46295 + Interview Questions in Chemistry

1.	Which of the following isomeric structure have lowest energy?
Answer» Which of the following isomeric structure have lowest energy?

Discussion

2.	39. How many moles of ammonia contains 6.022\ast10^{24} electron
Answer» 39. How many moles of ammonia contains 6.022\ast10^{24} electron

Discussion

3.	1.If the rate of reaction increases to two times with every 10 degree rise in temperature then if we raise the temperature by 40 degree the new rate of the reaction will be
Answer» 1.If the rate of reaction increases to two times with every 10 degree rise in temperature then if we raise the temperature by 40 degree the new rate of the reaction will be

Discussion

4.	Give the structure of ‘A’ in the following reaction.
Answer» Give the structure of ‘A’ in the following reaction.

4.

Give the structure of ‘A’ in the following reaction.

Answer»

Give the structure of ‘A’ in the following reaction.

Discussion

5.	NN bond is stronger or pp bond is stronger
Answer» NN bond is stronger or pp bond is stronger

Discussion

6.	what are the major and minor product formed, if I add CYCLOHEXAN-1,2-DIOL in a acidic solution? (a type of pinacol-pinacolone rearrangement
Answer» what are the major and minor product formed, if I add CYCLOHEXAN-1,2-DIOL in a acidic solution? (a type of pinacol-pinacolone rearrangement

Discussion

7.	The hybridization of any of the Carbon atoms in C2H2 is .
Answer» The hybridization of any of the Carbon atoms in C2H2 is .

Discussion

8.	The product "A" in the above reaction is :
Answer» The product "A" in the above reaction is :

Discussion

9.	NaBH4+I2→X+Y+ZBF3+NaH450K−−−→X+PBF3+LiAlH4→X+QIdentify X,Y,Z,P and Q.
Answer» $N a B H_{4} + I_{2} \to X + Y + Z$ $B F_{3} + N a H 450 K - -- \to X + P$ $B F_{3} + L i A l H_{4} \to X + Q$ Identify $X, Y, Z, P and Q .$

Discussion

10.	How to find the stability of carbocation
Answer» How to find the stability of carbocation

Discussion

11.	Vapourpressure of pure water at 298 K is 23.8 mm Hg. 50 g of urea(NH2CONH2)is dissolved in 850 g of water. Calculate the vapour pressure ofwater for this solution and its relative lowering.
Answer» Vapour pressure of pure water at 298 K is 23.8 mm Hg. 50 g of urea (NH₂CONH₂) is dissolved in 850 g of water. Calculate the vapour pressure of water for this solution and its relative lowering.

Discussion

12.	Predictthe products of the following reactions:(i) (ii) (iii) (iv)
Answer» Predict the products of the following reactions: (i) (ii) (iii) (iv)

12.

Predictthe products of the following reactions:(i) (ii) (iii) (iv)

Answer»

Predict
the products of the following reactions:

(i)

(ii)

(iii)

(iv)

Discussion

13.	What amount of bromine will be required to convert 2g of phenol into 2,4,6-tribromophenol? 1)4 2)6 3)10.22 4)20.44
Answer» What amount of bromine will be required to convert 2g of phenol into 2,4,6-tribromophenol? 1)4 2)6 3)10.22 4)20.44

Discussion

14.	total number of isomersfor the complex\lbrack Co(en)2(NO2)(SCN)\rbrack are:a.3 b.6 c.9 d.1
Answer» total number of isomersfor the complex\lbrack Co(en)2(NO2)(SCN)\rbrack are:a.3 b.6 c.9 d.1

Discussion

15.	Manufacture of SO3 is given by the following reaction2SO2 (g)+O2 (g)⇌2SO3 (g)If the equilibrium constant Kc is 1.7×102 at 300 K, then the value of ΔrG∘ at the same temperature will be
Answer» Manufacture of $S O_{3}$ is given by the following reaction $2 S O_{2} (g) + O_{2} (g) ⇌ 2 S O_{3} (g)$ If the equilibrium constant $K_{c}$ is $1.7 \times 10^{2}$ at $300 K$ , then the value of $Δ r G^{\circ}$ at the same temperature will be

Discussion

16.	mole fraction of ethanol water mixture 0.25 .hence percentage concentration by weight of mixture is 1.25% 2.75% 3.46% 4.54%
Answer» mole fraction of ethanol water mixture 0.25 .hence percentage concentration by weight of mixture is 1.25% 2.75% 3.46% 4.54%

