Explore topic-wise InterviewSolutions in Current Affairs.

This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.

1.

Which of the following gases will have a density of 1.8 g L−1 at 760 torr pressure and 27∘C?

Answer»

Which of the following gases will have a density of 1.8 g L1 at 760 torr pressure and 27C?

2.

(a) Based on the nature of intermolecular forces, classify the following solids: Sodium sulphate, Hydrogen (b) What happens when CdCl2 is doped with AgCl? (c) Why do ferrimagneic substances show better magnetism than antiferromagnetic substances?

Answer» (a) Based on the nature of intermolecular forces, classify the following solids:
Sodium sulphate, Hydrogen
(b) What happens when CdCl2 is doped with AgCl?
(c) Why do ferrimagneic substances show better magnetism than antiferromagnetic substances?
3.

The standard enthalpies of formation at 300 K for CCl4(l), H2O (g), CO2(g) and HCl(g) are −107,−242,−394 and−93 kJ mol−1, respectively. The value of △Uo300 for the reaction: CCl4(l)+2H2O(g)→CO2(g)+4HCl(g) is −x kJ mol−1. Find the value of x (Take R=8.314 JK−1mol−1)

Answer» The standard enthalpies of formation at 300 K for CCl4(l), H2O (g), CO2(g) and HCl(g) are 107,242,394 and93 kJ mol1, respectively. The value of Uo300 for the reaction:

CCl4(l)+2H2O(g)CO2(g)+4HCl(g) is
x kJ mol1. Find the value of x
(Take R=8.314 JK1mol1)
4.

Let An be the area enclosed by the nth orbit in a hydrogen atom. The graph of In (AnA1) against in (n);

Answer» Let An be the area enclosed by the nth orbit in a hydrogen atom. The graph of In (AnA1) against in (n);
5.

The shape of the px orbital is:

Answer»

The shape of the px orbital is:


6.

Which of the following compounds is polar and has a central atom with sp3 hybridisation?

Answer»

Which of the following compounds is polar and has a central atom with sp3 hybridisation?

7.

The major product of the reaction between CH3CH2ONa and (CH3)3CCl in ethanol is

Answer»

The major product of the reaction between CH3CH2ONa and (CH3)3CCl in ethanol is

8.

Which of the following cannot be hydrolysed?

Answer»

Which of the following cannot be hydrolysed?

9.

A hydrocarbon C5H10 does not react with chlorine in dark but gives a single monochloro compound C5H9Cl in bright sunlight. Identify the hydrocarbon.

Answer»

A hydrocarbon C5H10 does not react with chlorine in dark but gives a single monochloro compound C5H9Cl in bright sunlight. Identify the hydrocarbon.

10.

In which of the following compounds does the central atom violate the octet rule? (Given: Atomic number,Se=34, As=33, B=5, N=7)

Answer»

In which of the following compounds does the central atom violate the octet rule?
(Given: Atomic number,Se=34, As=33, B=5, N=7)

11.

The degree of dissociation of water at 25∘C is 1.9×10−7 and density is 1.0 g cm−3 The ionic constant for water is :

Answer»

The degree of dissociation of water at 25C is 1.9×107 and density is 1.0 g cm3 The ionic constant for water is :

12.

The solubility of a salt of weak acid (AB) at pH 3 is Y×10–3 mol L–1. The value of Y is . (Given that the value of solubility product of AB Ksp=2×10–10 and the value of ionization constant of HB Ka=1×10–8)

Answer»

The solubility of a salt of weak acid (AB) at pH 3 is Y×103 mol L1. The value of Y is .
(Given that the value of solubility product of AB Ksp=2×1010 and the value of ionization constant of HB Ka=1×108)

13.

Find the volume occupied by 30 g of neon gas at STP.

Answer»

Find the volume occupied by 30 g of neon gas at STP.

14.

The initial charge across capacitors A and B are shown with Q =CE. Find the ratio of final charge in capacitor A to the final charge in capacitor B, when cells are switched on.___

Answer» The initial charge across capacitors A and B are shown with Q =CE. Find the ratio of final charge in capacitor A to the final charge in capacitor B, when cells are switched on.___
15.

In the following reaction [Cu(H2O)4]2+(aq)+HCO−3(aq)⇌[Cu(H2O)4OH−]+(aq)+H2CO3(aq) species behaving as a bronsted- lowry acid are:

Answer»

In the following reaction [Cu(H2O)4]2+(aq)+HCO3(aq)[Cu(H2O)4OH]+(aq)+H2CO3(aq)
species behaving as a bronsted- lowry acid are:

16.

How do the iron in hemoglobin gets rusted? If the blood in our body contains iron, why doesn't it rust?

Answer» How do the iron in hemoglobin gets rusted? If the blood in our body contains iron, why doesn't it rust?
17.

