46295 + Interview Questions in Chemistry

1.	For which of the following species is Bohr’s theory not applicable:
Answer» For which of the following species is Bohr’s theory not applicable:

Discussion

2.	For the reaction, PCl5(g)⇌PCl3(g)+Cl2(g), the degree of dissociation 'x' is related to pressure 'P
Answer» For the reaction, $P C l_{5} (g) ⇌ P C l_{3} (g) + C l_{2} (g)$ , the degree of dissociation 'x' is related to pressure 'P

Discussion

3.	Find the molarity of 0.585 Gram NaCl present in 500 ml of solution??
Answer» Find the molarity of 0.585 Gram NaCl present in 500 ml of solution??

Discussion

4.	Why does a cation tend to surround itself with as many anions as possible?
Answer» Why does a cation tend to surround itself with as many anions as possible?

Discussion

5.	Which of the following statement does not hold true for the following reaction? xCu3P+yCr2O2−7+zH+→Cu2++H3PO4+Cr3+
Answer» Which of the following statement does not hold true for the following reaction? $x C u_{3} P + y C r_{2} O_{7}^{2 -} + z H^{+} \to C u^{2 +} + H_{3} P O_{4} + C r^{3 +}$

Discussion

6.	A monatomic ideal gas sample is given heat Q. One half of this heat is used as work done by the gas and rest is used for increasing its internal energy. The equation of process in terms of volume and temperature is
Answer» A monatomic ideal gas sample is given heat Q. One half of this heat is used as work done by the gas and rest is used for increasing its internal energy. The equation of process in terms of volume and temperature is

Discussion

7.	A certain oxide of metal M crystallizes in such a way that O2− ions adopt an HCP arrangement that follows the ABABAB pattern. The metal ions, occupy two thirds of the octahedral voids. The formula of the compound is :
Answer» A certain oxide of metal M crystallizes in such a way that $O^{2 -}$ ions adopt an HCP arrangement that follows the ABABAB pattern. The metal ions, occupy two thirds of the octahedral voids. The formula of the compound is :

Discussion

8.	In fast breeder reactors, liquid sodium metal is used as
Answer» In fast breeder reactors, liquid sodium metal is used as

Discussion

9.	Which of the following catalyst is used in the polymerisation of CH≡CH to C6H6
Answer» Which of the following catalyst is used in the polymerisation of $C H \equiv C H$ to $C_{6} H_{6}$

Discussion

10.	Which of the following compounds can be separated by water?
Answer» Which of the following compounds can be separated by water?

Discussion

11.	The standard heat of formation values of SF6(g) ,/S(g) and F(g) are: −1100,275 and 80 KJ mol−1 respectively. Then the average S - F bond energy in SF6 is:
Answer» The standard heat of formation values of $S F_{6} (g)$ ,/S(g) and $F (g)$ are: $- 1100, 275$ and $80 K J m o l^{- 1}$ respectively. Then the average S - F bond energy in $S F_{6}$ is:

Discussion

12.	The electronic configuration of four elements and are given in brackets L(1s2,2s22p4);QL(1s2,2s22p6,3s23p5),p(1s2,2s22p6,3s1);R(1s2,2s22p6,3s2)The formulae of ionic compounds that can be formed between these elements are
Answer» The electronic configuration of four elements and are given in brackets $L (1 s^{2}, 2 s^{2} 2 p^{4}); Q L (1 s^{2}, 2 s^{2} 2 p^{6}, 3 s^{2} 3 p^{5}), p (1 s^{2}, 2 s^{2} 2 p^{6}, 3 s^{1}); R (1 s^{2}, 2 s^{2} 2 p^{6}, 3 s^{2})$ The formulae of ionic compounds that can be formed between these elements are

Discussion

13.	Which of the following compounds has the smallest bond angle?
Answer» Which of the following compounds has the smallest bond angle?

Discussion

14.	Which of the following is/are true for Metamers?
Answer» Which of the following is/are true for Metamers?

Discussion

15.	Calculate the enthalpy change when 50 mL of 0.01 M Ca(OH)2 reacts with 25 mL of 0.01 M HCl. Given that ΔHo of neutralization of a strong acid and a strong base is 14 kcal mol−1
Answer» Calculate the enthalpy change when $50 m L$ of $0.01 M$ $C a (O H)_{2}$ reacts with $25 m L$ of $0.01 M$ $H C l$ . Given that $Δ H^{o}$ of neutralization of a strong acid and a strong base is $14 k c a l m o l^{- 1}$

Discussion

16.	Equal weights of methane and oxygen are mixed in an empty container at 25∘C the fraction of the total pressure exerted by oxygen is:
Answer» Equal weights of methane and oxygen are mixed in an empty container at $25^{\circ} C$ the fraction of the total pressure exerted by oxygen is:

Discussion

17.	The correct IUPAC name of the compound given below is :
Answer» The correct IUPAC name of the compound given below is :

Discussion

18.	Why does air have the least permittivity?
Answer» Why does air have the least permittivity?

Discussion

19.	Hyperconjugation involves the overlap of which of the following orbitals?
Answer» Hyperconjugation involves the overlap of which of the following orbitals?

Discussion

20.	Which of the following gives crimson red and golden yellow in flame is
Answer» Which of the following gives crimson red and golden yellow in flame is

Discussion

21.	Which of the following formula does not correctly represent the bonding capacity of the atom involved
Answer» Which of the following formula does not correctly represent the bonding capacity of the atom involved

Discussion

22.	The gas released when baking soda is mixed with vinegar, is
Answer» The gas released when baking soda is mixed with vinegar, is

Discussion

23.	Why does silver bromide (AgBr) show both Schottky and Frenkel defects? ( in simple words)
Answer» Why does silver bromide (AgBr) show both Schottky and Frenkel defects? ( in simple words)

Discussion

24.	One litre of 11.2 volume H2O2 is produced from dil H2SO4 during electrolysis. Then the number of electrons passed through dil H2SO4 during electrolysis is
Answer» One litre of 11.2 volume H₂O₂ is produced from dil H₂SO₄ during electrolysis. Then the number of electrons passed through dil H₂SO₄ during electrolysis is

Discussion

25.	Predict the major product in the following reaction :
Answer» Predict the major product in the following reaction :

Discussion

26.	What sequence of reaction would best accomplish the following reaction?
Answer» What sequence of reaction would best accomplish the following reaction?

Discussion

27.	CyclopentaneCl2(excess)−−−−−−→hν How many dichloro products (including stereoisomers) are possible in the given reaction?
Answer» $Cyclopentane C l_{2} (excess) - ----- \to h ν$ How many dichloro products (including stereoisomers) are possible in the given reaction?

Discussion

28.	How does atomic radius vary in a period and in a group? How do you explain the variation?
Answer» How does atomic radius vary in a period and in a group? How do you explain the variation?

Discussion

29.	Oxygen and nitrogen are present in a mixture in the ratio of 1:4. Calculate the ratio of their number of molecules in the mixture.
Answer» Oxygen and nitrogen are present in a mixture in the ratio of $1 : 4$ . Calculate the ratio of their number of molecules in the mixture.

Discussion

30.	For the electrochemical cell: Mg(s)\|Mg2+(aq,1M)\|\|Cu2+)(aq,1M)\|Cu(s) the standard emf of the cell is 2.70 V at 300 K. When the concentration of Mg2+ is changed to 'x' M, the cell potential changes to 2.67 V at 300 K. The value of 'x' is. (given, FR=11500KV−1, where F is the Faraday constant and R is the gas constant, ln(10)=2.30)
Answer» For the electrochemical cell: $M g (s) \| M g^{2 +} (a q, 1 M) \| \| C u^{2 +}) (a q, 1 M) \| C u (s)$ the standard emf of the cell is 2.70 V at 300 K. When the concentration of $M g^{2 +}$ is changed to 'x' M, the cell potential changes to 2.67 V at 300 K. The value of 'x' is. (given, $\frac{F}{R} = 11500 K V^{- 1}$ , where $F$ is the Faraday constant and $R$ is the gas constant, ln(10)=2.30)

Discussion

31.	How many years would it take to spend one Avogadro’s number of rupees at a rate of 10 lakh of rupees in one second?
Answer» How many years would it take to spend one Avogadro’s number of rupees at a rate of 10 lakh of rupees in one second?

Discussion

32.	Which of the following is the most stable carbocation ?
Answer» Which of the following is the most stable carbocation ?

