Explore topic-wise InterviewSolutions in Current Affairs.

This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.

1.

Petrochemicals are not used in the manufacture of

Answer»

Petrochemicals are not used in the manufacture of


2.

At STP, a container has 3 moles of He, 3 moles of O2 and 4 moles N2. Without changing total pressure, if 2 moles of O2 is removed, the partial pressure of O2 will be decreased by:

Answer»

At STP, a container has 3 moles of He, 3 moles of O2 and 4 moles N2. Without changing total pressure, if 2 moles of O2 is removed, the partial pressure of O2 will be decreased by:

3.

Why zinc have high lionisation energy

Answer» Why zinc have high lionisation energy
4.

The heat of combustion of solid benzoic acid at constant volume is -321.3 kJ at 27^{}. The heat ofcombustion at constant pressure is

Answer» The heat of combustion of solid benzoic acid at constant volume is -321.3 kJ at 27^{}. The heat ofcombustion at constant pressure is
5.

Which one is harder graphite or diamond

Answer» Which one is harder graphite or diamond
6.

Question 28Can we separate alcohol dissolved in water by using a separating funnel? If yes, then describe the procedure. If not, explain.

Answer» Question 28

Can we separate alcohol dissolved in water by using a separating funnel? If yes, then describe the procedure. If not, explain.
7.

How are the less reactive metals extracted?

Answer» How are the less reactive metals extracted?
8.

What are the characteristics of natural gas?

Answer»

What are the characteristics of natural gas?
9.

Coal reserves are said to be enough to last for another hundred years. Do you think we need to worry in such case? Why or why not?​

Answer» Coal reserves are said to be enough to last for another hundred years. Do you think we need to worry in such case? Why or why not?​
10.

100 mL each of coconut oil and water are taken in two beakers and kept in the freezer.a) What difference can be observed in their volumes during freezing?b) What do you infer from the observation?c) When water is frozen in glass bottles, it is advised not to fill the bottles completely. Explain the reason.

Answer» 100 mL each of coconut oil and water are taken in two beakers and kept in the freezer.

a) What difference can be observed in their volumes during freezing?

b) What do you infer from the observation?

c) When water is frozen in glass bottles, it is advised not to fill the bottles completely. Explain the reason.
11.

Which of the following characteristics is associated with gaseous state?

Answer»

Which of the following characteristics is associated with gaseous state?


12.

How are colloid, solution, and suspension different from each other?

Answer» How are colloid, solution, and suspension different from each other?
13.

Identify the biodegradable materials from the given options.

Answer»

Identify the biodegradable materials from the given options.


14.

90.How does the specific charge of particles of cathode rays independent of nature of gas taken in the discharge tube but particles of anode rays depend

Answer» 90.How does the specific charge of particles of cathode rays independent of nature of gas taken in the discharge tube but particles of anode rays depend
15.

What are the three states of matter? Give examples for each state. [3 MARKS]

Answer»

What are the three states of matter? Give examples for each state. [3 MARKS]



16.

What is the properties of matter and there measurement

Answer» What is the properties of matter and there measurement
17.

Which of the following metals on reacting with sodium hydroxide solution produce hydrogen gas?A. Cu B. AlC. Fe D. Zn

Answer» Which of the following metals on reacting with sodium hydroxide solution produce hydrogen gas?

A.
Cu B. Al

C. Fe D. Zn

18.

Match the following. Reaction NamesReactionsiDisplacement reactionA.CaO+O2→2Ca(OH)2iiDecomposition ReactionB.Fe+Pb(NO3)2→Fe(NO3)2+PbiiiRedox ReactionC.MgCl2+Ca(OH)2→Mg(OH)2+CaCl2ivCombination ReactionD.KClO3→2KCl+3O2vDouble Displacement ReactionE.CO2+H2→2CO+H2O

Answer»

Match the following.

Reaction NamesReactionsiDisplacement reactionA.CaO+O22Ca(OH)2iiDecomposition ReactionB.Fe+Pb(NO3)2Fe(NO3)2+PbiiiRedox ReactionC.MgCl2+Ca(OH)2Mg(OH)2+CaCl2ivCombination ReactionD.KClO32KCl+3O2vDouble Displacement ReactionE.CO2+H22CO+H2O


19.