Discussion

17.	Calcium carbonate reacts with aqueous HCl to give CaCl2 and CO2 according to the reaction given belowCaCO3(s)Calcium Carbonate+2HCl(aq)Hydrochloric acid⟶CaCl2(aq)Calcium Chloride+CO2(g)Carbon dioxide+H2O(l)WaterWhat mass of CaCO3 is required to react completely with 25 mL of 0.75 M HCl? 1) 0.68442) 0.93753) 0.42654) 0.2785
Answer» Calcium carbonate reacts with aqueous $HCl$ to give ${CaCl}_{2}$ and ${CO}_{2}$ according to the reaction given below $\underset{Calcium Carbonate}{{CaCO}_{3} (s)} + \underset{Hydrochloric acid}{2 HCl (aq)} ⟶ \underset{Calcium Chloride}{{CaCl}_{2} (aq)} + \underset{Carbon dioxide}{{CO}_{2} (g)} + \underset{Water}{H_{2} O (l)}$ What mass of ${CaCO}_{3}$ is required to react completely with 25 mL of 0.75 M HCl? 1) 0.6844 2) 0.9375 3) 0.4265 4) 0.2785

17.

Calcium carbonate reacts with aqueous HCl to give CaCl2 and CO2 according to the reaction given belowCaCO3(s)Calcium Carbonate+2HCl(aq)Hydrochloric acid⟶CaCl2(aq)Calcium Chloride+CO2(g)Carbon dioxide+H2O(l)WaterWhat mass of CaCO3 is required to react completely with 25 mL of 0.75 M HCl? 1) 0.68442) 0.93753) 0.42654) 0.2785

Answer»

Calcium carbonate reacts with aqueous $HCl$ to give ${CaCl}_{2}$ and ${CO}_{2}$ according to the reaction given below

$\underset{Calcium Carbonate}{{CaCO}_{3} (s)} + \underset{Hydrochloric acid}{2 HCl (aq)} ⟶ \underset{Calcium Chloride}{{CaCl}_{2} (aq)} + \underset{Carbon dioxide}{{CO}_{2} (g)} + \underset{Water}{H_{2} O (l)}$

What mass of ${CaCO}_{3}$ is required to react completely with 25 mL of 0.75 M HCl?

1) 0.6844

2) 0.9375

3) 0.4265

4) 0.2785

Discussion

18.	Select the correct statements :(1)Metal nitrides produce N2 gas on hydrolysis(2)Acetic acid is a weaker acid in liquid NH3, while stronger in water(3)In ostwald's process 'NO' is produced by the reaction of N2 with O2(4)NO2 is called as mixed anhydride
Answer» Select the correct statements : (1) Metal nitrides produce N2 gas on hydrolysis (2) Acetic acid is a weaker acid in liquid NH3, while stronger in water (3) In ostwald's process 'NO' is produced by the reaction of N2 with O2 (4) NO2 is called as mixed anhydride

Discussion

19.	Kp for the reaction CO2 + H2 =CO + H2O is found to be 16 at a given temperature. Originally equal number of moles of H2 and CO2 were placed in the flask.At equilibrium the pressure of H2 is 1.20 atm.What us the partial pressure of CO and H2O? A 1.2 each B 2.40 each C. 4.80 each D. None
Answer» Kp for the reaction CO2 + H2 =CO + H2O is found to be 16 at a given temperature. Originally equal number of moles of H2 and CO2 were placed in the flask.At equilibrium the pressure of H2 is 1.20 atm.What us the partial pressure of CO and H2O? A 1.2 each B 2.40 each C. 4.80 each D. None

Discussion

20.	how to take out whether the compound is aromatic and it follows huckel rule
Answer» how to take out whether the compound is aromatic and it follows huckel rule

Discussion

21.	34. The element having the lowest enthalpy of ionisation(I) Fe Co Ni Cu
Answer» 34. The element having the lowest enthalpy of ionisation(I) Fe Co Ni Cu

Discussion

22.	The relation between ΔE and ΔH is
Answer» The relation between $Δ E a n d Δ H$ is

Discussion

23.	What are alkyl halides?
Answer» What are alkyl halides?

Discussion

24.	In O3. Then select the correct option about bond length?
Answer» In O3. Then select the correct option about bond length?