QUESTION 2.37 Vapour pressures of pure acetone and chloroform at 328 K are 741.8 mm Hg and 632.8 mm Hg respectively. Assuming that they form ideal solution over the entire range of composition, plot ptotal, pchloroform and pacetone. The experimental data observed for different compoisition of mixture is: 100 xacetone011.823.436.050.858.264.572.1pacetone/mm Hg054.9110.1202.4322.7405.9454.1521.1pchloroform/mm Hg632.8548.1469.4359.7257.7193.6161.2120.7 Plot this data also on the same graph paper. Indicate whether it has positive deviation or negative deviation from the ideal solution.

Answer»

QUESTION 2.37

Vapour pressures of pure acetone and chloroform at 328 K are 741.8 mm Hg and 632.8 mm Hg respectively. Assuming that they form ideal solution over the entire range of composition, plot ptotal, pchloroform and pacetone. The experimental data observed for different compoisition of mixture is:

100 xacetone011.823.436.050.858.264.572.1pacetone/mm Hg054.9110.1202.4322.7405.9454.1521.1pchloroform/mm Hg632.8548.1469.4359.7257.7193.6161.2120.7

Plot this data also on the same graph paper. Indicate whether it has positive deviation or negative deviation from the ideal solution.

18.

Mark the correct reactions:

Answer»

Mark the correct reactions:

19.

when methanol react with phenyl magnesium bromide product gives....

Answer»

when methanol react with phenyl magnesium bromide product gives....

20.

What happens when fats or oils react with caustic soda?

Answer» What happens when fats or oils react with caustic soda?
21.

'P' may be :

Answer»
'P' may be :
22.

A solution gives the following colours with different indicators: (A) Methyl orange ⇒ yellow (B) Methyl red ⇒ yellow (C) Bromo thymol blue ⇒ Orange What is the pH of the solution?

Answer»

A solution gives the following colours with different indicators:

(A) Methyl orange yellow (B) Methyl red yellow (C) Bromo thymol blue Orange What is the pH of the solution?


23.

Backward reaction is favoured by increase in the pressure of which of the following equilibrium?

Answer»

Backward reaction is favoured by increase in the pressure of which of the following equilibrium?

24.

The value of ΔG∘f of gaseous mercury is 19.09 kJ/mol. At what total external pressure mercury start boiling at 27 ∘C. [take R = 8.3 J/K/mol, lnKp as 2.3logKp]

Answer»

The value of ΔGf of gaseous mercury is 19.09 kJ/mol. At what total external pressure mercury start boiling at 27 C. [take R = 8.3 J/K/mol, lnKp as 2.3logKp]

25.

Column-I: Property; Column-II: Variation of property; Column-III: Magnitude Column-IColumn-IIColumn-III(I)Electron a affinity(EA1)(i)Decreases along the period(P)Highest in halogen in their respective periods(II)Ionization energy(IE1)(ii)Directly proportional to Zeff(Q)Highest in noble gases in their respective periods (III)Electronegativity(iii)Decreases down the group(R)Highest in alkali metals in their respective periods (IV)Electropositive character(iv)Inversly proportional to size(S)Moderate in noble gases in their respective periods The only correct combination for the tendency of an atom to attract a shared pair of electrons towards itself in the bound state is:

Answer»

Column-I: Property; Column-II: Variation of property; Column-III: Magnitude


Column-IColumn-IIColumn-III(I)Electron a affinity(EA1)(i)Decreases along the period(P)Highest in halogen in their respective periods(II)Ionization energy(IE1)(ii)Directly proportional to Zeff(Q)Highest in noble gases in their respective periods (III)Electronegativity(iii)Decreases down the group(R)Highest in alkali metals in their respective periods (IV)Electropositive character(iv)Inversly proportional to size(S)Moderate in noble gases in their respective periods


The only correct combination for the tendency of an atom to attract a shared pair of electrons towards itself in the bound state is:


26.

The difference of molecules of water in gypsum and plaster of paris is: (correct answer +1, wrong answer -0.25)

Answer»

The difference of molecules of water in gypsum and plaster of paris is:
(correct answer +1, wrong answer -0.25)

27.

Which of the following is the correct electronic configuration for C2?

Answer»

Which of the following is the correct electronic configuration for C2?

28.

What is the Kc of the reaction 2C ⇌ 2A if [C] = 0.4 and [A] = 0.6?

Answer»

What is the Kc of the reaction 2C 2A if [C] = 0.4 and [A] = 0.6?


29.

Explain why White Phosphorus is kept under water but red phosphorus is not?

Answer» Explain why White Phosphorus is kept under water but red phosphorus is not?
30.

Which of the following cannot be prepared directly by using NaOH?

Answer»

Which of the following cannot be prepared directly by using NaOH?

31.

