This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.
| 1. |
The number of nodal planes in a px is |
|
Answer» The number of nodal planes in a px is |
|
| 2. |
Not let's try this in 3-D. Calculate r and a relationship from the following figure. If a=x∗r, type x.___ |
|
Answer» Not let's try this in 3-D. Calculate r and a relationship from the following figure. If a=x∗r, type x.
|
|
| 3. |
Dipole moment of which ketone is maximum? |
|
Answer» Dipole moment of which ketone is maximum? |
|
| 4. |
An empty container was filled with equal masses of methane and hydrogen gases. The fraction of total pressure exerted by hydrogen is____. |
|
Answer» An empty container was filled with equal masses of methane and hydrogen gases. The fraction of total pressure exerted by hydrogen is____. |
|
| 5. |
The Tyndall effect is observed only when following conditions are satisfied:-(a) The diameter of the dispersed particles is much smaller than the wavelength of the light used.(b) The diameter of the dispersed particle is not much smaller than the wavelength of the light used.(c) The refractive indices of the dispersed phase and dispersion medium are almost similar in magnitude.(d) The refractive indices of the dispersed phase and dispersion medium differ greatly in magnitude. |
|
Answer» The Tyndall effect is observed only when following conditions are satisfied:- (a) The diameter of the dispersed particles is much smaller than the wavelength of the light used. |
|
| 6. |
The geometric form of crystals is the result of orderly arrangement of _____ |
|
Answer» The geometric form of crystals is the result of orderly arrangement of _____ |
|
| 7. |
The oxidation state of Mo in its oxido-complex species [Mo2O4(C2H4)2(H2O)2]2− is: |
|
Answer» The oxidation state of Mo in its oxido-complex species [Mo2O4(C2H4)2(H2O)2]2− is: |
|
| 8. |
KCl has higher melting point than AgCl. Why? [rAg+ ≈ rK+] |
|
Answer» KCl has higher melting point than AgCl. Why? [rAg+ ≈ rK+] |
|
| 9. |
Which of the following have highest ionic radii |
|
Answer» Which of the following have highest ionic radii |
|
| 10. |
Which of the following has the smallest size? |
|
Answer» Which of the following has the smallest size?
|
|
| 11. |
When 2-bromobutane reacts with alcoholic KOH, the reaction is called |
|
Answer» When 2-bromobutane reacts with alcoholic KOH, the reaction is called |
|
| 12. |
One of the following metals forms a volatile carbonyl compound and this property is taken advantage for its extraction. This metal is |
|
Answer» One of the following metals forms a volatile carbonyl compound and this property is taken advantage for its extraction. This metal is |
|
| 13. |
The value of equilibrium constant for self ionisation of water at 25∘ C is (density of water 1 g/ml) : |
|
Answer» The value of equilibrium constant for self ionisation of water at 25∘ C is (density of water 1 g/ml) : |
|
| 14. |
A sample of 2.5 mol of hydrazine (N2H4) loses 25 mol of electrons on being converted to a new compound X. Assuming that there is no loss of nitrogen in the formation of the new compound and the oxidation state of H+ is +1 throughout the reaction, then what is the oxidation number of nitrogen in compound X? |
|
Answer» A sample of 2.5 mol of hydrazine (N2H4) loses 25 mol of electrons on being converted to a new compound X. Assuming that there is no loss of nitrogen in the formation of the new compound and the oxidation state of H+ is +1 throughout the reaction, then what is the oxidation number of nitrogen in compound X? |
|
| 15. |
Structure of some important polymers is given. Which one represents Buna-S? |
|
Answer» Structure of some important polymers is given. Which one represents Buna-S? |
|
| 16. |
The potential of the cell at 25∘C isPt|H2(1 atm)|CH3COONa(0.1M)+CH3COOH(0.01M)||NH4Cl(0.2M)+NH4OH(0.1M)|H2(1 atm)|PtGiven: pKa of CH3COOH and pKb of NH4OH=4.74 |
|
Answer» The potential of the cell at 25∘C is |
|
| 17. |
pH of 0.5 M Ba(CN)2 solution (pKb of CN−=9.30) is : |
|
Answer» pH of 0.5 M Ba(CN)2 solution (pKb of CN−=9.30) is : |
|
| 18. |
