Explore topic-wise InterviewSolutions in Current Affairs.

This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.

1.

which of the follwing is more soluble in water. a\rbrack carboxylic acid ;b\rbrack alcohol ;c\rbrack aldehydes ;d\rbrack ketones and why what is the reason for i

Answer» which of the follwing is more soluble in water. a\rbrack carboxylic acid ;b\rbrack alcohol ;c\rbrack aldehydes ;d\rbrack ketones and why what is the reason for i
2.

Th increasing order of the first ionization enthalpy of the elements B,P,S and F is:

Answer»

Th increasing order of the first ionization enthalpy of the elements B,P,S and F is:

3.

Which of the following is the correct expression for ΔS in case of isochoric process?

Answer»

Which of the following is the correct expression for ΔS in case of isochoric process?

4.

Electrical conduction of fused electrolyte depends on

Answer»

Electrical conduction of fused electrolyte depends on



5.

why benzophenone doesnot undergo cannizaro reaction and why 2,2dimethylbu†an al undergo cannizaro reaction despite having alpha hydroge

Answer» why benzophenone doesnot undergo cannizaro reaction and why 2,2dimethylbu†an al undergo cannizaro reaction despite having alpha hydroge
6.

The historical recorded use of litmus dyes was by the Spanish alchemist _____ around ____ AD.

Answer»

The historical recorded use of litmus dyes was by the Spanish alchemist _____ around ____ AD.



7.

what is insitu reaction? how does the production of phosphorus tribromide and triiodide being insitu obstruct the formation of alkyl halide?

Answer» what is insitu reaction? how does the production of phosphorus tribromide and triiodide being insitu obstruct the formation of alkyl halide?
8.

Law of equivalence

Answer» Law of equivalence
9.

in a closed packed structure of mixed oxides, the lattice is composed of oxide ions, 1/8th of tetrahedral voids are occupied by trivalent cation(A3+) and 1/4th of octahedral voidsare occupied by divalent cation (B2+). Find the formula of ox

Answer» in a closed packed structure of mixed oxides, the lattice is composed of oxide ions, 1/8th of tetrahedral voids are occupied by trivalent cation(A3+) and 1/4th of octahedral voidsare occupied by divalent cation (B2+). Find the formula of ox
10.

12. In the reaction of p-chlotoulene with KNH2 in liquid NH3 the product obtained are O-Toluidine&p-Tolulidine m-Toluidine& p-Tolulidine P-Tolulidine &p-choroaniline p-choroaniline & m-Toluidine

Answer» 12. In the reaction of p-chlotoulene with KNH2 in liquid NH3 the product obtained are O-Toluidine&p-Tolulidine m-Toluidine& p-Tolulidine P-Tolulidine &p-choroaniline p-choroaniline & m-Toluidine
11.

Match the compounds/ions in Column I with their properties/reactions in Column II. ColumnIColumnIIA.C6H5CHOp.gives precipitate with 2,4−dinitrophenylhydrazineB.CH3C≡CHq.gives precipitate with AgNO3C.CN−r.is a nucleophileD.I−s.is involved in cyanohydrin formation

Answer» Match the compounds/ions in Column I with their properties/reactions in Column II.
ColumnIColumnIIA.C6H5CHOp.gives precipitate with 2,4dinitrophenylhydrazineB.CH3CCHq.gives precipitate with AgNO3C.CNr.is a nucleophileD.Is.is involved in cyanohydrin formation
12.

We can't obtain methane from wurtz reaction. Am I right?

Answer» We can't obtain methane from wurtz reaction. Am I right?
13.

The molal elevation constant is the elevation in boiling point of

Answer»

The molal elevation constant is the elevation in boiling point of


14.

25.4 g of iodine and 7.1 g chlorine are made to react to give a mixture of ICl and ICl3. Number of moles of ICl and ICl3 formed are respectively ?

Answer»

25.4 g of iodine and 7.1 g chlorine are made to react to give a mixture of ICl and ICl3. Number of moles of ICl and ICl3 formed are respectively ?



15.

Q 15/15 In a cubic lattice if atoms are present only at all the corners and alternate face centres then the packing efficiency will be 74% 37% X) 68% Can't be determined

Answer» Q 15/15 In a cubic lattice if atoms are present only at all the corners and alternate face centres then the packing efficiency will be 74% 37% X) 68% Can't be determined
16.

which of the following represents heat of formation of the product:(1)2/3O3(g)---->O2(g)(2)NH4^+(g)+Cl^-(g) ---->NH4Cl(s)(3)1/2H2(g) +aq---->H^+(aq)(4)P4+5O2(g)---->P4O10(S)

Answer» which of the following represents heat of formation of the product:
(1)2/3O3(g)---->O2(g)
(2)NH4^+(g)+Cl^-(g) ---->NH4Cl(s)
(3)1/2H2(g) +aq---->H^+(aq)
(4)P4+5O2(g)---->P4O10(S)
17.

cr2o3 ,cro3 cro arrange according to increases acidic charater

Answer» cr2o3 ,cro3 cro arrange according to increases acidic charater
18.

What is recycling?

Answer» What is recycling?
19.

What are unsystematic errors?

Answer» What are unsystematic errors?
20.

Explain the formation of lewis bond structure of clo4-(per chlorate ion

Answer» Explain the formation of lewis bond structure of clo4-(per chlorate ion
21.

An alkene occupies 0.4 L g−1 at STP. The number of hydrogen atoms in one formula unit of the alkene is:

Answer»

An alkene occupies 0.4 L g1 at STP. The number of hydrogen atoms in one formula unit of the alkene is:

22.

Which of the following oxides is amphoteric in character?

Answer»

Which of the following oxides is amphoteric in character?


23.

8. A metal oxide has the formula A2O3 it can be reduced by hydrogen to give free metal and water 0.1 596 grams of this metal oxide requires 6 milligrams of hydrogen for complete reduction what is the atomic weight of metal

Answer» 8. A metal oxide has the formula A2O3 it can be reduced by hydrogen to give free metal and water 0.1 596 grams of this metal oxide requires 6 milligrams of hydrogen for complete reduction what is the atomic weight of metal
24.

Which of the following acids has the smallest dissociation constant?

Answer»

Which of the following acids has the smallest dissociation constant?

25.

2H2 + O2 → 2H2OIf 2 g of Hydrogen and 5 g of Oxygen is used in the following reaction, what is the limiting reagent?

Answer» 2H2 + O2 → 2H2O

If 2 g of Hydrogen and 5 g of Oxygen is used in the following reaction, what is the limiting reagent?
26.

How does entropy of h2 increases on adsorption on the glass surface? Won't it undergo physiosorption and thus entropy would decrease. Pl explain the exception.

Answer» How does entropy of h2 increases on adsorption on the glass surface? Won't it undergo physiosorption and thus entropy would decrease. Pl explain the exception.
27.

The final product formed in the following reaction is:

Answer» The final product formed in the following reaction is:


28.

28. For the given complex [CoCl2(en)(NH3)2]+, the number of geometrical isomers, the number of optical isomers and total number of isomers of all type possible respectively are

Answer» 28. For the given complex [CoCl2(en)(NH3)2]+, the number of geometrical isomers, the number of optical isomers and total number of isomers of all type possible respectively are
29.

In a sample , electron jump from 5th excited state to ground state then no of spectral line in visible range will be

Answer» In a sample , electron jump from 5th excited state to ground state then no of spectral line in visible range will be
30.

How to find the possible oxidation states of an element?

Answer» How to find the possible oxidation states of an element?
31.

A solute is dissolved in 0.1 litre of a solution which develops an osmotic pressure of 1.23 atm at 27°C. The molecular mass of the substance is:

Answer»

A solute is dissolved in 0.1 litre of a solution which develops an osmotic pressure of 1.23 atm at 27°C. The molecular mass of the substance is:



32.

In which of the following the repulsion is least?

Answer»

In which of the following the repulsion is least?

33.

how to write electronic configuration of an electron.?

Answer» how to write electronic configuration of an electron.?
34.

Find the incorrect match :-(1) Al2Cl6 : 3C–4e bond is present(2) Al 2(CH3 )6 : Allcarbonatomsaresp3 hybridised(3) I2Cl6 : Non-planar(4) Al2Br6 : Non-planar(actually my qouestion is how can be al2br6 planar as it posses sp3 hybridized orbitals)

Answer» Find the incorrect match :-
(1) Al2Cl6 : 3C–4e bond is present
(2) Al 2(CH3 )6 : Allcarbonatomsaresp3 hybridised
(3) I2Cl6 : Non-planar
(4) Al2Br6 : Non-planar
(actually my qouestion is how can be al2br6 planar as it posses sp3 hybridized orbitals)
35.

4.0 g of a substance when dissolved in 36.0 g of water lowered its vapour pressure by 0.5 mm Hg at a given temperature. The vapour pressure of water at this temperature is 25.0 mm Hg. Calculate the molecular weight of solute.

Answer»

4.0 g of a substance when dissolved in 36.0 g of water lowered its vapour pressure by 0.5 mm Hg at a given temperature. The vapour pressure of water at this temperature is 25.0 mm Hg. Calculate the molecular weight of solute.

36.

How many atoms are present in edge centered lattice??

Answer» How many atoms are present in edge centered lattice??
37.

Entropy change when 4 moles of an ideal gas expands reversibly from an initial volume of 1 dm3 to a final volume of 10 dm3 at a constant temperature of 298 K is:

Answer»

Entropy change when 4 moles of an ideal gas expands reversibly from an initial volume of 1 dm3 to a final volume of 10 dm3 at a constant temperature of 298 K is:

38.

For one of the element various ionization enthalpies (in KJ mol−1) are given below: I.E1st2nd3rd4th5th577.51810275011,58014,820 The element is

Answer»

For one of the element various ionization enthalpies (in KJ mol1) are given below:

I.E1st2nd3rd4th5th577.51810275011,58014,820

The element is


39.

The complete hydrolysis of (CH3)2SiCl2 forms-

Answer»

The complete hydrolysis of (CH3)2SiCl2 forms-



40.

Precipice Ltd., a laboratory equipment manufacturer, adopted several ways of training to improve the quality and quantity of output and provide job satisfaction. (i) Mr. Sirius was provided a dummy model of machinery to do practice on it. (ii) Ms. Minerva was shifted from purchase department to production department for a short interval of time. (iii) Mr. Harry was asked to work with an expert for a specific time period so that he can learn by observation. (iv) Ms. Hermione was provided study material so that she goes through these units by answering the questions and fill in the blanks. (v) Mr. Ron was in the company so that he could practice the theoretical knowledge acquired by him from his college. Identify which techniques of training were used and for whom by Precipice Ltd. Classify them as On-the-job training and Off-the-job training.

Answer»

Precipice Ltd., a laboratory equipment manufacturer, adopted several ways of training to improve the quality and quantity of output and provide job satisfaction.

(i) Mr. Sirius was provided a dummy model of machinery to do practice on it.

(ii) Ms. Minerva was shifted from purchase department to production department for a short interval of time.

(iii) Mr. Harry was asked to work with an expert for a specific time period so that he can learn by observation.

(iv) Ms. Hermione was provided study material so that she goes through these units by answering the questions and fill in the blanks.

(v) Mr. Ron was in the company so that he could practice the theoretical knowledge acquired by him from his college.

Identify which techniques of training were used and for whom by Precipice Ltd. Classify them as On-the-job training and Off-the-job training.

41.

Hybridization in [Co(NH3)6] is ?

Answer»

Hybridization in [Co(NH3)6] is ?

42.

a gaseous reaction 2A-->4B+C is carried out in closed vessel the concentration of B is found to increase by 5×10^{-3 }in 10 seconds so what is rate of disappreance of B and rate of appreance of

Answer» a gaseous reaction 2A-->4B+C is carried out in closed vessel the concentration of B is found to increase by 5×10^{-3 }in 10 seconds so what is rate of disappreance of B and rate of appreance of
43.

3. What is the heat of neutralisation when a weak base reacts with another weak base?

Answer» 3. What is the heat of neutralisation when a weak base reacts with another weak base?
44.

The most unstable compounds of the following are:

Answer»

The most unstable compounds of the following are:


45.

The reaction of HBr with the following compound would produce:

Answer»

The reaction of HBr with the following compound would produce:


46.

Which of the following species does not show disproportionation reaction

Answer»

Which of the following species does not show disproportionation reaction


47.

Liquid A (p0A=200 mm of Hg) and B (P0B=100 mm of Hg) forms ideal solution. If the vapour pressure of solution is 180 mm of Hg, the mole fraction of the liquid A in the solution is:[0.77 Mark]

Answer»

Liquid A (p0A=200 mm of Hg) and B (P0B=100 mm of Hg) forms ideal solution. If the vapour pressure of solution is 180 mm of Hg, the mole fraction of the liquid A in the solution is:

[0.77 Mark]

48.

Which is primary alcohol [CPMT 1980]

Answer»

Which is primary alcohol [CPMT 1980]



49.

The equilibrium constant KC for the reaction, CaSO4⋅5H2O(s)⇌CaSO4⋅3H2O(s)+2H2O(g), is equal to:

Answer»

The equilibrium constant KC for the reaction, CaSO45H2O(s)CaSO43H2O(s)+2H2O(g), is equal to:

50.

Consider the below-given reaction. The percentage yield of an amide product is (Round off to the Nearest Integer).[Given: Atomic mass: C: 12.0 u, H : 1.0 u, N : 14.0, O : 16.0 u, Cl : 35.5 u]

Answer» Consider the below-given reaction. The percentage yield of an amide product is (Round off to the Nearest Integer).

[Given: Atomic mass: C: 12.0 u, H : 1.0 u, N : 14.0, O : 16.0 u, Cl : 35.5 u]