This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.
| 1. |
Question 2 (iv) Write down the names of compounds represented by the following formulae: (iv) KNO3 |
|
Answer» Question 2 (iv) Write down the names of compounds represented by the following formulae: (iv) KNO3 |
|
| 2. |
A solution contains 30ml of ethyl alcohol mixed with 100ml of water. What is the concentration of the solution in terms of volume by volume percentage? |
|
Answer» A solution contains 30ml of ethyl alcohol mixed with 100ml of water. What is the concentration of the solution in terms of volume by volume percentage? |
|
| 3. |
What will be the valency of an element having atomic number (Z)=7? |
|
Answer» What will be the valency of an element having atomic number (Z)=7? |
|
| 4. |
Write the distribution of electrons in an atom of an element whose atomic number is 18. What is special about the outermost electron shell (or valence shell) of the atom of this element? |
|
Answer» Write the distribution of electrons in an atom of an element whose atomic number is 18. What is special about the outermost electron shell (or valence shell) of the atom of this element? |
|
| 5. |
The properties of water are different from the properties of the elements of which it is formed. Discuss. |
|
Answer» The properties of water are different from the properties of the elements of which it is formed. Discuss. |
|
| 6. |
The charge carried by an electron is ___. |
|
Answer» The charge carried by an electron is ___. |
|
| 7. |
What is the number of hydrogen atoms in hexyne? |
|
Answer» What is the number of hydrogen atoms in hexyne? |
|
| 8. |
The number of electron hydrogen contains in its K shell is- |
|
Answer» The number of electron hydrogen contains in its K shell is- |
|
| 9. |
Choose the correct match for the property of compounds. |
|
Answer» Choose the correct match for the property of compounds. |
|
| 10. |
How particles scatter light in collidation |
|
Answer» How particles scatter light in collidation |
|
| 11. |
Hydrogen is collected by the _______ displacement of _______ . |
|
Answer» Hydrogen is collected by the _______ displacement of _______ . |
|
| 12. |
What is the molar mass of hydrated salt of Na2CO3.10H2O? |
|
Answer» What is the molar mass of hydrated salt of Na2CO3.10H2O? |
|
| 13. |
Evaporation is considered to be a ___ and can take place at ___ |
|
Answer» Evaporation is considered to be a |
|
| 14. |
What happens when air with a very high content of water vapor goes from a region of high pressure to a region of low pressure? Give reason for your answer. |
| Answer» What happens when air with a very high content of water vapor goes from a region of high pressure to a region of low pressure? Give reason for your answer. | |
| 15. |
___ enriches the soil with nutrients. |
|
Answer» |
|
| 16. |
Which catalyst helps in reducing air pollution? |
|
Answer» Which catalyst helps in reducing air pollution? |
|
| 17. |
What is the valency of the cation, if it is known that the valency of each anion is -4.? |
|
Answer» What is the valency of the cation, if it is known that the valency of each anion is -4.? |
|
| 18. |
Define diffusion explain the rate of order of diffusion in solids liquids and gases and state the effect of temperature on diffusion |
|
Answer» Define diffusion explain the rate of order of diffusion in solids liquids and gases and state the effect of temperature on diffusion |
|
| 19. |
1. Convert the following temperature to Celsius scale. (A)293 K (B)470K 2. Convert the following temperature to kelvin scale. (A)25degree C (B)373degree C |
|
Answer» 1. Convert the following temperature to Celsius scale. (A)293 K (B)470K 2. Convert the following temperature to kelvin scale. (A)25degree C (B)373degree C |
|
| 20. |
The correct order of atomic radii of fe+2,fe+3,fe+4 |
|
Answer» The correct order of atomic radii of fe+2,fe+3,fe+4 |
|
| 21. |
Central part of the atom where neutrons and protons are held together is known as__. |
|
Answer» Central part of the atom where neutrons and protons are held together is known as |
|
| 22. |
Which contains more molecules, 10g of sulphur dioxide (SO2) or 10g of oxygen (O2)? How? |
|
Answer» Which contains more molecules, 10g of sulphur dioxide (SO2) or 10g of oxygen (O2)? How? |
|
| 23. |
Why do we say that water is h2o and not oh2 |
| Answer» Why do we say that water is h2o and not oh2 | |
| 24. |
Solid are generally very heavy while gases are light. Explain |
|
Answer» Solid are generally very heavy while gases are light. Explain |
|
| 25. |
Two gases found dissolved in natural water are (a) oxygen and carbon dioxide (b) hydrogen and oxygen (c) sulphur dioxide and hydrogen (d) chlorine and ammonia |
|
Answer» Two gases found dissolved in natural water are (a) oxygen and carbon dioxide (b) hydrogen and oxygen (c) sulphur dioxide and hydrogen (d) chlorine and ammonia |
|
| 26. |
Neon occurs as two isotopes of mass numbers 20 and 22. Its relative atomic mass is 20.2. What is the percentage of 20Ne in naturally occurring neon? |
