Explore topic-wise InterviewSolutions in Current Affairs.

This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.

1.

Ifand,then verify that (i) (ii)

Answer»

If

and,
then verify that


(i)


(ii)

2.

What is the relation of solubility wrt it's lattice energy and hydration energy??!?

Answer» What is the relation of solubility wrt it's lattice energy and hydration energy??!?
3.

The reactivity of ethyl chloride is [KCET 1986]

Answer»

The reactivity of ethyl chloride is


[KCET 1986]



4.

change in volume ehen 100ml PH_3 deco_{}mposed to solid phosphorus and H_2 ga

Answer» change in volume ehen 100ml PH_3 deco_{}mposed to solid phosphorus and H_2 ga
5.

1 mole of an ideal gas at 25∘C is subjected to expand reversibly 10 times of its initial volume. Calculate the change in entropy of expansions.

Answer»

1 mole of an ideal gas at 25C is subjected to expand reversibly 10 times of its initial volume. Calculate the change in entropy of expansions.

6.

2 Calculate the threshold frequency of metal from which the photoelectrons are emmited with zero velocity when exposed to radiation of wavelength 6800A.

Answer» 2 Calculate the threshold frequency of metal from which the photoelectrons are emmited with zero velocity when exposed to radiation of wavelength 6800A.
7.

consider the following species ::-CN+,CN-,NO AND CN WHICH OF THIS WILL HAVE THE HIGHEST BOND ORDER??

Answer» consider the following species ::-CN+,CN-,NO AND CN WHICH OF THIS WILL HAVE THE HIGHEST BOND ORDER??
8.

Which of the following species cannot behave as a base?

Answer»

Which of the following species cannot behave as a base?

9.

50.0 kg of N,(g) and 10.0 kg of H (9) are mixed to produce NH (9) Calculate the mcies NH, (a) formed. identify the limiting reagent in the production of NH, in this situationHint: N(g)+3H,(g)2NH, (9)

Answer» 50.0 kg of N,(g) and 10.0 kg of H (9) are mixed to produce NH (9) Calculate the mcies NH, (a) formed. identify the limiting reagent in the production of NH, in this situation

Hint: N(g)+3H,(g)

2NH, (9)
10.

6. If the radius of the second Bohr orbit of H atom is a1, then de-Broglie wavelength of an electron in third orbit is?

Answer» 6. If the radius of the second Bohr orbit of H atom is a1, then de-Broglie wavelength of an electron in third orbit is?
11.

180ml of pure water at 4 degree Celsius is saturated with ammonia gas, yielding a solution of density 0.8 gram/ml and containing ammonia (40% by weight). calculate- (a) volume of ammonia solution. (b) volume of ammonia present in saturated solution. (c) volume of ammonia gas at 15 degree Celsius and 950mm of Hg in Saturated solution.

Answer» 180ml of pure water at 4 degree Celsius is saturated with ammonia gas, yielding a solution of density 0.8 gram/ml and containing ammonia (40% by weight). calculate- (a) volume of ammonia solution. (b) volume of ammonia present in saturated solution. (c) volume of ammonia gas at 15 degree Celsius and 950mm of Hg in Saturated solution.
12.

16.EAN VALUE OF FERROCENE, WITH EXPLANATION?

Answer» 16.EAN VALUE OF FERROCENE, WITH EXPLANATION?
13.

Which of the following best describes a sol &gel colloidal system?

Answer»

Which of the following best describes a sol &gel colloidal system?


14.

The elements beyond atomic number (Z = 92) are known as:

Answer»

The elements beyond atomic number (Z = 92) are known as:


15.

Calculate the wavelength of a photon that is emitted when an electron in the Bohr orbit n=2 returns to the orbit n=1 in a He+ ion. The ionisation potential of the ground state He+ ion is 8.68×10−11 erg per atom.

Answer»

Calculate the wavelength of a photon that is emitted when an electron in the Bohr orbit n=2 returns to the orbit n=1 in a He+ ion.
The ionisation potential of the ground state He+ ion is 8.68×1011 erg per atom.

16.

Acetamide is treated with the following reagents separately. Which one of these would yield methylamine?

Answer»

Acetamide is treated with the following reagents separately. Which one of these would yield methylamine?

17.

Identify the product formed:

Answer»

Identify the product formed:
18.

What are the charge carriers in case of conduction through a gaseous medium

Answer»

What are the charge carriers in case of conduction through a gaseous medium

19.

Why are the transition metals generally colourful?

Answer» Why are the transition metals generally colourful?
20.

