Explore topic-wise InterviewSolutions in Current Affairs.

This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.

1.

Drawthe structures of the following compounds.(i) 3-Methylbutanal (ii) p-Nitropropiophenone(iii) p-Methylbenzaldehyde (iv) 4-Methylpent-3-en-2-one(v) 4-Chloropentan-2-one (vi) 3-Bromo-4-phenylpentanoicacid(vii) p,p’-Dihydroxybenzophenone (viii) Hex-2-en-4-ynoicacid

Answer»

Draw
the structures of the following compounds.


(i)
3-Methylbutanal
(ii) p-Nitropropiophenone


(iii)
p-Methylbenzaldehyde
(iv) 4-Methylpent-3-en-2-one


(v)
4-Chloropentan-2-one
(vi) 3-Bromo-4-phenylpentanoic
acid


(vii)
p
,p’-Dihydroxybenzophenone
(viii) Hex-2-en-4-ynoic
acid

2.

77 The second coordination number of cl- in the Nacl unit is?? Explain how to find 2nd. C.N.

Answer» 77 The second coordination number of cl- in the Nacl unit is?? Explain how to find 2nd. C.N.
3.

How many significant figures are there in 2020 ?

Answer» How many significant figures are there in 2020 ?
4.

The total number of electrons present in 5.6 L of methane gas at STP is:

Answer»

The total number of electrons present in 5.6 L of methane gas at STP is:

5.

25 mL of an aqueous solution of KCl was found to require 20 mL of 1 MAgNO3 solution when titrated using a K2CrO4 as indicator. The depression in freezing point of KCl solution with 100% ionization will be: [Kt=2oC.kg mol–1 and molarity = molality]

Answer»

25 mL of an aqueous solution of KCl was found to require 20 mL of 1 MAgNO3 solution when titrated using a K2CrO4 as indicator. The depression in freezing point of KCl solution with 100% ionization will be:
[Kt=2oC.kg mol–1 and molarity = molality]


6.

Which one of the following is not a surfactant?

Answer»

Which one of the following is not a surfactant?

7.

96.What is the hybridisation of carbon suboxide?

Answer» 96.What is the hybridisation of carbon suboxide?
8.

For a dilute solution containing 2.5 g of a non-volatile non-electrolyte in 100 g of water, the elevation in boiling point at 1 atm pressure is 2oC. Assuming concentration of solute is much lower than the concentration of solvent, the vapour pressure (mm of Hg) of the solution is (take Kb=0.76 K kg mol−1)

Answer»

For a dilute solution containing 2.5 g of a non-volatile non-electrolyte in 100 g of water, the elevation in boiling point at 1 atm pressure is 2oC. Assuming concentration of solute is much lower than the concentration of solvent, the vapour pressure (mm of Hg) of the solution is (take Kb=0.76 K kg mol−1)

9.

One mole of an unsaturated hydrocarbon on ozonolysis gives one mole each of CH3CHO,HCHO and OHC−CHO. The hydrocarbon is:

Answer»

One mole of an unsaturated hydrocarbon on ozonolysis gives one mole each of CH3CHO,HCHO and OHC−CHO. The hydrocarbon is:

10.

What is the difference between physisorption and chemisorption?

Answer»

What is the difference
between physisorption and chemisorption?

11.

Which one is a chain growth polymer

Answer»

Which one is a chain growth polymer


12.

the energy stored in 60cm length of a large electromagnetic beam operating at 4mW is ?

Answer» the energy stored in 60cm length of a large electromagnetic beam operating at 4mW is ?
13.

61.how to find bond order of compounds like CO, NH4+etc?

Answer» 61.how to find bond order of compounds like CO, NH4+etc?
14.

Which of the following carbocations is expected to be most stable?

Answer»

Which of the following carbocations is expected to be most stable?

15.

31. Why +R is not effective on meta hydroxy benzene

Answer» 31. Why +R is not effective on meta hydroxy benzene
16.

The number of chlorine atoms in 20 mL of chlorine gas at STP is x×1021. The value of x (Rounded off to the Nearest integer) is .[Assume chlorine is an ideal gas at STP, NA=6.023×1023]

Answer» The number of chlorine atoms in 20 mL of chlorine gas at STP is x×1021. The value of x (Rounded off to the Nearest integer) is

.

[Assume chlorine is an ideal gas at STP,

NA=6.023×1023]
17.

How to locate tetrahedral qnd octahedral void in fcc

Answer» How to locate tetrahedral qnd octahedral void in fcc
18.

Arrange the following compounds in increasing order of their reactivity in nucleophilic addition reactions.(i) Ethanal, Propanal, Propanone, Butanone.(ii) Benzaldehyde, p-Tolualdehyde, p-Nitrobenzaldehyde, Acetophenone.Hint: Consider steric effect and electronic effect.

Answer»

Arrange the following compounds in increasing order of their reactivity in nucleophilic addition reactions.

(i) Ethanal, Propanal, Propanone, Butanone.

(ii) Benzaldehyde, p-Tolualdehyde, p-Nitrobenzaldehyde, Acetophenone.

Hint: Consider steric effect and electronic effect.

19.

Why the stability of + 2 Oxidation state of chromium more than +2 OS of Cobalt??

Answer» Why the stability of + 2 Oxidation state of chromium more than +2 OS of Cobalt??
20.

Which of the following is not a polyamide? [AFMC 2000; CBSE PMT 2001; KCET 2001]

Answer»

Which of the following is not a polyamide?

[AFMC 2000; CBSE PMT 2001; KCET 2001]


21.

Molar conductivity (Λm) of an aqueous solution of sodium stearate, which behaves as a strong electrolyte, isrecorded at varying concentrations (c) of sodium stearate. Which one of the following plots provides thecorrect representation of micelle formation in the solution?(critical micelle concentration (CMC) is marked with an arrow in the figures)

Answer»

Molar conductivity (Λm) of an aqueous solution of sodium stearate, which behaves as a strong electrolyte, is

recorded at varying concentrations (c) of sodium stearate. Which one of the following plots provides the

correct representation of micelle formation in the solution?

(critical micelle concentration (CMC) is marked with an arrow in the figures)

22.

Why is POP used for setting fractured bones?

Answer»

Why is POP used for setting fractured bones?



23.

n = 3, l = 1, m = –2, s = –1/2 is it possible ? in electronic configuration\backslash

Answer» n = 3, l = 1, m = –2, s = –1/2 is it possible ? in electronic configuration\backslash
24.

Equilibrium constant of T2O (T or 31H is an isotope of 11H) and H2O are different at 298 K. At 298 K, pure T2O has pT (like pH) of 7.62. The pT of a solution prepared by adding 10 mL of 0.2 M TCl to 15 mL of 0.25 M NaOT is:

Answer»

Equilibrium constant of T2O (T or 31H is an isotope of 11H) and H2O are different at 298 K. At 298 K, pure T2O has pT (like pH) of 7.62. The pT of a solution prepared by adding 10 mL of 0.2 M TCl to 15 mL of 0.25 M NaOT is:

25.

Which of the following pairs of compounds does not represent structural isomerism?

Answer»

Which of the following pairs of compounds does not represent structural isomerism?

26.

One mole of a monoatomic real gas satisfies the equation p(V−b)=RT where, b is a constant. The correct relationship between interatomic potential V(r) and interatomic distance r for the gas is given by:

Answer»

One mole of a monoatomic real gas satisfies the equation p(V−b)=RT where, b is a constant. The correct relationship between interatomic potential V(r) and interatomic distance r for the gas is given by:

27.

87. S is a set with n elements. p and q are subsets chosen from S. What is the probability that p and q have exactly r common elements?

Answer» 87. S is a set with n elements. p and q are subsets chosen from S. What is the probability that p and q have exactly r common elements?
28.

The absolute configuration of

Answer»

The absolute configuration of


29.

4 Cyclohexa-1,4-diene reacts with NBS to form : ? (Is there any rearrangement?)

Answer» 4 Cyclohexa-1,4-diene reacts with NBS to form : ? (Is there any rearrangement?)
30.

why fluorine is more electronegative than oxygen.

Answer» why fluorine is more electronegative than oxygen.
31.

The reactivity of compound Z with different halogens under appropriate conditions is given below The observed pattern of electrophilic substitution can be explain by

Answer»

The reactivity of compound Z with different halogens under appropriate conditions is given below

The observed pattern of electrophilic substitution can be explain by


32.

In which of the following molecules, all atoms are coplanar ?

Answer»

In which of the following molecules, all atoms are coplanar ?

33.

Among these compounds, the order of heats of hydrogenation is:

Answer»

Among these compounds, the order of heats of hydrogenation is:


34.

21.which is paramagnetic

Answer» 21.which is paramagnetic
35.

32. What is the exact functioning of LiAlH4 and LiBH4? How does it vary from NaBH4? Is it different for different substrates as such?

Answer» 32. What is the exact functioning of LiAlH4 and LiBH4? How does it vary from NaBH4? Is it different for different substrates as such?
36.

50. Hydrogen peroxide in aqueous solution decomposes on warming to give oxygen according to the equation 2H2O2(aq) --≥ 2H2O(l) +O2(g) (under conditions where one mole of gas occupies 24dm3). 100 dm3 of `X` M solution of H2O2 produces 3dm3 of O2 .thus X is?

Answer» 50. Hydrogen peroxide in aqueous solution decomposes on warming to give oxygen according to the equation 2H2O2(aq) --≥ 2H2O(l) +O2(g) (under conditions where one mole of gas occupies 24dm3). 100 dm3 of `X` M solution of H2O2 produces 3dm3 of O2 .thus X is?
37.

What is pi electron

Answer» What is pi electron
38.

why we take X=0 in the formula H=1/2(V+X-C+A) while prediction of hybridisation of NO3-

Answer» why we take X=0 in the formula H=1/2(V+X-C+A) while prediction of hybridisation of NO3-
39.

95.Q) CH3CH2CH2OCH3 and (CH3)2CHOCH3 are which of them and why? options 1)chain isomers 2) position isomers 3) ring chain isomers 4) funtional isomer

Answer» 95.Q) CH3CH2CH2OCH3 and (CH3)2CHOCH3 are which of them and why? options 1)chain isomers 2) position isomers 3) ring chain isomers 4) funtional isomer
40.

A sample of hydrated sodium phosphate has a mass of 190g . Of this 108g is the mass of water of crystallisation . What is the molar mass of the hydrated sodium phosphate.

Answer» A sample of hydrated sodium phosphate has a mass of 190g . Of this 108g is the mass of water of crystallisation . What is the molar mass of the hydrated sodium phosphate.
41.

how to find electronic configuration of any given element

Answer» how to find electronic configuration of any given element
42.

what is the oxidation no. of Cl in HClO4?

Answer» what is the oxidation no. of Cl in HClO4?
43.

Which is a good absorber of neutrons ? Uranium 235 or Uranium 238 ?

Answer» Which is a good absorber of neutrons ? Uranium 235 or Uranium 238 ?
44.

What is line spectrum? Is it same as emission spectrum ?

Answer» What is line spectrum? Is it same as emission spectrum ?
45.

Different between atom & molecul

Answer» Different between atom & molecul
46.

A piston filled with 0.04 mole of an ideal gas expand reversibly from 50.0mL to 375 mL at a consumed temperature of 37.0∘C. As it does so, it absorbs 208∘C heat. The values of q and W for the process will be (R = 8.314J/mol K, In 7.5 = 2.01)

Answer» A piston filled with 0.04 mole of an ideal gas expand reversibly from 50.0mL to 375 mL at a consumed temperature of 37.0∘C. As it does so, it absorbs 208∘C heat. The values of q and W for the process will be
(R = 8.314J/mol K, In 7.5 = 2.01)
47.

Tetragonal system has which of the following dimensions?

Answer»

Tetragonal system has which of the following dimensions?



48.

The two strands of DNA are held together by bonds of

Answer» The two strands of DNA are held together by bonds of
49.

The half life period for a first order reaction is 69.3s. Its rate constant is

Answer» The half life period for a first order reaction is 69.3s. Its rate constant is
50.

Identify Z in the following reaction sequence, CH2 = CH2HBr−−−→xAg. NaOH−−−−−−→YNa2CO3/Excess I2−−−−−−−−−−−−→

Answer»

Identify Z in the following reaction sequence, CH2 = CH2HBr−−−→xAg. NaOH−−−−−−→YNa2CO3/Excess I2−−−−−−−−−−−−→