|
Answer» Neon occurs as two isotopes of mass numbers 20 and 22. Its relative atomic mass is 20.2. What is the percentage of 20Ne in naturally occurring neon? |
|
| 27. |
A mixture of chalk powder and water can be separated using the technique of filtration because: |
|
Answer» A mixture of chalk powder and water can be separated using the technique of filtration because: |
|
| 28. |
Which solvent can be used to obtain sodium chloride from a mixture of sodium chloride and sulphur without using water? |
|
Answer» Which solvent can be used to obtain sodium chloride from a mixture of sodium chloride and sulphur without using water? |
|
| 29. |
X is the most abundant element in the atmosphere. In which of the following case element X cannot be used? |
|
Answer» X is the most abundant element in the atmosphere. In which of the following case element X cannot be used? |
|
| 30. |
name 2 liquid non metal |
| Answer» name 2 liquid non metal | |
| 31. |
The symbol of a metal element which is used in making thermometers is: |
|
Answer» The symbol of a metal element which is used in making thermometers is: |
|
| 32. |
For the symbols H, D and T, write the subatomic particles (protons, neutrons and electrons) found in each one of them. |
|
Answer» For the symbols H, D and T, write the subatomic particles (protons, neutrons and electrons) found in each one of them. |
|
| 33. |
Name a liquid which can be classified as a pure substance and conducts electricity. |
|
Answer» Name a liquid which can be classified as a pure substance and conducts electricity. |
|
| 34. |
Question 10 (f) Classify the following into elements, compounds and mixtures. f. Tin |
|
Answer» Question 10 (f) Classify the following into elements, compounds and mixtures. f. Tin |
|
| 35. |
Alloy is considered a mixture. Give 3 reason to support your answer |
|
Answer» Alloy is considered a mixture. Give 3 reason to support your answer |
|
| 36. |
Chlorofluorocarbons(CFCs) are widely used in air conditioner and refrigerators etc because of being |
|
Answer» Chlorofluorocarbons(CFCs) are widely used in air conditioner and refrigerators etc because of being |
|
| 37. |
Boiling does not occur when: |
|
Answer» Boiling does not occur when: |
|
| 38. |
While Fe3+ is stable, Mn3+ is not stabe in acid solution because: (Mn3++e−→Mn2+, E∘=1.5 V;O2+4H++4e−→2H2O, E∘=+1.23V;Fe3++e−→Fe2+,E∘=0.77V) |
|
Answer» While Fe3+ is stable, Mn3+ is not stabe in acid solution because: |
|
| 39. |
Which among the given equations is an example of the reaction of metal carbonate with hydrochloric acid? |
|
Answer» Which among the given equations is an example of the reaction of metal carbonate with hydrochloric acid? |
|
| 40. |
During the electrolysis of water, large amount of hydronium ions are produced when water is acidified with |
|
Answer» During the electrolysis of water, large amount of hydronium ions are produced when water is acidified with |
|
| 41. |
The process of burning subtstance in oxygen is called ___ . |
|
Answer» The process of burning subtstance in oxygen is called |
|
| 42. |
5.0 g of a certain element X forms 10.0g of its oxide having the formula X4O6. The atomic mass of X is ? |
|
Answer» 5.0 g of a certain element X forms 10.0g of its oxide having the formula X4O6. The atomic mass of X is ? |
|
| 43. |
Which one of the following reactions is an example of decomposition reaction? |
|
Answer» Which one of the following reactions is an example of decomposition reaction? |
|
| 44. |
What is the weight percentage of solution formed by dissolving 30g salt in 270 g water? |
|
Answer» What is the weight percentage of solution formed by dissolving 30g salt in 270 g water? |
|
| 45. |
Design an experiment to show that air contains water vapour. [3 MARKS] |
|
Answer» Design an experiment to show that air contains water vapour. [3 MARKS] |
|
| 46. |
How does the increase in temperature affect the solubility of solids and gases? |
|
Answer» How does the increase in temperature affect the solubility of solids and gases? |
|
| 47. |
Question 13 (c) The arrangement of particles is less ordered in the ___ state. However. There is no order in the ___ state. |
|
Answer» Question 13 (c) The arrangement of particles is less ordered in the |
|
| 48. |
Which of these reactions releases hydrogen gas? |
|
Answer» Which of these reactions releases hydrogen gas? |
|
| 49. |
A farmer while cultivating his farm by mistake added a lot of pesticides with a pH 2 into the soil. What will be the effect on his crops? |
|
Answer» A farmer while cultivating his farm by mistake added a lot of pesticides with a pH 2 into the soil. What will be the effect on his crops? |
|
| 50. |
Which one of the following is not a chemical change?(a) Formation of curd (b) Ripening of banana(c) Sublimation of naphthalene (d) Corrosion of photo frame |
|
Answer» Which one of the following is not a chemical change? (a) Formation of curd (b) Ripening of banana (c) Sublimation of naphthalene (d) Corrosion of photo frame |
|