Saved Bookmarks
This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.
| 1. |
if radius of the 13Al27 nucleus is taken to be Ral then the radius of 53 Te 125 nucleus is nearly |
| Answer» if radius of the 13Al27 nucleus is taken to be Ral then the radius of 53 Te 125 nucleus is nearly | |
| 2. |
The 71st electron of an element X with an atomic number of 71 enters into the orbital: |
|
Answer» The 71st electron of an element X with an atomic number of 71 enters into the orbital: |
|
| 3. |
Acetophenone when reacted with a base,C2HONa, yields a stable compound which has thestructure?\lbrack AIPMT (Prelims)-2008\rbrack |
| Answer» Acetophenone when reacted with a base,C2HONa, yields a stable compound which has thestructure?\lbrack AIPMT (Prelims)-2008\rbrack | |
| 4. |
RCONH2 undergo acid catalysed hydrolysis to give: |
|
Answer» RCONH2 undergo acid catalysed hydrolysis to give: |
|
| 5. |
The folowing reaction 2Br^{- } + Cl_2 → 2cl^- + Br_2 is used for the commercial preparation of bromine from its salts. suppose we have 50 ml of a 0.080 M solution of NaBr. what volume of a 0.050 M solution of Cl_2 |
| Answer» The folowing reaction 2Br^{- } + Cl_2 → 2cl^- + Br_2 is used for the commercial preparation of bromine from its salts. suppose we have 50 ml of a 0.080 M solution of NaBr. what volume of a 0.050 M solution of Cl_2 | |
| 6. |
What do you mean by resonance in carbon? |
|
Answer» What do you mean by resonance in carbon? |
|
| 7. |
How to find R and S configuration in lactic acid , explain it with line structure? |
| Answer» How to find R and S configuration in lactic acid , explain it with line structure? | |
| 8. |
Describe Boyle's law in complete detail. |
| Answer» Describe Boyle's law in complete detail. | |
| 9. |
Howmany mL of 0.1 M HCl are required to react completely with 1 gmixture of Na2CO3and NaHCO3containing equimolar amounts of both? |
|
Answer» How |
|
| 10. |
Why fluorine Exhibit only negative Oxidation state and Cs show only positive Oxidation State? |
|
Answer» Why fluorine Exhibit only negative Oxidation state and Cs show only positive Oxidation State? |
|
| 11. |
10. What is parts per million and parts per billion? |
| Answer» 10. What is parts per million and parts per billion? | |
| 12. |
How many moles of electrones weigh one kilogram. Do it by unitary method . |
| Answer» How many moles of electrones weigh one kilogram. Do it by unitary method . | |
| 13. |
Is shell and orbital the same thing |
| Answer» Is shell and orbital the same thing | |
| 14. |
What is the definition of chemical equilibrium and ionic equilibrium? |
| Answer» What is the definition of chemical equilibrium and ionic equilibrium? | |
| 15. |
The IUPAC name of |
Answer» The IUPAC name of  |
|
| 16. |
The given molecule is used as an: |
|
Answer» The given molecule is used as an: |
|
| 17. |
Which of the following solutions will have minimum vapour pressurea] 1N NaCl b] 1 N MgCl2c] 1 N AlCl3 d] 1 M Sucrose |
|
Answer» Which of the following solutions will have minimum vapour pressure a] 1N NaCl b] 1 N MgCl2 c] 1 N AlCl3 d] 1 M Sucrose |
|
| 18. |
In Nessler’s reagent for detection of NH3, the active species is |
|
Answer» In Nessler’s reagent for detection of NH3, the active species is |
|
| 19. |
Which of the following is the correct graph for a second order reaction?Here,t12 is the half life period.(Concentration)i is the intial concentration of the reactant. |
|
Answer» Which of the following is the correct graph for a second order reaction? |
|
| 20. |
Calculate moles of KMnO4 required for complete oxidation of 2 moles of KHC2O4.2H2C2O4 under acidic condition. |
|
Answer» Calculate moles of KMnO4 required for complete oxidation of 2 moles of KHC2O4.2H2C2O4 under acidic condition. |
|
| 21. |
By sucking through a straw,a boy can reduce the pressure in his lungs to 750mm of Hg.Using a straw he can drink water from a maximum depth.(density of mercury=13.6kg/m) 13.6cm 1.36cm 10cm 0.13cm |
| Answer» By sucking through a straw,a boy can reduce the pressure in his lungs to 750mm of Hg.Using a straw he can drink water from a maximum depth.(density of mercury=13.6kg/m) 13.6cm 1.36cm 10cm 0.13cm | |
| 22. |
An acid-base indicator HIn differs in colour from its conjugate base [IN-]. The human eye is sensitive to colour differences { only when the ratio \lbrack\operatorname{In^-\rbrack/\lbrack HIn\rbrack is greaterthan 10 or smaller than 0.1 . What should be the minimum change in PH of the soln to observe a complete colour change? a=1×10^{-5 |
| Answer» An acid-base indicator HIn differs in colour from its conjugate base [IN-]. The human eye is sensitive to colour differences { only when the ratio \lbrack\operatorname{In^-\rbrack/\lbrack HIn\rbrack is greaterthan 10 or smaller than 0.1 . What should be the minimum change in PH of the soln to observe a complete colour change? a=1×10^{-5 | |
| 23. |
47. if an element X has atomicnumber 27 deduce the four quantum number values for the 20th electron of element X. |
| Answer» 47. if an element X has atomicnumber 27 deduce the four quantum number values for the 20th electron of element X. | |
| 24. |
What will be the group and period of an element having atomic no. 83 in modern periodic table? |
| Answer» What will be the group and period of an element having atomic no. 83 in modern periodic table? | |
| 25. |
why do carbocations have sp2 hybridisation? |
| Answer» why do carbocations have sp2 hybridisation? | |
| 26. |
35. What is the product of the reaction? CH3-CHBr2------------->1alc. KOH 2 NaNH2 |
| Answer» 35. What is the product of the reaction? CH3-CHBr2------------->1alc. KOH 2 NaNH2 | |
| 27. |
Which of the following compounds will form a significant amount of meta product during mono-nitration with nitrating mixture? |
|
Answer» Which of the following compounds will form a |
|
| 28. |
Q. The density of mercury is 13.6 g/mL. The diameter of an atom of mercury assuming that each atom is occupying a cube of edge length equal to the diameter of the mercury atom is approximately (in Angstrom):(a) 3.01(b) 2.54(c) 0.29(d) 2.91 |
|
Answer» Q. The density of mercury is 13.6 g/mL. The diameter of an atom of mercury assuming that each atom is occupying a cube of edge length equal to the diameter of the mercury atom is approximately (in Angstrom): (a) 3.01 (b) 2.54 (c) 0.29 (d) 2.91 |
|
| 29. |
What will be the boiling point of 0.1 m Urea(aq) solution? (Kb=0.52 K Kg/mol) |
| Answer» What will be the boiling point of 0.1 m Urea(aq) solution? (Kb=0.52 K Kg/mol) | |
| 30. |
An ideal gas expands according to the new law P^2V= constant the internal energy of the gas 1)increases continuously 2)decreases continuously 3)remain constant 4)first increases and then decreases |
| Answer» An ideal gas expands according to the new law P^2V= constant the internal energy of the gas 1)increases continuously 2)decreases continuously 3)remain constant 4)first increases and then decreases | |
| 31. |
find the value of x if 2sinx/2=√3 |
| Answer» find the value of x if 2sinx/2=√3 | |
| 32. |
How to know if a molecule is homonuclear diatomic molecule? |
| Answer» How to know if a molecule is homonuclear diatomic molecule? | |
| 33. |
Choose the correct order for heat of combustion of the following compounds: |
|
Answer» Choose the correct order for heat of combustion of the following compounds: |
|
| 34. |
A 12 gm sample of CH4 and C2H4 yielded 35.2gm of CO2on complete oxidation.what was the average molar mass of the original sample?? |
| Answer» A 12 gm sample of CH4 and C2H4 yielded 35.2gm of CO2on complete oxidation.what was the average molar mass of the original sample?? | |
| 35. |
A(g)+B(g)⇋C(g)In the above reaction, Kp is found to be 4 atm−1 at 27∘C. Find Kc for the given reaction.(Given: R=0.0821 L atm K−1 mol−1) |
|
Answer» A(g)+B(g)⇋C(g) In the above reaction, Kp is found to be 4 atm−1 at 27∘C. Find Kc for the given reaction. (Given: R=0.0821 L atm K−1 mol−1) |
|
| 36. |
Why is it that Carbon(C) is always written in the central position in Lewis Dot Structures and Bonding diagrams? Is it only in case of organic chemistry? |
| Answer» Why is it that Carbon(C) is always written in the central position in Lewis Dot Structures and Bonding diagrams? Is it only in case of organic chemistry? | |
| 37. |
Classify each of the following on the basis of their atomicity.(a) O2(b) CO2(c) H2O(d) C2H6(e) P4(f) H2O2(g) P4O10(h) O3(i) HCl(j) CCl4(k) He(l) Ag |
|
Answer» Classify each of the following on the basis of their atomicity. (a) O2 (b) CO2 (c) H2O (d) C2H6 (e) P4 (f) H2O2 (g) P4O10 (h) O3 (i) HCl (j) CCl4 (k) He (l) Ag |
|
| 38. |
A and B combinescto form three compound AB AB2 AB3. In 3rd compound 32g of A combined to form 84g B. In 2nd compound 16g of A will combine to form how many grams of B. |
| Answer» A and B combinescto form three compound AB AB2 AB3. In 3rd compound 32g of A combined to form 84g B. In 2nd compound 16g of A will combine to form how many grams of B. | |
| 39. |
How is sodium chloride different from its constituent elements? |
|
Answer» How is sodium chloride different from its constituent elements? |
|
| 40. |
66. Why formation ionic compound require low ionisation enthalpy and high electron gain enthalpy and high lattice enthalpy ? |
| Answer» 66. Why formation ionic compound require low ionisation enthalpy and high electron gain enthalpy and high lattice enthalpy ? | |
| 41. |
What is exchange energy and how does it help increase the stability? |
| Answer» What is exchange energy and how does it help increase the stability? | |
| 42. |
The Increasing Order of acidic Strength of the following is |
|
Answer» The Increasing Order of acidic Strength of the following is
|
|
| 43. |
Aniline behaves as a weak base. When 0.1 M, 50 mL solution of aniline was mixed with 0.1 M, 25 mL solution of HCl, the pH of the resulting solution was 8. Then the pH of 0.01 M solution of anilinium chloride will be (Kw=10−14). |
|
Answer» Aniline behaves as a weak base. When 0.1 M, 50 mL solution of aniline was mixed with 0.1 M, 25 mL solution of HCl, the pH of the resulting solution was 8. Then the pH of 0.01 M solution of anilinium chloride will be (Kw=10−14) |
|
| 44. |
What are inner and outer transitional elements? |
|
Answer» What are inner and outer transitional elements? |
|
| 45. |
31 Explain (1)pie bond and (2)sigma bond. |
| Answer» 31 Explain (1)pie bond and (2)sigma bond. | |
| 46. |
For complete combustion of ethanol . C2H5OH(l)+3O2(g)=2CO2(g)+3H2O(l) the amount of heat produced as measured in bomb calorimeter ,is 1364.47kJ/mol at 25degree celsius . Assuming ideality the enthalpy of combustion ,DelHcFor the reaction will be(R =8.314) |
|
Answer» For complete combustion of ethanol . C2H5OH(l)+3O2(g)=2CO2(g)+3H2O(l) the amount of heat produced as measured in bomb calorimeter ,is 1364.47kJ/mol at 25degree celsius . Assuming ideality the enthalpy of combustion ,DelHc For the reaction will be(R =8.314) |
|
| 47. |
Haemoglobin contain 0.334% of iron by weight. Molecular weight of haemoglobin isapproximately 67200. How many iron atoms are present in one molecule ofhaemoglobin? |
|
Answer» Haemoglobin contain 0.334% of iron by weight. Molecular weight of haemoglobin is approximately 67200. How many iron atoms are present in one molecule of haemoglobin? |
|
| 48. |
If the radius of a potentiometer wire is increased fourtimes, keeping in length constant, then the value of its potential gradient will become |
| Answer» If the radius of a potentiometer wire is increased fourtimes, keeping in length constant, then the value of its potential gradient will become | |
| 49. |
Which one of the following structures has the IUPAC name 3-ethynyl-2-hydroxy-4-methylhex-3-en-5-ynoic acid? |
|
Answer» Which one of the following structures has the IUPAC name 3-ethynyl-2-hydroxy-4-methylhex-3-en-5-ynoic acid? |
|
| 50. |
Why is Na- not possible?? |
|
Answer» Why is Na- not possible?? |
|