The electron belongs to the angular momentum of an e−in a Bohr's orbit of H atom is 4.2178 × 10−34 Kg.m2.Sec−1. |
|
Answer» The electron belongs to the angular momentum of an e−in a Bohr's orbit of H atom is 4.2178 × 10−34 Kg.m2.Sec−1. |
|
| 19. |
Which of the following has square planar geometry? |
|
Answer» Which of the following has square planar geometry? |
|
| 20. |
CaC2+H2O → A H2SO4/HgSO4−−−−−−−−−→ B. Identify A and B in the given reaction |
|
Answer» CaC2+H2O → A H2SO4/HgSO4−−−−−−−−−→ B. Identify A and B in the given reaction |
|
| 21. |
From the options given below, choose the one that helps accomplish the given (above)conversion: |
|
Answer»
|
|
| 22. |
Proteinsare built up of [CPMT 1981, 99; BHU 1987; CBSE PMT 2001;MP PMT 1987, 96; KCET1984] |
|
Answer» Proteins [CPMT 1981, 99; BHU 1987; CBSE PMT 2001;
|
|
| 23. |
Number of lone pair-bond pair repulsion at 90∘ are (P) in I−3. Find the value of P |
|
Answer» Number of lone pair-bond pair repulsion at 90∘ are (P) in I−3. Find the value of P |
|
| 24. |
Which of the following is not a basic aminoacid? |
|
Answer» Which of the following is not a basic amino |
|
| 25. |
Van der Waals forces |
|
Answer» Van der Waals forces |
|
| 26. |
The polymer used for making contact lenses for eyes is |
|
Answer» The polymer used for making contact lenses for eyes is |
|
| 27. |
The French physicist Louis de Broglie in 1924 postulated that matter, like radiation, should exhibit a dual behaviour. He proposed the following relationship between the wavelength lambda of a material particle, its linear momentum p and planck constant h.λ=hp=hmvThe de Broglie relation implies that the wavelength of a particle should decrease as its velocity increases. It also implies that for a given velocity heavier particles should have shorter wavelength than lighter particles. The waves associated with particles in motion are called matter waves or de Broglie waves. These waves differ from the electromagnetic waves as they(i) have lower velocities(ii) have no electrical and magnetic fields and(iii) are not emitted by the particle under consideration.The experimental confirmation of the de Broglie’s relation was obtained when Davisson and Germer, in 1927, observed that a beam of electrons is diffracted by a nickel crystal. As diffraction is a characteristic property of waves, hence the beam of electron behaves as a wave, as proposed by de Broglie.Using Bohr’s theory, the transition, so that the electron's de-Broglie wavelength becomes 3 times of its original value in He+ ion will be? |
|
Answer» The French physicist Louis de Broglie in 1924 postulated that matter, like radiation, should exhibit a dual behaviour. He proposed the following relationship between the wavelength lambda of a material particle, its linear momentum p and planck constant h. |
|
| 28. |
What is the geometry of H2SO4? |
|
Answer» What is the geometry of H2SO4? |
|
| 29. |
3.6 g of oxygen is adsorbed on 1.2 g of a metal powder. What volume of oxygen is adsorbed per gram of the adsorbent at 1 atm and 300 K? |
|
Answer» 3.6 g of oxygen is adsorbed on 1.2 g of a metal powder. What volume of oxygen is adsorbed per gram of the adsorbent at 1 atm and 300 K? |
|
| 30. |
Which of the following structure is more stable? |
|
Answer» Which of the following structure is more stable? |
|
| 31. |
The correct order of acid strength is: |
|
Answer» The correct order of acid strength is: |
|
| 32. |
Which of the following cyclic dienes does not show geometrical isomerism? |
|
Answer» Which of the following cyclic dienes does not show geometrical isomerism? |
|
| 33. |
In the IUPAC name of the above compound, the locant position of Br is . |
Answer» ![]() In the IUPAC name of the above compound, the locant position of Br is |
|
| 34. |
The solubility of Iodine in pure water is less than its solubility in potassium iodide solution, because |
|
Answer» The solubility of Iodine in pure water is less than its solubility in potassium iodide solution, because |
|
| 35. |
The heat of formation of C2H5OH(l) is −66 kcal mol−1. The heat of combustion of CH3OCH3 (g) is −348 kcal mol−1. △Hf for H2O and CO2 are −68 kcal mol−1 and −94 kcal mol−1 respectively.Then, the △H for reaction C2H5OH(l)→CH3OCH3(g) is : |
