Explore topic-wise InterviewSolutions in Current Affairs.

This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.

1.

The s†an dard reduction potentials at 298 K for the following half reactions are given against each half reaction. Zn2+(aq) + 2e → Zn(s); – 0.762 V Cr3+(aq) + 3e → Cr(s); – 0.740 V 2H+(aq) + 2e → H2(g); 0.00 V Fe3+(aq) + e → Fe2+(aq); 0.770 V Which is the strongest reducing agent? Options: 1) Zn(s) 2) Cr(s) 3) H2(g) 4) Fe2+(aq.)

Answer» The s†an dard reduction potentials at 298 K for the following half reactions are given against each half reaction. Zn2+(aq) + 2e → Zn(s); – 0.762 V Cr3+(aq) + 3e → Cr(s); – 0.740 V 2H+(aq) + 2e → H2(g); 0.00 V Fe3+(aq) + e → Fe2+(aq); 0.770 V Which is the strongest reducing agent? Options: 1) Zn(s) 2) Cr(s) 3) H2(g) 4) Fe2+(aq.)
2.

In a CCP structure of compound xy atoms is present at octahedral voids the ratio of 6th coordination number and third coordination number for an atom X located at body centre is

Answer» In a CCP structure of compound xy atoms is present at octahedral voids the ratio of 6th coordination number and third coordination number for an atom X located at body centre is
3.

Wilkinson’s catalyst used as homogenous catalyst in hydrogenation of alkenes contains

Answer» Wilkinson’s catalyst used as homogenous catalyst in hydrogenation of alkenes contains
4.

Question 5: Which are the other two states of matter apart from solid, liquid and gas? Who discovered the other two states of matter?

Answer»

Question 5:





  1. Which are the other two states of matter apart from solid, liquid and gas?




  2. Who discovered the other two states of matter?





5.

The weak acid, HA, has a Ka of 1.00×10−5. If 0.1 mol of this acid is dissolved in one litre of water, the percentage of acid dissociated at equilibrium is closest to:

Answer» The weak acid, HA, has a Ka of 1.00×105. If 0.1 mol of this acid is dissolved in one litre of water, the percentage of acid dissociated at equilibrium is closest to:
6.

students Ram, Shyam and Raj measured the radius of an element A. The values of their practical were not same (Ram = 110 nm, Shyam = 190 nm and Raj = 108 nm). Their teacher explained that their measurement were correct by saying that the recorded values are -

Answer»

students Ram, Shyam and Raj measured the radius of an element A. The values of their practical were not same (Ram = 110 nm, Shyam = 190 nm and Raj = 108 nm). Their teacher explained that their measurement were correct by saying that the recorded values are -


7.

Consider the disproportionation of Iodine to iodide and iodate ions. Using Oxidation method calculate the ratio of iodate and iodide ions formed in alkaline medium : I2→IO−3+I−

Answer»

Consider the disproportionation of Iodine to iodide and iodate ions. Using Oxidation method calculate the ratio of iodate and iodide ions formed in alkaline medium :



I2IO3+I

8.

Name of the following compound is :

Answer»

Name of the following compound is :

9.

The ratio of the number of aromatic to non-aromatic molecules from the compounds given is:

Answer»
The ratio of the number of aromatic to non-aromatic molecules from the compounds given is:
10.

H-F forms hydrogen bonding - True or False?

Answer» H-F forms hydrogen bonding - True or False?
11.

10. A giant molecule contains 0.25% of a metal whose atomic weight is 59. Its molecule contains one atom of that metal. Its minimum molecular weight is - (1) 5900 (2) 23600 (3) 11800 (4) (100*59)/0.4

Answer» 10. A giant molecule contains 0.25% of a metal whose atomic weight is 59. Its molecule contains one atom of that metal. Its minimum molecular weight is - (1) 5900 (2) 23600 (3) 11800 (4) (100*59)/0.4
12.

Keto-enol tautomerism is observed in

Answer»

Keto-enol tautomerism is observed in


13.

what is the equivalent mass of AS2S3in the follwing reaction ( molar mass of AS2S3=M) AS2S3 + HNO3 + H+→ AS2O5 + HNO2 + So3 + H2

Answer» what is the equivalent mass of AS2S3in the follwing reaction ( molar mass of AS2S3=M) AS2S3 + HNO3 + H+→ AS2O5 + HNO2 + So3 + H2
14.

Assertion (A): In the dissociation of PCl5 at constant pressure and temperature addition of helium at equilibrium increases the dissociation of PCl5 . Reason (R) : Helium removes Cl2 from the field of action. (i) Both A and R are true and R is correct explanation of A. (ii) Both A and R are true but R is not correct explanation of A. (iii) A is true but R is false. (iv) Both A and R are false.

Answer» Assertion (A): In the dissociation of PCl5 at constant pressure and
temperature addition of helium at equilibrium increases the
dissociation of PCl5 .
Reason (R) : Helium removes Cl2 from the field of action.
(i) Both A and R are true and R is correct explanation of A.
(ii) Both A and R are true but R is not correct explanation of A.
(iii) A is true but R is false.
(iv) Both A and R are false.
15.

