Explore topic-wise InterviewSolutions in Current Affairs.

This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.

1.

Solubility of AgCl in 0.1M CaCl2 is

Answer» Solubility of AgCl in 0.1M CaCl2 is
2.

The potential energy between two atoms,in a molecule , is given by U=a/x^12 -b/x^6 where a and b are positive constants and x is the distance between the atoms . The atom is in stable equilibrium, when

Answer» The potential energy between two atoms,in a molecule , is given by U=a/x^12 -b/x^6 where a and b are positive constants and x is the distance between the atoms . The atom is in stable equilibrium, when
3.

1‑propanol & 2‑propanol can be best distinguished by:

Answer»

1‑propanol & 2‑propanol can be best distinguished by:



4.

What is molecular orbital?

Answer»

What is molecular orbital?

5.

What is vactor low and magnitude

Answer» What is vactor low and magnitude
6.

The predominant form of histamine present in human blood is (pKa Histidine =6.0 )

Answer»

The predominant form of histamine present in human blood is (pKa Histidine =6.0 )

7.

Number of isomers including stereoisomers for molecular formula C4H8O is?

Answer» Number of isomers including stereoisomers for molecular formula C4H8O is?
8.

Consider the following moleculeThe number of stereogenic centres and stereoisomers respectively of the above molecule are:

Answer»

Consider the following molecule





The number of stereogenic centres and stereoisomers respectively of the above molecule are:

9.

Which of the following is resistant to boiling aqua regia

Answer»

Which of the following is resistant to boiling aqua regia


10.

Find the ph value of 0.02 moles of Hydrochloric Acid (HCl).

Answer» Find the ph value of 0.02 moles of Hydrochloric Acid (HCl).
11.

Number of electrons in chromium atom for which ‘n + l = 4’ is

Answer» Number of electrons in chromium atom for which ‘n + l = 4’ is
12.

An aqueous solution contains 10% ammonia by mass and has a density0.99 g cm-3. If Ka for NH4+ is 5.0×10-10 M, the value of hydroxyl ion concentration will be

Answer»
An aqueous solution contains 10% ammonia by mass and has a density
0.99 g cm-3. If Ka for NH4+ is 5.0×10-10 M, the value of hydroxyl ion concentration will be
13.

two components in the ratio of x:y form azeotropic mixture. they are mixed in the ratio of x:2y,how many moles one of the pure component y will be evaporated before getting azeotropic solution

Answer» two components in the ratio of x:y form azeotropic mixture. they are mixed in the ratio of x:2y,how many moles one of the pure component y will be evaporated before getting azeotropic solution
14.

Decreasing order of relative nucleophilicity of the following nucleophiles in protic solvent is -⊖SH,AC⊖O,Ph⊖O,⊖OH,H2O

Answer»

Decreasing order of relative nucleophilicity of the following nucleophiles in protic solvent is -

SH,ACO,PhO,OH,H2O

15.

If a photon of wavelength 100 pm strikes an atom and one of its inner bound electrons is ejected out with a velocity of 1.5×107 ms−1, calculate the energy with which it is bound to nucleus.

Answer»

If a photon of wavelength 100 pm strikes an atom and one of its inner bound electrons is ejected out with a velocity of 1.5×107 ms1, calculate the energy with which it is bound to nucleus.

16.

Are all the cations in the periodic table are smaller in size with respect to all anions in the periodic table

Answer»

Are all the cations in the periodic table are smaller in size with respect to all anions in the periodic table

17.

why newtons 2nd law called real equation

Answer» why newtons 2nd law called real equation
18.

The solubility product of PbI2 is 8.0×10−9. The solubility of lead iodide in 0.1 molar solution of lead nitrate is x×10−6 mol/L. Given: √2=1.41. The value of x is

Answer» The solubility product of PbI2 is 8.0×109. The solubility of lead iodide in 0.1 molar solution of lead nitrate is x×106 mol/L. Given: 2=1.41. The value of x is
19.

Identify the physical property of the given metals from the following images:

Answer»

Identify the physical property of the given metals from the following images:

20.

It was told that dueidu the formation of SO2 the oxidation state of S is +4 that is it is in its first exited state.it forms sp2 hybridisation and the other p and d orbitals from pπ-pπ and pπ-dπ bonds.then where did the lonepair come from? ​​​

Answer» It was told that dueidu the formation of SO2 the oxidation state of S is +4 that is it is in its first exited state.it forms sp2 hybridisation and the other p and d orbitals from pπ-pπ and pπ-dπ bonds.then where did the lonepair come from?
​​​
21.

The mole fraction of solute in aqueous solution is 0.2. Calculate molality of solution.

Answer» The mole fraction of solute in aqueous solution is 0.2. Calculate molality of solution.
22.

Give reason for the below 1))all bonds in pcl5are not equivalent. 2)ka2

Answer» Give reason for the below
1))all bonds in pcl5are not equivalent.
2)ka2< 3)inter halogen compounds are strong oxidising agents
4)the bond energy of F2 is less than that of cl2
5) of the Nobel gases only Xenon forms known chemical compounds
23.

7. Reaction of cyclohexanone with dimethylamine in presence of catalytic amount of acid form compound if water during reaction is continuously removed .the compound formed is known as 1_Schiff's base 2_enamine 3_imine 4_amine

Answer» 7. Reaction of cyclohexanone with dimethylamine in presence of catalytic amount of acid form compound if water during reaction is continuously removed .the compound formed is known as 1_Schiff's base 2_enamine 3_imine 4_amine
24.

1 mole of equimolar mixture of ferric oxalate and ferrous oxalate will require x mole of KMnO4 in acidic medium for complete oxidation, x is

Answer»

1 mole of equimolar mixture of ferric oxalate and ferrous oxalate will require x mole of KMnO4 in acidic medium for complete oxidation, x is


25.

The compound X in the reaction,

Answer»

The compound X in the reaction,

26.

what does isotropy of nature mean?

Answer» what does isotropy of nature mean?
27.

is an example of which of the following types of reactions[AFMC 1997; CPMT 1999]

Answer»

is an example of which of the following types of reactions


[AFMC 1997; CPMT 1999]
28.

Find out number of dimerised products obtained by the following reaction.

Answer» Find out number of dimerised products obtained by the following reaction.


29.

The correct order of melting point of alkali metal chlorides is:

Answer»

The correct order of melting point of alkali metal chlorides is:

30.

In reaction CH3COCH3(g)⇌CH3CH3(g)+CO(g) If the initial pressure of CH3COCH3(g) is 150 mm and at Equilibrium the mole fraction of CO is 13 then the value of Kp is

Answer»

In reaction CH3COCH3(g)CH3CH3(g)+CO(g) If the initial pressure of CH3COCH3(g) is 150 mm and at Equilibrium the mole fraction of CO is 13 then the value of Kp is

31.

The above P-V diagram represents the thermodynamic cycle of an engine, operating with an ideal monoatomic gas. The amount of heat, extracted from the source in a single cycle is:

Answer»

The above P-V diagram represents the thermodynamic cycle of an engine, operating with an ideal monoatomic gas. The amount of heat, extracted from the source in a single cycle is:

32.

Convert 33 degree 36' 18" to degree.

Answer» Convert 33 degree 36' 18" to degree.
33.

4 gram of H2 reacts with 20 gram of O2 to form water. The mass of water formed is.

Answer» 4 gram of H2 reacts with 20 gram of O2 to form water. The mass of water formed is.
34.

CsCl crystallizes in B.C.C lattice. If ‘a’ is its edge length then which of the following expressions is correct?

Answer»

CsCl crystallizes in B.C.C lattice. If ‘a’ is its edge length then which of the following expressions is correct?

35.

For a first order reaction, A→ products, the plot of rate versus t is correctly represented in

Answer»

For a first order reaction, A products, the plot of rate versus t is correctly represented in

36.

light of wavelength 500nm is incident on a metal work function 2.28 ev .the de brogli wavelength of emiited e

Answer» light of wavelength 500nm is incident on a metal work function 2.28 ev .the de brogli wavelength of emiited e
37.

What is conductance and conductivity and difference between them and what is molar conductivity?

Answer» What is conductance and conductivity and difference between them and what is molar conductivity?
38.

why are the gills of fish fine and delicate?

Answer» why are the gills of fish fine and delicate?
39.

Energy of 2p-orbital of hydrogen atom is greater than 2s-orbital. true or false

Answer» Energy of 2p-orbital of hydrogen atom is greater than 2s-orbital. true or false
40.

33.Why 3 lone pairs cannot be present in AB6 type of molecule.

Answer» 33.Why 3 lone pairs cannot be present in AB6 type of molecule.
41.

The reaction in which hydrocarbons combine with oxygen to form carbon dioxide and water along with heat and light is known as

Answer»

The reaction in which hydrocarbons combine with oxygen to form carbon dioxide and water along with heat and light is known as



42.

Does the reaction R• +HX slow down with increase in temperature

Answer» Does the reaction R• +HX slow down with increase in temperature
43.

find the total number of enantiomers of \lbrack M(en)_2ab\rbrack complex where M is the central metal atom and a,b are ligands. (en) represents ethylene 1,2 diamine. _{}

Answer» find the total number of enantiomers of \lbrack M(en)_2ab\rbrack complex where M is the central metal atom and a,b are ligands. (en) represents ethylene 1,2 diamine. _{}
44.

what is the highest oxidation state of boron and why?

Answer» what is the highest oxidation state of boron and why?
45.

The density of gold is 19 g/cm3. If 1.9 x 104 g of goldis dispersed in one litre of water to give a sol havingspherical gold particles of radius 10 nm, then the numberof gold particles per mm3 of the sol will be

Answer» The density of gold is 19 g/cm3. If 1.9 x 104 g of goldis dispersed in one litre of water to give a sol havingspherical gold particles of radius 10 nm, then the numberof gold particles per mm3 of the sol will be
46.

Which one of the following compounds will be least susceptible to elimination of HBr?

Answer»

Which one of the following compounds will be least susceptible to elimination of HBr?

47.

In the calculation of number of atoms per unit cell, how many atoms will be present in an End Centered Cubic Unit Cell(ECC)?

Answer» In the calculation of number of atoms per unit cell, how many atoms will be present in an End Centered Cubic Unit Cell(ECC)?
48.

300ml N2 80% pure and reacts with 300ml H2 50% pure to form NH3 and volume become 550m. calculate volume of NH3 produce

Answer» 300ml N2 80% pure and reacts with 300ml H2 50% pure to form NH3 and volume become 550m. calculate volume of NH3 produce
49.

The suspension of slaked lime in water is known as

Answer»

The suspension of slaked lime in water is known as

50.

Two cylinders A and B fitted with pistons contain equal amounts of an ideal diatomic gas at 300K. The piston A is free to move, while that of B is held fixed. The same amount of heat is given to the gas in each cylinder. If the rise in temperature of the gas in A is 30K, then the rise in temperature of the gas in B isWhy will be pressure constant in case A ?

Answer» Two cylinders A and B fitted with pistons contain equal amounts of an ideal diatomic gas at 300K. The piston A is free to move, while that of B is held fixed. The same amount of heat is given to the gas in each cylinder. If the rise in temperature of the gas in A is 30K, then the rise in temperature of the gas in B is

Why will be pressure constant in case A ?