Explore topic-wise InterviewSolutions in Current Affairs.

This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.

1.

The eccentricity of the hyperbola x2-y2=a2 is ___________________.

Answer» The eccentricity of the hyperbola x2-y2=a2 is ___________________.
2.

52.Prove that cos2xcosx/2-cos3x cos 9x/2= sin 5xsin 5x/2

Answer» 52.Prove that cos2xcosx/2-cos3x cos 9x/2= sin 5xsin 5x/2
3.

If Sn=n∑r=11√4n2−r2, then which of the following statement(s) is(are) correct ?

Answer»

If Sn=nr=114n2r2, then which of the following statement(s) is(are) correct ?

4.

Solve the equation(value of x): \operatorname{cos}^2x+\sqrt3=2(\sqrt3+1)

Answer» Solve the equation(value of x): \operatorname{cos}^2x+\sqrt3=2(\sqrt3+1)
5.

If the area bounded by the circle having centre at origin and radius 9 unit and the curve √|x|+√|y|=3 is aπ+b, then (a+b)=

Answer» If the area bounded by the circle having centre at origin and radius 9 unit and the curve |x|+|y|=3 is aπ+b, then (a+b)=
6.

If the probability that a person can swim is 0.4. Five persons are selected randomly to jump into a river, then the probability that 2 of them survive is (a) 144625 (b) 232625 (c) 108125 (d) 216625

Answer» If the probability that a person can swim is 0.4. Five persons are selected randomly to jump into a river, then the probability that 2 of them survive is

(a) 144625 (b) 232625
(c) 108125 (d) 216625
7.

18. Two whole numbers are randomly selected and multiplied . If the probability that the unit place in their product is even is P and the probability that the unit place in their product is odd is q then P/q is.

Answer» 18. Two whole numbers are randomly selected and multiplied . If the probability that the unit place in their product is even is P and the probability that the unit place in their product is odd is q then P/q is.
8.

The angle between the straight lines, whose direction cosines are given by the equations 2l+2m−n=0 and mn+nl+lm=0, is

Answer»

The angle between the straight lines, whose direction cosines are given by the equations 2l+2mn=0 and mn+nl+lm=0, is

9.

Consider the binary relation:S={(x,y)|y=x+1 and x,yϵ{0,1,2,……}}The reflexive transitive closure of S is

Answer»

Consider the binary relation:

S={(x,y)|y=x+1 and x,yϵ{0,1,2,}}

The reflexive transitive closure of S is

10.

If (x−1)4−16=0, then the sum of non real complex values of x, is

Answer» If (x1)416=0, then the sum of non real complex values of x, is
11.

The two parabolas y2=4ax and y2=4c(x−b) cannot have a common normal, other than the axis unless, if

Answer»

The two parabolas y2=4ax and y2=4c(xb) cannot have a common normal, other than the axis unless, if

12.

22. How to find range of f(x)= sinx-3 cosx+1

Answer» 22. How to find range of f(x)= sinx-3 cosx+1
13.

The general solution(s) of θ satisfying the equation tan2θ+sec2θ=1 can be (where n∈Z)

Answer»

The general solution(s) of θ satisfying the equation tan2θ+sec2θ=1 can be (where nZ)

14.

The number of solution(s) of the equation (log2cosθ)2+log4cosθ(16cosθ)=2 in the interval [0,2π) is

Answer» The number of solution(s) of the equation (log2cosθ)2+log4cosθ(16cosθ)=2 in the interval [0,2π) is
15.

If →a,→b,→c are non-zero vectors such that →a⋅(→b+→c)=→c⋅(→a+→b), then which of the following can be true ?

Answer»

If a,b,c are non-zero vectors such that a(b+c)=c(a+b), then which of the following can be true ?

16.

11. If a b and c are mutually perpendicular vectors of equal magnitude find angles which the vector 2a + b + 2c makes with the vectors a , b and c

Answer» 11. If a b and c are mutually perpendicular vectors of equal magnitude find angles which the vector 2a + b + 2c makes with the vectors a , b and c
17.

If |x| < 1 then the coefficient of xn in the expansion of (1+x+x2+.......)2 will be

Answer»

If |x| < 1 then the coefficient of xn in the expansion

of (1+x+x2+.......)2 will be


18.

The locus of the orthocentre of the triangle formed by the lines (1+p)x−py+p(1+p)=0,(1+q)x−qy+q(1+q)=0 and y=0, where p≠q, is

Answer»

The locus of the orthocentre of the triangle formed by the lines (1+p)xpy+p(1+p)=0,(1+q)xqy+q(1+q)=0 and y=0, where pq, is

19.

If Z = 2197 and R = 729, how would J be written in that code? J=125 how

Answer» If Z = 2197 and R = 729, how would J be written in that code? J=125 how
20.

The letters of the word "RANDOM" are arranged in all possible ways. The number of arrangements in which there are 2 letters between 'R' and 'D' is

Answer»

The letters of the word "RANDOM" are arranged in all possible ways. The number of arrangements in which there are 2 letters between 'R' and 'D' is

21.

If the equation sin−1(x2+x+1)+cos−1(ax+1)=π2 has exactly two solutions, then a cannot have the integral value/s

Answer»

If the equation sin1(x2+x+1)+cos1(ax+1)=π2 has exactly two solutions, then a cannot have the integral value/s


22.

The number of chords can be drawn through 21 points on the circle is

Answer»

The number of chords can be drawn through 21 points on the circle is


23.

limx→π4 cosec2 x-2cot x-1 is equal to ______________________.

Answer» limxπ4 cosec2 x-2cot x-1 is equal to ______________________.
24.

Consider the following system of equations : ax+by+cz=0az+bx+cy=0ay+bz+cx=0 List - I List - II(I)If a+b+c≠0 and (P) Planes meet only at one point(a−b)2+(b−c)2+(c−a)2=0.(II)If a+b+c=0 and (Q) Equations represent the line x=y=z(a−b)2+(b−c)2+(c−a)2≠0(III) If a+b+c≠0 and (R) Equations represent identical planes(a−b)2+(b−c)2+(c−a)2≠0(IV)If a+b+c=0 and (S) The solution of the system represents (a−b)2+(b−c)2+(c−a)2=0 whole of the three dimensional space Which of the following is the "INCORRECT" option?

Answer»

Consider the following system of equations :
ax+by+cz=0az+bx+cy=0ay+bz+cx=0
List - I List - II(I)If a+b+c0 and (P) Planes meet only at one point(ab)2+(bc)2+(ca)2=0.(II)If a+b+c=0 and (Q) Equations represent the line x=y=z(ab)2+(bc)2+(ca)20(III) If a+b+c0 and (R) Equations represent identical planes(ab)2+(bc)2+(ca)20(IV)If a+b+c=0 and (S) The solution of the system represents (ab)2+(bc)2+(ca)2=0 whole of the three dimensional space


Which of the following is the "INCORRECT" option?

25.

Let f be a quadratic polynomial such that f(−π)=f(π)=0 and f(π2)=3π24. If limx→πf(x)⋅cos(sinx)⋅cosec(sinx)=mπ, then the value of m is

Answer» Let f be a quadratic polynomial such that f(π)=f(π)=0 and f(π2)=3π24. If limxπf(x)cos(sinx)cosec(sinx)=mπ, then the value of m is
26.

Let f : R → R be defined by f(x) = 3x2 – 5 and g : R → R by gx=xx2+1. Then (gof) (x) is(a) 3x2−59x4−30x2+26(b) 3x2−59x4−6x2+26(c) 3x2x4+2x2−4(d) 3x29x4+30x2−2

Answer» Let f : R → R be defined by f(x) = 3x2 – 5 and g : R → R by gx=xx2+1. Then (gof) (x) is

(a) 3x259x430x2+26



(b) 3x259x46x2+26



(c) 3x2x4+2x24



(d) 3x29x4+30x22
27.

If (x3+1,y−23)=(53,13), find the values of x and y.

Answer» If (x3+1,y23)=(53,13), find the values of x and y.
28.

A metal crystallises in a face centred cubic structure. If the edge length of its unit cell is ‘a′, the closest approach between two atoms in a metallic crystal will be:

Answer»

A metal crystallises in a face centred cubic structure. If the edge length of its unit cell is a, the closest approach between two atoms in a metallic crystal will be:

29.

f(x+p)=f(x)∀xϵ X if c. xϵX f(cx+p)=f(c(x+pc))=f(cx)

Answer» f(x+p)=f(x)xϵ X if c. xϵX
f(cx+p)=f(c(x+pc))=f(cx)
30.

If the foot of perpendicular drawn from origin to a plane is (1,2,−3), then the equation of the plane is

Answer»

If the foot of perpendicular drawn from origin to a plane is (1,2,3), then the equation of the plane is

31.

If PQ is a normal chord of the parabola y2=4ax at P(at2,2at). Then the axis of the parabola divides ¯¯¯¯¯¯¯¯PQ in the ratio

Answer»

If PQ is a normal chord of the parabola y2=4ax at P(at2,2at). Then the axis of the parabola divides ¯¯¯¯¯¯¯¯PQ in the ratio

32.

Respected Sir, Please help me in solving my below mentioned doubt, If a + b + c = 0, then find one of the roots of quadratic equation ax2 + bx + c = 0

Answer»

Respected Sir,

Please help me in solving my below mentioned doubt,

If a + b + c = 0, then find one of the roots of quadratic equation ax2 + bx + c = 0

33.

The solution of the differential equation dydx−y+3xloge(y+3x)+3=0 is(where c is a constant of integration)

Answer»

The solution of the differential equation dydxy+3xloge(y+3x)+3=0 is

(where c is a constant of integration)

34.

7ˡᵒᵍ ˣ+xˡᵒᵍ ⁷=9,then \log\surd x=

Answer» 7ˡᵒᵍ ˣ+xˡᵒᵍ ⁷=9,then \log\surd x=
35.

The value of integral ∞∫0ze−z√1−e−2zdz is

Answer»

The value of integral 0zez1e2zdz is

36.

[Hint:multiply numerator and denominator by xn− 1 and put xn = t]

Answer»

[Hint:
multiply numerator and denominator by xn
− 1
and put xn = t]

37.

For the curve xy=c2 the subnormal at any point varies as[Karnataka CET 2003]

Answer» For the curve xy=c2 the subnormal at any point varies as

[Karnataka CET 2003]
38.

If ΔABC is right angled at A, then the value of r2+r3 is:

Answer»

If ΔABC is right angled at A, then the value of r2+r3 is:

39.

If z+4≤3, then find the greatest and least values of z+1.

Answer» If z+43, then find the greatest and least values of z+1.
40.

13. (1 —x) (1+x2)

Answer» 13. (1 —x) (1+x2)
41.

If 3+2i sinθ1−2i sin θ is a real number and 0 &lt; θ&lt;2&lt;2π then θ

Answer»

If 3+2i sinθ12i sin θ is a real number and 0 < θ<2<2π then θ


42.

A plane meets the coordinate axes in A, B, C such that the centroid of the triangle ABC is the point (a, a, a).Then the equation of the plane is x + y + z = p, where p is

Answer»

A plane meets the coordinate axes in A, B, C such that the centroid of the triangle ABC is the point (a, a, a).

Then the equation of the plane is x + y + z = p, where p is

43.

If 10∫0f(x)dx=5 and 10∑k=11∫0f(k−1+x)dx=R, then the value of R is

Answer»

If 100f(x)dx=5 and 10k=110f(k1+x)dx=R, then the value of R is

44.

Draw the graphs of the equations x - y + 1 = 0 and 3x + 2y - 12 = 0. Determine the coordinates of the vertices of the triangle formed by these lines and the x-axis, and shade the triangular region.

Answer» Draw the graphs of the equations x - y + 1 = 0 and 3x + 2y - 12 = 0. Determine the coordinates of the vertices of the triangle formed by these lines and the x-axis, and shade the triangular region.
45.

The ratio in which the area enclosed by the curve y=cosx(0≤0≤π2) in the first quadrant is divided by the curve y=sinx, is:

Answer»

The ratio in which the area enclosed by the curve y=cosx(00π2) in the first quadrant is divided by the curve y=sinx, is:



46.

A rectangle with sides 2m -1 and 2n -1 is divided into squares of unit length by drawing parallel lines as shows in the diagram, then the number of rectangles possible with odd side lengths is

Answer»

A rectangle with sides 2m -1 and 2n -1 is divided into squares of unit length by drawing parallel lines as shows in the diagram, then the number of rectangles possible with odd side lengths is


47.

Forthe matrix,verify that(i) is a symmetric matrix(ii) is a skew symmetric matrix

Answer»

For
the matrix
,
verify that


(i)

is a symmetric matrix


(ii)

is a skew symmetric matrix

48.

Evaluate each of the following:(i) cosec-1cosecπ4(ii) cosec-1cosec3π4(iii) cosec-1cosec6π5(iv) cosec-1cosec11π6(v) cosec-1cosec13π6(vi) cosec-1cosec-9π4

Answer» Evaluate each of the following:



(i) cosec-1cosecπ4

(ii) cosec-1cosec3π4

(iii) cosec-1cosec6π5

(iv) cosec-1cosec11π6

(v) cosec-1cosec13π6

(vi) cosec-1cosec-9π4
49.

If the projections of the line segment AB on the coordinate axes are 12,3,k such that k∈R+ and AB=13 then k2−2k+3=

Answer» If the projections of the line segment AB on the coordinate axes are 12,3,k such that kR+ and AB=13 then k22k+3=
50.

Let S=∑∞n=0nαn where α

Answer» Let S=n=0nαn where α<1. The value of α in the range 0<α<1, such that S=2\alpha\) is