Theskeletal structure of CH3COOHas shown below is correct, but some of the bonds are shownincorrectly. Write the correct Lewis structure for acetic acid.

Answer»

The
skeletal structure of CH
3COOH
as shown below is correct, but some of the bonds are shown
incorrectly. Write the correct Lewis structure for acetic acid.




21.

Find out P in the given reaction sequence:

Answer»

Find out P in the given reaction sequence:


22.

The correct order of increasing thermal stability of K2CO3, MgCO3, CaCO3 and BeCO3 is:

Answer»

The correct order of increasing thermal stability of K2CO3, MgCO3, CaCO3 and BeCO3 is:


23.

Nitrogen detection in an organic compound is carried out by Lassaigne's test. The blue colour formed corresponds to which of the following formulae?

Answer»

Nitrogen detection in an organic compound is carried out by Lassaigne's test. The blue colour formed corresponds to which of the following formulae?

24.

The dielectric constant of helium at 0^0C and 1atm pressure is 1.00074. Find the dipole moment induced in each helium atom when the gas is in an electric field of intensity 10V/m.

Answer» The dielectric constant of helium at 0^0C and 1atm pressure is 1.00074. Find the dipole moment induced in each helium atom when the gas is in an electric field of intensity 10V/m.
25.

Q48. A neutron is released into a uranium rod. It dissipates after breaking a uranium nucleus and produces two neutrons and the process continues. If any neutron takes exactly 1 second to find and break a nucleus, how many nucleuses are broken in 6 seconds? एक न्यूट्रॉन को एक यूरेनियम की छड़ पर छोड़ा जाता है। वह यूरेनियम के नाभिक विखंडन के बाद नष्ट हो जाता है और दो न्यूट्रॉन उत्सर्जित करता है तथा यही प्रक्रिया जारी रहती है। यदि कोई न्युट्रॉन नाभिक खोजने और उसे विखंडित करने में 1 सेकंड का समय लेता है, तो 6 सेकंड में कितने नाभिक विखंडित होंगे?

Answer»

Q48. A neutron is released into a uranium rod. It dissipates after breaking a uranium nucleus and produces two neutrons and the process continues. If any neutron takes exactly 1 second to find and break a nucleus, how many nucleuses are broken in 6 seconds?

एक न्यूट्रॉन को एक यूरेनियम की छड़ पर छोड़ा जाता है। वह यूरेनियम के नाभिक विखंडन के बाद नष्ट हो जाता है और दो न्यूट्रॉन उत्सर्जित करता है तथा यही प्रक्रिया जारी रहती है। यदि कोई न्युट्रॉन नाभिक खोजने और उसे विखंडित करने में 1 सेकंड का समय लेता है, तो 6 सेकंड में कितने नाभिक विखंडित होंगे?


26.

The bond angle is the lowest in which of the following species?

Answer»

The bond angle is the lowest in which of the following species?

27.

What is cathode

Answer» What is cathode
28.

When 2-bromobutane reacts with alcoholic KOH, the reaction is called

Answer»

When 2-bromobutane reacts with alcoholic KOH, the reaction is called


29.

56. Vapour density of a metal chloride is 66.its oxide contains 53% metal. the atomic weight of the metal is

Answer» 56. Vapour density of a metal chloride is 66.its oxide contains 53% metal. the atomic weight of the metal is
30.

The solution exhibiting an osmotic pressure of 2.4 atm at 127∘C contains 12 g of an organic compound per litre of the solution .Calculate the molecular mass of the organic compound.

Answer»

The solution exhibiting an osmotic pressure of 2.4 atm at 127C contains 12 g of an organic compound per litre of the solution .

Calculate the molecular mass of the organic compound.

31.

31. If an element oxidation number changes from 0 to 5 then how much electron it gain or loss]

Answer» 31. If an element oxidation number changes from 0 to 5 then how much electron it gain or loss]
32.

The number of radial nodes of 4s and 3p respectively, are:

Answer»

The number of radial nodes of 4s and 3p respectively, are:

33.

Is rate of reaction only for reversible reactions because forward and backward reaction happen only in reversible reactions

Answer» Is rate of reaction only for reversible reactions because forward and backward reaction happen only in reversible reactions
34.

which has smallest rsdiusV2+Ti4+Mn7+Sc3+

Answer» which has smallest rsdius
V2+
Ti4+
Mn7+
Sc3+
35.

39. A catalyst lowers the activation energy of a reaction from 20 kJ per mole to 10 kJ per mole. The temperature at which an catalyzed reaction will have same rate as that of catalyzed at 27 degree Celsius

Answer» 39. A catalyst lowers the activation energy of a reaction from 20 kJ per mole to 10 kJ per mole. The temperature at which an catalyzed reaction will have same rate as that of catalyzed at 27 degree Celsius
36.

Ionization enthalpy of gaseous Na atom is 495.5 kJ/mol. The lowest possible frequency of light that ionizes a sodium atom is(1) 1.24 x 10^15 s-1(2) 3.15 x 10^15 s-1(3) 4.76 x 10^15 s-1(4) 7.50 x 10^15 s-1

Answer» Ionization enthalpy of gaseous Na atom is 495.5 kJ/mol. The lowest possible frequency of light that ionizes a sodium atom is
(1) 1.24 x 10^15 s-1
(2) 3.15 x 10^15 s-1
(3) 4.76 x 10^15 s-1
(4) 7.50 x 10^15 s-1
37.

Gold (atomic radius = 0.144 nm) crystallises in a face-centred uinit cell. What is the length of a side of the cell ?

Answer»

Gold (atomic radius = 0.144 nm) crystallises in a face-centred uinit cell. What is the length of a side of the cell ?

38.

What are the symptoms of CO poisoning?

Answer»

What are the symptoms of CO poisoning?
39.

The ionization potential of a hydrogen atom is 13.6 eV. The energy required to remove an electron from the second orbit of a hydrogen atom is:

Answer»

The ionization potential of a hydrogen atom is 13.6 eV. The energy required to remove an electron from the second orbit of a hydrogen atom is:

40.

17. Why e/m ratio differs for positive charge that is proton for has to gas?

Answer» 17. Why e/m ratio differs for positive charge that is proton for has to gas?
41.

How do you determine the sign of (delta) s and (delta ) h?

Answer» How do you determine the sign of (delta) s and (delta ) h?

42.

46. Number of valancy electrons in 32 grams of methane

Answer» 46. Number of valancy electrons in 32 grams of methane
43.

The value of enthalpy change ΔH for the reaction C2H5OH(1)+3O2(g)→2CO2(g)+3H2O(1) at 27∘C is−1366.5kJmol−1, The value of internal energy change for the above reaction at this temperature will be:

Answer»

The value of enthalpy change ΔH for the reaction

C2H5OH(1)+3O2(g)2CO2(g)+3H2O(1) at 27C is1366.5kJmol1, The value of internal

energy change for the above reaction at this temperature will be:


44.

most acidic hydrogen is present in? 1 . CH3-CO-CH2-CO-O-CH3 2 .CH3-O-CO-CH2-CO-O-CH3 3. CH3-CO-CH2-CO-CH3 4. CH3-CO-CH2-CH3

Answer» most acidic hydrogen is present in? 1 . CH3-CO-CH2-CO-O-CH3 2 .CH3-O-CO-CH2-CO-O-CH3 3. CH3-CO-CH2-CO-CH3 4. CH3-CO-CH2-CH3
45.

On analysis it was found that the black oxide of copper and red oxides of copper contain 80% of copper. Show that this data is in accordance with the law of multiple proportions.

Answer» On analysis it was found that the black oxide of copper and red oxides of copper contain 80% of copper. Show that this data is in accordance with the law of multiple proportions.
46.

If ∆q amount of heat energy is provided to a monoatomic gas samplehaving two moles in a process PT=constant then increase in temperature of gas is equal to

Answer» If ∆q amount of heat energy is provided to a monoatomic gas sample
having two moles in a process PT=constant then increase in temperature of gas is equal to
47.

For the Balmer series in the spectrum of H-atom, ¯v=RH[1n12−1n22] The correct statements among (A) to (D) are: A)The integer n1=2 B)The ionization energy of hydrogen can be calculated from the wave number of these lines. C) The lines of longest wavelength corresponds to n2=3 D) As wavelength decreases, the lines of the series converge.

Answer»

For the Balmer series in the spectrum of H-atom,
¯v=RH[1n121n22]
The correct statements among (A) to (D) are:
A)The integer n1=2
B)The ionization energy of hydrogen can be calculated from the wave number of these lines.
C) The lines of longest wavelength corresponds to n2=3
D) As wavelength decreases, the lines of the series converge.

48.

explain why:o-nitro phenol is more volatile than p-nitro phenol.

Answer» explain why:
o-nitro phenol is more volatile than p-nitro phenol.
49.

8. Why open chain compounds are known as aliphatic compounds?

Answer» 8. Why open chain compounds are known as aliphatic compounds?
50.

Thermos flask containing tea is an example of:

Answer»

Thermos flask containing tea is an example of: