Explore topic-wise InterviewSolutions in Current Affairs.

This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.

1.

Calculate the concentration i.e., %(w/v) of the solution (BaCl2 in H2O). If 10 g of BaCl2 is dissolved in 90 g of water. The density of the solution is 1.09 g/mL.

Answer»

Calculate the concentration i.e., %(w/v) of the solution (BaCl2 in H2O). If 10 g of BaCl2 is dissolved in 90 g of water. The density of the solution is 1.09 g/mL.

2.

what is kuchervous reaction

Answer» what is kuchervous reaction
3.

10 g of ice at 0 ice at 00C is mixed with m mass of water at 500 C. What is minimum value of m so that ice melts completely?( L = 80 cal/g and s = 1 cal/ g-0C)

Answer»

10 g of ice at 0 ice at 00C is mixed with m mass of water at 500 C. What is minimum value of m so that ice melts completely?( L = 80 cal/g and s = 1 cal/ g-0C)


4.

Two equal negative charges , -q are fixed at points (0,-a) , (0,a) on y axis . A positive charge Q is released from rest at point (2a,0) on the X axis . The charge Q will1). Execute simple harmonic motion2). Move to the origin and remains at rest3). Move to infinity4). Execute oscillatory but not simple harmonic motion

Answer» Two equal negative charges , -q are fixed at points (0,-a) , (0,a) on y axis . A positive charge Q is released from rest at point (2a,0) on the X axis . The charge Q will

1). Execute simple harmonic motion
2). Move to the origin and remains at rest
3). Move to infinity
4). Execute oscillatory but not simple harmonic motion
5.

Ion with highest polarizing power is ______.

Answer»

Ion with highest polarizing power is ______.



6.

Which will be adsorbed more readily on the surface of charcoal and why :NH3or CO2

Answer» Which will be adsorbed more readily on the surface of charcoal and why :NH3or CO2
7.

Carbon carbon double bond is considered a stereocenter ; is C-C "TRIPLE BOND" also a stereocenter ?

Answer» Carbon carbon double bond is considered a stereocenter ; is C-C "TRIPLE BOND" also a stereocenter ?
8.

How many primary, secondary, tertiary and quaternary carbons are present in the following hydrocarbon CH3−CH(CH3)−C(CH3)2−CH2−CH(CH3)−CH2−CH3

Answer»

How many primary, secondary, tertiary and quaternary carbons are present in the following hydrocarbon

CH3CH(CH3)C(CH3)2CH2CH(CH3)CH2CH3


9.

Que1.which has maximum equilibrium molarity of sodium ion in 0.1 M aqueous solution (assume 100 %ionization) (a)sodium oxalate (b) Sodium orthophosphate (c) Sodium metaphosphate (d) Sodium bicarbonate

Answer» Que1.which has maximum equilibrium molarity of sodium ion in 0.1 M aqueous solution (assume 100 %ionization) (a)sodium oxalate (b) Sodium orthophosphate (c) Sodium metaphosphate (d) Sodium bicarbonate
10.

ntIf the pressure of H2 gas is increased from 1 atm to 100 atm keeping hydrgen ion concentration constant at 1M find voltage of hydrogen half cell at 25^°C A 0.0295 V B -0.0295 V c -0.059 v D 0.059Vn

Answer» ntIf the pressure of H2 gas is increased from 1 atm to 100 atm keeping hydrgen ion concentration constant at 1M find voltage of hydrogen half cell at 25^°C A 0.0295 V B -0.0295 V c -0.059 v D 0.059Vn
11.

Three infinitely long charge sheets are placed as shown in figure. The electric field at point P is

Answer» Three infinitely long charge sheets are placed as shown in figure. The electric field at point P is

12.

How many spherical nodes are there in 4s – sub-shell?

Answer»

How many spherical nodes are there in 4s – sub-shell?

13.

Theneutron separation energy is defined as the energy required to removea neutron from the nucleus. Obtain the neutron separation energies ofthe nuclei andfromthe following data:=39.962591 u)= 40.962278 u=25.986895 u)= 26.981541 u

Answer»

The
neutron separation energy is defined as the energy required to remove
a neutron from the nucleus. Obtain the neutron separation energies of
the nuclei

and

from
the following data:


=
39.962591 u


)
= 40.962278 u


=
25.986895 u


)
= 26.981541 u

14.

Arrange the elements of group 13 in the increasing order of ionisation potential. Do provide an explanation for the exceptional Trend.

Answer» Arrange the elements of group 13 in the increasing order of ionisation potential. Do provide an explanation for the exceptional Trend.
15.

A solution contains 2 moles of sugar. What volume of solution give rise to an osmotic pressure of 1 atm at 27∘C?