Discussion

25.	Is steel metal or non metal
Answer» Is steel metal or non metal

Discussion

26.	43. Among LiCl and AlCl3 which has higher hydration energy??
Answer» 43. Among LiCl and AlCl3 which has higher hydration energy??

Discussion

27.	Which of the following can not be resolved?
Answer» Which of the following can not be resolved?

Discussion

28.	calculate the number of oxygen atoms in 1 litr air if air contains 20% O_2.
Answer» calculate the number of oxygen atoms in 1 litr air if air contains 20% O_2.

Discussion

29.	Find total number of isomers for square planar complex \lbrack Pd(H2O)(Br)(NH3)(CN)\rbrack(1)(2)2(3)4(4)6
Answer» Find total number of isomers for square planar complex \lbrack Pd(H2O)(Br)(NH3)(CN)\rbrack(1)(2)2(3)4(4)6

Discussion

30.	One liter of NH3 solution dissolves 0.10 mole of AgCl. Its concentration is: (Ksp of AgCl and Kf of [Ag(NH3)2]+ are 10−10 and 1.6×107 respectively)
Answer» One liter of $N H_{3}$ solution dissolves 0.10 mole of AgCl. Its concentration is: $(K_{s p}$ of AgCl and $K_{f}$ of $[A g (N H_{3})_{2}]^{+}$ are $10^{- 10} and 1.6 \times 10^{7}$ respectively)

Discussion

31.	CO2 gas along with solid (Y) is obtained when sodium salt (X) is heated. (X) is again obtained when CO2 gas is passed into aqueous solution of (Y). Identify (X) & (Y) respectively
Answer» $C O_{2}$ gas along with solid (Y) is obtained when sodium salt (X) is heated. (X) is again obtained when $C O_{2}$ gas is passed into aqueous solution of (Y). Identify (X) & (Y) respectively

Discussion

32.	How many structural isomers can you write for all the isomeric alcohols having the molecular formula C4H10O.
Answer» How many structural isomers can you write for all the isomeric alcohols having the molecular formula $C_{4} H_{10} O$ .

Discussion

33.	Agiven coin has a mass of 3.0 g. Calculate the nuclear energy thatwould be required to separate all the neutrons and protons from eachother. For simplicity assume that the coin is entirely made of atoms(of mass 62.92960 u).
Answer» A given coin has a mass of 3.0 g. Calculate the nuclear energy that would be required to separate all the neutrons and protons from each other. For simplicity assume that the coin is entirely made of atoms (of mass 62.92960 u).

Discussion

34.	Tc and Pc of a gas are 400 K and 41 atm respectively, Vc is:
Answer» $T_{c}$ and $P_{c}$ of a gas are $400 K$ and $41$ atm respectively, $V_{c}$ is:

Discussion

35.	what represents the radial probability density of finding an electron
Answer» what represents the radial probability density of finding an electron

Discussion

36.	Actinoid contraction is greater than lanthanoid contraction because the shielding effect of 5f orbitals is poorer than that of 4f orbitals, then why is the ionisation enthalpies of actinoids less than that of the lanthanoids?
Answer» Actinoid contraction is greater than lanthanoid contraction because the shielding effect of 5f orbitals is poorer than that of 4f orbitals, then why is the ionisation enthalpies of actinoids less than that of the lanthanoids?

Discussion

37.	A KCl solution of conductivity 0.14Sm−1 shows a resistance of 4.19 Ω in a conductivity cell. If the same cell is filled with an HCl solution, the resistance drops 1.03 Ω. The conductivity of the HCl solution is . x 10−2Sm−1. (Round off to the Nearest Integer).
Answer» A KCl solution of conductivity $0.14 S m^{- 1}$ shows a resistance of 4.19 Ω in a conductivity cell. If the same cell is filled with an HCl solution, the resistance drops 1.03 Ω. The conductivity of the HCl solution is . x $10^{- 2} S m^{- 1}$ . (Round off to the Nearest Integer).

Discussion

38.	how to draw the structures of p block elements- steps
Answer» how to draw the structures of p block elements- steps

Discussion

39.	लेखक के अनुसार उन्हें स्कूल खुशी से भागे जाने की जगह न लगने पर भी कब और क्यों उन्हें स्कूल जाना अच्छा लगने लगा?
Answer» लेखक के अनुसार उन्हें स्कूल खुशी से भागे जाने की जगह न लगने पर भी कब और क्यों उन्हें स्कूल जाना अच्छा लगने लगा?

