This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.
| 1. |
how to find what is the major compound in aldol condensation |
| Answer» how to find what is the major compound in aldol condensation | |
| 2. |
The power of halides of boron to act as Lewis acids decreases in the order: |
|
Answer» The power of halides of boron to act as Lewis acids decreases in the order: |
|
| 3. |
How many of the following are resolvable. |
Answer» How many of the following are resolvable.![]() |
|
| 4. |
Oxidation number of carbon in C3O2 ,Mg2C3,are respectively |
|
Answer» Oxidation number of carbon in C3O2 ,Mg2C3,are respectively |
|
| 5. |
How to find hybridisation using crystal field theory |
| Answer» How to find hybridisation using crystal field theory | |
| 6. |
in haber process 30 litres ofdihydrogen and 30 litres ofdinitrogen were taken for reaction which yielded only 50%of the expected product.what will be the composition of gaseous mixture under the aforesaid condition in the end |
| Answer» in haber process 30 litres ofdihydrogen and 30 litres ofdinitrogen were taken for reaction which yielded only 50%of the expected product.what will be the composition of gaseous mixture under the aforesaid condition in the end | |
| 7. |
Which of the following compounds reduce(s) ammoniacal silver nitrate solution?C6H5CHOCH3CH2CHOCH3CH2OHCH3CH(OH)COCH3 |
|
Answer» Which of the following compounds reduce(s) ammoniacal silver nitrate solution? |
|
| 8. |
10 g of CaCO3 is completely decomposed to X and CaO. X is passed into an aqueous solution containing one mole of sodium carbonate. What is the number of moles of sodium bicarbonate formed? |
|
Answer» 10 g of CaCO3 is completely decomposed to X and CaO. X is passed into an aqueous solution containing one mole of sodium carbonate. What is the number of moles of sodium bicarbonate formed? |
|
| 9. |
Predict the general formula for the given unit cell. |
|
Answer» Predict the general formula for the given unit cell. |
|
| 10. |
How to learn preodic table? |
| Answer» How to learn preodic table? | |
| 11. |
What are the alpha particles? |
| Answer» What are the alpha particles? | |
| 12. |
Atank is filled with water to a height of 12.5 cm. The apparentdepth of a needle lying at the bottom of the tank is measured by amicroscope to be 9.4 cm. What is the refractive index of water? Ifwater is replaced by a liquid of refractive index 1.63 up to the sameheight, by what distance would the microscope have to be moved tofocus on the needle again? |
|
Answer» A |
|
| 13. |
On the basis of LCAO – MO theory the magnetic characteristics of N2 and N+2 are: |
|
Answer» On the basis of LCAO – MO theory the magnetic characteristics of N2 and N+2 are: |
|
| 14. |
Briefly explain the formation of bakelite with proper chemical equations |
| Answer» Briefly explain the formation of bakelite with proper chemical equations | |
| 15. |
Why the slowest step of reaction is the rate determining step of the reaction? Give reason and explanation? |
| Answer» Why the slowest step of reaction is the rate determining step of the reaction? Give reason and explanation? | |
| 16. |
The IUPAC name of the compound? |
|
Answer» The IUPAC name of the compound? |
|
| 17. |
If the radius of 3rd Bohr’s orbit of H-atom is r, then the radius of 4th Bohr’s orbit of He+ would be |
|
Answer» If the radius of 3rd Bohr’s orbit of H-atom is r, then the radius of 4th Bohr’s orbit of He+ would be |
|
| 18. |
For "16.8 V" H2O2 solution ( density = 0.95 g/ml), calculate :-1. Molarity2. Molality3. % w/w4. % w/v5. ppm of solute6. mole fraction of solute |
|
Answer» For "16.8 V" H2O2 solution ( density = 0.95 g/ml), calculate :- 1. Molarity 2. Molality 3. % w/w 4. % w/v 5. ppm of solute 6. mole fraction of solute |
|
| 19. |