When a solid solute is added to solvent, some solute dissolves and its concentration increases in solution. This process is known as

Answer»

When a solid solute is added to solvent, some solute dissolves and its concentration increases in solution. This process is known as

32.

Which of the following is correct for the orbitals of Cr?

Answer»

Which of the following is correct for the orbitals of Cr?


33.

In which of the following option the order of arrangement does not agree with the variation of property indicated against it a) Li<Na<K<Rb(increasing metallic radius) b) B<C<N<O(increasing 1st ionisation enthalpy) c)I<Br<Cl<F(increasing electron gain enthalpy) d) Al3+<Mg2+<Na+<F-(increasing ionic size)

Answer»

In which of the following option the order of arrangement does not agree with the variation of property indicated against it

a) Li<Na<K<Rb(increasing metallic radius)

b) B<C<N<O(increasing 1st ionisation enthalpy)

c)I<Br<Cl<F(increasing electron gain enthalpy)

d) Al3+<Mg2+<Na+<F-(increasing ionic size)

34.

Draw the structures of the following molecules : (i) XeF6 (ii) H2S2O7

Answer» Draw the structures of the following molecules :
(i) XeF6 (ii) H2S2O7
35.

What is the co ordination number of centered metal atom in the the complex K3[Fe(C2O4)3] please ......help me with this ......please

Answer»

What is the co ordination number of centered metal atom in the the complex K3[Fe(C2O4)3] please ......help me with this ......please

36.

What is coordinate number and how to find coordinate number of any particular compound

Answer» What is coordinate number and how to find coordinate number of any particular compound
37.

Intermolecular hydrogen bonding is strongest in:

Answer»

Intermolecular hydrogen bonding is strongest in:


38.

Explain mixed melting point

Answer» Explain mixed melting point
39.

Which one of the following is an amphoteric oxide?

Answer»

Which one of the following is an amphoteric oxide?


40.

Chalk is almost pure calcium carbonate. We can work out its purity by measuring how much carbon dioxide is given off when it reacts with HCl. 15 g of chalk was reacted with an excess of dilute hydrochloric acid. 2.24 liters of carbon dioxide gas was collected at standard temperature and pressure (STP). The equation for the reaction is : CaCO3(s)+2HCl(aq)→CaCl2(aq)+H2O(l)+CO2(g) Calculate the percentage purity. (Assume that impurity present does not produce CO2)

Answer»

Chalk is almost pure calcium carbonate. We can work out its purity by measuring how much carbon dioxide is given off when it reacts with HCl. 15 g of chalk was reacted with an excess of dilute hydrochloric acid. 2.24 liters of carbon dioxide gas was collected at standard temperature and pressure (STP).
The equation for the reaction is :
CaCO3(s)+2HCl(aq)CaCl2(aq)+H2O(l)+CO2(g)
Calculate the percentage purity.
(Assume that impurity present does not produce CO2)

41.

Lyophilic colloids that shows the property of protecting lyophobic colloids are also called as:

Answer»

Lyophilic colloids that shows the property of protecting lyophobic colloids are also called as:


42.

Write the IUPAC name of (CH3)2CCHO?

Answer»

Write the IUPAC name of (CH3)2CCHO?


43.

For a monoatomic gas, kinetic energy = E. The relation with rms velocity is:

Answer»

For a monoatomic gas, kinetic energy = E. The relation with rms velocity is:


44.

Silver benzoate reacts with bromine in CCl4 refluxing to form

Answer»

Silver benzoate reacts with bromine in CCl4 refluxing to form


45.

Predict the relative bond lengths a and b, in napthalene

Answer»

Predict the relative bond lengths a and b, in napthalene


46.

In Bohr's model of the hydrogen atom the ratio between the period of revolution of an electron in the orbit of n=1 to the period of the revolution of the electron in the orbit n=3 is:

Answer»

In Bohr's model of the hydrogen atom the ratio between the period of revolution of an electron in the orbit of n=1 to the period of the revolution of the electron in the orbit n=3 is:

47.

Which is the valence shell electronic configuration of group 14 elements?

Answer»

Which is the valence shell electronic configuration of group 14 elements?


48.

The correct order of density of alkali metals

Answer»

The correct order of density of alkali metals


49.

Iron reacts with oxygen to form Fe2O3. If the atomic mass of iron is 56, the mass of oxygen that reacts with 2.5moles of iron is

Answer»

Iron reacts with oxygen to form Fe2O3. If the atomic mass of iron is 56, the mass of oxygen that reacts with 2.5moles of iron is


50.

If one mole of a gas (mol.wt-40) occupies a volume of 20 litres, under the same conditions of temperature and pressure the volume occupied by 2 moles of gas (mol.wt=80) is

Answer»

If one mole of a gas (mol.wt-40) occupies a volume of 20 litres, under the same conditions of temperature and pressure the volume occupied by 2 moles of gas (mol.wt=80) is