Explore topic-wise InterviewSolutions in Current Affairs.

This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.

1.

What happens when sodium bicarbonate reacts with nitric acid?

Answer»

What happens when sodium bicarbonate reacts with nitric acid?


2.

The percentage impurities present in 22 carat gold is

Answer»

The percentage impurities present in 22 carat gold is

3.

A colloid is a __ (heterogeneous/homogeneous) mixture and its components can be separated by the technique known as centrifugation.

Answer»

A colloid is a __ (heterogeneous/homogeneous) mixture and its components can be separated by the technique known as centrifugation.

4.

Question 44(a) The following reaction takes place when aluminium powder is heated with MnO2: 3MnO2(s)+4Al (s)→3Mn (l)+2Al2O3(l)+Heat Is aluminium getting reduced?

Answer» Question 44(a)
The following reaction takes place when aluminium powder is heated with MnO2:

3MnO2(s)+4Al (s)→3Mn (l)+2Al2O3(l)+Heat

Is aluminium getting reduced?
5.

How to write word form of bond structure of ketone

Answer» How to write word form of bond structure of ketone
6.

Electronic configuration of: Element X: 2,8,2Element Y: 2,8,4Element Z: 2,8,7Which among the given element can be beaten into sheets easily?

Answer»

Electronic configuration of:

Element X: 2,8,2

Element Y: 2,8,4

Element Z: 2,8,7

Which among the given element can be beaten into sheets easily?



7.

Two flasks A and B of equal volumes are kept under similar conditions of temperature and pressure . If flasks A holds 16.2 g of gas X while flasks B holds 1.35 g of hydrogen , calculate the relative molecular mass of gas X ?

Answer» Two flasks A and B of equal volumes are kept under similar conditions of temperature and pressure . If flasks A holds 16.2 g of gas X while flasks B holds 1.35 g of hydrogen , calculate the relative molecular mass of gas X ?
8.

An element having electronic configuration 1s2,2s2 2p6, 3s2 3p6, 4s1forms

Answer»

An element having electronic configuration 1s2,
2s2 2p6, 3s2 3p6, 4s1
forms


9.

A solution of sodium acetate in water will?

Answer»

A solution of sodium acetate in water will?


10.

What is the order and molecularity of cannizaro reaction?

Answer» What is the order and molecularity of cannizaro reaction?
11.

Why is 1molar aqueous solution more concentrated than 1 molal aqueous solution?

Answer» Why is 1molar aqueous solution more concentrated than 1 molal aqueous solution?
12.

Ch3-ch(ch2)(CH3)-ch3---cl2-,uvlight---------major product will be

Answer» Ch3-ch(ch2)(CH3)-ch3---cl2-,uvlight---------major product will be
13.

Question 2Name two metals which are found in nature in the free state.

Answer» Question 2

Name two metals which are found in nature in the free state.
14.

39 1f EFe2+/Fe-0.441 V and EFe3+/Fe2+ 0.771 Vthe standard EMF of the reaction Fe 2Fe3+ -3Fe2 will be\lbrack AIPMT (Prelims)-2006\rbrack(1) 0.330 V(2) 1.653 V(3) 1.212 V(4) 0.111 V

Answer» 39 1f EFe2+/Fe-0.441 V and EFe3+/Fe2+ 0.771 Vthe standard EMF of the reaction Fe 2Fe3+ -3Fe2 will be\lbrack AIPMT (Prelims)-2006\rbrack(1) 0.330 V(2) 1.653 V(3) 1.212 V(4) 0.111 V
15.

42.The maximum number of electrons present in px orbital

Answer» 42.The maximum number of electrons present in px orbital
16.

When NaCl decomposes in the presence of water, product A, B and C are formed. When B reacts with D, bleaching powder is formed. What are A, B, C and D?

Answer»

When NaCl decomposes in the presence of water, product A, B and C are formed. When B reacts with D, bleaching powder is formed. What are A, B, C and D?



17.

31. A metal forms two oxides. The higher oxide contains 20% oxygen , while 4.29g of the lower oxide when converted to higher oxide became 4.77g. The equivalent weight of the metal in higher oxide and lower oxide respectively are? (1)16 and 32.2 (2) 32.2 and 16 (3) 64.4 and 32 (4) 32 and 64.4

Answer» 31. A metal forms two oxides. The higher oxide contains 20% oxygen , while 4.29g of the lower oxide when converted to higher oxide became 4.77g. The equivalent weight of the metal in higher oxide and lower oxide respectively are? (1)16 and 32.2 (2) 32.2 and 16 (3) 64.4 and 32 (4) 32 and 64.4
18.

Select from the following list: [4 MARKS] Fe2O3,NO,SO3,PbO,Mn2O7 (a) Basic oxide ...... (b) Amphoteric oxide ...... (c) Acidic oxide ...... (d) Neutral oxide .....

Answer» Select from the following list: [4 MARKS]
Fe2O3,NO,SO3,PbO,Mn2O7
(a) Basic oxide ......
(b) Amphoteric oxide ......
(c) Acidic oxide ......
(d) Neutral oxide .....
19.

Write down the physical properties of Bases.

Answer»


Write down the physical properties of Bases.



20.

Which of the following bond/s contain ions?(i) Ionic bond(ii) Covalent bond(iii) Metallic bond

Answer»

Which of the following bond/s contain ions?

(i) Ionic bond

(ii) Covalent bond

(iii) Metallic bond


21.

Shivam took a beaker containing a basic solution and added a metal to the solution. What will happen after the addition of copper metal ?

Answer»

Shivam took a beaker containing a basic solution and added a metal to the solution. What will happen after the addition of copper metal ?


22.

nta vessel contain 28gm N2, 32 gm O2, T = 1000K and P = 2 atm . find pressure if N2 dissociates30% and O2 50%, temperature remaining constantn

Answer» nta vessel contain 28gm N2, 32 gm O2, T = 1000K and P = 2 atm . find pressure if N2 dissociates30% and O2 50%, temperature remaining constantn
23.

Which amongst the following is a positional isomer of CH3−CH2−CH=CH3

Answer»

Which amongst the following is a positional isomer of CH3−CH2−CH=CH3

24.

what is the trend of effective nuclear charge in a group and period ?

Answer» what is the trend of effective nuclear charge in a group and period ?
25.

What will you observe when concentrated HCl is added to lead (IV) oxide and warmed?

Answer»

What will you observe when concentrated HCl is added to lead (IV) oxide and warmed?

26.

The result of adding a small crystal of NaCl to a saturated solution of NaCl is that:

Answer»

The result of adding a small crystal of NaCl to a saturated solution of NaCl is that:



27.

What type of chemical reactions are represented by the following equations ? (i) A+BC⟶AC+B (ii) A+B⟶C (iii) X⟶Y+Z (iv) PQ+RS⟶PS+RQ (v) A2O3+2B⟶B2O3+2A

Answer»

What type of chemical reactions are represented by the following equations ?

(i) A+BC⟶AC+B

(ii) A+B⟶C

(iii) X⟶Y+Z

(iv) PQ+RS⟶PS+RQ

(v) A2O3+2B⟶B2O3+2A

28.

What is the mass of oxygen required to react completely with 15g of H2 gas to form water?

Answer»

What is the mass of oxygen required to react completely with 15g of H2 gas to form water?


29.

20ml of 0.2N NaOH, 40ml of 0.1N Ca (OH)2 and 40ml of KOH solutions are mixed and the total volume of the mixture is made up to 500ml. Calculate the POH and PH of the mixture

Answer» 20ml of 0.2N NaOH, 40ml of 0.1N Ca (OH)2 and 40ml of KOH solutions are mixed and the total volume of the mixture is made up to 500ml. Calculate the POH and PH of the mixture
30.

The noble gases are unreactive because

Answer»

The noble gases are unreactive because


31.

Which bubble would give 20 as the answer?

Answer»

Which bubble would give 20 as the answer?

32.

48. The composition of KClO3(s) takes place- KClO3→ KCl+O2 ↓ KClO4+KCl . If 2gm sample of KClO3 on complete decomposition gives 224ml of O2 at STP, then calculate percentage by mass of KCl in the residue.

Answer» 48. The composition of KClO3(s) takes place- KClO3→ KCl+O2 ↓ KClO4+KCl . If 2gm sample of KClO3 on complete decomposition gives 224ml of O2 at STP, then calculate percentage by mass of KCl in the residue.
33.

