This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.
| 1. |
18.Explain whether the following pairs show common ion effect or not : (a) NaCl+HCl (b) AgCN + KCN |
| Answer» 18.Explain whether the following pairs show common ion effect or not : (a) NaCl+HCl (b) AgCN + KCN | |
| 2. |
32 Which of the following on treatment with 50% aqueous NaOH gives alcohol and acid ? A C6H5CHO B CH3CH2CH2CHO C CH3COCH3 D C6H5CH2CHO |
| Answer» 32 Which of the following on treatment with 50% aqueous NaOH gives alcohol and acid ? A C6H5CHO B CH3CH2CH2CHO C CH3COCH3 D C6H5CH2CHO | |
| 3. |
Ammonium carbamate when heated to 200^° C gives a mixture of NH3 and CO2 vapours with a density of 16.0. What is the degree of dissociationof ammonium carbamate? |
| Answer» Ammonium carbamate when heated to 200^° C gives a mixture of NH3 and CO2 vapours with a density of 16.0. What is the degree of dissociationof ammonium carbamate? | |
| 4. |
For a monatomic gas, kinetic energy is E. The relation of E with rms velocity is |
|
Answer» For a monatomic gas, kinetic energy is E. The relation of E with rms velocity is |
|
| 5. |
FeC2O4+KMnO4+H2SO4→Fe2(SO4)3+CO2+MnSO4+K2SO4+H2OThe n− factor for FeC2O4 in the above reaction is: |
|
Answer» FeC2O4+KMnO4+H2SO4→Fe2(SO4)3+CO2+MnSO4+K2SO4+H2O The n− factor for FeC2O4 in the above reaction is: |
|
| 6. |
Which of the following compounds is aromatic alcohol? (a) A, B, C, D (b) A, D (c) B, C (d) A |
|
Answer» Which of the following compounds is aromatic alcohol? |
|
| 7. |
8. total valence electron in water is? |
| Answer» 8. total valence electron in water is? | |
| 8. |
Consider following equilibrium at 400 K and 30 atm3A(g)⇌2B(g)+2C(g)+D(g)If the equilibrium pressure of A is 5 atm then Kc will be: |
|
Answer» Consider following equilibrium at 400 K and 30 atm |
|
| 9. |
a^2-b^2-(a+b)^2 |
| Answer» a^2-b^2-(a+b)^2 | |
| 10. |
Pcl4- == hybridisation |
| Answer» Pcl4- == hybridisation | |
| 11. |
IF CH2-X is called trihalogen compound then what CHX3 is called I CH2-X I CH2-X |
|
Answer» IF CH2-X is called trihalogen compound then what CHX3 is called I CH2-X I CH2-X |
|
| 12. |
What are alloys? Name an important alloy which contains some of the lanthanoid metals. Mention its uses. |
|
Answer» What
|
|
| 13. |
200ml of decimolar h2so4 and 300ml of decimolar hcl mixture is treated with m/5 naoh solution. For complete neutralusation of acid mixture, volume of naoh required is |
| Answer» 200ml of decimolar h2so4 and 300ml of decimolar hcl mixture is treated with m/5 naoh solution. For complete neutralusation of acid mixture, volume of naoh required is | |
| 14. |
There are 3 different apples, 4 alike bananas and 5 alike grapes, in how many ways we can select 5 fruits? |
| Answer» There are 3 different apples, 4 alike bananas and 5 alike grapes, in how many ways we can select 5 fruits? | |
| 15. |
When ethyl chloride is added to Sodium tert-butoxide, ethyl tert-butyl ether is obtained as the major product (shown below): What happens to the rate if the temperature is increased? |
|
Answer» When ethyl chloride is added to Sodium tert-butoxide, ethyl tert-butyl ether is obtained as the major product (shown below): What happens to the rate if the temperature is increased? |
|
| 16. |
momentrum |
| Answer» momentrum | |
| 17. |
The rate constant of a reaction is 1.2*10-2 mol-2L2 s-1. The order of the reaction is |
| Answer» The rate constant of a reaction is 1.2*10-2 mol-2L2 s-1. The order of the reaction is | |
| 18. |
The radius of the second Bohr orbit for hydrogen atom is:(Planck’s constant h=6.6262×10−34Js; mass of an electron =9.1091×10−31kg; charge of an electrone=1.60210×10−19C; permittivity of vacuum ϵϕ=8.854185×10−12kg−1m−3A2) |
|
Answer» The radius of the second Bohr orbit for hydrogen atom is: |
|
| 19. |
The chemistry of the actinoid elements is not so smooth as that of the Lanthanoids. Justify this statement by giving some examples from the oxidation state of these elements. |
|
Answer» The
|
|
| 20. |