|
Answer» The heat of formation of C2H5OH(l) is −66 kcal mol−1. The heat of combustion of CH3OCH3 (g) is −348 kcal mol−1. △Hf for H2O and CO2 are −68 kcal mol−1 and −94 kcal mol−1 respectively. |
|
| 36. |
Which of the following is not an example of green chemistry? |
|
Answer» Which of the following is not an example of green chemistry? |
|
| 37. |
Which compound is formed when CH3OH reacts with CH3-Mg-X[CPMT 1977, 89] |
|
Answer» Which compound is formed when CH3OH reacts with CH3-Mg-X[CPMT 1977, 89] |
|
| 38. |
In the manufacture of sodium carbonate, the following reactions are involved:(A)Δ−→(B)+CO2(B)+H2O→(C)NH4Cl−−−−→(D)(E)+CO2→(F)(F)+NaCl→GHeat−−−→Na2CO3+CO2+H2O(D) is a gas which is soluble in H2OCompound (A) is: |
|
Answer» In the manufacture of sodium carbonate, the following reactions are involved: |
|
| 39. |
Which of the following produces Benzene as a byproduct? |
|
Answer» Which of the following produces Benzene as a byproduct? |
|
| 40. |
The molar solubility in (mol L−1) of a sparingly soluble salt MX4 is ′s′.The molar solubility product is Ksp. ′s′ is given in terms of Ksp by the relation: |
|
Answer» The molar solubility in (mol L−1) of a sparingly soluble salt MX4 is ′s′.The molar solubility product is Ksp. ′s′ is given in terms of Ksp by the relation: |
|
| 41. |
An element X has the following isotopic composition: 200X−90%, 199X−8%, 202X−2%. The weighted average atomic mass of the naturally occurring element X is closest to: |
|
Answer» An element X has the following isotopic composition: 200X−90%, 199X−8%, 202X−2%. The weighted average atomic mass of the naturally occurring element X is closest to: |
|
| 42. |
In a fuel cell, H2 and O2 react to produce electricity. In the process, H2 gas is oxidized at the anode and O2 gas is reduced at the cathode. If 67.2 litres of H2 at STP react in 15 minutes and the entire current is used for electrode deposition of Cu from Cu(II) solution, how many grams of Cu will be deposited and what is the average current produced?Anode : H2+2OH−→2H2O+2e−Cathode : O2+2H2O+4e−→4OH− |
|
Answer» In a fuel cell, H2 and O2 react to produce electricity. In the process, H2 gas is oxidized at the anode and O2 gas is reduced at the cathode. If 67.2 litres of H2 at STP react in 15 minutes and the entire current is used for electrode deposition of Cu from Cu(II) solution, how many grams of Cu will be deposited and what is the average current produced? |
|
| 43. |
The detergent used in hair conditioner is |
|
Answer» The detergent used in hair conditioner is |
|
| 44. |
A 100 W power source emits green light having a wavelength of 5000 ∘A. How many photons are emitted per minute by the source? |
|
Answer» A 100 W power source emits green light having a wavelength of 5000 ∘A. How many photons are emitted per minute by the source? |
|
| 45. |
LiCl is hydrated while NaCl is not. Why? |
|
Answer» LiCl is hydrated while NaCl is not. Why? |
|
| 46. |
Which of the following complex compounds will not exhibit geometrical isomerism? |
|
Answer» Which of the following complex compounds will not exhibit geometrical isomerism? |
|
| 47. |
Gravity separation is also called __ |
|
Answer» Gravity separation is also called |
|
| 48. |
Read the following question and answer as per the direction given below: Statement 1: In any ionic solid [MX] with Schottky defect, the number of positive and negative ions are same.Statement 2: An equal number of cation and anion vacancies is present. |
|
Answer» Read the following question and answer as per the direction given below: |
|
| 49. |
The impurities present in mined ore are technically called |
|
Answer» The impurities present in mined ore are technically called |
|
| 50. |
The enthalpy of vaporisation of liquid diethyl ether is 26.0 kJ mol−1 at its boiling point 35.0oC.Calculate △ S for conversion of vapour to liquid at 35.0oC in JK−1mol−1. |
|
Answer» The enthalpy of vaporisation of liquid diethyl ether is 26.0 kJ mol−1 at its boiling point 35.0oC. |
|