Which of the following reaction(s) is/are correct:

Answer»

Which of the following reaction(s) is/are correct:

16.

Why group number 1-7 were divided into 2 subgroups in Mendeleev's periodic table

Answer» Why group number 1-7 were divided into 2 subgroups in Mendeleev's periodic table
17.

If x molal solution of a compound in benzene has mole fraction of solute equal to 0.4.Then the value of x i

Answer» If x molal solution of a compound in benzene has mole fraction of solute equal to 0.4.Then the value of x i
18.

20. The following two reactions are knownFe,O3(s) + 3CO(g)- 2Fe(s) + 3CO2(g)AH =-26.8 kJFeO(s) + CO(g)Fe(s) +CO,(g);AH = -16.5 kJThe value of AH for the following reactionFe203(s) + CO(g) 2FeO(s) + CO2(g) is

Answer» 20. The following two reactions are knownFe,O3(s) + 3CO(g)- 2Fe(s) + 3CO2(g)AH =-26.8 kJFeO(s) + CO(g)Fe(s) +CO,(g);AH = -16.5 kJThe value of AH for the following reactionFe203(s) + CO(g) 2FeO(s) + CO2(g) is
19.

Trichloroacetaldehyde reacts with chlorobenzene in presence of sulphuric acid and produces

Answer» Trichloroacetaldehyde reacts with chlorobenzene in presence of sulphuric acid and produces
20.

A gas mixture consists of 3 moles of oxygen and 5 moles of argon at temperature T. Assuming the gases to be ideal and the oxygen bond to be rigid, the total internal energy (in units of RT) of the mixture is :

Answer»

A gas mixture consists of 3 moles of oxygen and 5 moles of argon at temperature T. Assuming the gases to be ideal and the oxygen bond to be rigid, the total internal energy (in units of RT) of the mixture is :

21.

How to compare the acidity between cyclohexanol and cyclohexylacetyline

Answer» How to compare the acidity between cyclohexanol and cyclohexylacetyline
22.

The most suitable reagent for the following conversion is:

Answer»

The most suitable reagent for the following conversion is:


23.

Amongst the compounds given, the one that would form a brilliant coloured dye on treatment with NaNO2 in dil. HCl followed by addition to an alkaline solution of β−naphthol is:

Answer»

Amongst the compounds given, the one that would form a brilliant coloured dye on treatment with NaNO2 in dil. HCl followed by addition to an alkaline solution of βnaphthol is:

24.

How would distinguish the following set of compounds? copper nitrate and iron(III) nitrate.

Answer» How would distinguish the following set of compounds?
copper nitrate and iron(III) nitrate.
25.

Arrange the following reaction mechanism of sulphonation of benzene

Answer»

Arrange the following reaction mechanism of sulphonation of benzene

26.

49.No of co ordination isomers of [Cr(NH3)6][Co(CN)6] and[Cr(en)3][Co(CN)6] Are?

Answer» 49.No of co ordination isomers of [Cr(NH3)6][Co(CN)6] and[Cr(en)3][Co(CN)6] Are?
27.

What is the basic definition of significant figures

Answer» What is the basic definition of significant figures
28.

For the process to occur under adiabatic conditions, the correct condition is: (i) Δ T=0 (ii) Δ p=0 (iii) q = 0 (iv) w = 0

Answer»

For the process to occur under adiabatic conditions, the correct condition is:
(i) Δ T=0
(ii) Δ p=0
(iii) q = 0
(iv) w = 0

29.

A liquid contained in a calorimeter cools from 80°C to 60°C in 10 mins. If the temperature of the surroundings is 30°C, calculate time it will take to cool further to 45°C?

Answer» A liquid contained in a calorimeter cools from 80°C to 60°C in 10 mins. If the temperature of the surroundings is 30°C, calculate time it will take to cool further to 45°C?
30.

Identify the IUPAC name of the following compound.

Answer»

Identify the IUPAC name of the following compound.


31.

Order of acidic strength of oxyacids of halogens down the group decreases why

Answer» Order of acidic strength of oxyacids of halogens down the group decreases why
32.

For the electrons of oxygen atom, which of the following statements is correct ? (a) Zeff for an electron in a 2s orbital is the same as Zeff for an electron in a 2p orbital (b) An electron in the 2s orbital has the same energy as an electron in the2p orbital (c) Zeff for an electron in 1s orbital is the same as Zeff for an electron in a 2s orbital (d) The two electrons present in the 2s orbital have spin quantum number ms but of opposite sign

Answer»

For the electrons of oxygen atom, which of the following statements is correct ?

(a) Zeff for an electron in a 2s orbital is the same as Zeff for an electron in a 2p orbital

(b) An electron in the 2s orbital has the same energy as an electron in the2p orbital

(c) Zeff for an electron in 1s orbital is the same as Zeff for an electron in a 2s orbital

(d) The two electrons present in the 2s orbital have spin quantum number ms but of opposite sign

33.

Balance the following equation (also show the steps):Cu+HNO3-->Cu(NO3)2+NO+H2O

Answer» Balance the following equation (also show the steps):
Cu+HNO3-->Cu(NO3)2+NO+H2O
34.

Silane, SiH4 like methane, burns in air. The product silica (silicon dioxide) is solid quite unlike carbondioxide. SiH4(g)+2O2(g)→SiO2(s)+2H2O(g) standard Gibbs energy of formation of SiO2(s), H2O and SiH4 are 805, – 228.6 and + 52.3 (all is KJ mol−1) respectively. Calculate the value of ΔrG.

Answer»

Silane, SiH4 like methane, burns in air. The product silica (silicon dioxide) is solid quite unlike carbondioxide.
SiH4(g)+2O2(g)SiO2(s)+2H2O(g) standard Gibbs energy of formation of SiO2(s), H2O and SiH4 are 805, – 228.6 and + 52.3 (all is KJ mol1) respectively. Calculate the value of ΔrG.

35.

Two compounds A and B in when mixed form nearly ideal solutions. At room temperature, P0A=40 mm Hg and P0B=120 mm Hg.A liquid mixture is composed of 1 mol of A and 3 mol of B. If the pressure over the mixture at room temperature is reduced. At what pressure does the first vapour form?

Answer»

Two compounds A and B in when mixed form nearly ideal solutions. At room temperature, P0A=40 mm Hg and P0B=120 mm Hg.

A liquid mixture is composed of 1 mol of A and 3 mol of B.

If the pressure over the mixture at room temperature is reduced. At what pressure does the first vapour form?


36.

Mole fraction of HCl is 0.78. Calculate its molality.

Answer» Mole fraction of HCl is 0.78. Calculate its molality.
37.

How to Draw FBD for a particle kept in a moving train ?

Answer» How to Draw FBD for a particle kept in a moving train ?
38.

which have greaer solubility in ccl4 options cl2, br2 , i2 , NACL . WHY

Answer» which have greaer solubility in ccl4 options cl2, br2 , i2 , NACL . WHY
39.

Why does hydrofluoric acid among the hydrohalic acids behave as the weakest acid

Answer» Why does hydrofluoric acid among the hydrohalic acids behave as the weakest acid
40.

what is alloyes?

Answer» what is alloyes?
41.

The reaction between A and B is first order with respect to A and zero order with respect to B. Fill in the blanks in the following table: Experiment A/ mol L−1 B/ mol L−1 Initial rate/mol L−1 min−1 I 0.1 0.1 2.0 × 10−2 II -- 0.2 4.0 × 10−2 III 0.4 0.4 -- IV -- 0.2 2.0 × 10−2

Answer»

The
reaction between A and B is first order with respect to A and zero
order with respect to B. Fill in the blanks in the following table:









































Experiment



A/
mol L
−1



B/
mol L
−1



Initial
rate/mol L
−1
min
−1



I



0.1



0.1



2.0
× 10
−2



II



--



0.2



4.0
× 10
−2



III



0.4



0.4



--



IV



--



0.2



2.0
× 10
−2



42.

2z+5z+7z=?

Answer» 2z+5z+7z=?
43.

Calculate the number of FeSO4.7H2O formula units in 0.5 millimoles of pure FeSO4.7H2O.

Answer»

Calculate the number of FeSO4.7H2O formula units in 0.5 millimoles of pure FeSO4.7H2O.

44.

31. Prove the converse of BPT.

Answer» 31. Prove the converse of BPT.
45.

On mixing which of the following will show contraction in volume 1. Methanol and water 2. Acetone and aniline 3. Acetone and benzene 4. Acetone and CS2

Answer» On mixing which of the following will show contraction in volume
1. Methanol and water
2. Acetone and aniline
3. Acetone and benzene
4. Acetone and CS2
46.

Amalgamation refers to:

Answer»

Amalgamation refers to:



47.

Which of the following is the correct order for heat of hydrogenation of these compounds?

Answer»

Which of the following is the correct order for heat of hydrogenation of these compounds?


48.

1. In exothermic reaction the activation energy of reactant is 1.less than that of activation energy of product . 2.greater than that of product. 3. Equal 4.none of these

Answer» 1. In exothermic reaction the activation energy of reactant is 1.less than that of activation energy of product . 2.greater than that of product. 3. Equal 4.none of these
49.

Among the following substituted silanes, the one which will give rise to cross-linked silicone polymer on hydrolysis is:

Answer»

Among the following substituted silanes, the one which will give rise to cross-linked silicone polymer on hydrolysis is:


50.

Consider the reaction:3I−(aq)+S2O2−8(aq)→I−3(aq)+2SO2−4(aq)At a particular time t,d[SO2−4]dt=2.2×10−2M/sWhat will be the value of −d[I−]dt at the same time t ?

Answer»

Consider the reaction:

3I(aq)+S2O28(aq)I3(aq)+2SO24(aq)



At a particular time t,

d[SO24]dt=2.2×102M/s

What will be the value of d[I]dt at the same time t ?