Explore topic-wise InterviewSolutions in Current Affairs.

This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.

1.

which complex has lower splitting energy than pairing energy:-1)\lbrack RhF6\rbrack3-,2)\lbrack Fe(NH3)6\rbrack2+,3)\lbrack Co(OX)3\rbrack3-,4)\lbrack Ir(NH3)6\rbrack3+

Answer» which complex has lower splitting energy than pairing energy:-1)\lbrack RhF6\rbrack3-,2)\lbrack Fe(NH3)6\rbrack2+,3)\lbrack Co(OX)3\rbrack3-,4)\lbrack Ir(NH3)6\rbrack3+
2.

40K isotope of potassium has a half life of 1.37×109 years and decays to an isotope of argon which is stable. In a particular sample of moon rock, the ratio of potassium atoms to argon atoms was found to be 1:7. The age of the rock, assuming that originally there was no argon present, is

Answer» 40K isotope of potassium has a half life of 1.37×109 years and decays to an isotope of argon which is stable. In a particular sample of moon rock, the ratio of potassium atoms to argon atoms was found to be 1:7. The age of the rock, assuming that originally there was no argon present, is
3.

Ozone layer is present in

Answer»

Ozone layer is present in


4.

find the principal quantum number for the electron having the de broglie wavelength in an orbit of hydrogen atom is 10 raise to minus 9 m.

Answer» find the principal quantum number for the electron having the de broglie wavelength in an orbit of hydrogen atom is 10 raise to minus 9 m.
5.

Which of the following anions is most easily polarized?

Answer»

Which of the following anions is most easily polarized?



6.

In a crystalline solid, atoms of X form fcc packing andthe atoms of Y occupy all octahedral voids. If all theatoms along one body diagonal are removed then the simplest formula of the crystalline solid will be:

Answer» In a crystalline solid, atoms of X form fcc packing andthe atoms of Y occupy all octahedral voids. If all theatoms along one body diagonal are removed then the simplest formula of the crystalline solid will be:
7.

3. What is the hybridisation of central atom in O3?

Answer» 3. What is the hybridisation of central atom in O3?
8.

Calculate the vapour pressure of water at 27∘C, when the aqueous tension at 77∘C is 314.1 torr. (Given: Heat of vapourisation of water is nearly 40 kJ/mol) [e−2.3=0.1]

Answer»

Calculate the vapour pressure of water at 27C, when the aqueous tension at 77C is 314.1 torr. (Given: Heat of vapourisation of water is nearly 40 kJ/mol) [e2.3=0.1]

9.

4.9gram of H2SO4 react with how much amount of NaOH for complete reaction

Answer» 4.9gram of H2SO4 react with how much amount of NaOH for complete reaction
10.

3. How to convert Ethanal to 2-hydroxy-3-butenoic acid?

Answer» 3. How to convert Ethanal to 2-hydroxy-3-butenoic acid?
11.

Why does the high hydration enthalpy account for high reducing power?

Answer» Why does the high hydration enthalpy account for high reducing power?
12.

The formula of cyclic silicate in which 6 tetrahedra are arranged cyclically is:

Answer»

The formula of cyclic silicate in which 6 tetrahedra are arranged cyclically is:

13.

Which of the following is correct option for free expansion of an ideal gas under adiabatic condition?

Answer»

Which of the following is correct option for free expansion of an ideal gas under adiabatic condition?


14.

Calculate the specific rotation of invert sugar given that [α]D=+52.7o for D-glucose and [α]D=−92.4o for D-fructose.

Answer»

Calculate the specific rotation of invert sugar given that [α]D=+52.7o for D-glucose and [α]D=92.4o for D-fructose.

15.

65 How to convert propene to propanone

Answer» 65 How to convert propene to propanone
16.

In sets a−d, only one of the set is incorrect regarding basic strength. Select it:

Answer»

In sets ad, only one of the set is incorrect regarding basic strength. Select it:

17.

The pressure of h2 required to make the potential of h2 electrode zero in pure water at 298k is-

Answer» The pressure of h2 required to make the potential of h2 electrode zero in pure water at 298k is-
18.

Which of the following is most basic in nature?

Answer»

Which of the following is most basic in nature?

19.

23.Equimolar concentration of H2 and I2 are heated to equilibrium in a 2L flask. At equilibrium the forward and backward rate constants are found to be equal. What percent of initial concentration of H2 has reacted at equilibrium?

Answer» 23.Equimolar concentration of H2 and I2 are heated to equilibrium in a 2L flask. At equilibrium the forward and backward rate constants are found to be equal. What percent of initial concentration of H2 has reacted at equilibrium?
20.

In the CO molecule , is there a coordinate bond in which electrons are given by the O atom? There are three bonds, 2 covalent and 1 coordinate bond. Am I right ?

Answer» In the CO molecule , is there a coordinate bond in which electrons are given by the O atom?
There are three bonds, 2 covalent and 1 coordinate bond.
Am I right ?
21.

One cationic complex has two isomers A and B. Each has one Co3+, five NH3, one Br−, and one SO2−4 stoi-chiometrically. A gives white ppt with BaCl2 whle B give yellow ppt with AgNO3.Complexes A and B have similarity in which type of isomerism?

Answer»

One cationic complex has two isomers A and B. Each has one Co3+, five NH3, one Br, and one SO24 stoi-chiometrically. A gives white ppt with BaCl2 whle B give yellow ppt with AgNO3.

Complexes A and B have similarity in which type of isomerism?



22.

Why is cu+2 is more stable than cu+ even after its d9 orbital

Answer»

Why is cu+2 is more stable than cu+ even after its d9 orbital

23.

Diazomethane reacts with acid chlorides followed by Ag2O and hydrolysis to produce 1) carboxylic acid 2) alcohol 3) amine 4) imines

Answer» Diazomethane reacts with acid chlorides followed by Ag2O and hydrolysis to produce 1) carboxylic acid 2) alcohol 3) amine 4) imines
24.

Indicate the types ofisomerism exhibited by the following complexes anddraw the structures forthese isomers: K[Cr(H2O)2(C2O4)2 [Co(en)3]Cl3 [Co(NH3)5(NO2)](NO3)2 [Pt(NH3)(H2O)Cl2]

Answer»

Indicate the types of
isomerism exhibited by the following complexes and


draw the structures for
these isomers:



  1. K[Cr(H2O)2(C2O4)2


  2. [Co(en)3]Cl3


  3. [Co(NH3)5(NO2)](NO3)2


  4. [Pt(NH3)(H2O)Cl2]


25.

Relative error in the measurement of the side of the cube is 0.027.relative error in the measurement of its volume is

Answer» Relative error in the measurement of the side of the cube is 0.027.relative error in the measurement of its volume is
26.

20.2 litres of a mixture of nitrous and nitric oxide at STP have a mean molecular weight of 39.8 Watt volume of Nitrogen measured at STP could be obtained when the mixture has been passed over Red Hot copper

Answer» 20.2 litres of a mixture of nitrous and nitric oxide at STP have a mean molecular weight of 39.8 Watt volume of Nitrogen measured at STP could be obtained when the mixture has been passed over Red Hot copper
27.

What is the difference between neutral equilibrium and static equilibrium?

Answer» What is the difference between neutral equilibrium and static equilibrium?
28.

What is asemiconductor? Describe the two main types of semiconductors andcontrast their conduction mechanism.

Answer»

What is a
semiconductor? Describe the two main types of semiconductors and
contrast their conduction mechanism.

29.

The carbon-oxygen bond in phenol is slightly stronger than that in methanol. Why ?

Answer»

The carbon-oxygen bond in phenol is slightly stronger than that in methanol. Why ?

30.

In which of the following compounds does hydrogen bonding occur?

Answer»

In which of the following compounds does hydrogen bonding occur?


31.

what is agro chemicals and thire effects in detail

Answer» what is agro chemicals and thire effects in detail
32.

17. What is concept of homolytic bond fission and hetrolytic bond fission? What is the significance of this type of bond fission?

Answer» 17. What is concept of homolytic bond fission and hetrolytic bond fission? What is the significance of this type of bond fission?
33.

How to pridict by analsis a given reaction weather a reaction is unimolecular,binolecular or trimolecular

Answer» How to pridict by analsis a given reaction weather a reaction is unimolecular,binolecular or trimolecular
34.

Which of the following is the radioactive isotope of hydrogen?

Answer»

Which of the following is the radioactive isotope of hydrogen?



35.

43. Calculate the rms speed of an ideal monoatomic gas having molecular weight 28gm/mol at 27 degree Celsius. If the specific heats at constant pressure and volume are respectively 6.3 J/mol K and 3.14 J/mol K respectively.

Answer» 43. Calculate the rms speed of an ideal monoatomic gas having molecular weight 28gm/mol at 27 degree Celsius. If the specific heats at constant pressure and volume are respectively 6.3 J/mol K and 3.14 J/mol K respectively.
36.

Assume the EAN of the metal in the complex [Fe(C2O4)3]3− is 7X. Find the value of X.

Answer» Assume the EAN of the metal in the complex [Fe(C2O4)3]3 is 7X. Find the value of X.


37.

Consider the following liquid-vapour equilibriumLiquid⇌VapourWhich of the following relations is correct ?

Answer»

Consider the following liquid-vapour equilibrium

LiquidVapour

Which of the following relations is correct ?

38.

Match List I with List II and select the correct answer using the codes given below the listsList I (Compound) List II (Oxidation state of N)(A) NO2 (1) +5(B) HNO (2) -3(C) NH3 (3) +4(D) N2O5 (4) +1

Answer»

Match List I with List II and select the correct answer using the codes given below the lists


List I (Compound) List II (Oxidation state of N)


(A) NO2 (1) +5


(B) HNO (2) -3


(C) NH3 (3) +4


(D) N2O5 (4) +1



39.

Which of the following are trans?

Answer»

Which of the following are trans?



40.

What is meant by activating or deactivating a benzene ring?

Answer»

What is meant by activating or deactivating a benzene ring?

41.

Stability order for CCl​​​​4 ​​​​>SiCl4 >GeCl4 >SnCl4 >PbCl4 bt we know that carbon have no vacant d-orbital than how it form bond with 4Chlorine stom and bocomes most stable ?

Answer»

Stability order for CCl​​​​4 ​​​​>SiCl4 >GeCl4 >SnCl4 >PbCl4 bt we know that carbon have no vacant d-orbital than how it form bond with 4Chlorine stom and bocomes most stable ?

42.

Find the minimum no. of carbon atoms in aldehyde required to produce stereo isomeric aldol product.___

Answer» Find the minimum no. of carbon atoms in aldehyde required to produce stereo isomeric aldol product.___
43.

An electron and a proton are in a uniform electric field,the ratio of their accelerations will be

Answer» An electron and a proton are in a uniform electric field,the ratio of their accelerations will be
44.

32 A compound formed of element A present at alternate corners ,element B present at alternate face centres and element C present at the body centre of cubic structure. The formula of compound is?

Answer» 32 A compound formed of element A present at alternate corners ,element B present at alternate face centres and element C present at the body centre of cubic structure. The formula of compound is?
45.

The equilibrium constant for the reaction A2+B2⇌2AB is 20 at 500 K .The equilibrium constant for the reaction 2AB(g)⇌A2(g)+B2(g) would be

Answer»

The equilibrium constant for the reaction A2+B22AB is 20 at 500 K .The equilibrium constant for the reaction 2AB(g)A2(g)+B2(g) would be


46.

CrO5+H2SO4→Cr2(SO4)3+H2O+O2,In the above reaction how many moles of O2 will be liberated from one mole of CrO5?

Answer» CrO5+H2SO4Cr2(SO4)3+H2O+O2,

In the above reaction how many moles of O2 will be liberated from one mole of CrO5?
47.

A hole diffuses from the P-side to the N-side in a P-N junction. This means that-

Answer»

A hole diffuses from the P-side to the N-side in a P-N junction. This means that-


48.

In which of the following ionization processes, the bond order has increased and the magnetic behaviour has changed ?

Answer»

In which of the following ionization processes, the bond order has increased and the magnetic behaviour has changed ?

49.

Which one of the following compounds would be easily oxidised by K2Cr207 in dil. H2SO4 1)CH3OH 2)(CH3)3COH 3)CH3CH2OH 4CH3CHO

Answer» Which one of the following compounds would be easily oxidised by K2Cr207 in dil. H2SO4 1)CH3OH 2)(CH3)3COH 3)CH3CH2OH 4CH3CHO
50.

67. The time taken for a first order reaction, to reduce the intial concentration by a factor of 1/4 is 10 minute. If the concentration is reduced to 1/16 then the time required is.

Answer» 67. The time taken for a first order reaction, to reduce the intial concentration by a factor of 1/4 is 10 minute. If the concentration is reduced to 1/16 then the time required is.