During a physical change or a chemical change, the total mass of the products remains equal to the total mass of reactants. Which of the following law states this?

Answer»

During a physical change or a chemical change, the total mass of the products remains equal to the total mass of reactants. Which of the following law states this?


20.

Saloni took a piece of burning charcoal and collected the gas evolved in a test tube.Write down word equations of all the reactions taking place in this process.

Answer» Saloni took a piece of burning charcoal and collected the gas evolved in a test tube.

Write down word equations of all the reactions taking place in this process.
21.

'दरबार' सवैये में किस प्रकार के वातावरण का वर्णन किया गया है?

Answer» 'दरबार' सवैये में किस प्रकार के वातावरण का वर्णन किया गया है?
22.

The equivalent weight of oxygen, when it is converted to oxide is equal to

Answer» The equivalent weight of oxygen, when it is converted to oxide is equal to
23.

In chlorine, when the protons and electrons are equal, the charges cancel each other and the atom remains neutral. Then how does it accept one more electron when there is no force to act on it?

Answer»

In chlorine, when the protons and electrons are equal, the charges cancel each other and the atom remains neutral. Then how does it accept one more electron when there is no force to act on it?

24.

29. atom a, b, c and d are located at center, face center,Tetrahedra voids,octahedral voids if the minimum distance of an atom b, c and d from atom a are x,y,z respectively then x:y:z is equal to

Answer» 29. atom a, b, c and d are located at center, face center,Tetrahedra voids,octahedral voids if the minimum distance of an atom b, c and d from atom a are x,y,z respectively then x:y:z is equal to
25.

Question 23 Find out the wrong statements and write them in their correct form. (i) We can survive for some time without air but we cannot survive even for a few minutes without food. (ii) A brick kiln emits a lot of smoke and other harmful gases causing air pollution. (iii) Carbon monoxide is produced by the complete burning of fuels such as coal, petrol, diesel. (iv) Chlorination is a commonly used chemical method for killing germs in water. (v) Water which is suitable for drinking is called soft water.

Answer»

Question 23
Find out the wrong statements and write them in their correct form.
(i) We can survive for some time without air but we cannot survive even for a few minutes without food.
(ii) A brick kiln emits a lot of smoke and other harmful gases causing air pollution.
(iii) Carbon monoxide is produced by the complete burning of fuels such as coal, petrol, diesel.
(iv) Chlorination is a commonly used chemical method for killing germs in water.
(v) Water which is suitable for drinking is called soft water.

26.

Calcium hydroxide + Carbon dioxide → Calcium carbonate + WaterThe balanced chemical equation for the following word equation is:

Answer»

Calcium hydroxide + Carbon dioxide → Calcium carbonate + Water



The balanced chemical equation for the following word equation is:

27.

The diagram represents the zones of flame, which zone will produce maximum soot?

Answer»

The diagram represents the zones of flame, which zone will produce maximum soot?


28.

What is the weight of available oxygen from a solution of H2O2 , if 20 ml of this solution needs 25 ml , N/20 KMnO4 for complete oxidation?

Answer» What is the weight of available oxygen from a solution of H2O2 , if 20 ml of this solution needs 25 ml , N/20 KMnO4 for complete oxidation?
29.

A neutral atom of an element has 2K, 8L, 11 Mand 2N electrons. The number of p-electron in the atom are (1) 2 (2) 12 (3) 10(4) 6

Answer» A neutral atom of an element has 2K, 8L, 11 Mand 2N electrons. The number of p-electron in the atom are (1) 2 (2) 12 (3) 10(4) 6
30.

Which of the following interhalogen compound is/are solid in nature?

Answer»

Which of the following interhalogen compound is/are solid in nature?

31.

What is electron configuration and how to find it in simple words ?

Answer» What is electron configuration and how to find it in simple words ?
32.

Calculate the volume occupied by (0) 28 u nitrogen gas (i) 28 g N2 gas at STP.

Answer» Calculate the volume occupied by (0) 28 u nitrogen gas (i) 28 g N2 gas at STP.
33.

Fractures in oil reservoirs ___

Answer»

Fractures in oil reservoirs ___



34.

25.the half life of A is10.6min. it undergoes decay to its daughter element B of half life 60.58s .the time which the daugter element will have maximum activity a 22.71s b 227.1s c 227.1 min d 22.71 min

Answer» 25.the half life of A is10.6min. it undergoes decay to its daughter element B of half life 60.58s .the time which the daugter element will have maximum activity a 22.71s b 227.1s c 227.1 min d 22.71 min
35.

The measures to be taken to keep public places clean and free from plastic are:

Answer»

The measures to be taken to keep public places clean and free from plastic are:



36.

Amongst the reactant pairs given below, how many of them yield no product?(a) Mg(s)+CuSO4(aq)(b) Cu(s)+ZnSO4(aq)(c) Zn(s)+HCl(aq)1

Answer» Amongst the reactant pairs given below, how many of them yield no product?



(a) Mg(s)+CuSO4(aq)



(b) Cu(s)+ZnSO4(aq)



(c) Zn(s)+HCl(aq)
  1. 1
37.

How can we briefly describe atomic mass?

Answer»

How can we briefly describe atomic mass?

38.

Define atomicity.

Answer»


Define atomicity.



39.

Question 5 (b)Give reason.LPG is a better domestic fuel than wood.

Answer» Question 5 (b)

Give reason.

LPG is a better domestic fuel than wood.
40.

Explain about coal and petroleum from basics

Answer»

Explain about coal and petroleum from basics

41.

What is the observation of discovery of electron

Answer» What is the observation of discovery of electron
42.

MnO4 ^{- }+ H^{+ }+ C_2O_4^{2- }→ Mn^{2+ }+ co_{2 + }H_2O the moles of CO_{2 } + H_2O, the moles of CO_{2 }formed ar

Answer» MnO4 ^{- }+ H^{+ }+ C_2O_4^{2- }→ Mn^{2+ }+ co_{2 + }H_2O the moles of CO_{2 } + H_2O, the moles of CO_{2 }formed ar
43.

MnO2 (s)+4HCl(aq)→MnCl2(aq)+Cl2(g)+2H2O(l) In the above reaction, which one of them is getting reduced?

Answer» MnO2 (s)+4HCl(aq)MnCl2(aq)+Cl2(g)+2H2O(l) In the above reaction, which one of them is getting reduced?
44.

Which of following produce gas? 1.CuSo​​​​4 and Zn 2.HCl and Zn 3.CuSo4 and Fe 4.​​​​NaOH and Al

Answer» Which of following produce gas?
1.CuSo​​​​4 and Zn
2.HCl and Zn
3.CuSo4 and Fe
4.​​​​NaOH and Al
45.

Which of the following burns without producing a flame ? (a) camphor (b) coke (c) cooking gas (d) kerosene

Answer»

Which of the following burns without producing a flame ?

(a) camphor

(b) coke

(c) cooking gas

(d) kerosene

46.

Question 6 (d)Give reasons for the following.Why Sodium and potassium are stored in kerosene?

Answer» Question 6 (d)

Give reasons for the following.


Why Sodium and potassium are stored in kerosene?
47.

Question 6What is fuel? Give two examples each of solid, liquid, and gaseous fuels.

Answer»


Question 6



What is fuel? Give two examples each of solid, liquid, and gaseous fuels.



48.

Which of the following is an example of double displacement reaction?(i) CO2(g)+H2(g)→CO(g)+H2O(g)(ii) P4O10(s)+6H2O(l)→4H3PO4(aq)(iii) H2+O2→H2O​​​​​​​(iv) CoCl2(aq)+Na2CO3(aq)→CoCO3(aq)+2NaCl(aq)​​​​​​​

Answer»

Which of the following is an example of double displacement reaction?

(i)
CO2(g)+H2(g)CO(g)+H2O(g)

(ii) P4O10(s)+6H2O(l)4H3PO4(aq)

(iii) H2+O2H2O​​​​​​​

(iv) CoCl2(aq)+Na2CO3(aq)CoCO3(aq)+2NaCl(aq)​​​​​​​



49.

62 Atomic radius order for F-,Cl-,Br-,H-

Answer» 62 Atomic radius order for F-,Cl-,Br-,H-
50.

What is atom ??

Answer» What is atom ??