This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.
| 1. |
Which of the following compound is covalent? |
|
Answer» Which of the following compound is covalent? |
|
| 2. |
If the closed packed cations in an AB type crystal has a radius of 75 pm. What would be the maximum and minimum size of the anions filling the void. |
|
Answer» If the closed packed cations in an AB type crystal has a radius of 75 pm. What would be the maximum and minimum size of the anions filling the void. |
|
| 3. |
How many moles of magnesium phosphate, Mg3(PO4)2 will contain 0.25 mole of oxygen atoms? |
|
Answer» How many moles of magnesium phosphate, Mg3(PO4)2 will contain 0.25 mole of oxygen atoms? |
|
| 4. |
Each of the following options contains a set of four molecules, identify the option(s) where all four molecules possess a permanent dipole moment at room temperature. |
|
Answer» Each of the following options contains a set of four molecules, identify the option(s) where all four molecules possess a permanent dipole moment at room temperature. |
|
| 5. |
Based on the octet rule, boron will most likely form: |
|
Answer» Based on the octet rule, boron will most likely form: |
|
| 6. |
Which of the following statements about control of particulate pollution is not correct? |
|
Answer» Which of the following statements about control of particulate pollution is not correct? |
|
| 7. |
If you are given a 4 m NaOH solution having density 2 g/mL, then find the molarity of the solution. |
|
Answer» If you are given a 4 m NaOH solution having density 2 g/mL, then find the molarity of the solution. |
|
| 8. |
Which of the following is TRUE for alkenes? |
|
Answer» Which of the following is TRUE for alkenes? |
|
| 9. |
Calculate ΔH at 358 K for the reaction,Fe2O3(s)+3H2(g) → 2Fe(s)+3H2O(l)Given that , ΔH298=−33.29 kJ mol−1 and CP for Fe2O3(s), Fe(s), H2O(l) and H2(g) are 103.8, 25.1, 75.3, and 28.8 J/K mol. |
|
Answer» Calculate ΔH at 358 K for the reaction, |
|
| 10. |
Which of the following bonds has the least energy? |
|
Answer» Which of the following bonds has the least energy? |
|
| 11. |
Which of the following compounds will behave as a reducing sugar in an aqueous KOH solution? |
|
Answer» Which of the following compounds will behave as a reducing sugar in an aqueous KOH solution? |
|
| 12. |
The standard emf of the cell Fe|Fe2+(aq)||Cd2+(aq)|Cd is 0.0372 V and temperature coefficient of the cell is −1.25×10−4VK−1. Which is/are correct about the cell (at 300 K)? |
|
Answer» The standard emf of the cell Fe|Fe2+(aq)||Cd2+(aq)|Cd is 0.0372 V and temperature coefficient of the cell is −1.25×10−4VK−1. Which is/are correct about the cell (at 300 K)? |
|
| 13. |
While Fe3+ is stable, Mn3+ is not stabe in acid solution because:(Mn3++e−→Mn2+, E∘=1.5 V;O2+4H++4e−→2H2O, E∘=+1.23V;Fe3++e−→Fe2+,E∘=0.77V) |
|
Answer» While Fe3+ is stable, Mn3+ is not stabe in acid solution because: |
|
| 14. |
Extrinsic semiconductor made from intrinsic semiconductor by - |
|
Answer» Extrinsic semiconductor made from intrinsic semiconductor by - |
|
| 15. |
The species in which the central atom uses sp2 - hybrid orbitals in its bonding is |
|
Answer» The species in which the central atom uses sp2 - hybrid orbitals in its bonding is |
|
| 16. |
What is the maximum concentration of an equimolar solution of ferrous sulphate(FeSO4) and sodium sulphide (Na2S) so that when mixed in equal volumes, there is not precipitation of iron sulphide (FeS)?(For FeS, Ksp=5×10−18) |
|
Answer» What is the maximum concentration of an equimolar solution of ferrous sulphate(FeSO4) and sodium sulphide (Na2S) so that when mixed in equal volumes, there is not precipitation of iron sulphide (FeS)? |
|
| 17. |
Consider the sequence of reactions and choose the major product: |
|
Answer» Consider the sequence of reactions and choose the major product: |
|
| 18. |
ACl3 is trigonal pyramidal and ECl3 is trigonal planar. These two combine to give AECl6. Crystallographic studies and structural analysis reveal that AECl6 is an ionic compound. If the shape of the anion is tetrahedral, then the shape of the cation is: |
|
Answer» ACl3 is trigonal pyramidal and ECl3 is trigonal planar. These two combine to give AECl6. Crystallographic studies and structural analysis reveal that AECl6 is an ionic compound. If the shape of the anion is tetrahedral, then the shape of the cation is: |
|
| 19. |
The compound which obeys Markovnikov's rule when reacted with HBr is: |
|
Answer» The compound which obeys Markovnikov's rule when reacted with HBr is: |
|
| 20. |
Caprolactam is the monomer of |
|
Answer» Caprolactam is the monomer of |
|
| 21. |
The charge on the electron is- |
|
Answer» The charge on the electron is- |
|
| 22. |
Which of the following is the correct structure of staggered newman projection of CH3−CH3? |
|
Answer» Which of the following is the correct structure of staggered newman projection of CH3−CH3? |
|
| 23. |
In the reaction,C6H5CHO+(CH3CO)2OCH3COONa−−−−−−−−→180∘CX, 'X' is |
|
Answer» In the reaction, |
|
| 24. |
The number of P – O – P bonds in P4O6: |
|
Answer» The number of P – O – P bonds in P4O6: |
|
| 25. |
Which of the following graphs represent the probability density curve for 4d electrons? |
|
Answer» Which of the following graphs represent the probability density curve for 4d electrons? |
|
| 26. |
A crystalline solid has |
|
Answer» A crystalline solid has |
|
| 27. |
Gastric juice contains 3.0g of HCl per litre. If a person produces 2.44 litre of gastric juice per day. How many antacid tablets each containing 400 mg of Al(OH)3 are needed to neutralize all the HCl produced in one day ? |
|
Answer» Gastric juice contains 3.0g of HCl per litre. If a person produces 2.44 litre of gastric juice per day. How many antacid tablets each containing 400 mg of Al(OH)3 are needed to neutralize all the HCl produced in one day ? |
|
| 28. |
Which of the following compound(s) can show geometrical isomerism? |
|
Answer» Which of the following compound(s) can show geometrical isomerism? |
|
| 29. |
CH3BrKCN−−−→AH3O+−−−→BB is : |
|
Answer» CH3BrKCN−−−→AH3O+−−−→B B is : |
|
| 30. |
Choose the correct stability order of the given alkenes. |
|
Answer» Choose the correct stability order of the given alkenes. |
|
| 31. |
What determines the shape of a sub-shell? |
|
Answer» What determines the shape of a sub-shell? |
|
| 32. |
Two resistances X and Y are in the left and right gaps of a meter bridge. The balance point is 40 cm from left.Two resistances of 10Ω each are connected in series with X and Y separately. The balance point is 45 cm. The value of X and Y are |
|
Answer» Two resistances X and Y are in the left and right gaps of a meter bridge. The balance point is 40 cm from left.Two resistances of 10Ω each are connected in series with X and Y separately. The balance point is 45 cm. The value of X and Y are |
|
| 33. |
The reciprocal of viscosity is called |
|
Answer» The reciprocal of viscosity is called |
|
| 34. |
The formal charge of S atom in SO3 is : |
|
Answer» The formal charge of S atom in SO3 is : |
|
| 35. |
The correct structure of 3-Methylpenta-1,3-diene is |
|
Answer» The correct structure of 3-Methylpenta-1,3-diene is |
|
| 36. |
A gas is confined in a chamber of constant volume. When the chamber is immersed in a bath of melting ice, the pressure of the gas is 1000 torr. The final temperature, when the pressure in the manometer indicates an absolute pressure of 400 torr is: |
|
Answer» A gas is confined in a chamber of constant volume. When the chamber is immersed in a bath of melting ice, the pressure of the gas is 1000 torr. The final temperature, when the pressure in the manometer indicates an absolute pressure of 400 torr is: |
|
| 37. |
Which of the following would not react with benzene sulphonyl chloride in aq NaOH? |
|
Answer» Which of the following would not react with benzene sulphonyl chloride in aq NaOH? |
|
| 38. |
NaOH is a strong base because |
|
Answer» NaOH is a strong base because |
|
| 39. |
The end product of the reaction C6H6+Cl2Sunlight−−−−−→ |
|
Answer» The end product of the reaction C6H6+Cl2Sunlight−−−−−→ |
|
| 40. |
Calculate the lattice energy of a salt MX(s) from the data given below:Heat of formation of MX(ΔH)=−550 kJ/molHeat of sublimation of M(S)=80 kJ/molHeat of dissociation of X2(D)=155 kJ/molIonization energy of M(I)=347 kJ/molElectron affinity of X(E)=−343 kJ/mol |
|
Answer» Calculate the lattice energy of a salt MX(s) from the data given below: |
|
| 41. |
A catalyst is used in a reactionto[CPMT 1972, 75, 97; DPMT 1982] |
|
Answer» A catalyst is used in a reaction
|
|
| 42. |
In the reactionHC≡CH+2AgNO3NH4OH−−−−−→X+2NH4NO3+2H2O 'X' is |
|
Answer» In the reaction HC≡CH+2AgNO3NH4OH−−−−−→X+2NH4NO3+2H2O 'X' is |
|
| 43. |
Match the following:a) Lyman (r, t)p) visibleb) Balmer (p)q) Infraredc) Paschen (q, s)r) Ultravioletd) Brackett (q)s)n2=4,n1=3t)n2=5,n1=1 |
|
Answer» Match the following: a) Lyman (r, t)p) visibleb) Balmer (p)q) Infraredc) Paschen (q, s)r) Ultravioletd) Brackett (q)s)n2=4,n1=3t)n2=5,n1=1 |
|
| 44. |
Molal depression constant for water is 1.86°C. The freezing point of a 0.05 molal solution of a non-electrolyte in water is |
|
Answer» Molal depression constant for water is 1.86°C. The freezing point of a 0.05 molal solution of a non-electrolyte in water is |
|
| 45. |
In a kingdom there was an excellent archer. The ruler was jealous of his archery skills, so he decided to put his skills to test. The archer was asked to shoot an apple which was placed on his son's head or else his son will be killed. The archer always used his trusted bow.Now that his son's life was in his hands the archer's hand started to tremble. So, now when he started shooting with the original bow he hit different spots which were close to the apple. In this case the archer is: |
|
Answer» In a kingdom there was an excellent archer. The ruler was jealous of his archery skills, so he decided to put his skills to test. The archer was asked to shoot an apple which was placed on his son's head or else his son will be killed. The archer always used his trusted bow. Now that his son's life was in his hands the archer's hand started to tremble. So, now when he started shooting with the original bow he hit different spots which were close to the apple. In this case the archer is: |
|
| 46. |
Among the following species, identify the isostructural pairs:NF3,NO−3,BF3,H3O+,HN3 |
|
Answer» Among the following species, identify the isostructural pairs: |
|
| 47. |
The correct order of hydrogen bond strength and boiling point respectively is |
|
Answer» The correct order of hydrogen bond strength and boiling point respectively is |
|
| 48. |
When 5.85 g of NaCl and 6 g of urea are dissolved in 1000 g of water, the freezing point gets depressed by Kf for water is 1.86 |
|
Answer» When 5.85 g of NaCl and 6 g of urea are dissolved in 1000 g of water, the freezing point gets depressed by Kf for water is 1.86 |
|
| 49. |
In Bohr series of lines of hydrogen spectrum, the third line from the red end corresponds to which one of the following inter-orbit jumps of the electron for Bohr orbits in an atom of hydrogen? |
|
Answer» In Bohr series of lines of hydrogen spectrum, the third line from the red end corresponds to which one of the following inter-orbit jumps of the electron for Bohr orbits in an atom of hydrogen? |
|
| 50. |
A 100 watt bulb emits monochromatic light of wavelength 396 nm. Calculate the number of photons emitted per second by the bulb. |
|
Answer» A 100 watt bulb emits monochromatic light of wavelength 396 nm. Calculate the number of photons emitted per second by the bulb. |
|