how to know stable carbocation |
| Answer» how to know stable carbocation | |
| 20. |
n1 and n2 moles of two ideal gases (mol. wt. M1 and M2) respectively at temperature T1K and T2K are mixed. Assuming that no loss of energy, the temperature of mixture becomes - |
|
Answer» n1 and n2 moles of two ideal gases (mol. wt. M1 and M2) respectively at temperature T1K and T2K are mixed. Assuming that no loss of energy, the temperature of mixture becomes - |
|
| 21. |
the number of octahedral void present per atom in a cubic close packed structure is |
| Answer» the number of octahedral void present per atom in a cubic close packed structure is | |
| 22. |
nitrogen cycl |
| Answer» nitrogen cycl | |
| 23. |
Arrange water, ethanol and phenol in increasing order of acidity and give reason for your answer. |
|
Answer» Arrange water, ethanol and phenol in increasing order of acidity and give reason for your answer. |
|
| 24. |
What is homothellic and monoecious |
| Answer» What is homothellic and monoecious | |
| 25. |
41. What is the mass percentage ofetganoic acid in vinegar when 5g of sample of vinegar is titrated with 39.1 ml of 0.108 M NaOH for complete neutralisation? |
| Answer» 41. What is the mass percentage ofetganoic acid in vinegar when 5g of sample of vinegar is titrated with 39.1 ml of 0.108 M NaOH for complete neutralisation? | |
| 26. |
how many isomer of C6H12 containing cyclobutane ring ?(including stereoisomers) |
| Answer» how many isomer of C6H12 containing cyclobutane ring ?(including stereoisomers) | |
| 27. |
what volume of oxygen at STPis required to affect the combustion of 11 litres of ethylene \lbrack C2H4\rbrack at 273 degree celciusand 380 mm of Hg pressure? |
| Answer» what volume of oxygen at STPis required to affect the combustion of 11 litres of ethylene \lbrack C2H4\rbrack at 273 degree celciusand 380 mm of Hg pressure? | |
| 28. |
Which of the following compounds will not give a positive test with Tollens' reagent? |
|
Answer» Which of the following compounds will not give a positive test with Tollens' reagent? |
|
| 29. |
75.Which of the following complexes is expected to absorb visible light? a)[Sc(H2O)3(NH3)3]+3 b)[Ti(en)2(NH3)2]+4 c)[Cr(NH3)6]+3 d)[Zn(NH3)6]+2 In general cases like this, how to predict the colour absorbed by the compound? |
| Answer» 75.Which of the following complexes is expected to absorb visible light? a)[Sc(H2O)3(NH3)3]+3 b)[Ti(en)2(NH3)2]+4 c)[Cr(NH3)6]+3 d)[Zn(NH3)6]+2 In general cases like this, how to predict the colour absorbed by the compound? | |
| 30. |
Ammonia kept under pressure of 15 atm at 270C is heated to 3470C in a closed vessel in the presence of catalyst. Under these conditions, NH3 is partially decomposed according to the equation, 2NH3⇋N2+3H2. The vessel is such that the volume remains effectively constant whereas pressure increases to 50 atm. Calculate the percentage of NH3 actually decomposed. |
|
Answer» Ammonia kept under pressure of 15 atm at 270C is heated to 3470C in a closed vessel in the presence of catalyst. Under these conditions, NH3 is partially decomposed according to the equation, 2NH3⇋N2+3H2. The vessel is such that the volume remains effectively constant whereas pressure increases to 50 atm. Calculate the percentage of NH3 actually decomposed. |
|
| 31. |
△ G no(std) of reversible reaction at its euilibrium is positive or negative |
| Answer» △ G no(std) of reversible reaction at its euilibrium is positive or negative | |
| 32. |
4. The octahedral complex of a metal ion M3+ with four monodentate ligands L1, L2, L3 and L4 absorb wavelengths in the region of red, green, yellow and blue, respectively. The increasing order of ligand strength of the four ligands is: (1) L3 < L2 < L4 < L1 (2) L1 < L2 < L4 < L3 (3) L4 < L3 < L2 < L1 4) L1 < L3 < L2 < L4 |
| Answer» 4. The octahedral complex of a metal ion M3+ with four monodentate ligands L1, L2, L3 and L4 absorb wavelengths in the region of red, green, yellow and blue, respectively. The increasing order of ligand strength of the four ligands is: (1) L3 < L2 < L4 < L1 (2) L1 < L2 < L4 < L3 (3) L4 < L3 < L2 < L1 4) L1 < L3 < L2 < L4 | |
| 33. |
Lithium boron hydride crystallizes in an orthorhombic system with 4 molecules per unit cell. Dimensions of the unit cell are: a=6∘A,b=4∘A and c=7 ∘A.If the molar mass is 21 g, calculate the density of crystal. |
|
Answer» Lithium boron hydride crystallizes in an orthorhombic system with 4 molecules per unit cell. Dimensions of the unit cell are: |
|
| 34. |
What is Aqua dag? |
| Answer» What is Aqua dag? | |
| 35. |
What is nodal plane and explain it's features |
|
Answer» What is nodal plane and explain it's features |
|
| 36. |
15. 87.5% of a first order reaction is 300 seconds and then value of 93.7%will be |
| Answer» 15. 87.5% of a first order reaction is 300 seconds and then value of 93.7%will be | |
| 37. |
Listen and complete with the words given.Je, ans, Paris, frère, français |
|
Answer» Listen and complete with the words given. Je, ans, Paris, frère, français |
|
| 38. |
35. When a metal is burnt it's weight is increased by 25% the equivalent weight of the metal will be ? |
| Answer» 35. When a metal is burnt it's weight is increased by 25% the equivalent weight of the metal will be ? | |
| 39. |
What is trihydroxypropane? |
| Answer» What is trihydroxypropane? | |
| 40. |
Selenium monochloride exists as a dimer. It disproportionate to give: |
|
Answer» Selenium monochloride exists as a dimer. It disproportionate to give: |
|
| 41. |
Which of the following relation is true for cubical voids?Where, R is radius of sphere r is radius of octahedral void a is edge length of unit cell |
|
Answer» Which of the following relation is true for cubical voids? |
|
| 42. |
How to determine isomers on the basis of the types of ligands? |
| Answer» How to determine isomers on the basis of the types of ligands? | |
| 43. |
H2O2 cannot oxidize: |
|
Answer» H2O2 cannot oxidize: |
|
| 44. |
39.The enthalpies of neutralization of a weak base AOH and a strong base BOH by HCl are -12250cal/mol and -13000cal/mol respectively. When one mole of HCl is added to a solution containing 1 mole of AOH and 1mole of BOH, the enthalpy change was -12500cal/mol.In what ratio is the acid distribution between AOH and BOH? |
| Answer» 39.The enthalpies of neutralization of a weak base AOH and a strong base BOH by HCl are -12250cal/mol and -13000cal/mol respectively. When one mole of HCl is added to a solution containing 1 mole of AOH and 1mole of BOH, the enthalpy change was -12500cal/mol.In what ratio is the acid distribution between AOH and BOH? | |
| 45. |
The nitrogen oxides that contain N – N bond(s) is: |
|
Answer» The nitrogen oxides that contain N – N bond(s) is: |
|
| 46. |
1. Assertion: Maleic acid shows geometrical isomerism. Reason: it has -C=C- bond. |
| Answer» 1. Assertion: Maleic acid shows geometrical isomerism. Reason: it has -C=C- bond. | |
| 47. |
the number of unpaired electrons in complex ion [cof6]-3 is |
| Answer» the number of unpaired electrons in complex ion [cof6]-3 is | |
| 48. |
how dien and yne show functional isomeris |
| Answer» how dien and yne show functional isomeris | |
| 49. |
The number of structural isomers possible from the molecular formula C3H9N is: |
|
Answer» The number of structural isomers possible from the molecular formula C3H9N is: |
|
| 50. |
The wave number of the limiting line of Balmer series of hydrogen spectrum is |
|
Answer» The wave number of the limiting line of Balmer series of hydrogen spectrum is |
|