This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.
| 1. |
47.Elevation of Boiling Point of 1M KCl solution is double than that of 1M sugar solution. Why?? |
| Answer» 47.Elevation of Boiling Point of 1M KCl solution is double than that of 1M sugar solution. Why?? | |
| 2. |
36.what is formula of butanol how to find formula of butanol |
| Answer» 36.what is formula of butanol how to find formula of butanol | |
| 3. |
At 1990 K and 1 atm pressure, there are equal number of Cl2 molecules and Cl atoms in the reaction mixture. The value of Kp for the reaction Cl2(g)⇌2Cl(g) under the above condition is x×10−1. The value of x is ______.(rounded off to the nearest integer) |
|
Answer» At 1990 K and 1 atm pressure, there are equal number of Cl2 molecules and Cl atoms in the reaction mixture. The value of Kp for the reaction Cl2(g)⇌2Cl(g) under the above condition is x×10−1. The value of x is ______. (rounded off to the nearest integer) |
|
| 4. |
Potential difference across a cell is V and its emf is E. Which of the following is correct?(1) E=V(2)E>V(3)E |
|
Answer» Potential difference across a cell is V and its emf is E. Which of the following is correct? (1) E=V (2)E>V (3)E |
|
| 5. |
The correct order of +M effect of ′N′ containing functional group on benzene ring, amongst the given compounds is (I) (II) (III) (IV) |
|
Answer» The correct order of +M effect of ′N′ containing functional group on benzene ring, amongst the given compounds is |
|
| 6. |
Give the oxidation state, d-orbital occupation and coordination number of the central metal ion in the following complexes: K3[Co(C2O4)3] (NH4)2[CoF4] Cis−[Cr(en)2Cl2]Cl [Mn(H2O)6]SO4 |
|
Answer» Give the oxidation state, d-orbital occupation and coordination number of the central metal ion in the following complexes: (NH4)2[CoF4] Cis−[Cr(en)2Cl2]Cl [Mn(H2O)6]SO4 |
|
| 7. |
Identify the trans isomer of [Pt(NH3)2Cl2] from the following |
|
Answer» Identify the trans isomer of [Pt(NH3)2Cl2] from the following |
|
| 8. |
Find the distance of tetrahedral void from the corner of a cube for a ccp crystal lattice.Given:The edge length of the unit cell is 20√3 pm |
|
Answer» Find the distance of tetrahedral void from the corner of a cube for a ccp crystal lattice. |
|
| 9. |
What is a nuclear reactor? Name the first nuclear reactor of India. Also, mention the date on which it went critical. |
|
Answer» What is a nuclear reactor? Name the first nuclear reactor of India. Also, mention the date on which it went critical. |
|
| 10. |
An aqueous solution containing 58.8% w/v ofH2S04 has density 1.388 g/mL. The molality with respect to H2S04 of the solution is |
| Answer» An aqueous solution containing 58.8% w/v ofH2S04 has density 1.388 g/mL. The molality with respect to H2S04 of the solution is | |
| 11. |
The element having highest ionisation potential is: |
|
Answer» The element having highest ionisation potential is: |
|
| 12. |
Writethe equations for the preparation of 1−iodobutane from(i) 1-butanol (ii) 1-chlorobutane (iii) but-1-ene. |
|
Answer» Write (i) (ii) (iii) |
|
| 13. |
21. How to derive formula for the number of regions into which a set of n coplanar lines in general position divide the plane. |
| Answer» 21. How to derive formula for the number of regions into which a set of n coplanar lines in general position divide the plane. | |
| 14. |
n factor of fes2 in the below reaction:- fes2 + o2 ----> fe2o3 + so2. |
| Answer» n factor of fes2 in the below reaction:- fes2 + o2 ----> fe2o3 + so2. | |
| 15. |
What do you mean by a saturated solution? |
|
Answer» What do you mean by a saturated solution? |
