Explore topic-wise InterviewSolutions in Current Affairs.

This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.

1.

In the given reaction, C6H6 + Br2 → C6H5Br + HBr 39 gm of C6H6 reacts with 40 gm of Br2. It was found that 19.625 gm of C6H5Br was obtained. Calculate the percentage yield of the reaction.

Answer»

In the given reaction, C6H6 + Br2 C6H5Br + HBr
39 gm of C6H6 reacts with 40 gm of Br2. It was found that 19.625 gm of C6H5Br was obtained. Calculate the percentage yield of the reaction.

2.

The addition of ammonium chloride to 0.1 M acetic acid will cause:

Answer»

The addition of ammonium chloride to 0.1 M acetic acid will cause:


3.

In which complex is the C−O bond length maximum?

Answer»

In which complex is the CO bond length maximum?

4.

Calculate the increase in internal energy of 1 kg of water at 100 ∘C when it is converted into steam at the same temperature and at 1 atm (100 kPa). The density of water and steam are 1000 kgm−3 and 0.6 kgm−3 respectively. The latent heat of vapourisation of water = 2.25×106 J kg−1

Answer»

Calculate the increase in internal energy of 1 kg of water at 100 C when it is converted into steam at the same temperature and at 1 atm (100 kPa). The density of water and steam are 1000 kgm3 and 0.6 kgm3 respectively. The latent heat of vapourisation of water = 2.25×106 J kg1

5.

The average kinetic energy (in joules) of molecules in 8.0 g of methane at 27∘ C is:

Answer»

The average kinetic energy (in joules) of molecules in 8.0 g of methane at 27 C is:

6.

A cylinder with a movable piston contains 3 moles of hydrogen at standard temperature and pressure. The walls of the cylinder are made of heat insulator, and the piston is insulated by having a pile of sand on it/ by what factor does the pressure of the gas increase, if the gas is compressed to half it original volume?

Answer»

A cylinder with a movable piston contains 3 moles of hydrogen at standard temperature and pressure. The walls of the cylinder are made of heat insulator, and the piston is insulated by having a pile of sand on it/ by what factor does the pressure of the gas increase, if the gas is compressed to half it original volume?


7.

Cp and Cv are specific heats at constant pressure and constant volume respectively. It is observed thatCp−Cv=a for hydrogen gasCp−Cv=b for nitrogen gasThe correct relation between a and b is

Answer» Cp and Cv are specific heats at constant pressure and constant volume respectively. It is observed that

CpCv=a for hydrogen gas

CpCv=b for nitrogen gas

The correct relation between a and b is
8.

Calculate the number of atoms in 52u of He

Answer»

Calculate the number of atoms in 52u of He

9.

Assuming human pupil to have a radius of 0.25 cm and a comfortable viewing distance of 25 cm, the minimum separation between two objects that the human eye can resolve at 500 nm wavelength is

Answer»

Assuming human pupil to have a radius of 0.25 cm and a comfortable viewing distance of 25 cm, the minimum separation between two objects that the human eye can resolve at 500 nm wavelength is

10.

A source of sound emits sound waves in uniform medium. If energy density is E and maximum speed of particles of the medium is Vmax then the graph between E and Vmax is best representedby

Answer»

A source of sound emits sound waves in uniform medium. If energy density is E and maximum speed of particles of the medium is Vmax then the graph between E and Vmax is best representedby


11.

What is the degree of hardness of a sample of water containing 24 mg of MgSO4 (molecular mass 120) per kg of water?

Answer»

What is the degree of hardness of a sample of water containing 24 mg of MgSO4 (molecular mass 120) per kg of water?

12.

Difference in the molar mass of (D) and (A) is: g/mol

Answer»
Difference in the molar mass of (D) and (A) is: g/mol
13.

A light wave has a wavelength of 10∘A. Find its frequency if speed of light is 300000 km/second.

Answer» A light wave has a wavelength of 10A. Find its frequency if speed of light is 300000 km/second.
14.

Choose the best reaction sequence that could be used to perform the following transformation.

Answer»

Choose the best reaction sequence that could be used to perform the following transformation.

15.

In the below reaction sequence identify the correct structures for 'A' and 'B' respectively:

Answer»

In the below reaction sequence identify the correct structures for 'A' and 'B' respectively:

16.