Discussion

40.	Calculate the percentage of p − character of the orbitals of ‘B′ atom involved in bonding with H-atom in BH3 molecule.
Answer» Calculate the percentage of $p -$ character of the orbitals of $‘ B^{'}$ atom involved in bonding with $H$ -atom in $B H_{3}$ molecule.

Discussion

41.	If the density of crystalline CsCl is 3.988g/cm calculate the volume effectively occupied by a single CsCl Ion pair in the Crystal (CsCl =168.4)
Answer» If the density of crystalline CsCl is 3.988g/cm calculate the volume effectively occupied by a single CsCl Ion pair in the Crystal (CsCl =168.4)

Discussion

42.	What happens when AlCl3 vapours are passed over fused Al2O3 at 1000C
Answer» What happens when AlCl3 vapours are passed over fused Al2O3 at 1000C

Discussion

43.	44.Why the ionisation energy of Zn>Cd
Answer» 44.Why the ionisation energy of Zn>Cd

Discussion

44.	Let A and B be two sets such that n(A) = 4 and n(B) = 6, then minimum value of n(A ∪ B) and maximum value of n(A ∪ B) are λ and μ respectively, where (2 λ – μ) equals
Answer» Let A and B be two sets such that n(A) = 4 and n(B) = 6, then minimum value of n(A ∪ B) and maximum value of n(A ∪ B) are λ and μ respectively, where (2 λ – μ) equals

Discussion

45.	Calculate the mass % of MgO in 20g of a mixture of MgO and CaO which just reacts with 100mL of 8M HCI completely MgO + 2HCI → MgCl_2+H_2O; CaO + 2HCI → CaCl_2+ H_2O:- (1) 30%, (2) 40%, (3) 50%, (4) 70%.
Answer» Calculate the mass % of MgO in 20g of a mixture of MgO and CaO which just reacts with 100mL of 8M HCI completely MgO + 2HCI → MgCl_2+H_2O; CaO + 2HCI → CaCl_2+ H_2O:- (1) 30%, (2) 40%, (3) 50%, (4) 70%.

Discussion

46.	Which of the following complex ion is expected to absorb light in the visible region ?
Answer» Which of the following complex ion is expected to absorb light in the visible region ?

Discussion

47.	Potassium when heated strongly in oxygen, it forms
Answer» Potassium when heated strongly in oxygen, it forms

Discussion

48.	Which of the following oxyanions contain S-S (single bond)?
Answer» Which of the following oxyanions contain S-S (single bond)?

Discussion

49.	Assuming z-orbital to be the inter-nuclear axis, which of the following overlaps is incorrect?
Answer» Assuming $z$ -orbital to be the inter-nuclear axis, which of the following overlaps is incorrect?

Discussion

50.	What is the hybridisation of central atom in N20 (nitrous oxide).
Answer» What is the hybridisation of central atom in N20 (nitrous oxide).

Discussion

Explore topic-wise InterviewSolutions in Current Affairs.

Which of the following isomeric structure have lowest energy?

39. How many moles of ammonia contains 6.022\ast10^{24} electron

1.If the rate of reaction increases to two times with every 10 degree rise in temperature then if we raise the temperature by 40 degree the new rate of the reaction will be

Give the structure of ‘A’ in the following reaction.

NN bond is stronger or pp bond is stronger

what are the major and minor product formed, if I add CYCLOHEXAN-1,2-DIOL in a acidic solution? (a type of pinacol-pinacolone rearrangement

The hybridization of any of the Carbon atoms in C2H2 is .

The product "A" in the above reaction is :

NaBH4+I2→X+Y+ZBF3+NaH450K−−−→X+PBF3+LiAlH4→X+QIdentify X,Y,Z,P and Q.

How to find the stability of carbocation

Vapourpressure of pure water at 298 K is 23.8 mm Hg. 50 g of urea(NH2CONH2)is dissolved in 850 g of water. Calculate the vapour pressure ofwater for this solution and its relative lowering.

Predictthe products of the following reactions:(i) (ii) (iii) (iv)

What amount of bromine will be required to convert 2g of phenol into 2,4,6-tribromophenol? 1)4 2)6 3)10.22 4)20.44

total number of isomersfor the complex\lbrack Co(en)2(NO2)(SCN)\rbrack are:a.3 b.6 c.9 d.1

Manufacture of SO3 is given by the following reaction2SO2 (g)+O2 (g)⇌2SO3 (g)If the equilibrium constant Kc is 1.7×102 at 300 K, then the value of ΔrG∘ at the same temperature will be

mole fraction of ethanol water mixture 0.25 .hence percentage concentration by weight of mixture is 1.25% 2.75% 3.46% 4.54%

Select the correct statements :(1)Metal nitrides produce N2 gas on hydrolysis(2)Acetic acid is a weaker acid in liquid NH3, while stronger in water(3)In ostwald's process 'NO' is produced by the reaction of N2 with O2(4)NO2 is called as mixed anhydride

Kp for the reaction CO2 + H2 =CO + H2O is found to be 16 at a given temperature. Originally equal number of moles of H2 and CO2 were placed in the flask.At equilibrium the pressure of H2 is 1.20 atm.What us the partial pressure of CO and H2O? A 1.2 each B 2.40 each C. 4.80 each D. None

how to take out whether the compound is aromatic and it follows huckel rule

34. The element having the lowest enthalpy of ionisation(I) Fe Co Ni Cu

The relation between ΔE and ΔH is

What are alkyl halides?

In O3. Then select the correct option about bond length?

Is steel metal or non metal

43. Among LiCl and AlCl3 which has higher hydration energy??

Which of the following can not be resolved?

calculate the number of oxygen atoms in 1 litr air if air contains 20% O_2.

Find total number of isomers for square planar complex \lbrack Pd(H2O)(Br)(NH3)(CN)\rbrack(1)(2)2(3)4(4)6

One liter of NH3 solution dissolves 0.10 mole of AgCl. Its concentration is: (Ksp of AgCl and Kf of [Ag(NH3)2]+ are 10−10 and 1.6×107 respectively)

CO2 gas along with solid (Y) is obtained when sodium salt (X) is heated. (X) is again obtained when CO2 gas is passed into aqueous solution of (Y). Identify (X) & (Y) respectively

How many structural isomers can you write for all the isomeric alcohols having the molecular formula C4H10O.

Agiven coin has a mass of 3.0 g. Calculate the nuclear energy thatwould be required to separate all the neutrons and protons from eachother. For simplicity assume that the coin is entirely made of atoms(of mass 62.92960 u).

Tc and Pc of a gas are 400 K and 41 atm respectively, Vc is:

what represents the radial probability density of finding an electron

Actinoid contraction is greater than lanthanoid contraction because the shielding effect of 5f orbitals is poorer than that of 4f orbitals, then why is the ionisation enthalpies of actinoids less than that of the lanthanoids?

A KCl solution of conductivity 0.14Sm−1 shows a resistance of 4.19 Ω in a conductivity cell. If the same cell is filled with an HCl solution, the resistance drops 1.03 Ω. The conductivity of the HCl solution is . x 10−2Sm−1. (Round off to the Nearest Integer).

how to draw the structures of p block elements- steps

लेखक के अनुसार उन्हें स्कूल खुशी से भागे जाने की जगह न लगने पर भी कब और क्यों उन्हें स्कूल जाना अच्छा लगने लगा?

Calculate the percentage of p − character of the orbitals of ‘B′ atom involved in bonding with H-atom in BH3 molecule.

If the density of crystalline CsCl is 3.988g/cm calculate the volume effectively occupied by a single CsCl Ion pair in the Crystal (CsCl =168.4)

What happens when AlCl3 vapours are passed over fused Al2O3 at 1000C

44.Why the ionisation energy of Zn>Cd

Let A and B be two sets such that n(A) = 4 and n(B) = 6, then minimum value of n(A ∪ B) and maximum value of n(A ∪ B) are λ and μ respectively, where (2 λ – μ) equals

Calculate the mass % of MgO in 20g of a mixture of MgO and CaO which just reacts with 100mL of 8M HCI completely MgO + 2HCI → MgCl_2+H_2O; CaO + 2HCI → CaCl_2+ H_2O:- (1) 30%, (2) 40%, (3) 50%, (4) 70%.

Which of the following complex ion is expected to absorb light in the visible region ?

Potassium when heated strongly in oxygen, it forms

Which of the following oxyanions contain S-S (single bond)?

Assuming z-orbital to be the inter-nuclear axis, which of the following overlaps is incorrect?

What is the hybridisation of central atom in N20 (nitrous oxide).