|
| 16. |
The reducing agent in the following reaction is:Pb(s) + Cu2+(aq) → Pb2+ (aq) + Cu(s) |
|
Answer» The reducing agent in the following reaction is: |
|
| 17. |
The number of waves in the third orbit of hydrogen atom is? |
|
Answer» The number of waves in the third orbit of hydrogen atom is? |
|
| 18. |
sp3- hybridsed nitrogen is present in: |
|
Answer» sp3- hybridsed nitrogen is present in: |
|
| 19. |
a 2% solution of cellulose acetate in acetone shows an osmotic rise of 32.3 mm at 300 K against pure acetone. the density of acetone is 0.8 g/cc. find the relative molar mass of the polymer(take R=0.08) |
| Answer» a 2% solution of cellulose acetate in acetone shows an osmotic rise of 32.3 mm at 300 K against pure acetone. the density of acetone is 0.8 g/cc. find the relative molar mass of the polymer(take R=0.08) | |
| 20. |
Which of the following is a Sandmeyer reaction? |
|
Answer» Which of the following is a Sandmeyer reaction? |
|
| 21. |
Most stable radical among the following is(1) CH3-CH2.(2) F-CH2-CH2.(3)(F)2-CH-CH2. (4) (F)3-C-CH2 |
| Answer» Most stable radical among the following is(1) CH3-CH2.(2) F-CH2-CH2.(3)(F)2-CH-CH2. (4) (F)3-C-CH2 | |
| 22. |
How many minimum no of carbons are needed for an optically active ether? i)2 ii)3 iii)4 iv) |
| Answer» How many minimum no of carbons are needed for an optically active ether? i)2 ii)3 iii)4 iv) | |
| 23. |
38 Which of the following reagents would not be a good choicefor reducing anaryl nitro compound to an amine? (1) H2(excess)/Pt (2) LiAlH4 in ether. (3) Fe and HCl (4) Sn and HCl |
| Answer» 38 Which of the following reagents would not be a good choicefor reducing anaryl nitro compound to an amine? (1) H2(excess)/Pt (2) LiAlH4 in ether. (3) Fe and HCl (4) Sn and HCl | |
| 24. |
What is correct order of stability of the following carbocations:A. +CH2−CH3B. +CH2−CH2ClC. +CH2−CHCl2D. +CH2−CCl3 |
|
Answer» What is correct order of stability of the following carbocations: |
|
| 25. |
35.The concentration of glucose (in g/litre) solution which is isotonic with a solution of a urea containing 6g per litre will be. |
| Answer» 35.The concentration of glucose (in g/litre) solution which is isotonic with a solution of a urea containing 6g per litre will be. | |
| 26. |
Abeam of helium atoms moves with a velocity of 2 into 10 to the power 4 metre per second find the wavelength of particle constituting the beam |
| Answer» Abeam of helium atoms moves with a velocity of 2 into 10 to the power 4 metre per second find the wavelength of particle constituting the beam | |
| 27. |
If three complex numbers are in ap then they lie on |
|
Answer» If three complex numbers are in ap then they lie on |
|
| 28. |
Number of amphoteric compounds among the following is ______.BeOBaOBe(OH)2Sr(OH)2 |
|
Answer» Number of amphoteric compounds among the following is ______. BeOBaOBe(OH)2Sr(OH)2 |
|
| 29. |
What is the mass of the precipitate formed when 60 mL of 15.3% solution of AgNO3 is mixed with 60 mL of 6.2% of NaCl solution? |
| Answer» What is the mass of the precipitate formed when 60 mL of 15.3% solution of AgNO3 is mixed with 60 mL of 6.2% of NaCl solution? | |
| 30. |
how many stereoisomers are there for 1-ethyl-3-methylcyclohexane? |
| Answer» how many stereoisomers are there for 1-ethyl-3-methylcyclohexane? | |
| 31. |
What are Alkali |
| Answer» What are Alkali | |
| 32. |
How many grams of methane are required to produce 22 g CO2 by combustion? CH4+2O2→CO2+2H2O |
|
Answer» How many grams of methane are required to produce 22 g CO2 by combustion? |
|
| 33. |
35.What amount of electron ,proton and neutron are present in chlorine |
| Answer» 35.What amount of electron ,proton and neutron are present in chlorine | |
| 34. |
The standard molar entropy of H2O (1) is 70 JK−1 mol−1. Will the standard molar entropy of H2O(s) be more, or less than 70 JK−1 mol−1? |
|
Answer» The standard molar entropy of H2O (1) is 70 JK−1 mol−1. Will the standard molar entropy of H2O(s) be more, or less than 70 JK−1 mol−1? |
|
| 35. |
Why does R3P=O exist but R3N=O does not (R = alkyl group)? |
|
Answer» Why
|
|
| 36. |
In the above reaction product ′P′ is: |
Answer» ![]() In the above reaction product ′P′ is: |
|
| 37. |
Using Bohr's postulates of the atomic model, derive the expression for radius of nth electron orbit. Hence obtain the expression for Bohr's radius. |
| Answer» Using Bohr's postulates of the atomic model, derive the expression for radius of nth electron orbit. Hence obtain the expression for Bohr's radius. | |
| 38. |
Lis la publicité et remplis la grille ci-dessous : Pays proposé Viêtnam Nom de voyage Lieu visité Durée de voyage Nombre de repas Prix |
||||||||||||
Answer» Lis la publicité et remplis la grille ci-dessous :
|
|||||||||||||
| 39. |
A 3 L container has 4 atm pressure at 27 ∘C. If 2 L of gas at 2 atm is added to this container at same temperature, then what will be the new pressure in the container? |
|
Answer» A 3 L container has 4 atm pressure at 27 ∘C. If 2 L of gas at 2 atm is added to this container at same temperature, then what will be the new pressure in the container? |
|
| 40. |
Which of the following compound of nitrogen shows disproportionation reaction in acid solution? |
|
Answer» Which of the following compound of nitrogen shows disproportionation reaction in acid solution? |
|
| 41. |
What is viscosity ?explain |
| Answer» What is viscosity ?explain | |
| 42. |
The unit of equivalent conductivity is [CPMT 1999; BCECE 2005] |
|
Answer» The unit of equivalent conductivity is [CPMT 1999; BCECE 2005] |
|
| 43. |
40. 1-phenylpropyne +h2so4+hgso4 mechnism |
| Answer» 40. 1-phenylpropyne +h2so4+hgso4 mechnism | |
| 44. |
Atom is made up of electron, proton, and neutron. Then electron, proton, and neutron are made up of? |
| Answer» Atom is made up of electron, proton, and neutron. Then electron, proton, and neutron are made up of? | |
| 45. |
Why are Mn2+compounds more stable than Fe2+ towards oxidation to their +3 state? |
|
Answer» Why
|
|
| 46. |
94 0.9 g Al reacts with dil. HCl to give H2. The volume of H2 evolved at STP is |
| Answer» 94 0.9 g Al reacts with dil. HCl to give H2. The volume of H2 evolved at STP is | |
| 47. |
Excess of which of the followings in drinking water is responsible for disease known as ‘Blue Baby Syndrome’ or ‘Methemoglobinemia’? |
|
Answer» Excess of which of the followings in drinking water is responsible for disease known as ‘Blue Baby Syndrome’ or ‘Methemoglobinemia’? |
|
| 48. |
A20.0 mL solution containing 0.2 g impure H2O2 reacts completely with 0.316 g of KMnO4 in acid solution. The purity of H2O2 (in%) is (Nearest integer) (mol.wt.ofH2O2=34mole.wt.of.KMnO4=158) |
|
Answer» A20.0 mL solution containing 0.2 g impure H2O2 reacts completely with 0.316 g of KMnO4 in acid solution. The purity of H2O2 (in%) is (Nearest integer) (mol.wt.ofH2O2=34mole.wt.of.KMnO4=158) |
|
| 49. |
Arrange OHCH2COOH (I), HOCH2CH2COOH (II) and CH3COOH (III) in order of their acidic strength. |
|
Answer» Arrange OHCH2COOH (I), HOCH2CH2COOH (II) and CH3COOH (III) in order of their acidic strength. |
|
| 50. |
9. What is mean by isotope |
| Answer» 9. What is mean by isotope | |