Explore topic-wise InterviewSolutions in Current Affairs.

This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.

1.

how much time is required for complete dissociation of 4 moles of water using 4 ampere

Answer» how much time is required for complete dissociation of 4 moles of water using 4 ampere
2.

what is the iupac name of this compound ? and what is the oxidation no of co? K\lbrack Cocl2(NH3)3(H2O)(ONO)\rbrack

Answer» what is the iupac name of this compound ? and what is the oxidation no of co? K\lbrack Cocl2(NH3)3(H2O)(ONO)\rbrack
3.

30.pH of a mixture which contain 0.1 M in CH3COOH and 0.05 M in (CH3COO)2Ba is [pKa of CH3COOH = 4.74] a) 4.74 b) 5.04 c) 4.44 d) 7.00

Answer» 30.pH of a mixture which contain 0.1 M in CH3COOH and 0.05 M in (CH3COO)2Ba is [pKa of CH3COOH = 4.74] a) 4.74 b) 5.04 c) 4.44 d) 7.00
4.

The density of a certain gaseous oxide at 3.2 bar pressure and 47 ∘C is same as that of O2 at 27 ∘C and 4.2 bar pressure. The molecular mass of the gaseous oxide (in g) is:

Answer» The density of a certain gaseous oxide at 3.2 bar pressure and 47 C is same as that of O2 at 27 C and 4.2 bar pressure. The molecular mass of the gaseous oxide (in g) is:


5.

Which of the following displace Br2 from an aqueous solution containing bromide ions?

Answer»

Which of the following displace Br2 from an aqueous solution containing bromide ions?

6.

Choose the eclipsed conformations from among the following.

Answer»

Choose the eclipsed conformations from among the following.

7.

X- rays of wavelength equal to 0.134 nm give a first order diffraction from the surface of a crystal when the value of θ is 10.5∘. Calculate the distance between the planes in the crystal parallel to the surface examined.

Answer» X- rays of wavelength equal to 0.134 nm give a first order diffraction from the surface of a crystal when the value of θ is 10.5. Calculate the distance between the planes in the crystal parallel to the surface examined.
8.

The correct formula of dolomite is:

Answer»

The correct formula of dolomite is:

9.

1.For symmetrical alkenes/alkynes ,we can add the negative and positive part of the reagent to any of the double/triple bonded carbon atoms.Markovnikov's rule does not apply to such alkenes and alkynes.Is this correct?

Answer» 1.For symmetrical alkenes/alkynes ,we can add the negative and positive part of the reagent to any of the double/triple bonded carbon atoms.Markovnikov's rule does not apply to such alkenes and alkynes.Is this correct?
10.

The electronegativity of the followingelements increases in the order

Answer»

The electronegativity of the followingelements increases in the order


11.

order of M.P.in 1,2 dichloro benzene,1,3 di chloro benzene and 1,4 dichloro benzene is ?

Answer» order of M.P.in 1,2 dichloro benzene,1,3 di chloro benzene and 1,4 dichloro benzene is ?
12.

Explain gibbs free energy

Answer» Explain gibbs free energy
13.

A horizontal pipe has a cross section of 10 cm2 in one region and of 5 cm2 in another. The water velocity at the first is 5 ms–1 and the pressure in the second is 2×105 Nm–2. Find the pressure of water in 1st region (in 102 Pa).

Answer»

A horizontal pipe has a cross section of 10 cm2 in one region and of 5 cm2 in another. The water velocity at the first is 5 ms1 and the pressure in the second is 2×105 Nm2. Find the pressure of water in 1st region (in 102 Pa).

14.

Which of the following will be most reactive for SN1 reaction ?

Answer»

Which of the following will be most reactive for SN1 reaction ?

15.

In zn and H2SO4 reaction how grams of 80% pure zn is needed to produce 10 grams of H2?

Answer» In zn and H2SO4 reaction how grams of 80% pure zn is needed to produce 10 grams of H2?
16.

Metals are good conductors of electricity because

Answer»

Metals are good conductors of electricity because

17.

Cos20.cos40.cos60.cos80=1/16 prove that

Answer» Cos20.cos40.cos60.cos80=1/16 prove that
18.

Determine number of gram mole and gram solute in 2.5 litre of 2M H2So4

Answer» Determine number of gram mole and gram solute in 2.5 litre of 2M H2So4
19.

Heat has randomising influence on a system and temperature is the measure of average chaotic motion of particles in the system. Write the mathematical relation which relates these three parameters.

Answer»

Heat has randomising influence on a system and temperature is the measure of average chaotic motion of particles in the system. Write the mathematical relation which relates these three parameters.

20.

Match the items of Column I with items of Column II and assign the correct code. Column I Column IIA. Blisterred Cu1. AluminiumB. Blast furnace2. 2Cu2O+Cu2S⟶6Cu+SO2C. Reverberatory furnace3. IronD. Hall−Heroult process4. FeO+SiO2⟶FeSiO35. 2Cu2S+3O2⟶2Cu2O+2SO2 Codes A B C D A B C D (a) 2 3 4 1 (b) 1 2 3 5 (c) 5 4 3 2 (d) 4 5 3 2

Answer»

Match the items of Column I with items of Column II and assign the correct code.
Column I Column IIA. Blisterred Cu1. AluminiumB. Blast furnace2. 2Cu2O+Cu2S6Cu+SO2C. Reverberatory furnace3. IronD. HallHeroult process4. FeO+SiO2FeSiO35. 2Cu2S+3O22Cu2O+2SO2
Codes
A B C D A B C D
(a) 2 3 4 1 (b) 1 2 3 5
(c) 5 4 3 2 (d) 4 5 3 2

21.

Consider a weak base, BOH. Molar concentration of BOH that provides [OH]− of 1.5×10−3 M will be : Given: Kb(KOH)=1.5×10−5

Answer»

Consider a weak base, BOH. Molar concentration of BOH that provides [OH] of 1.5×103 M will be :
Given: Kb(KOH)=1.5×105

22.

24. Br2+NaOH --> NaBrO3+NaBr+H2O (Basic medium) Balance the equation in ion electron method in basic medium.

Answer» 24. Br2+NaOH --> NaBrO3+NaBr+H2O (Basic medium) Balance the equation in ion electron method in basic medium.
23.

Which one of the alkali metals, forms normal oxide M2O on heating in excess of air?

Answer»

Which one of the alkali metals, forms normal oxide M2O on heating in excess of air?



24.

Which of the following is correct for I.E.2? (Here, I.E.2=2nd ionization enthalpy)

Answer»

Which of the following is correct for I.E.2? (Here, I.E.2=2nd ionization enthalpy)

25.

Consider the following orbitals, 3s, 2px, 4dxy, 4dz2, 3dx2−y2, 3py, 4s, 4pz and find total number of orbital(s) having even number of nodal plane.

Answer» Consider the following orbitals, 3s, 2px, 4dxy, 4dz2, 3dx2y2, 3py, 4s, 4pz and find total number of orbital(s) having even number of nodal plane.
26.

Why CO is not used for the reduction of ZnO?

Answer» Why CO is not used for the reduction of ZnO?
27.

How many moles are there in 100 amu of He?

Answer» How many moles are there in 100 amu of He?
28.

What is the difference between erythro Vs meso ?Is erythro a type of meso compound?

Answer» What is the difference between erythro Vs meso ?Is erythro a type of meso compound?
29.

Dimensional formula for capacity

Answer»

Dimensional formula for capacity

30.

The cleansing action of soap can be explained on the basis of:

Answer»

The cleansing action of soap can be explained on the basis of:


31.

the chif ore of Zn is the sulphide . ZnS the ore is concentrated by the froth floating process and then heated in air to to convert ZnS to ZnO 2ZnS+3O2 ---70%--->2ZnO+ 2SO2 the mass of the znS required to produce 243g of ZnO is-

Answer» the chif ore of Zn is the sulphide . ZnS the ore is concentrated by the froth floating process and then heated in air to to convert ZnS to ZnO
2ZnS+3O2 ---70%--->2ZnO+ 2SO2
the mass of the znS required to produce 243g of ZnO is-
32.

1. How many metamers of formula C4H10are possible?(2) 3(4) 1(3) 4

Answer» 1. How many metamers of formula C4H10are possible?(2) 3(4) 1(3) 4
33.

Two moles of helium gas (γ=53) are initially at a temperature at 27∘C and occupy a volume of 20 litres. The gas is first expanded at constant pressure until the volume is doubled. It then undergoes adiabatic change until the temperature returns to its initial value. If total work done on the gas is -x kcal, then what is x?

Answer» Two moles of helium gas (γ=53) are initially at a temperature at 27C and occupy a volume of 20 litres. The gas is first expanded at constant pressure until the volume is doubled. It then undergoes adiabatic change until the temperature returns to its initial value. If total work done on the gas is -x kcal, then what is x?
34.

The two bulbs of volume 5 litre and 10 litre containing an ideal gas at 9 atm and 6 atm respectively are connected what is the final pressure in the two bulbs if the temperature remain constant. please give explanation with answer

Answer» The two bulbs of volume 5 litre and 10 litre containing an ideal gas at 9 atm and 6 atm respectively are connected what is the final pressure in the two bulbs if the temperature remain constant.
please give explanation with answer
35.

A metal M does not liberate hydrogen from acids but reacts with oxygen to give a black colour product. Identify M and black coloured product and also explain the reaction of M with oxygen.

Answer»

A metal M does not liberate hydrogen from acids but reacts with oxygen to give a black colour product. Identify M and black coloured product and also explain the reaction of M with oxygen.
36.

what is extended pauling scale of electronegativity?

Answer» what is extended pauling scale of electronegativity?
37.

Why are potassium and cesium, rather than lithium used in photoelectric cells?

Answer»


Why are potassium and cesium, rather than lithium used in
photoelectric cells?

38.

How many ways a bond between two atoms can cleave?One Two Three Four

Answer» How many ways a bond between two atoms can cleave?
One
Two
Three
Four
39.

Explain the nomenclature of the compound tert.butyl.chloride or 2- chloro 2- methyl propane

Answer» Explain the nomenclature of the compound tert.butyl.chloride or 2- chloro 2- methyl propane
40.

Find A and B.

Answer»

Find A and B.




41.

Which of the following complex compound is low spin, inner orbital, diamagnetic complex? (a) \lbrack Ni(NH_3)_6\rbrack Cl_{2 } (b) K_3\lbrack Fe(CN)_6\rbrack (c) K_2\lbrack PtCl_6\rbrack (d) \lbrack Cr(H_2O)_6\rbrack Cl_{

Answer» Which of the following complex compound is low spin, inner orbital, diamagnetic complex? (a) \lbrack Ni(NH_3)_6\rbrack Cl_{2 } (b) K_3\lbrack Fe(CN)_6\rbrack (c) K_2\lbrack PtCl_6\rbrack (d) \lbrack Cr(H_2O)_6\rbrack Cl_{
42.

96 How many dichloro products are formed in the reaction ? C5H10+Cl2

Answer» 96 How many dichloro products are formed in the reaction ? C5H10+Cl2
43.

The solubility of AgCl in water at 298 K is 1.06×10−5 mole per litre. Calculate its solubility product at this temperature.

Answer»

The solubility of AgCl in water at 298 K is 1.06×105 mole per litre. Calculate its solubility product at this temperature.

44.

38. Among the properties (a) reducing (b) oxidising (c) complexing,the set of properties shown by CN- ion towards metal species is

Answer» 38. Among the properties (a) reducing (b) oxidising (c) complexing,the set of properties shown by CN- ion towards metal species is
45.

If fundamental period of f(x)=|sec4πx|+|cosec 6πx| is P, then coefficient of x−24P in the expansion (x+bx3)32P is

Answer»

If fundamental period of f(x)=|sec4πx|+|cosec 6πx| is P, then coefficient of x24P in the expansion (x+bx3)32P is

46.

40. How to convert benzaldehyde to benzophenone not in more than 2 steps?

Answer» 40. How to convert benzaldehyde to benzophenone not in more than 2 steps?
47.

Grignard reagent behave as

Answer»

Grignard reagent behave as

48.

When KMnO4 acts as an oxidising agent and ultimately forms [MnO4]−2, MnO2, Mn2O3, Mn+2 then the number of electrons transferred in each case respectively is

Answer»

When KMnO4 acts as an oxidising agent and ultimately forms [MnO4]2, MnO2, Mn2O3, Mn+2 then the number of electrons transferred in each case respectively is


49.

37. Calculate percentage of carbon in ethanol??

Answer» 37. Calculate percentage of carbon in ethanol??
50.

In equivalent weight why Water molecule is not considered ?

Answer» In equivalent weight why Water molecule is not considered ?