Explore topic-wise InterviewSolutions in Current Affairs.

This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.

1.

Assertion : Formaldehyde cannot be prepared by Rosenmund's reduction. Reason : Acid chlorides can be reduced into aldehydes with hydrogen in boiling xylene using palladium or platinum as a catalyst supported on barium sulphate. This is known as Rosenmund's reduction.

Answer»

Assertion : Formaldehyde cannot be prepared by Rosenmund's reduction.

Reason : Acid chlorides can be reduced into aldehydes with hydrogen in boiling xylene using palladium or platinum as a catalyst supported on barium sulphate. This is known as Rosenmund's reduction.


2.

16. The vapour pressure of pure benzene and toluene are 0.12 bar and 0.04 bar, respectively at 300K. A liquid mixture is composed of 1 mole, each of benzene and toluene. Q1 If the pressure over the mixture at 300 K is reduced at what pressure does the first vapour form. Q2 What is the mole fraction of benzene in the first trace of vapour formed ? Q3 If the pressure is further reduced , at what pressure does the last trace of liquid disappear ? Q4 What is the mole fraction of benzene in the last trace of liquid?

Answer» 16. The vapour pressure of pure benzene and toluene are 0.12 bar and 0.04 bar, respectively at 300K. A liquid mixture is composed of 1 mole, each of benzene and toluene. Q1 If the pressure over the mixture at 300 K is reduced at what pressure does the first vapour form. Q2 What is the mole fraction of benzene in the first trace of vapour formed ? Q3 If the pressure is further reduced , at what pressure does the last trace of liquid disappear ? Q4 What is the mole fraction of benzene in the last trace of liquid?
3.

John teller distortion. Role in high and low spin complex

Answer» John teller distortion. Role in high and low spin complex
4.

Which of the following is correct when the following equilibrium is established when C and water is placed in a container?C(s)+H2O(g)⇌CO(g)+H2(g)

Answer»

Which of the following is correct when the following equilibrium is established when C and water is placed in a container?

C(s)+H2O(g)⇌CO(g)+H2(g)

5.

37. The ionic conductance of Ba2+ and Cl- are respectively 127 and 76 ohm-1 sq.cm at infinite dilution. The equivalent conductance of Bacl2 at infinite dilution will be (in ohm-1 sq.cm)

Answer» 37. The ionic conductance of Ba2+ and Cl- are respectively 127 and 76 ohm-1 sq.cm at infinite dilution. The equivalent conductance of Bacl2 at infinite dilution will be (in ohm-1 sq.cm)
6.

75 What is the normality of 0.3 M H3PO4, When it undergoes the reaction as: H3PO4+2OH- reacts to HPO32-+2H2O

Answer» 75 What is the normality of 0.3 M H3PO4, When it undergoes the reaction as: H3PO4+2OH- reacts to HPO32-+2H2O
7.

What happen when DIBAL react with aldehyde

Answer» What happen when DIBAL react with aldehyde
8.

For a nth order reaction A→ Product, t1/2 varies with concentration of A as shown in graph What is value of n ?

Answer» For a nth order reaction A→ Product, t1/2 varies with concentration of A as shown in graph
What is value of n ?
9.

Calculate the fraction volume covered by atom which undergoes end centred packing.

Answer» Calculate the fraction volume covered by atom which undergoes end centred packing.
10.

At what temperature, zinc and carbon have equal affinity for oxygen?

Answer»

At what temperature, zinc and carbon have equal affinity for oxygen?




11.

Ferrous sulphate heptahydrate is used to fortify foods with iron. The amount (in grams) of the salt required to achieve 10 ppm of iron in 100 kg of wheat is (Atomic weight: Fe=55.85; S=32.00; O=16.00)

Answer» Ferrous sulphate heptahydrate is used to fortify foods with iron. The amount (in grams) of the salt required to achieve 10 ppm of iron in 100 kg of wheat is
(Atomic weight: Fe=55.85; S=32.00; O=16.00)
12.

In a reaction A+B gives product rate is doubled when the concentration of B is doubled and the rate increases by a factor of 8 when the concentration of both the reac†an ts (A and B) are doubled rate law for the reaction can be written a aredoubled

Answer» In a reaction A+B gives product rate is doubled when the concentration of B is doubled and the rate increases by a factor of 8 when the concentration of both the reac†an ts (A and B) are doubled rate law for the reaction can be written a aredoubled
13.

How is leaching carried out in case of low grade copper ores?

Answer»

How is leaching carried out in case of low grade copper ores?

14.

2 gram of a gas A is introduced into evacuated flask kept at 25 degree Celsius the pressure is found to be 1 ATM if 3 gram of another gas B is added to the same flask the total pressure becomes 1.5 ATM assume ideal gas behaviour the ratio of molecular weight of gas A to gas B is

Answer» 2 gram of a gas A is introduced into evacuated flask kept at 25 degree Celsius the pressure is found to be 1 ATM if 3 gram of another gas B is added to the same flask the total pressure becomes 1.5 ATM assume ideal gas behaviour the ratio of molecular weight of gas A to gas B is
15.

in the presence of alumina catalyst two alcohol molecules will undergo dehydration and form what?

Answer» in the presence of alumina catalyst two alcohol molecules will undergo dehydration and form what?
16.

Which of the following is least reactive towards SN1?

Answer»

Which of the following is least reactive towards SN1?


17.

Describe some features of catalysis by zeolites. ?

Answer»

Describe some features of catalysis by zeolites. ?

18.

Theionization constant of propanoic acid is 1.32 × 10–5.Calculate the degree of ionization of the acid in its 0.05M solutionand also its pH. What will be its degree of ionization if thesolution is 0.01M in HCl also?

Answer»

The
ionization constant of propanoic acid is 1.32 × 10–5.
Calculate the degree of ionization of the acid in its 0.05M solution
and also its pH. What will be its degree of ionization if the
solution is 0.01M in HCl also?

19.

3. Explain the mechanism of Allylic substitution in alkenes using NBS (N Bromo Succinimide)

Answer» 3. Explain the mechanism of Allylic substitution in alkenes using NBS (N Bromo Succinimide)
20.

In the case homologous series of alkanes, which one of the following statements is incorrect

Answer»

In the case homologous series of alkanes, which one of the following statements is incorrect




21.

4. Give the reaction mechanism of preparing ketone from acid chloride by using dialalkylcadmium .

Answer» 4. Give the reaction mechanism of preparing ketone from acid chloride by using dialalkylcadmium .
22.

The α - amino acids, usually exist in the form of zwitter ions. It means they have:

Answer»

The α - amino acids, usually exist in the form of zwitter ions. It means they have:


23.

Schottkydefect generally appears in[DCE 2004]

Answer»

Schottky
defect generally appears in

[DCE 2004]


24.

The total number of stereoisomers of the compound CH3CH=CH-CH(OH)-CH=CH-CH3

Answer» The total number of stereoisomers of the compound
CH3CH=CH-CH(OH)-CH=CH-CH3
25.

A silicon specimen is made into a p-type semiconductor by doping on an average one indium per 5×10^7 silicon atoms. If the number density of atoms in the silicon specimen is 5×10^28 atm/m^3 then the number of acceptor atoms in silicon per cubic centimeter will be

Answer» A silicon specimen is made into a p-type semiconductor by doping on an average one indium per 5×10^7 silicon atoms. If the number density of atoms in the silicon specimen is 5×10^28 atm/m^3 then the number of acceptor atoms in silicon per cubic centimeter will be
26.

The ratio of number of moles of O2 required to the number of moles of H2O produced during complete combustion of 1 mole of benzene is :

Answer»

The ratio of number of moles of O2 required to the number of moles of H2O produced during complete combustion of 1 mole of benzene is :

27.

A sample of hard water contains 1 mg of CaCl2 and 1 mg MgCl2 per litre. Calculate the hardness of water in terms of CaCO3 present in per 106 parts of water.

Answer» A sample of hard water contains 1 mg of CaCl2 and 1 mg MgCl2 per litre. Calculate the hardness of water in terms of CaCO3 present in per 106 parts of water.
28.

Specify the hybridization of the central atom in the following species respectively (N−3,NOCl,N2O):

Answer»

Specify the hybridization of the central atom in the following species respectively (N−3,NOCl,N2O):

29.

Which shape has equal parts? Choose the correct option.

Answer»

Which shape has equal parts? Choose the correct option.




30.

35. 100ml of 0.1M NaCl solution is mixed with 100ml of 0.2M AgNO3 solution. Find the mass of AgCl precipitate formed.

Answer» 35. 100ml of 0.1M NaCl solution is mixed with 100ml of 0.2M AgNO3 solution. Find the mass of AgCl precipitate formed.
31.