The amount of energy released when 1012 atoms of Cl vapours are converted to Cl− ions, according to the equation: Cl(g)+e−→Cl− is 60×10−10 J. The magnitude of ΔegH of Cl atom in kJ/mol is (take NA=6×1023

Answer» The amount of energy released when 1012 atoms of Cl vapours are converted to Cl ions, according to the equation:
Cl(g)+eCl is 60×1010 J. The magnitude of
ΔegH of Cl atom in kJ/mol is (take NA=6×1023
17.

Absorption of energy by an atom of hydrogen in the ground state results in the ejection of electron with de-Broglie wavelength λ=4.7×10−10 m. Given that the ionization energy is 13.6eV, calculate the energy of photon which caused the ejection of electron.

Answer»

Absorption of energy by an atom of hydrogen in the ground state results in the ejection of electron with de-Broglie wavelength λ=4.7×1010 m. Given that the ionization energy is 13.6eV, calculate the energy of photon which caused the ejection of electron.

18.

A valid Lewis structure cannot be drawn for which of the following compounds? (P=15, Si=14, C=6, Se=34)

Answer»

A valid Lewis structure cannot be drawn for which of the following compounds?
(P=15, Si=14, C=6, Se=34)

19.

The correct order of decreasing X−O−X bond angle is:

Answer»

The correct order of decreasing XOX bond angle is:

20.

An aromatic compound 'A' on heating withBr2 and KOH forms a compound 'B' of molecular formula C6H7N which on reacting with CHCl3 and alcoholic KOH produces a foul smelling compound 'C'. Write the structures and IUPAC names of compounds A,B and C .

Answer» An aromatic compound 'A' on heating withBr2 and KOH forms a compound 'B' of molecular formula C6H7N which on reacting with CHCl3 and alcoholic KOH produces a foul smelling compound 'C'. Write the structures and IUPAC names of compounds A,B and C .
21.

5 litres of a solution in m3 is

Answer»

5 litres of a solution in m3
is

22.

In the system, LaCl3(S)+H2O(g)+heat⇌LaClO(s)+2HCl(g), equilibrium is established. More water vapour is added to restablish the equilibrium. The pressure of water vapour is doubled. The factor by which pressure of HCI is changed is:

Answer»

In the system, LaCl3(S)+H2O(g)+heatLaClO(s)+2HCl(g), equilibrium is established. More water vapour is added to restablish the equilibrium. The pressure of water vapour is doubled. The factor by which pressure of HCI is changed is:


23.

What will be the oxidation state of Carbon in baking soda i.e. NaHCO3

Answer»

What will be the oxidation state of Carbon in baking soda i.e. NaHCO3

24.

Consider the following case of completing first order reactions. After the start of the reaction at t = 0 with only A, the [B] is equal to the [C] at all times. The time in which all three concentrations will be equal is given by

Answer»

Consider the following case of completing first order reactions.

After the start of the reaction at t = 0 with only A, the [B] is equal to the [C] at all times. The time in which all three concentrations will be equal is given by


25.

The fat C57H104O6 (s) is metabolized via the following reaction. calculate the energy (KJ) liberated when 1g of this fat reacts. C57H104O6(s)+80O2(g)→57CO2(g)+52H2O(l) Given the enthalpies of formation: ΔH0f(C57H104O6,s)=−70870 kJ/mol ΔH0f(H2O,l)=−285.8 kJ/mol ΔH0f(CO2,g)=−393.5 kJ/mol

Answer»

The fat C57H104O6 (s) is metabolized via the following reaction.
calculate the energy (KJ) liberated when 1g of this fat reacts.

C57H104O6(s)+80O2(g)57CO2(g)+52H2O(l)

Given the enthalpies of formation:

ΔH0f(C57H104O6,s)=70870 kJ/mol
ΔH0f(H2O,l)=285.8 kJ/mol
ΔH0f(CO2,g)=393.5 kJ/mol


26.

In XeF2 molecule, the angle between the two lone pair orbitals is α, the angle between the lone pair orbital and the bond pair orbital is β. The angle between the bond pair orbitals γ is:

Answer»

In XeF2 molecule, the angle between the two lone pair orbitals is α, the angle between the lone pair orbital and the bond pair orbital is β. The angle between the bond pair orbitals γ is:

27.

How to identify zero oder, first, second order and third order reactions?

Answer»

How to identify zero oder, first, second order and third order reactions?

28.

Which one is a double displacement reaction?

Answer»

Which one is a double displacement reaction?


29.

Consider the following statements about Masala bonds Which of the above statements is/are correct

Answer»

Consider the following statements about Masala bonds

Which of the above statements is/are correct


30.

Find the ratio of frequencies of violet light (λ1=4.10×10−5 cm) to that of red light (λ2=6.56×10−5 cm). Also determine the ratio of energies carried by them.

Answer»

Find the ratio of frequencies of violet light (λ1=4.10×105 cm) to that of red light (λ2=6.56×105 cm). Also determine the ratio of energies carried by them.

31.

Which of the following explains the particle like nature of light?

Answer»

Which of the following explains the particle like nature of light?


32.

Can aluminium be extracted from bauxite through hydrometallurgy?

Answer»

Can aluminium be extracted from bauxite through hydrometallurgy?

33.

A solid is made of two elements X & Z .the atoms Z are in CCP arrangement while atom X occupy all tetrahedral sites . what is the formula of the compound?

Answer»

A solid is made of two elements X & Z .the atoms Z are in CCP arrangement while atom X occupy all tetrahedral sites . what is the formula of the compound?

34.

What is bent rule? Please explain

Answer»

What is bent rule? Please explain

35.

Consider the following reaction. P4+xOH−+yH2O→PH3+zHPO−2 Find the sum of x, y and z, when the above reaction is balanced.

Answer» Consider the following reaction.
P4+xOH+yH2OPH3+zHPO2
Find the sum of x, y and z, when the above reaction is balanced.
36.

How can negative adsorption be adsorption since here the particles are accumulated even in the bulk ?

Answer»

How can negative adsorption be adsorption since here the particles are accumulated even in the bulk ?

37.

The unit cell of a NaCl lattice

Answer»

The unit cell of a NaCl lattice


38.

A metallic element crystallizes into a lattice containing a sequence of layers of ABABAB. . . .Percentage of empty space (by volume) is

Answer»

A metallic element crystallizes into a lattice containing a sequence of layers of ABABAB. . . .Percentage of empty space (by volume) is


39.

Mole fraction of ethyl alcohol in aqueous ethyl alcohol solution is 0. 25 hence the percentage of ethyl alcohol by weight is:

Answer»

Mole fraction of ethyl alcohol in aqueous ethyl alcohol solution is 0. 25 hence the percentage of ethyl alcohol by weight is:

40.

Name the linkage connecting monosaccharide units in polysaccharides.

Answer»

Name the linkage connecting monosaccharide units in polysaccharides.

41.

Stable oxidation state of Thallium is

Answer» Stable oxidation state of Thallium is
42.

Is the secondary structure of the rRna a modified form of its linear primary structure?

Answer»

Is the secondary structure of the rRna a modified form of its linear primary structure?

43.

In which of the following compound B – F bond length is shortest?

Answer» In which of the following compound B – F bond length is shortest?
44.

One of the assumptions of kinetic theory of gases states that "there is no force of attraction between the molecules of a gas." How far is this statement correct? Is it possible to liquefy an ideal gas? Explain.

Answer»

One of the assumptions of kinetic theory of gases states that "there is no force of attraction between the molecules of a gas." How far is this statement correct? Is it possible to liquefy an ideal gas? Explain.

45.

Toluene reacts with a halogen in the presence of iron (III) chloride giving ortho and para halo compounds. The reaction is (a) electrophilic elimination reaction (b) electrophilic substitution reaction (c) free radical addition reaction (d) nucleophilic substitution reaction

Answer»

Toluene reacts with a halogen in the presence of iron (III) chloride giving ortho and para halo compounds. The reaction is

(a) electrophilic elimination reaction

(b) electrophilic substitution reaction

(c) free radical addition reaction

(d) nucleophilic substitution reaction

46.

The ratio of osmotic pressure of a 1:1 electrolyte AB to that of a non electrolyte solute of same concentration is

Answer»

The ratio of osmotic pressure of a 1:1 electrolyte AB to that of a non electrolyte solute of same concentration is


47.

Which of the following items is cooked on Saturday?

Answer»

Which of the following items is cooked on Saturday?


48.

Write the chemical reactions involved in the process of extraction of Gold. Explain the role of dilute NaCN and Zn in this process.

Answer» Write the chemical reactions involved in the process of extraction of Gold. Explain the role of dilute NaCN and Zn in this process.
49.

Which of the following structures of 1-methoxy-1, 3-butadiene is least stable?

Answer»

Which of the following structures of 1-methoxy-1, 3-butadiene is least stable?


50.

A non-ideal gas follows van der Walls' gas equation, if x moles of a given gas is kept at a higher pressure, then:

Answer»

A non-ideal gas follows van der Walls' gas equation, if x moles of a given gas is kept at a higher pressure, then: