Explore topic-wise InterviewSolutions in Current Affairs.

This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.

1.

ntwhat is molalityn

Answer» ntwhat is molalityn
2.

Among group 13 metals, which one has the highest electronegativity?

Answer»

Among group 13 metals, which one has the highest electronegativity?



3.

The structure of IF7 is

Answer»

The structure of IF7 is

4.

8. 500 ml of a sample of water contains 0.5mg of CaCl2 and 0.5mg of MgCl2.The degree of hardness of water is (1)1.95 ppm (2)2.25ppm (3)2.90ppm (4)0.95ppm

Answer» 8. 500 ml of a sample of water contains 0.5mg of CaCl2 and 0.5mg of MgCl2.The degree of hardness of water is (1)1.95 ppm (2)2.25ppm (3)2.90ppm (4)0.95ppm
5.

Point out the angular momentum of an electron in 3p orbital

Answer»

Point out the angular momentum of an electron in 3p orbital

6.

The structure of Q is

Answer» The structure of Q is
7.

76 what is alkyl radical group?

Answer» 76 what is alkyl radical group?
8.

exchange in matter but not energy is possible in thermodynamics system ?

Answer» exchange in matter but not energy is possible in thermodynamics system ?
9.

The ratio of Boyle's temperature and critical temperature for a gas is:

Answer»

The ratio of Boyle's temperature and critical temperature for a gas is:



10.

the reagent which converts glucose into osazone is

Answer» the reagent which converts glucose into osazone is
11.

2. Total number of electrons present in 48 gram Mg²+ positive are : 1. 24NA 2. 2.5 NA 3. 1.1 NA 4. 100 NA

Answer» 2. Total number of electrons present in 48 gram Mg²+ positive are : 1. 24NA 2. 2.5 NA 3. 1.1 NA 4. 100 NA
12.

The recommended concentration of fluoride ion in drinking water is up to 1 ppm as fluoride ions are required to make teeth enamel harder by converting [3Ca3(PO4)2.Ca(OH)2] to

Answer»

The recommended concentration of fluoride ion in drinking water is up to 1 ppm as fluoride ions are required to make teeth enamel harder by converting [3Ca3(PO4)2.Ca(OH)2] to

13.

What is the number of stereoisomers in case of camphor?

Answer» What is the number of stereoisomers in case of camphor?
14.

17 How many oxygen atoms are required to form ozonide from benzene ? With proper explanation

Answer» 17 How many oxygen atoms are required to form ozonide from benzene ? With proper explanation
15.

what is main differences between ion ion , dipole dipole and vander wall interactions

Answer» what is main differences between ion ion , dipole dipole and vander wall interactions
16.

10.Two moles of pcl5 when heated in a closed vessel of 2 L capacity is found to attain equilibrium when 60 %of pcl5 was decomposed. The kc of the reaction is

Answer» 10.Two moles of pcl5 when heated in a closed vessel of 2 L capacity is found to attain equilibrium when 60 %of pcl5 was decomposed. The kc of the reaction is
17.

Electrochemical equivalent of Ag in the reactionAg+ + e– → Ag is

Answer» Electrochemical equivalent of Ag in the reaction
Ag+ + e– → Ag is
18.

a 5μ F capacitor is charged to 10V .the positive plate of this capacitor is now connected to the negative terminal of a 10V battery and vice-versa.the heat developed during the second step is

Answer» a 5μ F capacitor is charged to 10V .the positive plate of this capacitor is now connected to the negative terminal of a 10V battery and vice-versa.the heat developed during the second step is
19.

which of the following with aqueous KOH will give acetaldehyde? 1) 1,2-dichloroethane 2) 1,1-dichloroethane 3) Chloroacetic acid 4) Ethyl chlorid

Answer» which of the following with aqueous KOH will give acetaldehyde? 1) 1,2-dichloroethane 2) 1,1-dichloroethane 3) Chloroacetic acid 4) Ethyl chlorid
20.

In which pair of ions, both the species contain a S-S bond?

Answer»

In which pair of ions, both the species contain a S-S bond?

21.

In reduction CH3COCH3(g)⇌CH3CH3(g)+CO(g), if the initial pressure of CH3COCH3(g) is 150 mm and at equilibrium the mole fraction of CO(g) is 13 then the value Kp is

Answer»

In reduction
CH3COCH3(g)CH3CH3(g)+CO(g), if the initial pressure of CH3COCH3(g) is 150 mm and at equilibrium the mole fraction of CO(g) is 13 then the value Kp is

22.

The smell of hot sizzling food reaches you several meters away, but to get the smell from cold food you have to go close. Explain the reason.

Answer»

The smell of hot sizzling food reaches you several meters away, but to get the smell from cold food you have to go close. Explain the reason.
23.

Acid anhydrides on reaction with primary amines give ____________.(i) amide(ii) imide(iii) secondary amine(iv) imine

Answer» Acid anhydrides on reaction with primary amines give ____________.
(i) amide
(ii) imide
(iii) secondary amine
(iv) imine
24.

In polymeric (becl2)n there are A. Three centre four electron bonds B. Three centre three electrons bond C. Two centre two electrons bond D. Two centre three electrons bond

Answer» In polymeric (becl2)n there are A. Three centre four electron bonds B. Three centre three electrons bond C. Two centre two electrons bond D. Two centre three electrons bond
25.

The correct acidic strength is 1)HCLO4>HCLO3>HCLO2>HCLO 2)HCLO3>HBRO3>HIO3 3)H3po2>H3po3>H3po44) all

Answer» The correct acidic strength is
1)HCLO4>HCLO3>HCLO2>HCLO
2)HCLO3>HBRO3>HIO3
3)H3po2>H3po3>H3po4
4) all
26.

lowering of vapour pressure for 1 molal aqueous solution is 1.08 mm of Hg at 298 K. The vapour pressure of pure liquid at 298 K is 10x mm of Hg. The value of x will be, assuming very dilute aqueous solution

Answer» lowering of vapour pressure for 1 molal aqueous solution is 1.08 mm of Hg at 298 K. The vapour pressure of pure liquid at 298 K is 10x mm of Hg. The value of x will be, assuming very dilute aqueous solution
27.

8 CH2=CH-CH=CH2 + HBr---->Low temp. (X) ----->High temp. (Y) X and Y respectively are ? (1) CH3-CH=CH-CH2-Br and CH3-CHBr-CH=CH2 (2) CH3-CHBr-CH=CH2 and CH3-CH=CH-CH2-Br (3) CH3-CH=CH-CH2-Br and CH3-CH=CH-CH2-Br (4) CH3-CHBr-CH=CH2 and CH3-CHBr-CH=CH2.

Answer» 8 CH2=CH-CH=CH2 + HBr---->Low temp. (X) ----->High temp. (Y) X and Y respectively are ? (1) CH3-CH=CH-CH2-Br and CH3-CHBr-CH=CH2 (2) CH3-CHBr-CH=CH2 and CH3-CH=CH-CH2-Br (3) CH3-CH=CH-CH2-Br and CH3-CH=CH-CH2-Br (4) CH3-CHBr-CH=CH2 and CH3-CHBr-CH=CH2.
28.

77.What will be the equivalent mass of hcl in the reaction : k2cr2o7+14hcl--->2kcl + 2crcl3 + 3cl2 + h2O. Detailed explanation. Describe how to determine the n factor of HCl in the reaction

Answer» 77.What will be the equivalent mass of hcl in the reaction : k2cr2o7+14hcl--->2kcl + 2crcl3 + 3cl2 + h2O. Detailed explanation. Describe how to determine the n factor of HCl in the reaction
29.

The binding energy per nucleon is lowest for H atom , so does that mean H is the least stable among all

Answer» The binding energy per nucleon is lowest for H atom , so does that mean H is the least stable among all
30.

In what terms the Planck's Constant is used ?What's the reason ?

Answer» In what terms the Planck's Constant is used ?What's the reason ?
31.

For the balanced chemical equation :xH2SO4+ySO2+zNa2CrO4⟶Cr2(SO4)3+aNa2SO4+bH2OThe value of x+y+z-a-b is :3

Answer» For the balanced chemical equation :



xH2SO4+ySO2+zNa2CrO4Cr2(SO4)3+aNa2SO4+bH2O



The value of x+y+z-a-b is :
  1. 3
32.

The correct increasing order of acidity is:

Answer»

The correct increasing order of acidity is:



33.

glucose is a simpler or complex molecule?

Answer» glucose is a simpler or complex molecule?
34.

A compound of vanadium has a spin magnetic moment of 1.73 BM. Work out the electronic configuration of the vanadium ion in the compound.

Answer»

A compound of vanadium has a spin magnetic moment of 1.73 BM. Work out the electronic configuration of the vanadium ion in the compound.