an aromatic compound like toluene free radical (free radical is the methyl part) can exhibit resonance to form an anti aromatic compound so will toluene free radical exhibit resonance or not? |
| Answer» an aromatic compound like toluene free radical (free radical is the methyl part) can exhibit resonance to form an anti aromatic compound so will toluene free radical exhibit resonance or not? | |
| 21. |
Which of the following complexes show linkage isomerism? (a) [Co(NH3)5(NO2)]2+ (b) [Co(H2O)5CO]3+ (c) [Cr(NH3)5]SCN2+ (d) [Fe(en)2Cl2]+ |
|
Answer» Which of the following complexes show linkage isomerism? |
|
| 22. |
What change would you observe if a silver coin is immersed in hydrochloric acid and kept for many hours? |
|
Answer» What change would you observe if a silver coin is immersed in hydrochloric acid and kept for many hours? |
|
| 23. |
In hydrogen like species energy depends on??And in multi electron species energy depends on?? |
|
Answer» In hydrogen like species energy depends on?? And in multi electron species energy depends on?? |
|
| 24. |
48.Which orbital is used by oxygen atom to form a sigma bond with other oxygen atom in O2 molecule |
| Answer» 48.Which orbital is used by oxygen atom to form a sigma bond with other oxygen atom in O2 molecule | |
| 25. |
The compounds used as refrigerant are |
|
Answer» The compounds used as refrigerant are |
|
| 26. |
The vapour pressure of two liquids P and Q are 80 and 60 torr, respectively. The total vapour pressure of the ideal solution obtained by mixing 3 mole of P and 2 mol of Q would be: |
|
Answer» The vapour pressure of two liquids P and Q are 80 and 60 torr, respectively. The total vapour pressure of the ideal solution obtained by mixing 3 mole of P and 2 mol of Q would be: |
|
| 27. |
When HCL react with Fe it form FeCl2 not FeCl3 why? |
| Answer» When HCL react with Fe it form FeCl2 not FeCl3 why? | |
| 28. |
9.If equivalent weight of meal hydide is 13 , then the equivalent weight of metal oxide is? |
| Answer» 9.If equivalent weight of meal hydide is 13 , then the equivalent weight of metal oxide is? | |
| 29. |
2. 0.1092 of certain diabasic organic acid neutralized 21ml of decinormal solution of NaOH. The molar mass of acid is |
| Answer» 2. 0.1092 of certain diabasic organic acid neutralized 21ml of decinormal solution of NaOH. The molar mass of acid is | |
| 30. |
What is spin quantum?? |
| Answer» What is spin quantum?? | |
| 31. |
Which of the following reaction can produce boron nitride 'BN' |
|
Answer» Which of the following reaction can produce boron nitride 'BN' |
|
| 32. |
Consider the following reactions.EthanolPBr3−−−→Xalc. KOH−−−−−−→YKMnO4−−−−−−−−−−−−→(cold dilute alkaline) |
|
Answer» Consider the following reactions. |
|
| 33. |
Given that the vapour pressure of benzaldehyde is 400 torr at 154^° C and its normal boiling point is 179^° C . what is its molar enthalpy of vapourisation ? |
| Answer» Given that the vapour pressure of benzaldehyde is 400 torr at 154^° C and its normal boiling point is 179^° C . what is its molar enthalpy of vapourisation ? | |
| 34. |
Which of the following compounds is chiral? |
|
Answer» Which of the following compounds is chiral? |
|
| 35. |
The complexes given below are: |
Answer» The complexes given below are:![]() |
|
| 36. |
Which of the following are responsible for tertiary structure of proteins1) Hydrogen bonding 2) Disulphide linkage 3) Hydrophobic interactions 4) Ionic bond The correct answer is |
|
Answer» Which of the following are responsible for tertiary structure of proteins 1) Hydrogen bonding 2) Disulphide linkage 3) Hydrophobic interactions 4) Ionic bond
The correct answer is |
|
| 37. |
1089 If enthalpy of solution of BaCl,(s) andBaCl2.2H20(s) respectively are -x and -y kJ mol-1then enthalpy change (in kJ mol-1) for thehydation of BaCl2(s) isbutLt12(2) x-y(4) x+ y(3) у †extemdash хThe antronu channe wrhon onA mole of an idealan |
| Answer» 1089 If enthalpy of solution of BaCl,(s) andBaCl2.2H20(s) respectively are -x and -y kJ mol-1then enthalpy change (in kJ mol-1) for thehydation of BaCl2(s) isbutLt12(2) x-y(4) x+ y(3) у †extemdash хThe antronu channe wrhon onA mole of an idealan | |
| 38. |
BaSO4 is least soluble in 1. BaCl22. H2O3. Al2(SO4)34. AgNO3 |
|
Answer» BaSO4 is least soluble in 1. BaCl2 2. H2O 3. Al2(SO4)3 4. AgNO3 |
|
| 39. |
do drops and bubbles coalease in the same way or both have different formulas and concept? |
| Answer» do drops and bubbles coalease in the same way or both have different formulas and concept? | |
| 40. |
In faintly alkaline solution 4 moles of permaganate anoin quantitatively oxidise thiosulphate anoin to produce X moles of sulphate anion. tha value of X is 1. 82. 63. 44. 3 |
| Answer» In faintly alkaline solution 4 moles of permaganate anoin quantitatively oxidise thiosulphate anoin to produce X moles of sulphate anion. tha value of X is 1. 82. 63. 44. 3 | |
| 41. |
There is a loss in mass when mixture of Li2CO3 and Na2CO3 . 10H2O is heated strongly . The loss is due to : |
| Answer» There is a loss in mass when mixture of Li2CO3 and Na2CO3 . 10H2O is heated strongly . The loss is due to : | |
| 42. |
Why thallium forms an oxygen layer when it reacts with air? |
| Answer» Why thallium forms an oxygen layer when it reacts with air? | |
| 43. |
A 5% solution of a cane sugar has freezing point of 271 k. Calculate the freezing point of a 5% glucose in water if freezing point of pure water is 273.15 kelvin |
| Answer» A 5% solution of a cane sugar has freezing point of 271 k. Calculate the freezing point of a 5% glucose in water if freezing point of pure water is 273.15 kelvin | |
| 44. |
A cylinder of cross-section area A has two piston of negligible mass separated by distance l loaded with spring of negligible mass. An ideal gas at temperature T1 is in the cylinder where the springs are relaxed. When the gas is heated by some means its temperature becomes T2 and the springs get compressed by l/2 each. If P0 is atmospheric pressure and spring constant k=2P0Al, then find the ratio of T2 and T1. (Answer upto two digit after the decimal point) |
|
Answer» A cylinder of cross-section area A has two piston of negligible mass separated by distance l loaded with spring of negligible mass. An ideal gas at temperature T1 is in the cylinder where the springs are relaxed. When the gas is heated by some means its temperature becomes T2 and the springs get compressed by l/2 each. If P0 is atmospheric pressure and spring constant k=2P0Al, then find the ratio of T2 and T1. |
|
| 45. |
83. On addition of 1mL of 10% of NaCl solution to 10mL gold sol in presence of 0.025g of starch, the coagulation is just prevented. starch has a gold number of |
| Answer» 83. On addition of 1mL of 10% of NaCl solution to 10mL gold sol in presence of 0.025g of starch, the coagulation is just prevented. starch has a gold number of | |
| 46. |
On a given condition , the equilibrium concentration of HI, H2 and I2 are 0.80,0.10 and 0.10 mole/litre the equilibrium constant for the reaction H2+I2⇌2HI will be: |
|
Answer» On a given condition , the equilibrium concentration of HI, H2 and I2 are 0.80,0.10 and 0.10 mole/litre the equilibrium constant for the reaction H2+I2⇌2HI will be: |
|
| 47. |
24.What is redox potential scale?? |
| Answer» 24.What is redox potential scale?? | |
| 48. |
Estimate the change in the density of water in ocean at a depth of 400 m below the surface. The density of water at the surface = 1030 kgm−3 and the bulk modulus of water = 2×109Nm−2. |
|
Answer» Estimate the change in the density of water in ocean at a depth of 400 m below the surface. The density of water at the surface = 1030 kgm−3 and the bulk modulus of water = 2×109Nm−2. |
|
| 49. |
Name a compound of each type and draw the figure.(a) Cyclic compound with single bond.(b) Cyclic compound with triple bond. |
|
Answer» Name a compound of each type and draw the figure. (a) Cyclic compound with single bond. (b) Cyclic compound with triple bond. |
|
| 50. |
Volume of CO2 obtained at STP by the complete decomposition of 9.85 gm BaCO3 is |
| Answer» Volume of CO2 obtained at STP by the complete decomposition of 9.85 gm BaCO3 is | |