What will be the colour of red and blue litmus paper when they are dipped in a suspension of rust and water?

Answer» What will be the colour of red and blue litmus paper when they are dipped in a suspension of rust and water?
32.

Which of the following molecules have (2R, 3-Z) configuration?

Answer» Which of the following molecules have (2R, 3-Z) configuration?
33.

Newman representation of staggered propane is:

Answer»

Newman representation of staggered propane is:



34.

A mixture of KBr and NaBr weighing 0.560 g was treated with aq. Ag+ ion and all bromide ion was recovered as 0.970 g of pure AgBr. What was the fraction by weight of KBr in the sample?

Answer»

A mixture of KBr and NaBr weighing 0.560 g was treated with aq. Ag+ ion and all bromide ion was recovered as 0.970 g of pure AgBr. What was the fraction by weight of KBr in the sample?

35.

the ratio of moles of water as water of crystallisation in LiCl and BaCl_2 i

Answer» the ratio of moles of water as water of crystallisation in LiCl and BaCl_2 i
36.

Identify the following compound:

Answer»

Identify the following compound:



37.

The C-C single bond distance is 1.54 A^°. What is the distance between the terminal carbons in propane?

Answer» The C-C single bond distance is 1.54 A^°. What is the distance between the terminal carbons in propane?
38.

Equal volume of N2 and H2 react to form ammonia under suitable condition then the limiting reagent is? How to solve?

Answer» Equal volume of N2 and H2 react to form ammonia under suitable condition then the limiting reagent is? How to solve?
39.

Which of the tubes in Figure (a) and (b) will be more effective as a condenser in the distillation apparatus? Fig(a) Fig(b)

Answer» Which of the tubes in Figure (a) and (b) will be more effective as a condenser in the distillation apparatus?

Fig(a) Fig(b)


40.

The metal calcium crystallizes in F.C.C unit cell with a = 600 pm. The density of metal if it contains 0.2% schottky deficits.

Answer»

The metal calcium crystallizes in F.C.C unit cell with a = 600 pm. The density of metal if it contains 0.2% schottky deficits.



41.

Condition when NaNO2+HCl 1.nitroso compound2.Diazotisation3.-OH addition

Answer» Condition when NaNO2+HCl
1.nitroso compound
2.Diazotisation
3.-OH addition
42.

The first ionisation potential of Na, Mg and Si are 496, 737, and 776 kJ mol−1 respectively. The ionisation potential of Al could be:

Answer»

The first ionisation potential of Na, Mg and Si are 496, 737, and 776 kJ mol−1 respectively. The ionisation potential of Al could be:

43.

Arrange in increasing order of acid strength. HF,HCl,HBr,HI

Answer»

Arrange in increasing order of acid strength.

HF,HCl,HBr,HI

44.

Which of the following compounds is not chiral?

Answer»

Which of the following compounds is not chiral?



45.

A doubly ionized lithium atom is hydrogen like with atomic number 3. If the product of speed and radius of the electron is new physical quantity ′K′, then the ratio of ′K′ in 3rd and 2nd orbit of Li++ is

Answer»

A doubly ionized lithium atom is hydrogen like with atomic number 3. If the product of speed and radius of the electron is new physical quantity ′K′, then the ratio of ′K′ in 3rd and 2nd orbit of Li++ is

46.

Which of the following compounds would be hydrolysed most easily?

Answer»

Which of the following compounds would be hydrolysed most easily?

47.

The unstable halide among the following is

Answer»

The unstable halide among the following is



48.

Two metal plates A and B are soldered together ad in fug. A=100cm^2, x1=x2=4mm,T1=120°C,T2=0°C. Thermal conductivity of A and B are 50 and 80 W/mK. The temperature of the soldered junction is

Answer» Two metal plates A and B are soldered together ad in fug. A=100cm^2, x1=x2=4mm,T1=120°C,T2=0°C. Thermal conductivity of A and B are 50 and 80 W/mK. The temperature of the soldered junction is
49.

Which of the following will have sp2 hybridisation?

Answer»

Which of the following will have sp2 hybridisation?

50.

Which of the following oxides shows electrical properties like metals ? (a) SiO2 (b) MgO (c) SO2()s (d) CrO2

Answer»

Which of the following oxides shows electrical properties like metals ?

(a) SiO2 (b) MgO (c) SO2()s (d) CrO2