.

1.

If a set has 7 proper subsets, then it contains ____ elements.

Answer»

If a set has 7 proper subsets, then it contains ____ elements.



2.

I.Q. of a person is given by I=MC×100, where M is mental age and C is chronological age. If 80≤I≤140 for a group of 12 years old children, then their mental age can be

Answer»

I.Q. of a person is given by I=MC×100, where M is mental age and C is chronological age. If 80I140 for a group of 12 years old children, then their mental age can be

3.

A lady gives a dinner party for six guests. The number of ways in which they may be selected from among ten friends if wto of the friends will not attend the party together is

Answer»

A lady gives a dinner party for six guests. The number of ways in which they may be selected from among ten friends if wto of the friends will not attend the party together is


4.

79.Find the equation of the parabola whose focus is (a,b) and whose directrix is x/a+y/b=1.

Answer» 79.Find the equation of the parabola whose focus is (a,b) and whose directrix is x/a+y/b=1.
5.

Differentiate thefunctions with respect to x.

Answer»

Differentiate the
functions with respect to x.


6.

14. Range of function f(x)=ex-1/ex+1

Answer» 14. Range of function f(x)=ex-1/ex+1
7.

Find the equations of the bisectors of the angles between the coordinate axes.

Answer»

Find the equations of the bisectors of the angles between the coordinate axes.

8.

The sum of the series i + i2 + i3 +_____ upto 1000 terms is ____________.

Answer» The sum of the series i + i2 + i3 +_____ upto 1000 terms is ____________.
9.

12. A motor boat whose speed is 15km/hr in still water goes 40km downstream and comes back in a total of 6 hrs . Find the speed of stream

Answer» 12. A motor boat whose speed is 15km/hr in still water goes 40km downstream and comes back in a total of 6 hrs . Find the speed of stream
10.

Evaluate the following : (i) i457(ii) i528(iii) 1i58(iv) i37+1i47(v) (i41+1i257)9(vi) (i77+i70+i87+i414)3(vii) i30+i40+i60(viii) i49+i68+i89+i110

Answer»

Evaluate the following :

(i) i457(ii) i528(iii) 1i58(iv) i37+1i47(v) (i41+1i257)9(vi) (i77+i70+i87+i414)3(vii) i30+i40+i60(viii) i49+i68+i89+i110

11.

Show tha 4 sin 27 =(5+(5)) - (3-(5))

Answer» Show tha 4 sin 27 =(5+(5)) - (3-(5))
12.

1−sin2θ1+cotθ−cos2θ1+tanθ

Answer»

1sin2θ1+cotθcos2θ1+tanθ

13.

Which of the following pairs of straight lines intersects at right angles?

Answer»

Which of the following pairs of straight lines intersects at right angles?

14.

17. If x=p sec Q+ q tan Q and y=p tan Q + q sec Q then prove that x2 -y2 =p2 - q2

Answer» 17. If x=p sec Q+ q tan Q and y=p tan Q + q sec Q then prove that x2 -y2 =p2 - q2
15.

28. Find the value of tan13÷ 12

Answer» 28. Find the value of tan13÷ 12
16.

The sides AC and AB of a △ABC touches the conjugate hyperbola of the hyperbola x2a2 −y2b2=1 at C and B. If the vertex A lies on the ellipse x2a2+y2b2=1, then the side BC always touches

Answer»

The sides AC and AB of a ABC touches the conjugate hyperbola of the hyperbola x2a2 y2b2=1 at C and B. If the vertex A lies on the ellipse x2a2+y2b2=1, then the side BC always touches

17.

A family of lines is given by (1+2λ)x+(1−λ)y+λ=0, λ being the parameter. The line belonging to this family at the maximum distance from the point (1,4) is

Answer»

A family of lines is given by (1+2λ)x+(1λ)y+λ=0, λ being the parameter. The line belonging to this family at the maximum distance from the point (1,4) is

18.

If (5−√21)2n+1 and f = R –[[R], where [R]denotes the greatest integer less than or equal to R, then R(1−f) =

Answer»

If (521)2n+1 and f = R –[[R], where [R]denotes the greatest integer less than or equal to R, then R(1f) =

19.

Find the points at which the function f given by has (i) local maxima (ii) local minima (ii) point of inflexion

Answer» Find the points at which the function f given by has (i) local maxima (ii) local minima (ii) point of inflexion
20.

If sin θ=1213, find the value of sin2 θ-cos2 θ2 sin θ cos θ×1tan2 θ.

Answer» If sin θ=1213, find the value of sin2 θ-cos2 θ2 sin θ cos θ×1tan2 θ.
21.

Given that tan A,tan B are the roots of the equation x2−px+q=0, then the value of sin2(A+B) is

Answer»

Given that tan A,tan B are the roots of the equation x2px+q=0, then the value of sin2(A+B) is

22.

If tan A=2tanB+cotB, then 2tan(A-B)=

Answer»

If tan A=2tanB+cotB, then 2tan(A-B)=


23.

Find the sum of all prime numbers p and q such that the below equation is satisfied. p2–p+1=q3

Answer» Find the sum of all prime numbers p and q such that the below equation is satisfied. p2p+1=q3
24.

Let zi,¯¯¯zi (i=1,2,..,5) are the complex roots of the equation x10+(13x−1)10=0, where the bar denotes complex conjugation. Then the value of 5∑i=11zi ¯¯¯zi is

Answer» Let zi,¯¯¯zi (i=1,2,..,5) are the complex roots of the equation x10+(13x1)10=0, where the bar denotes complex conjugation. Then the value of 5i=11zi ¯¯¯zi is
25.

The value of limx→0tan(x)x is 1

Answer» The value of limx0tan(x)x is
  1. 1
26.

The equation of the parabola whose focus is the point (0, 0) and the tangent at the vertex is x-y+1=0 is

Answer»

The equation of the parabola whose focus is the point (0, 0) and the tangent at the vertex is x-y+1=0 is


27.

There are two prime numbers p so that 5p can be expressed in the form of [n25] for some positive integer n, where [.] denotes the greatest integer function. The sum of these two prime numbers is

Answer»

There are two prime numbers p so that 5p can be expressed in the form of [n25] for some positive integer n, where [.] denotes the greatest integer function. The sum of these two prime numbers is

28.

sinx-sin y-ycosx +cos y18.- tan2

Answer» sinx-sin y-ycosx +cos y18.- tan2
29.

If f(x) is continuous and differentiable over [−2,5] and −4≤f′(x)≤3 for all x in (−2,5), then the greatest possible value of f(5)−f(−2) is

Answer»

If f(x) is continuous and differentiable over [2,5] and 4f(x)3 for all x in (2,5), then the greatest possible value of f(5)f(2) is

30.

Let f(x)=|x2−9|−|x−a|, then number of integers in the range of a so that f(x)=0 has 4 distinct real roots, is

Answer» Let f(x)=|x29||xa|, then number of integers in the range of a so that f(x)=0 has 4 distinct real roots, is
31.

If ∣∣∣∣∣2x2+x3x−54x+3x+5−x26x−62x−35x+6−3x∣∣∣∣∣=ax5+bx4+cx3+dx2+ex+f ∀ x∈R, then the value of f is

Answer»

If

2x2+x3x54x+3x+5x26x62x35x+63x

=ax5+bx4+cx3+dx2+ex+f xR,
then the value of f is

32.

Pick out a demonstrative pronoun for the blank. _____ is the school which I will go to next year.

Answer»

Pick out a demonstrative pronoun for the blank.

_____ is the school which I will go to next year.


33.

Let u, v, w, z be complex number such that |u| < 1, |v| = 1 and w=v(u−z)(¯uz−1) then

Answer»

Let u, v, w, z be complex number such that |u| < 1, |v| = 1 and w=v(uz)(¯uz1) then


34.

If f(x)=∣∣∣∣∣1+xn(1−x)n2+xn(2+x)n(2+x)n1(3−x)n13+x∣∣∣∣∣, then the constant term in the expansion is

Answer» If f(x)=

1+xn(1x)n2+xn(2+x)n(2+x)n1(3x)n13+x

,
then the constant term in the expansion is
35.

The number of points at which f(x)=1log|x| is discontinuous is.

Answer»

The number of points at which f(x)=1log|x| is discontinuous is.

36.

100.Given that x, a1, a2, y are in A.P. and x, b1, b2, b3, y are also in A.P., then the value of (a2-a1) /(b2-b3) if (x≠ y) (A) 1/2 (B) 3/4 (C) 4/3 (D) 1

Answer» 100.Given that x, a1, a2, y are in A.P. and x, b1, b2, b3, y are also in A.P., then the value of (a2-a1) /(b2-b3) if (x≠ y) (A) 1/2 (B) 3/4 (C) 4/3 (D) 1
37.

The least and the greatest distance of the point (10, 7) for the circle x2+y2–4x–2y–20= are

Answer»

The least and the greatest distance of the point (10, 7) for the circle x2+y24x2y20= are


38.

find the sum of real roots of eqn (x-2)^2+|x-2|-2=0

Answer» find the sum of real roots of eqn (x-2)^2+|x-2|-2=0
39.

Which of the following relations in R is an equivalence relatilon?

Answer» Which of the following relations in R is an equivalence relatilon?
40.

Find the vector equation of the plane passing through the intersection of the planes and through the point (2, 1, 3)

Answer» Find the vector equation of the plane passing through the intersection of the planes and through the point (2, 1, 3)
41.

Find limx→1f(x), where f(x)={x2−1,x≤1−x2−1,x&gt;1

Answer» Find limx1f(x), where f(x)={x21,x1x21,x>1
42.

Show that the line through the points (1, −1, 2) (3, 4, −2) is perpendicular to the line through the points (0, 3, 2) and (3, 5, 6).

Answer» Show that the line through the points (1, −1, 2) (3, 4, −2) is perpendicular to the line through the points (0, 3, 2) and (3, 5, 6).
43.

Let [t] denote the greatest integer ≤t. Then the value of 8⋅1∫−12([2x]+|x|) dx is

Answer» Let [t] denote the greatest integer t. Then the value of 8112([2x]+|x|) dx is
44.

The acute angle between the lines joining the points (0,0),(3,2) and (2,2),(3,4) is

Answer»

The acute angle between the lines joining the points (0,0),(3,2) and (2,2),(3,4) is

45.

If f(x)=x-1/x+1 than proved that f(2x)=3f(x)+1/f(x)+3

Answer»

If f(x)=x-1/x+1 than proved that f(2x)=3f(x)+1/f(x)+3

46.

In a ΔABC; the value of cos2B−C2(b+c)2+sin2B−C2(b−c)2 is

Answer»

In a ΔABC; the value of cos2BC2(b+c)2+sin2BC2(bc)2 is

47.

The set of values of k for which the equation x4+(k−1)x3+x2+(k−1)x+1=0 has 2 positive and 2 negative roots is

Answer»

The set of values of k for which the equation x4+(k1)x3+x2+(k1)x+1=0 has 2 positive and 2 negative roots is

48.

The comjugate of a complex number is 1i−1. Then that complex number is

Answer»

The comjugate of a complex number is 1i1. Then that complex number is


49.

Find thedirection cosines of the vector

Answer»

Find the
direction cosines of the vector

50.

12. For the reaction XA+ YB>ZC, if d[A]/dt =d[B]/dt =1.5d[C]/dt, then the correct statement among the following is: 1. The value of X=Y=Z=3 2. The value of X=Y=3 3. The value of X=2 4. The value of Y=2

Answer» 12. For the reaction XA+ YB>ZC, if d[A]/dt =d[B]/dt =1.5d[C]/dt, then the correct statement among the following is: 1. The value of X=Y=Z=3 2. The value of X=Y=3 3. The value of X=2 4. The value of Y=2