Explore topic-wise InterviewSolutions in Current Affairs.

This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.

1.

Loss of energy in a food web is n times the loss of energy in a food chain, i.e. loss of energy in a food web is more than that in a food chain.

Answer» Loss of energy in a food web is n times the loss of energy in a food chain, i.e. loss of energy in a food web is more than that in a food chain.
2.

Which of the following statement is incorrect? (a) all green plants and blue-green algae are producers (b) green plants get their food from readymade organic compounds (c) producers prepare their own food from inorganic compounds (d) plants convert solar energy into chemical energy

Answer»

Which of the following statement is incorrect?

(a) all green plants and blue-green algae are producers

(b) green plants get their food from readymade organic compounds

(c) producers prepare their own food from inorganic compounds

(d) plants convert solar energy into chemical energy

3.

Which is more basic (or more alkaline) : a solution of pH = 8 or a solution of pH = 11 ?

Answer»

Which is more basic (or more alkaline) : a solution of pH = 8 or a solution of pH = 11 ?

4.

You are provided with three test tubes A, B and C which contain distilled water, acidic solution and basic solution respectively. If you are given blue litmus paper only, how will you identify the contents of each test tube ?

Answer» You are provided with three test tubes A, B and C which contain distilled water, acidic solution and basic solution respectively. If you are given blue litmus paper only, how will you identify the contents of each test tube ?
5.

What is delocalisation?

Answer»

What is delocalisation?

6.

Explain why alkanes are excellent fuels.

Answer»

Explain why alkanes are excellent fuels.

7.

(a) Concentrated nitric acid oxidises phosphorus to phosphhoric acid according to the following equation; P+5HNO3(conc.)→H3PO4+H2O+5NO2 If 9.3 g of phosphorus was used in the reaction, calculate; (i) Number of mles of phosphorus take. (ii) The mass of phosphoric acid formed. (iii) The volume of nitrogen dioxide produced at STP. (b) (i) 67.2 Litres of hydrogen combines with 44.8 letres of nitrogen to form ammonia under specific conditions as: N_2(g) +3H_2(g) \rightarrow 2NH_3(g) Calculate the volume of ammonia produced. What is the other substance, if any that remains in the resultant mixture? (ii) The mass of 5.6dm3 of a certain gas at STP is 12.0 g. Calculate the relative molecular mass of the gas. (iii) Find the total percentage of Magnesium in magnisum nitrate crystals, Mg(NO3)2.6H2O. [Mg=24,N=14,O=16andH=1]

Answer»

(a) Concentrated nitric acid oxidises phosphorus to phosphhoric acid according to the following equation;
P+5HNO3(conc.)H3PO4+H2O+5NO2
If 9.3 g of phosphorus was used in the reaction, calculate;
(i) Number of mles of phosphorus take.
(ii) The mass of phosphoric acid formed.
(iii) The volume of nitrogen dioxide produced at STP.
(b) (i) 67.2 Litres of hydrogen combines with 44.8 letres of nitrogen to form ammonia under specific conditions as:
N_2(g) +3H_2(g) \rightarrow 2NH_3(g)
Calculate the volume of ammonia produced.
What is the other substance, if any that remains in the resultant mixture?
(ii) The mass of 5.6dm3 of a certain gas at STP is 12.0 g. Calculate the relative molecular mass of the gas.
(iii) Find the total percentage of Magnesium in magnisum nitrate crystals, Mg(NO3)2.6H2O.
[Mg=24,N=14,O=16andH=1]

8.

Tell me all colours of chemical solutions like H2SO4, NASO4 etc. With their chemical formula

Answer»

Tell me all colours of chemical solutions like H2SO4, NASO4 etc. With their chemical formula

9.

What type of reactions are represented by the following equations (a) CaO+CO2⟶CaCO3 (b) 2Na+2H2O⟶2NaOH+H2 (c) Mg+CuSO4⟶MgSO4+Cu (d) NH4NO2⟶N2+2H2O (e) CuSO4+2NaOH⟶Cu(OH)2+Na2SO4

Answer»

What type of reactions are represented by the following equations

(a) CaO+CO2CaCO3


(b) 2Na+2H2O2NaOH+H2


(c) Mg+CuSO4MgSO4+Cu


(d) NH4NO2N2+2H2O


(e) CuSO4+2NaOHCu(OH)2+Na2SO4

10.

Based on their basicity, acids are classified as:

Answer»

Based on their basicity, acids are classified as:


11.

____ is the ore of aluminium which contains a metallic element present in group IA of the periodic table.

Answer»

____ is the ore of aluminium which contains a metallic element present in group IA of the periodic table.


12.

Explain me about every types of reaction with help of examples

Answer»

Explain me about every types of reaction with help of examples

13.

Which of the following is not a combustion reaction?

Answer»

Which of the following is not a combustion reaction?


14.

The first ionisation enthalpies (kj/mol)for Li ,Be ,B and C have one of the following values. Which of these corresponds to that of boron ?

Answer»

The first ionisation enthalpies (kj/mol)for Li ,Be ,B and C have one of the following values. Which of these corresponds to that of boron ?


15.

Select the correct statement regarding covalent bond:

Answer»

Select the correct statement regarding covalent bond:


16.

State one industrial application of reduction process.

Answer»

State one industrial application of reduction process.

17.

Balancing complicated equations

Answer»

Balancing complicated equations

18.

Moist hydrogen gas combines with chlorine to form____.

Answer»

Moist hydrogen gas combines with chlorine to form____.


19.

In both I and VII group of the periodic table which of the following property increases with increase in atomic number?

Answer»

In both I and VII group of the periodic table which of the following property increases with increase in atomic number?


20.

Q12)Statements: Some towels are brushes. No brush is soap. All soaps are rats. Conclusions: I. Some rats are brushes. II. No rat is brush. III. Some towels are soaps.

Answer»

Q12)Statements:

Some towels are brushes.

No brush is soap.

All soaps are rats.

Conclusions:

I. Some rats are brushes.

II. No rat is brush.

III. Some towels are soaps.


21.

Why we take ratio of hydrogen and oxygen 2:1 in electrolysis of water?

Answer» Why we take ratio of hydrogen and oxygen 2:1 in electrolysis of water?
22.

Elements Q and S react together to form an ionic compound. Can Q and S both be metals? Justify your answer.

Answer»

Elements Q and S react together to form an ionic compound. Can Q and S both be metals? Justify your answer.


23.

A zinc plate was kept in a glass container having CuSO4 solution. On examining it was found that the blue colour of the solution is getting lighter. After a few days, when the zinc plate was taken out of the solution, a number of small holes were noticed in it. State the reason and give chemical equation of the reaction involved.

Answer»

A zinc plate was kept in a glass container having CuSO4 solution. On examining it was found that the blue colour of the solution is getting lighter. After a few days, when the zinc plate was taken out of the solution, a number of small holes were noticed in it. State the reason and give chemical equation of the reaction involved.

24.

Write the structures of the following compounds: (a) Prop-l-ene, (b) 2, 3-dimethylbutane, (c) 2-methylpropane (d) 3-hexene (e) Prop-l-yne (f) 2-methylprop-1-ene (g) Alcohol with molecular formula C4H10O.

Answer»

Write the structures of the following compounds:

(a) Prop-l-ene,

(b) 2, 3-dimethylbutane,

(c) 2-methylpropane

(d) 3-hexene

(e) Prop-l-yne

(f) 2-methylprop-1-ene

(g) Alcohol with molecular formula C4H10O.

25.

Which element has a total of three shells, with four electrons in its valence shell?

Answer» Which element has a total of three shells, with four electrons in its valence shell?
26.

Metals generally have very high melting and boiling points due to strong ___ bonds.

Answer» Metals generally have very high melting and boiling points due to strong ___ bonds.
27.

What is modern periodic table? What is its composition

Answer»

What is modern periodic table? What is its composition

28.

Chemical difference between metals and non metals?

Answer» Chemical difference between metals and non metals?
29.

Vinay was trying to create sodium acetate, he added ethanoic acid and ‘A’ in an open vessel to concentrated H2SO4 and was surprised when the solution gave a sweet effervescence. So he started again in a closed vessel and obtained ethyl acetate. Then he added ‘B’ and created sodium acetate. Find A and B.

Answer»

Vinay was trying to create sodium acetate, he added ethanoic acid and ‘A’ in an open vessel to concentrated H2SO4 and was surprised when the solution gave a sweet effervescence. So he started again in a closed vessel and obtained ethyl acetate. Then he added ‘B’ and created sodium acetate. Find A and B.


30.

Why is non biodegradable waste more harmful than biodegradable waste?

Answer»

Why is non biodegradable waste more harmful than biodegradable waste?

31.

The solubility of solid solutes depends on temperature. As temperature increases,

Answer»

The solubility of solid solutes depends on temperature. As temperature increases,


32.

The acidic character in acetic acid is due to the presence of replaceable______atom in the carboxylic group.

Answer»

The acidic character in acetic acid is due to the presence of replaceable______atom in the carboxylic group.


33.

What is an oxidation reaction? Identify the following in the given reaction: (i) the substance oxidised (ii) the substance reduced. ZnO+C→Zn+CO

Answer»

What is an oxidation reaction? Identify the following in the given reaction:
(i) the substance oxidised (ii) the substance reduced.
ZnO+CZn+CO

34.

An organic compound having the molecular formula C3H6O can exist in the form of two isomers A and B having different functional groups. The isomer A is a liquid which is used as a solvent for nail polish. The isomer B is also a liquid. An aqueous solution of one of the lower homologues of B is used for preserving biological specimens in the laboratory (a) What is compound A? (b) Write the electron-dot structure of A. (c) What is compound B? (d) Write the electron-dot structure of B. (e) Name the lower homologue of compound B which is used in preserving biological specimens.

Answer»

An organic compound having the molecular formula C3H6O can exist in the form of two isomers A and B having different functional groups. The isomer A is a liquid which is used as a solvent for nail polish. The isomer B is also a liquid. An aqueous solution of one of the lower homologues of B is used for preserving biological specimens in the laboratory
(a) What is compound A?
(b) Write the electron-dot structure of A.
(c) What is compound B?
(d) Write the electron-dot structure of B.
(e) Name the lower homologue of compound B which is used in preserving biological specimens.

35.

How does tooth enamel get damaged? What should be done to prevent it?

Answer»

How does tooth enamel get damaged? What should be done to prevent it?

36.

Write balanced chemical equations for the following: NaCl is heated with sulphuric acid in the presence of MnO2. Chlorine gas is passed into a solution of Nal in water.

Answer»

Write balanced chemical equations for the following:

NaCl is heated with sulphuric acid in the presence of MnO2.

Chlorine gas is passed into a solution of Nal in water.

37.

Give balanced equations with conditions,if any for the following conversions A to D. A.Sodium Chloride to Hydrogen Chloride B.Hydrogen Chloride to Iron [||] sulphide C.Hydrogen chloride to ammonium chloride D.Hydrogen Chloride to Lead chloride

Answer»

Give balanced equations with conditions,if any for the following conversions A to D.

A.Sodium Chloride to Hydrogen Chloride

B.Hydrogen Chloride to Iron [||] sulphide

C.Hydrogen chloride to ammonium chloride

D.Hydrogen Chloride to Lead chloride

38.

It is said that aqua regia can dissolve or corrode highly unreactive Metals like gold and platinum. Then how it is stored? In which container?

Answer»

It is said that aqua regia can dissolve or corrode highly unreactive

Metals like gold and platinum.

Then how it is stored? In which container?

39.

What is the function of acid in stomach?

Answer» What is the function of acid in stomach?
40.

Why is the chemical formula of iron oxide Fe3O4 when the valency of iron is 2,3 and that of oxygen is 2

Answer»

Why is the chemical formula of iron oxide Fe3O4 when the valency of iron is 2,3 and that of oxygen is 2

41.

What are micelles and 3 diffrence between soaps and detergents

Answer»

What are micelles and 3 diffrence between soaps and detergents

42.

Why if a substance loses hydrogen is said to be oxidised and if gains Hydrogen then reduced?

Answer»

Why if a substance loses hydrogen is said to be oxidised and if gains Hydrogen then reduced?

43.

The molecular mass of H2SO4 is :

Answer»

The molecular mass of H2SO4 is :


44.

What questions can we ask about diamond and mercury

Answer» What questions can we ask about diamond and mercury
45.

what is a decomposition reaction ? Give an example of a decomposition reaction. Desctribe an activity illustrate such a reaction by heating.

Answer»

what is a decomposition reaction ? Give an example of a decomposition reaction. Desctribe an activity illustrate such a reaction by heating.

46.

Question 17 In which of the following chemical equations, the abbreviations represent the correct states of the reactants and products involved at reaction temperature? (a) 2H2(l)+O2(l)→2H2O(g) (b) 2H2(g)+O2(l)→2H2O(l) (c) 2H2(g)+O2(g)→2H2O(l) (d) 2H2(g)+O2(g)→2H2O(g)

Answer» Question 17
In which of the following chemical equations, the abbreviations represent the correct states of the reactants and products involved at reaction temperature?

(a) 2H2(l)+O2(l)2H2O(g)
(b) 2H2(g)+O2(l)2H2O(l)
(c) 2H2(g)+O2(g)2H2O(l)
(d) 2H2(g)+O2(g)2H2O(g)
47.

What happens when solid iron piece is kept with cuso4 crystals ?Does any reaction takes place ? Guess the reason ??

Answer»

What happens when solid iron piece is kept with cuso4 crystals ?Does any reaction takes place ? Guess the reason ??

48.

Please give detailed explanation:- comment on the nature of bonds present in a molecule of XY when you have these additional information:- 1. the compound exists in the solid state 2. It has a very high melting point 3. Its aqueous solution makes an excellent electrolyte

Answer» Please give detailed explanation:-
comment on the nature of bonds present in a molecule of XY when you have these additional information:-
1. the compound exists in the solid state
2. It has a very high melting point
3. Its aqueous solution makes an excellent electrolyte
49.

Ethanol on complete oxidation gives:

Answer»

Ethanol on complete oxidation gives:


50.

Name the following : (a) The hardest naturally occurring substance. (b) A greyish black non-metal that is a good conductor of electricity. (c) The third crystalline form of carbon.

Answer»

Name the following :

(a) The hardest naturally occurring substance.

(b) A greyish black non-metal that is a good conductor of electricity.

(c) The third crystalline form of carbon.