Answer»

A solution contains 2 moles of sugar. What volume of solution give rise to an osmotic pressure of 1 atm at 27C?


16.

1 mole of diatomic element X2 contains 34 and 40 moles of electron and neutron respectively. The isotopic formula of the element is

Answer»

1 mole of diatomic element X2 contains 34 and 40 moles of electron and neutron respectively. The isotopic formula of the element is


17.

What is equivalent mass. What is oleum

Answer» What is equivalent mass. What is oleum
18.

a sample of a radioactive substance undergo 80% decomposition in 345 minutes its half life is

Answer» a sample of a radioactive substance undergo 80% decomposition in 345 minutes its half life is
19.

The electron affinity values (in kJ mol−1) of three halogens x, y and z are respectively -349, -333 and -325. Then x, y and z are respectively

Answer»

The electron affinity values (in kJ mol1) of three halogens x, y and z are respectively -349, -333 and -325. Then x, y and z are respectively

20.

Can you use soaps and detergents to check the hardness of water ?

Answer»

Can you use soaps and detergents to check the hardness of water ?

21.

A regenerative Brayton refrigeration working between pressure limit of 1 and 3 bar. The temperature and pressure of air at inlet of compressor is 270 K and 1 bar respectively. Compressed air enters regenerative heat exchanger at temperature of 310 K and exit at a temperature of 280 K. The refrigeration effect is 30 kJ/kg. The effectiveness of heat exchanger is ____.Assume compression and expansion are isentropic(Take γ for air = 1.4 and cp for air = 1.005 kJ/kgK)(Correct upto 3 decimal place)0.397

Answer» A regenerative Brayton refrigeration working between pressure limit of 1 and 3 bar. The temperature and pressure of air at inlet of compressor is 270 K and 1 bar respectively. Compressed air enters regenerative heat exchanger at temperature of 310 K and exit at a temperature of 280 K. The refrigeration effect is 30 kJ/kg. The effectiveness of heat exchanger is ____.

Assume compression and expansion are isentropic

(Take γ for air = 1.4 and cp for air = 1.005 kJ/kgK)

(Correct upto 3 decimal place)
  1. 0.397
22.

calculate the mass of MnO2 needed to produce 1.78 litres of chlorine gas at STP according to the equation MnO2 + 4HCl → MnCl2 + 2H2O + Cl2 [H = 1, Cl = 35.5, Mn = 54.9]

Answer»

calculate the mass of MnO2 needed to produce 1.78 litres of chlorine gas at STP according to the equation
MnO2 + 4HCl MnCl2 + 2H2O + Cl2

[H = 1, Cl = 35.5, Mn = 54.9]


23.

If the mole fraction of zinc chloride in water is 0.3 what is molality of the solution?

Answer» If the mole fraction of zinc chloride in water is 0.3 what is molality of the solution?
24.

59. What is controlled chain reaction and uncontrolled chain reaction explain by process

Answer» 59. What is controlled chain reaction and uncontrolled chain reaction explain by process
25.

For the reaction A->B, doubling the concentration of both the reactants increases the reaction rate by 8 times and doubling the concentration of only B simply doubles the reaction rate. Find the rate law for the above equation.

Answer» For the reaction A->B, doubling the concentration of both the reactants increases the reaction rate by 8 times and doubling the concentration of only B simply doubles the reaction rate. Find the rate law for the above equation.
26.

The Azimuthal quantum number for the valence electrons of Ga+ ion is . (Atomic number of Ga = 31)

Answer» The Azimuthal quantum number for the valence electrons of Ga+ ion is . (Atomic number of Ga = 31)
27.

Why sucrose is called invert sugar

Answer» Why sucrose is called invert sugar
28.

26. Heat of dissociation of acetic acid is 0.005 kcal per g hence enthalpy change when 1 mol of calcium hydroxide is completely neutrilised is?

Answer» 26. Heat of dissociation of acetic acid is 0.005 kcal per g hence enthalpy change when 1 mol of calcium hydroxide is completely neutrilised is?
29.

During electrolysis, Al+3 molecules are formed at cathode and O2 is formed at anode. Rectify the error in the above statement.

Answer»

During electrolysis, Al+3 molecules are formed at cathode and O2 is formed at anode.

Rectify the error in the above statement.


30.

2 moles of an ideal gas are compressed isothermally reversibly from a pressure of 10 atm to 25 atm then find the free energy change

Answer» 2 moles of an ideal gas are compressed isothermally reversibly from a pressure of 10 atm to 25 atm then find the free energy change
31.

IS THE FOLLOWING REACTION CORRECT -CL2+H2O-- 2HCL +\lbrack O

Answer» IS THE FOLLOWING REACTION CORRECT -CL2+H2O-- 2HCL +\lbrack O
32.

In a face centerd lattice of X and Y, X atoms are present at the corners while Y atoms are at the face centers. If two X atoms are removed from the corners, the formula of the compound would be:

Answer»

In a face centerd lattice of X and Y, X atoms are present at the corners while Y atoms are at the face centers. If two X atoms are removed from the corners, the formula of the compound would be:

33.

Chargaff's rule states that in an organism [CBSE PMT 2003]

Answer»

Chargaff's rule states that in an organism

[CBSE PMT 2003]


34.

40. When a metal is burnt in presence of oxygen, its weight is increased by 25%. The equivalent weight of the metal will be

Answer» 40. When a metal is burnt in presence of oxygen, its weight is increased by 25%. The equivalent weight of the metal will be
35.

52.In carbylamine reaction (1) The nucleophile is RNH2 and electrophile is CCl2 (2) The nucleophile is primary amine and electrophile is CCl3 negative (3) The nucleophile is CCl3 negative and the electrophile is primary amine (4) The attacking reagent is electrophile

Answer» 52.In carbylamine reaction (1) The nucleophile is RNH2 and electrophile is CCl2 (2) The nucleophile is primary amine and electrophile is CCl3 negative (3) The nucleophile is CCl3 negative and the electrophile is primary amine (4) The attacking reagent is electrophile
36.

CHOCHO (glyoxal) react with 50% NaOH solution to give what as product

Answer» CHOCHO (glyoxal) react with 50% NaOH solution to give what as product
37.

Which substance cannot be reduced by H2O2

Answer»

Which substance cannot be reduced by H2O2


38.

1 mole of a diatomic gas present in a 10 L vessel at a certain temperature exerts a pressure of 0.96 atm. Under similar conditions, an ideal gas exerts 1.0 atm pressure. If the volume of a gas molecule is negligible, then find the value of the van der Waals’ constant ‘a′ (in atm L2/mol2).

Answer» 1 mole of a diatomic gas present in a 10 L vessel at a certain temperature exerts a pressure of 0.96 atm. Under similar conditions, an ideal gas exerts 1.0 atm pressure. If the volume of a gas molecule is negligible, then find the value of the van der Waals’ constant a (in atm L2/mol2).
39.

what is term of electron microscope

Answer» what is term of electron microscope
40.

According to Kohlrausch law, the limiting value of molar conductivity of an strong electrolyte A2B is given by:

Answer»

According to Kohlrausch law, the limiting value of molar conductivity of an strong electrolyte A2B is given by:

41.

What is hydrogen spectrum

Answer» What is hydrogen spectrum
42.

Lanthanoids are :

Answer»

Lanthanoids are :


43.

Is [Zn(gly)2] optically active?

Answer» Is [Zn(gly)2] optically active?
44.

What hybrid orbitals will form the following compound H3C-CH=CH-CH2-CH3

Answer»

What hybrid orbitals will form the following compound H3C-CH=CH-CH2-CH3


45.

10. estimate the minimum potential difference needed to reduce Al2O3 at 500 C . the free energy change for decomposition reaction 2/3 Al2O3 -> 4/3 Al + O2 is 960KJ

Answer» 10. estimate the minimum potential difference needed to reduce Al2O3 at 500 C . the free energy change for decomposition reaction 2/3 Al2O3 -> 4/3 Al + O2 is 960KJ
46.

In the question arrange the compounds in increasing order of rate of reaction towards nucleophilic substitution. (a) (iii) < (ii) < (i) (b) (ii) < (iii) < (i) (c) (i) < (iii) < (ii) (d) (i) < (ii) < (iii)

Answer»

In the question arrange the compounds in increasing order of rate of reaction towards nucleophilic substitution.

(a) (iii) < (ii) < (i) (b) (ii) < (iii) < (i)

(c) (i) < (iii) < (ii) (d) (i) < (ii) < (iii)

47.

14. Number of tetrahedral void(s) per atom present in cubic closed pack structure is: a) 2 b) 4 c) 8 d) 1

Answer» 14. Number of tetrahedral void(s) per atom present in cubic closed pack structure is: a) 2 b) 4 c) 8 d) 1
48.

the molecule that has linear structure isA)CO2B)NO2C)SO2D)SIO2

Answer» the molecule that has linear structure is
A)CO2
B)NO2
C)SO2
D)SIO2
49.

What are the limitations of quantum mechanical model of atom?Explain about g orbital

Answer» What are the limitations of quantum mechanical model of atom?
Explain about g orbital
50.

The relative Lewis acid strengths of boron trihalides are in the order:

Answer»

The relative Lewis acid strengths of boron trihalides are in the order: