46295 + Interview Questions in Chemistry

1.	18. In the graphical representation of equilibrium state there was a point where the slope of the product & reactant met each other.Why that point is not considered as the equilibrium point?
Answer» 18. In the graphical representation of equilibrium state there was a point where the slope of the product & reactant met each other.Why that point is not considered as the equilibrium point?

Discussion

2.	The nuclear reactions accompanied with emission of neutron(s) are:
Answer» The nuclear reactions accompanied with emission of neutron(s) are:

Discussion

3.	What is meant by formula mass? Explain it elaborately.
Answer» What is meant by formula mass? Explain it elaborately.

Discussion

4.	iupac name of (c2h5)2
Answer» iupac name of (c2h5)2

Discussion

5.	When CuSO4 is treated with excess KCN solution, what compound(s) is/are formed?
Answer» When $C u S O_{4}$ is treated with excess KCN solution, what compound(s) is/are formed?

Discussion

6.	In the reaction N2(g) + 3H2(g) ⇌ 2NH3(g), the value of the equilibriumconstant depends on
Answer» In the reaction $N_{2} (g) + 3 H_{2} (g) ⇌ 2 N H_{3} (g)$ , the value of the equilibrium constant depends on

6.

In the reaction N2(g) + 3H2(g) ⇌ 2NH3(g), the value of the equilibriumconstant depends on

Answer»

In the reaction $N_{2} (g) + 3 H_{2} (g) ⇌ 2 N H_{3} (g)$ , the value of the equilibrium

constant depends on

Discussion

7.	For which of the following molecule significant μ≠0?(a) (b) (c) (d)
Answer» For which of the following molecule significant $μ \neq 0$ ? (a) (b) (c) (d)

7.

For which of the following molecule significant μ≠0?(a) (b) (c) (d)

Answer»

For which of the following molecule significant $μ \neq 0$ ?

(a) (b)

(c) (d)

Discussion

8.	The IUPAC name of the compoundH3C−CH\|C2H5−CH\|C2H5−CH3
Answer» The IUPAC name of the compound $H_{3} C - C H \| C_{2} H_{5} - C H \| C_{2} H_{5} - C H_{3}$

8.

The IUPAC name of the compoundH3C−CH|C2H5−CH|C2H5−CH3

Answer»

The IUPAC name of the compound

$H_{3} C - C H | C_{2} H_{5} - C H | C_{2} H_{5} - C H_{3}$

Discussion

9.	when 20g of CaCO3 were put into 10litre flask and heatedto 800^° C,30% of CaCO3 remained unreacted at equillibrium.Kp for decomposition of CaCO3 will b
Answer» when 20g of CaCO3 were put into 10litre flask and heatedto 800^° C,30% of CaCO3 remained unreacted at equillibrium.Kp for decomposition of CaCO3 will b

Discussion

10.	Define the following terms with an example in each case : (i) Macromolecular sol (ii) Peptization (iii) Emulsion
Answer» Define the following terms with an example in each case : (i) Macromolecular sol (ii) Peptization (iii) Emulsion

Discussion

11.	Question 10A cylindrical conductor of length l and uniform area of cross-section A has resistance R. Another conductor of length 2l and resistance R of the same material has area of cross section(a) A2(b) 3A2(c) 2A(d) 3A
Answer» Question 10 A cylindrical conductor of length l and uniform area of cross-section A has resistance R. Another conductor of length 2l and resistance R of the same material has area of cross section (a) $\frac{A}{2}$ (b) $\frac{3 A}{2}$ (c) $2 A$ (d) $3 A$

Discussion

12.	64 The correct decreasing order of magnitude of enthalpy of hydrogenation is And on what factor enthalpy of hydrogenation depends upon
Answer» 64 The correct decreasing order of magnitude of enthalpy of hydrogenation is And on what factor enthalpy of hydrogenation depends upon

Discussion

13.	A force that object A exerts on object B is observed over a 10 second interval, as shown on the graph. Howmuch work did object A do during that 10 s?F (N)x (m)10(1) Zero(2) 12.5 J(3) 25J(4) 50 J
Answer» A force that object A exerts on object B is observed over a 10 second interval, as shown on the graph. Howmuch work did object A do during that 10 s?F (N)x (m)10(1) Zero(2) 12.5 J(3) 25J(4) 50 J

Discussion

14.	Chlorobenzene reacts with Mg in dry ether to give a compound A which further reacts with ethanol to yieldPhenolBenzeneEthyl benzenephenyl
Answer» Chlorobenzene reacts with Mg in dry ether to give a compound A which further reacts with ethanol to yield Phenol Benzene Ethyl benzene phenyl

Discussion

15.	If three moles of nitrogen reacts with ten moles of hydrogen , then how many moles of ammonia will form?
Answer» If three moles of nitrogen reacts with ten moles of hydrogen , then how many moles of ammonia will form?

Discussion

16.	What is the oxidation of Ni (Ni(CO)4)
Answer» What is the oxidation of Ni (Ni(CO)4)

Discussion

17.	If 10^18 electrons are taken out every second from a body, then how much time is required to get a total charge of 0.1 C from it?
Answer» If 10^18 electrons are taken out every second from a body, then how much time is required to get a total charge of 0.1 C from it?

Discussion

18.	Why carbonyl oxygen of carboxylic acid instead of O of OH grp easily get Protonated during esterification
Answer» Why carbonyl oxygen of carboxylic acid instead of O of OH grp easily get Protonated during esterification

Discussion

19.

Calculate the Q value in the following decay using the atomic masses given in the table.25Al→25Mg+e++ν Mass of 25AlMass of 25Mg24.990432 u24.985839 u[Take melectron=0.511 MeVc2; c2=931 MeVu]

Answer»

Calculate the $Q$ value in the following decay using the atomic masses given in the table.

$^{25} Al \to^{25} Mg + e^{+} + ν$

Mass of $^{25} Al$	Mass of $^{25} Mg$
$24.990432 u$	$24.985839 u$

[Take m_{e l e c t r o n} = 0.511 \frac{MeV}{c^{2}}; c^{2} = 931 \frac{MeV}{u}]

Discussion

20.	Ionic conductance of infinite dilution of Al3+ and So4^2- are 189 and 160 ohm^-1 cm^2 mol^-1 respectively. Calculate the molar conductance of Agso4^2-.
Answer» Ionic conductance of infinite dilution of Al3+ and So4^2- are 189 and 160 ohm^-1 cm^2 mol^-1 respectively. Calculate the molar conductance of Agso4^2-.

Discussion

21.	7. Write the structural isomers obtained by reaction of 2 pentene with NBS
Answer» 7. Write the structural isomers obtained by reaction of 2 pentene with NBS

Discussion

22.	Compare the acidic strength of the following acids:
Answer» Compare the acidic strength of the following acids:

Discussion

23.	what is trend of ionisation energy in a period . explain in context to atomic size . in detail
Answer» what is trend of ionisation energy in a period . explain in context to atomic size . in detail

Discussion

24.	What is the amount of charge possessed by 1 kg of electrons ?
Answer» What is the amount of charge possessed by $1 kg$ of electrons ?

Discussion

25.	4. ass-CUFeS2 is concentratedby froathflotation process reason- CuFeS2 is main ore of copper
Answer» 4. ass-CUFeS2 is concentratedby froathflotation process reason- CuFeS2 is main ore of copper

Discussion

26.	Why E= 1/2 mv2 not applied for photon and why E= hc/lambda not applied for electron?
Answer» Why E= 1/2 mv2 not applied for photon and why E= hc/lambda not applied for electron?

Discussion

27.	A certain buffer solution contains equal concentration of X− and HX. Kb for X− is 10−10. The pH of the buffer will be:
Answer» A certain buffer solution contains equal concentration of $X^{-}$ and $H X$ . $K_{b}$ for $X^{-}$ is $10^{- 10}$ . The $p H$ of the buffer will be:

Discussion

28.	How many isomers are possible for C2FClBrI
Answer» How many isomers are possible for C2FClBrI

Discussion

29.	Identify the correct order of acidic strength of CO2, CuO, CaO, and H2O:
Answer» Identify the correct order of acidic strength of $C O_{2}, C u O, C a O,$ and $H_{2} O$ :

Discussion

30.	find the dimension of relative dens
Answer» find the dimension of relative dens

Discussion

31.	L0LILSThe gm-mol wt of two gasses A2 and B2 are 32 and 64respectively. If x lit of A2 contains Y atoms , how manyatoms are present in 7x lit of B2:(1)Y(3) 14YT(2)7Yt(4) none.UT
Answer» L0LILSThe gm-mol wt of two gasses A2 and B2 are 32 and 64respectively. If x lit of A2 contains Y atoms , how manyatoms are present in 7x lit of B2:(1)Y(3) 14YT(2)7Yt(4) none.UT

Discussion

32.	(a) Why does carbon form compounds mainly by covalent bonding?(b) List any two reasons for carbon forming a very large number of compounds.(c) An organic acid 'X' is a liquid which often freezes during winter time in cold countries, has the molecular formula C2H4O2. On warming it with ethanol in the presence of a few drops of concentrated sulphuric acid, a compound 'Y' with a sweet smell is formed.(i) Identify 'X' and 'Y'.(ii) Write a chemical equation for the reaction involved.
Answer» (a) Why does carbon form compounds mainly by covalent bonding? (b) List any two reasons for carbon forming a very large number of compounds. (c) An organic acid 'X' is a liquid which often freezes during winter time in cold countries, has the molecular formula C₂H₄O₂. On warming it with ethanol in the presence of a few drops of concentrated sulphuric acid, a compound 'Y' with a sweet smell is formed. (i) Identify 'X' and 'Y'. (ii) Write a chemical equation for the reaction involved.

Discussion

33.	BrCH2CH(Br)CH2CH2CH(Br)CH2Br1. excess NaNH2.NH3(l)−−−−−−−−−−−−−−−→2.H2O
Answer» $B r C H_{2} C H (B r) C H_{2} C H_{2} C H (B r) C H_{2} B r 1. excess N a N H_{2} . N H_{3} (l) - -------------- \to 2. H_{2} O$

Discussion

34.	What is the bond length of C - C bond in Benzene?
Answer» What is the bond length of C - C bond in Benzene?

Discussion

35.	Consider the following reaction.On complete reaction, number of molecule of NaNH2 consumed with 1 molecule of given compound, is:
Answer» Consider the following reaction. On complete reaction, number of molecule of $N a N H_{2}$ consumed with $1$ molecule of given compound, is:

Discussion

36.	What is the order for second ionisation enthalpy for carbon,nitrogen,oxygen,fluorine.
Answer» What is the order for second ionisation enthalpy for carbon,nitrogen,oxygen,fluorine.

Discussion

37.	Rate of reaction (r) is plotted against temperature (T) for an enzyme catalysed reaction. Which of the following is correct representation ?
Answer» Rate of reaction (r) is plotted against temperature (T) for an enzyme catalysed reaction. Which of the following is correct representation ?

Discussion

38.	For the reaction, N2 + 3H2 ⇌ 2NH3, ∆H= …………….
Answer» For the reaction, N₂ + 3H₂ ⇌ 2NH₃, ∆H= …………….

Discussion

39.	44.The third ionisation energy is highest for 1. Magnesium 2. Boron 3. Beryllium 4. Aluminium
Answer» 44.The third ionisation energy is highest for 1. Magnesium 2. Boron 3. Beryllium 4. Aluminium

Discussion

40.	why 3^o alcohol is very reactive though 3^o carbo cation is stable.
Answer» why 3^o alcohol is very reactive though 3^o carbo cation is stable.

Discussion

41.	how to find nearest neighbour and next nearest neighbour of a compound
Answer» how to find nearest neighbour and next nearest neighbour of a compound

Discussion

42.	what is ment be " hydroformylation of olefins yields aldehydes which further undergo reduction to give alcohol "?
Answer» what is ment be " hydroformylation of olefins yields aldehydes which further undergo reduction to give alcohol "?

Discussion

43.	Which of the following statements on critical constants of gases are correct?I : Larger the TcPc value of a gas, larger would be the excluded volume. II : Critical temperature (Tc) of a gas is greater than its Boyle's temperature (TB). III : At the critical point in the Van der Walls gas isotherm.⟮dPdVm⟯Tc=0
Answer» Which of the following statements on critical constants of gases are correct? I : Larger the $\frac{T_{c}}{P_{c}}$ value of a gas, larger would be the excluded volume. II : Critical temperature ( $T_{c}$ ) of a gas is greater than its Boyle's temperature ( $T_{B}$ ). III : At the critical point in the Van der Walls gas isotherm. $⟮ \frac{d P}{d V_{m}} ⟯ T_{c} = 0$

43.

Which of the following statements on critical constants of gases are correct?I : Larger the TcPc value of a gas, larger would be the excluded volume. II : Critical temperature (Tc) of a gas is greater than its Boyle's temperature (TB). III : At the critical point in the Van der Walls gas isotherm.⟮dPdVm⟯Tc=0

Answer»

Which of the following statements on critical constants of gases are correct?

I : Larger the $\frac{T_{c}}{P_{c}}$ value of a gas, larger would be the excluded volume.

II : Critical temperature ( $T_{c}$ ) of a gas is greater than its Boyle's temperature ( $T_{B}$ ).

III : At the critical point in the Van der Walls gas isotherm.

$⟮ \frac{d P}{d V_{m}} ⟯ T_{c} = 0$

Discussion

44.	can α elimination produce cyclic compounds?
Answer» can α elimination produce cyclic compounds?

Discussion

45.	From following molecules which has the highest bond angle?
Answer» From following molecules which has the highest bond angle?

Discussion

46.	An open flask contains air at 27∘ C. To what temperature it must be heated to expel one - fourth of the volume?
Answer» An open flask contains air at $27^{\circ} C$ . To what temperature it must be heated to expel one - fourth of the volume?

Discussion

47.	is it necessary to remember the radius ratios of each specific ionic solids ?
Answer» is it necessary to remember the radius ratios of each specific ionic solids ?

Discussion

48.	The reaction of chloroform with alcoholic KOH and p-toluidine forms
Answer» The reaction of chloroform with alcoholic KOH and p-toluidine forms

Discussion

49.	Dear Sir, On moving along the period in the transition series the density increases due to increases in mass and decrease in volume but what happens when we move down the group ? Plz explain sir
Answer» Dear Sir, On moving along the period in the transition series the density increases due to increases in mass and decrease in volume but what happens when we move down the group ? Plz explain sir

Discussion

50.	A person driving a car with a speed 72 km/h, suddenly sees a boy crossing the road.If the distance moved by car, before the person applies brakes is 5 m, the reaction time of the person is :
Answer» A person driving a car with a speed 72 km/h, suddenly sees a boy crossing the road.If the distance moved by car, before the person applies brakes is 5 m, the reaction time of the person is :

Discussion

Explore topic-wise InterviewSolutions in Current Affairs.

18. In the graphical representation of equilibrium state there was a point where the slope of the product & reactant met each other.Why that point is not considered as the equilibrium point?

The nuclear reactions accompanied with emission of neutron(s) are:

What is meant by formula mass? Explain it elaborately.

iupac name of (c2h5)2

When CuSO4 is treated with excess KCN solution, what compound(s) is/are formed?

In the reaction N2(g) + 3H2(g) ⇌ 2NH3(g), the value of the equilibriumconstant depends on

For which of the following molecule significant μ≠0?(a) (b) (c) (d)

The IUPAC name of the compoundH3C−CH|C2H5−CH|C2H5−CH3

when 20g of CaCO3 were put into 10litre flask and heatedto 800^° C,30% of CaCO3 remained unreacted at equillibrium.Kp for decomposition of CaCO3 will b

Define the following terms with an example in each case : (i) Macromolecular sol (ii) Peptization (iii) Emulsion

Question 10A cylindrical conductor of length l and uniform area of cross-section A has resistance R. Another conductor of length 2l and resistance R of the same material has area of cross section(a) A2(b) 3A2(c) 2A(d) 3A​​​​​​​

64 The correct decreasing order of magnitude of enthalpy of hydrogenation is And on what factor enthalpy of hydrogenation depends upon

A force that object A exerts on object B is observed over a 10 second interval, as shown on the graph. Howmuch work did object A do during that 10 s?F (N)x (m)10(1) Zero(2) 12.5 J(3) 25J(4) 50 J

Chlorobenzene reacts with Mg in dry ether to give a compound A which further reacts with ethanol to yieldPhenolBenzeneEthyl benzenephenyl

If three moles of nitrogen reacts with ten moles of hydrogen , then how many moles of ammonia will form?

What is the oxidation of Ni (Ni(CO)4)

If 10^18 electrons are taken out every second from a body, then how much time is required to get a total charge of 0.1 C from it?

Why carbonyl oxygen of carboxylic acid instead of O of OH grp easily get Protonated during esterification

Calculate the Q value in the following decay using the atomic masses given in the table.25Al→25Mg+e++ν Mass of 25AlMass of 25Mg24.990432 u24.985839 u[Take melectron=0.511 MeVc2; c2=931 MeVu]

Ionic conductance of infinite dilution of Al3+ and So4^2- are 189 and 160 ohm^-1 cm^2 mol^-1 respectively. Calculate the molar conductance of Agso4^2-.

7. Write the structural isomers obtained by reaction of 2 pentene with NBS

Compare the acidic strength of the following acids:

what is trend of ionisation energy in a period . explain in context to atomic size . in detail

What is the amount of charge possessed by 1 kg of electrons ?

4. ass-CUFeS2 is concentratedby froathflotation process reason- CuFeS2 is main ore of copper

Why E= 1/2 mv2 not applied for photon and why E= hc/lambda not applied for electron?

A certain buffer solution contains equal concentration of X− and HX. Kb for X− is 10−10. The pH of the buffer will be:

How many isomers are possible for C2FClBrI

Identify the correct order of acidic strength of CO2, CuO, CaO, and H2O:

find the dimension of relative dens

L0LILSThe gm-mol wt of two gasses A2 and B2 are 32 and 64respectively. If x lit of A2 contains Y atoms , how manyatoms are present in 7x lit of B2:(1)Y(3) 14YT(2)7Yt(4) none.UT

BrCH2CH(Br)CH2CH2CH(Br)CH2Br1. excess NaNH2.NH3(l)−−−−−−−−−−−−−−−→2.H2O

What is the bond length of C - C bond in Benzene?

Consider the following reaction.On complete reaction, number of molecule of NaNH2 consumed with 1 molecule of given compound, is:

What is the order for second ionisation enthalpy for carbon,nitrogen,oxygen,fluorine.

Rate of reaction (r) is plotted against temperature (T) for an enzyme catalysed reaction. Which of the following is correct representation ?

For the reaction, N2 + 3H2 ⇌ 2NH3, ∆H= …………….

44.The third ionisation energy is highest for 1. Magnesium 2. Boron 3. Beryllium 4. Aluminium

why 3^o alcohol is very reactive though 3^o carbo cation is stable.

how to find nearest neighbour and next nearest neighbour of a compound

what is ment be " hydroformylation of olefins yields aldehydes which further undergo reduction to give alcohol "?

can α elimination produce cyclic compounds?

From following molecules which has the highest bond angle?

An open flask contains air at 27∘ C. To what temperature it must be heated to expel one - fourth of the volume?

is it necessary to remember the radius ratios of each specific ionic solids ?

The reaction of chloroform with alcoholic KOH and p-toluidine forms

Dear Sir, On moving along the period in the transition series the density increases due to increases in mass and decrease in volume but what happens when we move down the group ? Plz explain sir

A person driving a car with a speed 72 km/h, suddenly sees a boy crossing the road.If the distance moved by car, before the person applies brakes is 5 m, the reaction time of the person is :

Question 10A cylindrical conductor of length l and uniform area of cross-section A has resistance R. Another conductor of length 2l and resistance R of the same material has area of cross section(a) A2(b) 3A2(c) 2A(d) 3A