Discussion

33.	0.004 mol of SO2Cl2(g) is taken in a sealed vessel where it decomposes as SO2Cl2(g)→SO2(g)+Cl2(g) After 0.2303 hours, the gaseous mixture is passed through a 150 ml of acidified, 0.1N I2 (aq) solution where all SO2 is oxidized to SO2−4. The resulting solution of I2 required 90 ml of 0.1 M Na2S2O3(aq) solution.Calculate rate constant (in hr−1) of the reaction. Given : log 2 = 0.3___
Answer» 0.004 mol of $S O_{2} C l_{2} (g)$ is taken in a sealed vessel where it decomposes as $S O_{2} C l_{2} (g) \to S O_{2} (g) + C l_{2} (g)$ After 0.2303 hours, the gaseous mixture is passed through a 150 $m l$ of acidified, $0.1 N I_{2}$ (aq) solution where all $S O_{2}$ is oxidized to $S O_{4}^{2 -}$ . The resulting solution of $I_{2}$ required 90 $m l$ of 0.1 $M$ $N a_{2} S_{2} O_{3} (a q)$ solution.Calculate rate constant $(i n h r^{- 1})$ of the reaction. Given : log 2 = 0.3___

Discussion

34.	Which one is the cofactor of carbonic anhydrase?
Answer» Which one is the cofactor of carbonic anhydrase?

Discussion

35.	50 ml of hydrogen diffuses out through a small hole from a vessel in 20 minutes. The time needed for 40 ml of oxygen to diffuse out is........
Answer» 50 ml of hydrogen diffuses out through a small hole from a vessel in 20 minutes. The time needed for 40 ml of oxygen to diffuse out is........

Discussion

36.	The reaction of 1-Bromo-3-Chlorocyclobutane with 2 equivalents of Na in the presence of ether products:
Answer» The reaction of 1-Bromo-3-Chlorocyclobutane with 2 equivalents of Na in the presence of ether products:

Discussion

37.	Which of the following is true in case of stereo isomerism?
Answer» Which of the following is true in case of stereo isomerism?

Discussion

38.	Which of the following is true ? a) φ2(r) represent probability density of electron b) RPF(Radial Probability Function) represent probability of electron in spherical region of unit thickness c) There is not any radial node in 1s orbital 1) only (a) 2) Both a, b 3) Both b, c 4) a, b ,c
Answer» Which of the following is true ? a) φ2(r) represent probability density of electron b) RPF(Radial Probability Function) represent probability of electron in spherical region of unit thickness c) There is not any radial node in 1s orbital 1) only (a) 2) Both a, b 3) Both b, c 4) a, b ,c

Discussion

39.	A metal M readily forms sulphate MSO4 which is water insoluble. It forms oxide MO which becomes inert on heating. It forms insoluble hydroxide which is soluble in NaOH. The metal M is:
Answer» A metal M readily forms sulphate $M S O_{4}$ which is water insoluble. It forms oxide MO which becomes inert on heating. It forms insoluble hydroxide which is soluble in NaOH. The metal M is:

Discussion

40.	A certain weak acid has Ka=1×10−4.Keq for its reaction with NaOH is
Answer» A certain weak acid has $K_{a} = 1 \times 10^{- 4} . K_{e q}$ for its reaction with NaOH is

Discussion

41.	Consider the reaction:3A+B+C→D+E Where the rate law is defined as: −Δ[A]Δt=k[A]2[B][C] An experiment is carried out where [B]o=[C]o=1.00 M and [A]o=1.00×10−4 M, Calculate the value of t12.
Answer» Consider the reaction: $3 A + B + C \to D + E$ Where the rate law is defined as: $- \frac{Δ [A]}{Δ t} = k [A]^{2} [B] [C]$ An experiment is carried out where $[B]_{o} = [C]_{o} = 1.00 M$ and $[A]_{o} = 1.00 \times 10^{- 4} M$ , Calculate the value of $t_{\frac{1}{2}}$ .

