Explore topic-wise InterviewSolutions in Current Affairs.

This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.

1.

State the odour of HCl gas.

Answer»

State the odour of HCl gas.


2.

The elements whose oxides can turn limus solution red are: (a) lithium and sodium (b) co. copper and potassium (c) carbon and hydrogen (d) phosphorus and sulphur

Answer»

The elements whose oxides can turn limus solution red are:
(a) lithium and sodium (b) co.

copper and potassium
(c) carbon and hydrogen (d) phosphorus and sulphur

3.

Out of methane, methene and methyne, which compound has the highest boiling point?

Answer»

Out of methane, methene and methyne, which compound has the highest boiling point?

4.

Ores mined from the earth are usually contaminated with large amounts of impurities such as soil, sand, etc., are called ____________.

Answer»

Ores mined from the earth are usually contaminated with large amounts of impurities such as soil, sand, etc., are called ____________.


5.

The properties of elements are periodic function of thier atomic number.justify(5).

Answer» The properties of elements are periodic function of thier atomic number.justify(5).
6.

A yellow coloured amphoteric oxide X react with caustic soda to give a colourless salt of sodium plumbate and water. What is X?

Answer»

A yellow coloured amphoteric oxide X react with caustic soda to give a colourless salt of sodium plumbate and water. What is X?


7.

If hydrogen is a gas then it should attract anode electrode but it attracts cathode electrode.why?

Answer»

If hydrogen is a gas then it should attract anode electrode but it attracts cathode electrode.why?

8.

Which of the following element is used in the extraction of Silicon when mixed with finely powdered silica:

Answer»

Which of the following element is used in the extraction of Silicon when mixed with finely powdered silica:


9.

From which of the following ores, metals cannot be extracted using calcination process?

Answer»

From which of the following ores, metals cannot be extracted using calcination process?


10.

Why is gold mixed with other metals for making jewellery? Name two metals mixed with gold.

Answer»

Why is gold mixed with other metals for making jewellery? Name two metals mixed with gold.

11.

Which bond is being represented here?

Answer»

Which bond is being represented here?


12.

Calculate the mass of iron in 10 kg of iron ore which contains 80% of pure ferric oxide.

Answer»

Calculate the mass of iron in 10 kg of iron ore which contains 80% of pure ferric oxide.

13.

Like alkali metals hydrogen also forms:

Answer»

Like alkali metals hydrogen also forms:


14.

CH3CH2CH2CH3(g)→CH3CH3(g)+P The given reaction is a thermal cracking reaction. Identify P.

Answer»

CH3CH2CH2CH3(g)CH3CH3(g)+P

The given reaction is a thermal cracking reaction. Identify P.


15.

In Lassaigne's test, the organic compound is fused with a piece of sodium metal in order to

Answer»

In Lassaigne's test, the organic compound is fused with a piece of sodium metal in order to


16.

What is the relation between 1 mole and vapour density?

Answer»

What is the relation between 1 mole and vapour density?

17.

In case of Aluminium, corrosion is not proved to be wasteful. Comment.

Answer»

In case of Aluminium, corrosion is not proved to be wasteful. Comment.

18.

In a weird sequence of amnesiac time-travel events, you are transported to 16th century Germany where the only practical fuel (or energy source) is firewood. Suppose you are given a piece of Copper which contains silver in small quantities. As luck would have it, you have a good quantity of Lead at your disposal. In this scenario, which one of the following metallurgical methods would you choose to refine the impure copper?

Answer»

In a weird sequence of amnesiac time-travel events, you are transported to 16th century Germany where the only practical fuel (or energy source) is firewood. Suppose you are given a piece of Copper which contains silver in small quantities. As luck would have it, you have a good quantity of Lead at your disposal. In this scenario, which one of the following metallurgical methods would you choose to refine the impure copper?


19.

Give reasons for the following : (a) Liquid ammonia is used as a refrigerant in ice plants. (b) Aqueous solution of ammonia is used for removing grease stains from woollen clothes. (c) Aqueous solution of ammonia gives a pungent smell. (d) Aqueous solution of ammonia conducts electricity.

Answer»

Give reasons for the following :

(a) Liquid ammonia is used as a refrigerant in ice plants.

(b) Aqueous solution of ammonia is used for removing grease stains from woollen clothes.

(c) Aqueous solution of ammonia gives a pungent smell.

(d) Aqueous solution of ammonia conducts electricity.

20.

A colourless gas X reacts with sulphuric acid to form ammonium sulphate. What is X?

Answer»

A colourless gas X reacts with sulphuric acid to form ammonium sulphate. What is X?


21.

The impurities present in mined ore are technically called

Answer»

The impurities present in mined ore are technically called


22.

Why are metals good conductors of heat?(please give a answer that can be written in board exams)

Answer» Why are metals good conductors of heat?(please give a answer that can be written in board exams)
23.

A student took a concentrated solution of H2SO4 and left it open in the air. What was his observation regarding the humidity of the surrounding:

Answer»

A student took a concentrated solution of H2SO4 and left it open in the air. What was his observation regarding the humidity of the surrounding:


24.

What is soap ? How would you make soap in the laboratory ? State one advantage and one disadvantage of soap over synthetic detergents.

Answer»

What is soap ? How would you make soap in the laboratory ? State one advantage and one disadvantage of soap over synthetic detergents.

25.

Which of the following compounds are a poor conductors of electricity?

Answer»

Which of the following compounds are a poor conductors of electricity?


26.

(a) What happens when an aqueous solution of sodium sulphate reacts with an aqueous solution of barium chloride ? (b) Write the balanced chemical equation for the reaction which takes place. (c) State the physical conditions of reactants in which the reaction will not take place. (d) Name the type of chemical reaction which occurs. (e) Give one example of another reaction which is of the same type as the above reaction.

Answer»

(a) What happens when an aqueous solution of sodium sulphate reacts with an aqueous solution of barium chloride ?

(b) Write the balanced chemical equation for the reaction which takes place.

(c) State the physical conditions of reactants in which the reaction will not take place.

(d) Name the type of chemical reaction which occurs.

(e) Give one example of another reaction which is of the same type as the above reaction.

27.

Question 8.4 Write the balanced chemical equation for the following and identify the type of reaction: Magnesium (s) + Hydrochloric acid (aq) → Magnesium chloride (aq) + Hydrogen (g)

Answer» Question 8.4
Write the balanced chemical equation for the following and identify the type of reaction:


Magnesium (s) + Hydrochloric acid (aq) Magnesium chloride (aq) + Hydrogen (g)
28.

The substances which are capable of adding oxygen to other substances are called:

Answer»

The substances which are capable of adding oxygen to other substances are called:


29.

The valencies of aluminium and chlorine in the compound AlCl3 are ______ and _____ respectively.

Answer»

The valencies of aluminium and chlorine in the compound AlCl3 are ______ and _____ respectively.


30.

Percent by mass of a solute (molar mass = 28 g) in its aqueous solution is 28. Calculate the mole fraction (X) and molality (m) of the solute in the solution.

Answer»

Percent by mass of a solute (molar mass = 28 g) in its aqueous solution is 28. Calculate the mole fraction (X) and molality (m) of the solute in the solution.


31.

What are the factors affecting the solubility of solute in solvent?

Answer»

What are the factors affecting the solubility of solute in solvent?

32.

Consider the following substances : NaCl, Ca(OH)2, NaHCO3, NH3, Na2CO3, H2O, Cl2 CO2, CaSO4.2H2O, 2CaSO4.H2O, CaOCl2 (a) Which two substances combine to form bleaching powder : (b) Which four substances are utilised in the production of washing soda ? (c) Which compound represents plaster of Paris ? (d) Which compound is a part of baking powder ? (e) Which compound is used as an antacid ?

Answer»

Consider the following substances :

NaCl, Ca(OH)2, NaHCO3, NH3, Na2CO3, H2O, Cl2 CO2, CaSO4.2H2O, 2CaSO4.H2O, CaOCl2

(a) Which two substances combine to form bleaching powder :

(b) Which four substances are utilised in the production of washing soda ?

(c) Which compound represents plaster of Paris ?