5. If 2 moles ofSF4 is mixed with 18g of H2O then incorrect statement is 1 only 0.5 mole of SF4 is reacted 2 H2O is limiting reagent 3 2 moles of HF is formed 4 1 mole of SO2 is formed Reaction= SF4 +2H2O=SO2+4HF

Answer» 5. If 2 moles ofSF4 is mixed with 18g of H2O then incorrect statement is 1 only 0.5 mole of SF4 is reacted 2 H2O is limiting reagent 3 2 moles of HF is formed 4 1 mole of SO2 is formed Reaction= SF4 +2H2O=SO2+4HF
34.

Draw the IUPAC structure for 1-chlorocycloproane carbaldehyde with explanation and steps

Answer» Draw the IUPAC structure for 1-chlorocycloproane carbaldehyde with explanation and steps
35.

Green chemistry is the study of an approach that aims to________.

Answer»

Green chemistry is the study of an approach that aims to________.


36.

Why does hydrogen gas burns with a pop sound?

Answer»

Why does hydrogen gas burns with a pop sound?

37.

Bond angle in water molecules is 104.5^° instead of109 28' mainly because of (1) Lone pair-bond pair repulsion (2) Bond pair-lone pair repulsion (3) Lone pair-lone pair replusion (4) Bond pair-bond pair repulsion

Answer» Bond angle in water molecules is 104.5^° instead of109 28' mainly because of (1) Lone pair-bond pair repulsion (2) Bond pair-lone pair repulsion (3) Lone pair-lone pair replusion (4) Bond pair-bond pair repulsion
38.

Explain the principle of the method of electrolytic refining of metals. Give one example.

Answer» Explain the principle of the method of electrolytic refining of metals. Give one example.
39.

In the calcination process, the ore is heated in

Answer»

In the calcination process, the ore is heated in



40.

can the process of rusting be called combustion

Answer» can the process of rusting be called combustion
41.

In the reaction 3MnO2+4Al→3Mn+2Al2O3, the oxidising agent is

Answer»

In the reaction 3MnO2+4Al→3Mn+2Al2O3, the oxidising agent is


42.

Which of the following statements are true?

Answer»

Which of the following statements are true?


43.

what is concentration of ores?

Answer» what is concentration of ores?
44.

An element with atomic number 34 belongs to1) s-block 2) p-block3) d-block 4) f-block

Answer» An element with atomic number 34 belongs to
1) s-block 2) p-block
3) d-block 4) f-block
45.

Show the bond formation in the structure of hydronium ion and ammonium ion.

Answer»

Show the bond formation in the structure of hydronium ion and ammonium ion.

46.

What is hydronium ion and how is it formed

Answer»

What is hydronium ion and how is it formed

47.

Dalton's law of partial pressure

Answer» Dalton's law of partial pressure
48.

in alcohol if there is repulsion between lone pair of electron why it doesn't increase the bond angle ? why it less than tetrahedral angle.

Answer» in alcohol if there is repulsion between lone pair of electron why it doesn't increase the bond angle ? why it less than tetrahedral angle.
49.

Write the electronic configuration for the following atoms: Magnesium (Mg) Neon (Ne) Boron (B) Fluorine (F)

Answer» Write the electronic configuration for the following atoms:

  1. Magnesium (Mg)

  2. Neon (Ne)

  3. Boron (B)

  4. Fluorine (F)



50.

Match the following: Column A Column B 1. A substance that turns moist starch iodide paper blue. A. Ammonium sulphate 2. A compound which releases a reddish brown gas on reaction with concentrated sulphuric acid and copper turnings. B. Lead carbonate 3. A solution of this compound gives a dirty green precipitate with sodium hydroxide. C. Chlorine 4. A compound which on heating with sodium hydroxide produces a gas which forms dense white fumes with hydrogen chloride. D. Copper nitrate 5. A white solid which gives a yellow residue on heating. E. Ferrous sulphate

Answer» Match the following:





































Column A Column B
1. A substance that turns moist starch iodide paper blue. A. Ammonium sulphate
2. A compound which releases a reddish brown gas on reaction with concentrated sulphuric acid and copper turnings. B. Lead carbonate
3. A solution of this compound gives a dirty green precipitate with sodium hydroxide. C. Chlorine
4. A compound which on heating with sodium hydroxide produces a gas which forms dense white fumes with hydrogen chloride. D. Copper nitrate
5. A white solid which gives a yellow residue on heating. E. Ferrous sulphate