Explore topic-wise InterviewSolutions in Current Affairs.

This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.

1.

From the given options, select the one with the highest pH value.

Answer»

From the given options, select the one with the highest pH value.

2.

Description for anode ray

Answer» Description for anode ray
3.

what is Bond order of carbon oxygen bond in acetic acid molecule and in acetate ion ?

Answer» what is Bond order of carbon oxygen bond in acetic acid molecule and in acetate ion ?
4.

Why do gases have neither a fixed shape nor a fixed volume ?

Answer»

Why do gases have neither a fixed shape nor a fixed volume ?

5.

The atomic size of an atom is the ___.

Answer»

The atomic size of an atom is the ___.



6.

{ The mass of }1 mole of electrons is (mass of }1 electron }}{ is }9.1×10^{-31}kg)

Answer» { The mass of }1 mole of electrons is (mass of }1 electron }}{ is }9.1×10^{-31}kg)
7.

Some symbols are given below. Explain those symbols. Which disasters may occur if those symbols are ignored?

Answer» Some symbols are given below. Explain those symbols. Which disasters may occur if those symbols are ignored?

8.

In a solution there is homogeneity at the particle level. Explain the statement with an example.

Answer»

In a solution there is homogeneity at the particle level. Explain the statement with an example.

9.

List the different ways through which water evaporates into air

Answer» List the different ways through which water evaporates into air
10.

If the ratio by number of constituent elements in a molecule of ammonia is 1 : 3, then the ratio by mass of constituent element respectively is

Answer»

If the ratio by number of constituent elements in a molecule of ammonia is 1 : 3, then the ratio by mass of constituent element respectively is

11.

Question 16 Isotopes of an element have: (a) the same physical properties (b) different chemical properties (c) different number of neutrons (d) different atomic numbers

Answer» Question 16
Isotopes of an element have:

(a) the same physical properties
(b) different chemical properties
(c) different number of neutrons
(d) different atomic numbers
12.

explain in detail about minimum molecular mass.

Answer» explain in detail about minimum molecular mass.
13.

The number of atoms in 100 g of an fcc crystal with density, ρ=10 g/cm3 and edge length of 100 pm is

Answer»

The number of atoms in 100 g of an fcc crystal with density, ρ=10 g/cm3 and edge length of 100 pm is


14.

(a) What are the three general classes of matter ? Give one example of each type. (b) Draw a flow-chart for the schematic representation of different types of matter.

Answer»

(a) What are the three general classes of matter ? Give one example of each type.

(b) Draw a flow-chart for the schematic representation of different types of matter.

15.

What is radiactivity?

Answer» What is radiactivity?
16.

Fill in the blanks:(a) Molecular weight of a gas is twice its __________.(b) Mass of 22.4 litre of a gas at STP is ___________.(c) One gram atom of an element contains __________ atoms.(d) One a.m.u. is the mass of __________ atom of C12.(e) Avogadro's number is equal to _________.

Answer»

Fill in the blanks:

(a) Molecular weight of a gas is twice its __________.

(b) Mass of 22.4 litre of a gas at STP is ___________.

(c) One gram atom of an element contains __________ atoms.

(d) One a.m.u. is the mass of __________ atom of C12.

(e) Avogadro's number is equal to _________.

17.

9. In the bulk production of hydrogen by electrolytic method what is the role of an electrolyte

Answer» 9. In the bulk production of hydrogen by electrolytic method what is the role of an electrolyte
18.

Rewrite the following table in such a way that column − 2 and column − 3 will match column 1: Column 1 Column 2 Column 3 (1) Pressure (a) Mass/ volume (i) Specific gravity (2) Density (b) Thrust/area (ii) Decreases with increase in height above the sea level. (3) Atmospheric pressure (c) No unit (iii) Useful to determine purity of substance (4) Relative density (d) pascal (iv) Decreases with increase in area.

Answer»

Rewrite the following table in such a way that column − 2 and column − 3 will match column 1:












































Column 1



Column 2



Column 3



(1)



Pressure



(a)



Mass/ volume



(i)



Specific gravity



(2)



Density



(b)



Thrust/area



(ii)



Decreases with increase in height above the sea level.



(3)



Atmospheric pressure



(c)



No unit



(iii)



Useful to determine purity of substance



(4)



Relative density



(d)



pascal



(iv)



Decreases with increase in area.


19.

What weight of BaCl2 would react with 24.4 g of sodium sulphate to produce 46.6 g of barium sulphate and 23.4 g of sodium chloride?(Given, BaCl2+Na2SO4→BaSO4+2NaCl)

Answer»

What weight of BaCl2 would react with 24.4 g of sodium sulphate to produce 46.6 g of barium sulphate and 23.4 g of sodium chloride?

(Given, BaCl2+Na2SO4BaSO4+2NaCl)

20.

six point charges each of magnitude Q are placed on the six vertices of a cube of side x, such that two adjacent vertices are vacant. what is the electrostatic field intensity at the centre of the cube?

Answer» six point charges each of magnitude Q are placed on the six vertices of a cube of side x, such that two adjacent vertices are vacant. what is the electrostatic field intensity at the centre of the cube?
21.

Out of stormy day and sunny day, which day have more solubility of O2 in water?

Answer» Out of stormy day and sunny day, which day have more solubility of O2 in water?
22.

44. Reaction in between 4 ethyl 1 nitro benzene and Bromine in the presence of Ultraviolet ray or heat, then what will be the product of this reaction?

Answer» 44. Reaction in between 4 ethyl 1 nitro benzene and Bromine in the presence of Ultraviolet ray or heat, then what will be the product of this reaction?
23.

The mass ratio of carbon to hydrogen in methane is 3:1. How much amount of hydrogen is required to react with 36 g of carbon to form methane?

Answer» The mass ratio of carbon to hydrogen in methane is 3:1. How much amount of hydrogen is required to react with 36 g of carbon to form methane?
24.

30. Are the following statements true or false and why 1) [Xe] 4f14 5d1 6s2 represents a d - block element. 2) The correct order of shielding effects of s , p , d , f orbitals is s > p > d >f

Answer» 30. Are the following statements true or false and why 1) [Xe] 4f14 5d1 6s2 represents a d - block element. 2) The correct order of shielding effects of s , p , d , f orbitals is s > p > d >f
25.

In SO42- ion, 1 atom of sulphur and four atoms of oxygen are present. Thus total number of atoms is 5.

Answer»

In SO42- ion, 1 atom of sulphur and four atoms of oxygen are present. Thus total number of atoms is 5.


26.

Discuss the similarities and difference between elements and compounds.

Answer» Discuss the similarities and difference between elements and compounds.
27.

At temperature T, a compound AB,(g) dissociatesaccording to the reaction2AB2(g)dissociation 'x' which is small as compared tounity. The expression for K, in terms of 'x' and total2AB(g) + B2(g) with a degree ofpressure P isPx3(1)29Px2(2)3Px3(3)3Px2(4)2

Answer» At temperature T, a compound AB,(g) dissociatesaccording to the reaction2AB2(g)dissociation 'x' which is small as compared tounity. The expression for K, in terms of 'x' and total2AB(g) + B2(g) with a degree ofpressure P isPx3(1)29Px2(2)3Px3(3)3Px2(4)2
28.

What are subatomic particles?

Answer» What are subatomic particles?
29.

Question 41What are the postulates of Bohr's model of an atom?

Answer» Question 41

What are the postulates of Bohr's model of an atom?
30.

the disp of a particle executing shm isy=Ao + Asinwt + Bcoswtthen ampletude of its oscillation is?

Answer» the disp of a particle executing shm is
y=Ao + Asinwt + Bcoswt
then ampletude of its oscillation is?
31.

Why does positive electron gain enthalpy of noble gases decrease down the group?

Answer» Why does positive electron gain enthalpy of noble gases decrease down the group?
32.

Mention the significance of a chemical symbol. Write the chemical symbols for copper, sodium, potassium, radon, silver and gold.

Answer» Mention the significance of a chemical symbol. Write the chemical symbols for copper, sodium, potassium, radon, silver and gold.
33.

On analysis it was found that the black oxide of copper, red oxide of copper, litharge, the red oxide of lead and the peroxide of lead contain 79.90%, 88.8%, 92.88%, 90.6% and 86.6% respectively of the metal. Establish the law of multiple proportion with the help of data.

Answer» On analysis it was found that the black oxide of copper, red oxide of copper, litharge, the red oxide of lead and the peroxide of lead contain 79.90%, 88.8%, 92.88%, 90.6% and 86.6% respectively of the metal. Establish the law of multiple proportion with the help of data.
34.

A certain sample of a gas has a volume of 0.2 lit at 1 atm and 0 ∘C. At the same pressure, but at 546 ∘C, the volume will be:

Answer»

A certain sample of a gas has a volume of 0.2 lit at 1 atm and 0 C. At the same pressure, but at 546 C, the volume will be:

35.

Calculate the number of atoms of carbon and oxygen in8.8g of CO

Answer» Calculate the number of atoms of carbon and oxygen in8.8g of CO
36.

how o find a valency of an element

Answer» how o find a valency of an element
37.

Convert into mole 20g of water

Answer» Convert into mole
20g of water
38.

light of wavelength 3310 A^° falls on a photocathode and an electron of energy 3×10^{-19}J is ejected if the wavelength of photon is changed to 5000A^° the electron energy is 7.91× 10^{-20}J calculate the plancks cons†an t and threshhold wavegth of photon

Answer» light of wavelength 3310 A^° falls on a photocathode and an electron of energy 3×10^{-19}J is ejected if the wavelength of photon is changed to 5000A^° the electron energy is 7.91× 10^{-20}J calculate the plancks cons†an t and threshhold wavegth of photon
39.

What is topsoil?

Answer»

What is topsoil?

40.

balance the equation mg hno3- mg no3 2 n2o h2o by oxidation number method

Answer» balance the equation mg hno3- mg no3 2 n2o h2o by oxidation number method
41.

How many moles of P4 can be produced by the reaction of 0.10 moles Ca5(PO4)3F,0.36 moles SiO2, and 0.90 moles C according to the following reaction? Ca5(PO4)3F+18SiO2+30C→3P4+2CaF2+18CaSiO3+30CO

Answer»

How many moles of P4 can be produced by the reaction of 0.10 moles Ca5(PO4)3F,0.36 moles SiO2, and 0.90 moles C according to the following reaction? Ca5(PO4)3F+18SiO2+30C3P4+2CaF2+18CaSiO3+30CO

42.

Question 3A molecule of ammonia (NH3) has:(a) Only single bonds(b) Only double bonds(c) Only triple bonds(d) One double bond and remaining are single bonds

Answer» Question 3

A molecule of ammonia (NH3) has:



(a) Only single bonds

(b) Only double bonds

(c) Only triple bonds

(d) One double bond and remaining are single bonds


43.

Why doesn't sand molecules mix with water??

Answer» Why doesn't sand molecules mix with water??
44.

Why alpha - particles cannot travel through the air for a long distance?

Answer»

Why alpha - particles cannot travel through the air for a long distance?


45.

Calculate the number of electrons for the central atom and also find the number of co-ordinate bonds1)so32)so4^-23) can super octet compounds have co-ordinate bonds

Answer» Calculate the number of electrons for the central atom and also find the number of co-ordinate bonds
1)so3
2)so4^-2
3) can super octet compounds have co-ordinate bonds
46.

What is the maximum number of electrons which can be accommodated in the: (a) innermost shell of an atom? (b) the outermost shell of an atom?

Answer»

What is the maximum number of electrons which can be accommodated in the:
(a) innermost shell of an atom?
(b) the outermost shell of an atom?

47.

Classify the following changes as physical or chemical(i) Filling of LPG gas under pressure in gas cylinders(ii) Cutting the wood(iii) Rusting of an iron object(iv) Burning of paper

Answer» Classify the following changes as physical or chemical

(i) Filling of LPG gas under pressure in gas cylinders

(ii) Cutting the wood

(iii) Rusting of an iron object

(iv) Burning of paper
48.

Given below is the table containing the properties of metals. Which amongst the following properties can be X and Y?

Answer» Given below is the table containing the properties of metals.

Which amongst the following properties can be X and Y?
49.

What is smog?

Answer»

What is smog?

50.

The oxidation number of Mn in the product of alkaline oxidative fusion of MnO2 is

Answer»

The oxidation number of Mn in the product of alkaline oxidative fusion of MnO2 is