(d) Which compound is a part of baking powder ?

(e) Which compound is used as an antacid ?

33.

Write balance chemical equation for the following reaction: (a) hydrochloric acid reacts with calcium hydroxide . (b) calcium hydroxide reacts with sulphuric acid

Answer»

Write balance chemical equation for the following reaction: (a) hydrochloric acid reacts with calcium hydroxide . (b) calcium hydroxide reacts with sulphuric acid

34.

A gas occupied 360 cm3 at 87∘C and 380 mm Hg pressure. If the mass of gas is 0.546 g find its relative molecular mass.

Answer»

A gas occupied 360 cm3 at 87C and 380 mm Hg pressure. If the mass of gas is 0.546 g find its relative molecular mass.

35.

The reaction between sodium and water is an example which type of reaction

Answer»

The reaction between sodium and water is an example which type of reaction

36.

Question 3 What were the limitations of Newlands' law of octaves?

Answer»

Question 3
What were the limitations of Newlands' law of octaves?

37.

Who is the father of period table.

Answer» Who is the father of period table.
38.

1 amu (atomic mass unit) is equal to

Answer»

1 amu (atomic mass unit) is equal to


39.

Among the following elements, which element will be most electronegative?

Answer»

Among the following elements, which element will be most electronegative?


40.

Which one of the following has the correct order of ionisation energy?

Answer»

Which one of the following has the correct order of ionisation energy?


41.

Potassium is never found in nature as free element because:

Answer»

Potassium is never found in nature as free element because:


42.

Distinguish between metals and non-metals on the basis of: [5 MARKS] i) Ion formation ii) Discharge of ions iii) Nature of oxides formed iv) Oxidising and reducing property v) Reaction with acids

Answer» Distinguish between metals and non-metals on the basis of: [5 MARKS]
i) Ion formation
ii) Discharge of ions
iii) Nature of oxides formed
iv) Oxidising and reducing property
v) Reaction with acids
43.

Chlorine has two isotopes having atomic masses of 35u and 37u each. They are present in the ratio 3:1 respectively. The average atomic mass of Chlorine is _______u.

Answer»

Chlorine has two isotopes having atomic masses of 35u and 37u each. They are present in the ratio 3:1 respectively. The average atomic mass of Chlorine is _______u.


44.

How would you distinguish between baking powder and washing soda by heating?

Answer» How would you distinguish between baking powder and washing soda by heating?
45.

In the process of rusting, the metal iron (Fe) reacts with which substances present in the atmosphere? [2 MARKS]

Answer» In the process of rusting, the metal iron (Fe) reacts with which substances present in the atmosphere? [2 MARKS]
46.

What is the effect of ethanol on the human body?

Answer»

What is the effect of ethanol on the human body?

47.

Why a dilute acid is added to water during electrolysis of water?

Answer»

Why a dilute acid is added to water during electrolysis of water?

48.

State the terms defined by the following sentences : (a) A soluble base. (b) The insoluble solid formed when two solutions are mixed together. (c) An acidic solution in which there is only partial ionization of the solute molecules.

Answer»

State the terms defined by the following sentences :

(a) A soluble base.

(b) The insoluble solid formed when two solutions are mixed together.

(c) An acidic solution in which there is only partial ionization of the solute molecules.

49.

How are ores concentrated? Is it different for sulphide and carbonate ores?

Answer»

How are ores concentrated? Is it different for sulphide and carbonate ores?

50.

Arrange the following process of formation of H2SO4 on the planet Venus in the sequence of occurrence. I.The reaction of Sulphur dioxide with atomic oxygen to form Sulphur trioxide. II.Sun's photochemical action on carbon dioxide to form carbon monoxide and atomic oxygen. III.The reaction of Sulphur trioxide with water to form sulphuric acid.

Answer»

Arrange the following process of formation of H2SO4 on the planet Venus in the sequence of occurrence.

I.The reaction of Sulphur dioxide with atomic oxygen to form Sulphur trioxide.

II.Sun's photochemical action on carbon dioxide to form carbon monoxide and atomic oxygen.

III.The reaction of Sulphur trioxide with water to form sulphuric acid.