Discussion

42.	5 g of Zinc is treated separately with an excess of I. dilute hydrochloric acid and II. aqueous sodium hydroxide. The ratio of the volumes of H2 evolved in these two reactions is:
Answer» 5 g of Zinc is treated separately with an excess of I. dilute hydrochloric acid and II. aqueous sodium hydroxide. The ratio of the volumes of $H_{2}$ evolved in these two reactions is:

Discussion

43.	CH3CH2OH can be converted into CH3CHO by . . . . (a) catalytic hydrogenation (b) treatment with LiAIH4 (c) treatment with pyridinium chlorochromate (d) treatment with KMnO4
Answer» $C H_{3} C H_{2} O H$ can be converted into $C H_{3} C H O$ by . . . . (a) catalytic hydrogenation (b) treatment with $L i A I H_{4}$ (c) treatment with pyridinium chlorochromate (d) treatment with $K M n O_{4}$

Discussion

44.	What are the interstitial compounds? Why, arc such compounds well known for transition metals?
Answer» What are the interstitial compounds? Why, arc such compounds well known for transition metals?

Discussion

45.	The correct order of bond lengths is:
Answer» The correct order of bond lengths is:

Discussion

46.	Write the electronic configurations of the following ions: (a) H– (b) Na+ (c) O2– (d) F– (ii) What are the atomic numbers of elements whose outermost electrons are represented by (a) 3s1 (b) 2p3 and (c) 3p5 ? Which atoms are indicated by the following configurations? (a) [He] 2s1 (b) [Ne] 3s23p3 (c) [Ar] 4s23d1
Answer» Write the electronic configurations of the following ions: (a) $H^{-}$ (b) $N a^{+}$ (c) $O^{2 -}$ (d) $F^{-}$ (ii) What are the atomic numbers of elements whose outermost electrons are represented by (a) 3 $s^{1}$ (b) 2 $p^{3}$ and (c) 3 $p^{5}$ ? Which atoms are indicated by the following configurations? (a) [He] 2 $s^{1}$ (b) [Ne] 3 $s^{2} 3 p^{3}$ (c) [Ar] 4 $s^{2} 3 d^{1}$

46.

Write the electronic configurations of the following ions: (a) H– (b) Na+ (c) O2– (d) F– (ii) What are the atomic numbers of elements whose outermost electrons are represented by (a) 3s1 (b) 2p3 and (c) 3p5 ? Which atoms are indicated by the following configurations? (a) [He] 2s1 (b) [Ne] 3s23p3 (c) [Ar] 4s23d1

Answer»

Write the electronic configurations of the following ions:
(a) $H^{-}$
(b) $N a^{+}$
(c) $O^{2 -}$
(d) $F^{-}$

(ii) What are the atomic numbers of elements whose outermost electrons are represented by
(a) 3 $s^{1}$
(b) 2 $p^{3}$ and
(c) 3 $p^{5}$ ?

Which atoms are indicated by the following configurations?
(a) [He] 2 $s^{1}$
(b) [Ne] 3 $s^{2} 3 p^{3}$
(c) [Ar] 4 $s^{2} 3 d^{1}$

Discussion

47.	For this graph, which option is correct ?
Answer» For this graph, which option is correct ?

Discussion

48.	Reaction mechanism given in ncert will be useful in neet?
Answer» Reaction mechanism given in ncert will be useful in neet?

Discussion

49.	A and B respectively are :
Answer» A and B respectively are :

Discussion

50.	Identify the correctly balanced redox reaction using ion-electron method. FeSO4+KMnO4+H2SO4→Fe2(SO4)3+MnSO4+H2O+K2SO4
Answer» Identify the correctly balanced redox reaction using ion-electron method. $F e S O_{4} + K M n O_{4} + H_{2} S O_{4} \to F e_{2} (S O_{4})_{3} + M n S O_{4} + H_{2} O + K_{2} S O_{4}$

Discussion

Explore topic-wise InterviewSolutions in Current Affairs.

For which of the following species is Bohr’s theory not applicable:

For the reaction, PCl5(g)⇌PCl3(g)+Cl2(g), the degree of dissociation 'x' is related to pressure 'P

Find the molarity of 0.585 Gram NaCl present in 500 ml of solution??

Why does a cation tend to surround itself with as many anions as possible?

Which of the following statement does not hold true for the following reaction? xCu3P+yCr2O2−7+zH+→Cu2++H3PO4+Cr3+

A monatomic ideal gas sample is given heat Q. One half of this heat is used as work done by the gas and rest is used for increasing its internal energy. The equation of process in terms of volume and temperature is

A certain oxide of metal M crystallizes in such a way that O2− ions adopt an HCP arrangement that follows the ABABAB pattern. The metal ions, occupy two thirds of the octahedral voids. The formula of the compound is :

In fast breeder reactors, liquid sodium metal is used as

Which of the following catalyst is used in the polymerisation of CH≡CH to C6H6

Which of the following compounds can be separated by water?

The standard heat of formation values of SF6(g) ,/S(g) and F(g) are: −1100,275 and 80 KJ mol−1 respectively. Then the average S - F bond energy in SF6 is:

The electronic configuration of four elements and are given in brackets L(1s2,2s22p4);QL(1s2,2s22p6,3s23p5),p(1s2,2s22p6,3s1);R(1s2,2s22p6,3s2)The formulae of ionic compounds that can be formed between these elements are

Which of the following compounds has the smallest bond angle?

Which of the following is/are true for Metamers?

Calculate the enthalpy change when 50 mL of 0.01 M Ca(OH)2 reacts with 25 mL of 0.01 M HCl. Given that ΔHo of neutralization of a strong acid and a strong base is 14 kcal mol−1

Equal weights of methane and oxygen are mixed in an empty container at 25∘C the fraction of the total pressure exerted by oxygen is:

The correct IUPAC name of the compound given below is :

Why does air have the least permittivity?

Hyperconjugation involves the overlap of which of the following orbitals?

Which of the following gives crimson red and golden yellow in flame is

Which of the following formula does not correctly represent the bonding capacity of the atom involved

The gas released when baking soda is mixed with vinegar, is

Why does silver bromide (AgBr) show both Schottky and Frenkel defects? ( in simple words)

One litre of 11.2 volume H2O2 is produced from dil H2SO4 during electrolysis. Then the number of electrons passed through dil H2SO4 during electrolysis is

Predict the major product in the following reaction :

What sequence of reaction would best accomplish the following reaction?

CyclopentaneCl2(excess)−−−−−−→hν How many dichloro products (including stereoisomers) are possible in the given reaction?

How does atomic radius vary in a period and in a group? How do you explain the variation?

Oxygen and nitrogen are present in a mixture in the ratio of 1:4. Calculate the ratio of their number of molecules in the mixture.

How many years would it take to spend one Avogadro’s number of rupees at a rate of 10 lakh of rupees in one second?

Which of the following is the most stable carbocation ?

Which one is the cofactor of carbonic anhydrase?

50 ml of hydrogen diffuses out through a small hole from a vessel in 20 minutes. The time needed for 40 ml of oxygen to diffuse out is........

The reaction of 1-Bromo-3-Chlorocyclobutane with 2 equivalents of Na in the presence of ether products:

Which of the following is true in case of stereo isomerism?

Which of the following is true ? a) φ2(r) represent probability density of electron b) RPF(Radial Probability Function) represent probability of electron in spherical region of unit thickness c) There is not any radial node in 1s orbital 1) only (a) 2) Both a, b 3) Both b, c 4) a, b ,c

A metal M readily forms sulphate MSO4 which is water insoluble. It forms oxide MO which becomes inert on heating. It forms insoluble hydroxide which is soluble in NaOH. The metal M is:

A certain weak acid has Ka=1×10−4.Keq for its reaction with NaOH is

Consider the reaction:3A+B+C→D+E Where the rate law is defined as: −Δ[A]Δt=k[A]2[B][C] An experiment is carried out where [B]o=[C]o=1.00 M and [A]o=1.00×10−4 M, Calculate the value of t12.

5 g of Zinc is treated separately with an excess of I. dilute hydrochloric acid and II. aqueous sodium hydroxide. The ratio of the volumes of H2 evolved in these two reactions is:

CH3CH2OH can be converted into CH3CHO by . . . . (a) catalytic hydrogenation (b) treatment with LiAIH4 (c) treatment with pyridinium chlorochromate (d) treatment with KMnO4

What are the interstitial compounds? Why, arc such compounds well known for transition metals?

The correct order of bond lengths is:

For this graph, which option is correct ?

Reaction mechanism given in ncert will be useful in neet?

A and B respectively are :

Identify the correctly balanced redox reaction using ion-electron method. FeSO4+KMnO4+H2SO4→Fe2(SO4)3+MnSO4+H2O+K2SO4