35.

Name a sweetening agent used in the preparation of sweets for a diabetic patient.

Answer»

Name
a sweetening agent used in the preparation
of sweets for a diabetic patient.

36.

Oxygen and hydrogen are present in 2:1 molar ratio at 10 atm pressure find ratio of rate of diffusion . also find mole of gases diffused Find ratio of gas diffused from H2 to O2 if equal mass of gas is present

Answer» Oxygen and hydrogen are present in 2:1 molar ratio at 10 atm pressure find ratio of rate of diffusion . also find mole of gases diffused Find ratio of gas diffused from H2 to O2 if equal mass of gas is present
37.

The correct increasing order of the rate of reaction for alkyl halides undergoing E1 and E2 reaction respectively is: Here,1∘is primary alkyl halide2∘is secondary alkyl halide3∘is tertiary alkyl halide

Answer»

The correct increasing order of the rate of reaction for alkyl halides undergoing E1 and E2 reaction respectively is:

Here,

1is primary alkyl halide

2is secondary alkyl halide

3is tertiary alkyl halide

38.

formula of grazing emergence

Answer» formula of grazing emergence
39.

Given are the bond enthalpies: ϵN≡N=945 kJ mol−1, ϵH−H=436 kJ mol−1 and ϵ(N−H)=391 kJ mol−1. The enthalpy change of the reactionN2(g)+3H2(g)→2NH3(g) is

Answer»

Given are the bond enthalpies: ϵNN=945 kJ mol1, ϵHH=436 kJ mol1 and ϵ(NH)=391 kJ mol1. The enthalpy change of the reaction

N2(g)+3H2(g)2NH3(g) is

40.

calculate volume of the gases liberated at STP if 1 l of 0.2 molar solution of CuSO4 is electrolysed by 5.79 A current for 10000 seconds

Answer» calculate volume of the gases liberated at STP if 1 l of 0.2 molar solution of CuSO4 is electrolysed by 5.79 A current for 10000 seconds
41.

Consider the nitration of benzene using mixed conc. H2SO4 and HNO3. If a large amount of KHSO4 is added to the mixture, the rate of nitration will be:

Answer»

Consider the nitration of benzene using mixed conc. H2SO4 and HNO3. If a large amount of KHSO4 is added to the mixture, the rate of nitration will be:


42.

Calculate % ionic character in HCl. Bond length=1.275∘A, μobserved = 1.03 D

Answer»

Calculate % ionic character in HCl.

Bond length=1.275A, μobserved = 1.03 D


43.

Three elements X, Y and Z crystallise in a cubic solid with X at corners, Y at body centre and Z at the face centres of the cube, then the formula of the solid is

Answer»

Three elements X, Y and Z crystallise in a cubic solid with X at corners, Y at body centre and Z at the face centres of the cube, then the formula of the solid is


44.

the no. of moles of N-atom in 18.066 * 10^23 nitrogen atom is?

Answer» the no. of moles of N-atom in 18.066 * 10^23 nitrogen atom is?
45.

Which of the following compound(s) gives SN1 and SN2 mechanisms?

Answer»

Which of the following compound(s) gives SN1 and SN2 mechanisms?

46.

20. Which interaction is stronger , hydrogen bond or dipole-dipole why?

Answer» 20. Which interaction is stronger , hydrogen bond or dipole-dipole why?
47.

A 100 mL flask contained H2 at 200 Torr, and a 200 mL flask contained He at 100 Torr. The two flask were then connected so that each gas filled their combined volume. Assuming no change in temperature, total pressure is:

Answer»

A 100 mL flask contained H2 at 200 Torr, and a 200 mL flask contained He at 100 Torr. The two flask were then connected so that each gas filled their combined volume. Assuming no change in temperature, total pressure is:

48.

39.Why the coordination number crystals with directional bond is lower than the crystals with non directional bonds ?

Answer» 39.Why the coordination number crystals with directional bond is lower than the crystals with non directional bonds ?
49.

Why is the second ionisation energy of Bismuth greater than that of Antimony?

Answer»

Why is the second ionisation energy of Bismuth greater than that of Antimony?

50.

MSO4NH4OH−−−−−→↓XwhiteNH4OH−−−−−→excessYH2S−−→↓Z. Here M and Z are:

Answer»

MSO4NH4OH−−−−XwhiteNH4OH−−−−excessYH2SZ. Here M and Z are: