This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.
| 1. |
2. Which scientist re-propounded the concept of a stable universe?(b) Oparin(a) Darwin(c) Einsteirn(d) Stanley Mi |
|
Answer» It is was Albert Einstein, but interesting to know that his own theory predicts that universe is expanding, for making it stable he adds cosmological constant, in Field Equation |
|
| 2. |
33. Select correct statement (w.r.t. somaclones)(1) Somaclones of tomato and banana have beenproduced on commercial scale(2) They are genetically not identical(3) They are produced by sexual reproduction(4) Can be generated in field |
|
Answer» The method of producing thousands of plants through tissue culture is called micro propagation. Each of these plants will be genetically identical to the original plant. Hence they are called ‘Somaclones’. Tomato and banana are produced through micro propagation for commercial purposes. |
|
| 3. |
Column ip) Virusesa) VaccineR) Antibioticil) Edward jenner5) Antiseptic | iv) #vanowckyT) Microscope) loseph ListerU) Pasteurization vi) Christian GramV) Staining2,Column-ili) Alexandar Fiemingil) Louis Pasteurvil) Antony Van Leuwenhock(D) P- iv, Q ,RI,SvT vi, U ii,V.vi |
|
Answer» thanks for your prestigious answer i have posted multiple questions try to answer that question also |
|
| 4. |
37) Draw neat labelled diagram of eukaryotic animal cell. |
| Answer» | |
| 5. |
Draw a neat labelled diagram of vertical section Human Heart |
| Answer» | |
| 6. |
Draw a neat labelled diagram of Stomata & State its fuctions. |
| Answer» | |
| 7. |
59. Describe the method of pasteurisation for the preservation of milk |
|
Answer» first milk is heated for 2 or 3 second in 138 centigrade |
|
| 8. |
Question 4. Who discovered Malaria Parasite? |
|
Answer» Scientific studies only became possible after the discovery of the parasites themselves byCharles Louis Alphonse Laveranin 1880 and the incrimination of mosquitoes as the vectors, first for avian malaria by Ronald Ross in 1897 and then for human malaria by the Italian scientists Giovanni Battista Grassi, Amico Charles Louis Alphonse |
|
| 9. |
what is porin |
|
Answer» Any of a class of proteins whose molecules can form channels (large enough to allow the passage of small ions and molecules) through cellular membranes i's just chking how to hndle ds appbut thnks for ur co-operation...:) |
|
| 10. |
explain the basis for grouping organisms into five kingdoms. |
|
Answer» R.H. Whittaker proposed afive kingdomClassification of livingorganismson thebasisof Linnaeus' system of Classification. Thefive kingdomsproposed by Whittaker are Monera, Protista, Fungi, Plantae, and Animalia. |
|
| 11. |
3.Explain the basis for grouping organisms into five kingdon |
| Answer» | |
| 12. |
for developing a hierarchy in classneauollExplain the basis for grouping organisms into five kingdoms.3.t nre thr maior divisions in the Plantae? What is the basis |
|
Answer» Thebasis for groupingorganismsinto five kingdomare, (i) Whether the organisms are made of prokaryotic or eukaryotic cells. (ii) Whether the organism is unicellular, i.e., a cell living singly or organizedintomulticellular and thus complex organisms. |
|
| 13. |
4. Duo5. The bacterium calledim calledcan take atmospheric nitrogen and convert it into a solublecan take atmospheric nitrogen and convert it into a solubleform called |
|
Answer» Bacteria called RHIZOBIUM present in the root nodules of leguminous plants can convert atmospheric nitrogen into water soluble nitrogen compounds called NITRATES. |
|
| 14. |
ORThe flow of energy between various components of the environment has heen extensively studied. Give an outline ofthe findings. 13)SECTION D6 al Hou O shou eynerimentally tha, metals are good conductors of heat. |
|
Answer» The flow of energy between various components of the environment occur as : Solar energy is trap and fixed by the producers (plants) and is converted into biomass. Primary consumer (Herbivore) absorbs this stored energy in plants through digestion and transforms it into the form of energy that they are needed. Secondary consumer (carnivore) consume primary consumer and absorbed the stored energy through the process of digestion. The last link in the food chain is that of decomposer which break down organic matter of the top consumer and release it into the soil. They also break down plants, herbivores and carnivores that are not eaten by organisms on the food chain. The follow of energy in an ecosystem at each trophic level and each time about 90% of the energy is lost, which is being lost as heat into the environment and some lost as incompletely digested food. At each trophic level about 10% of the energy the previous trophic level is passed to the next food chain. This is known as 10% law. The proces is well explained with the help of an animation in your study material at |
|
| 15. |
2sin 61sin 20mwatt(a) cot 61°(0) Lan 61"22 241961600(c)0(d) tan27 |
|
Answer» sin61/sin29sin 61/sin(90-61)= sin61/cos61= tan61option b is right sin61/sin29 ,sin61/sin(90-61)=sin61/cos61=tan61 option b is right Tan61 is correct answer Tan61 is correct answer option b is correct assin/cos = tanhere sin61/sin( 90-61)sin 61/ cos 61tan61 tan 61°is the correct answer tan 61 is the answer sin 61°/sin 29°= sin 61°/cos 61° = tan 61°Therefore, (b) tan 61° is the right answer. sin 61°/sin 29° = tan 61° Option (b) is the right answer . 0 is answer is right Option B is the Correct Answer for the given problem Option d is correct option tan61is the right answer option (b) is the best answer option B is Right answers. Tan61 is right answer h 1 is the best answer tan61 is a right answer 32 is the best answer 1/4 is the best answer Tan61'is correct answer (b) tan 60° answer B is the correct answer Tan 61' hoga because sin61/sin29 ko karne par aayega option B is the correct answer hai sin61°\sin29°=sin61°\sin(90°-61°)=sin61°\cos61°=tan61° anawer we know that sin /cos = tan so its answer is tan61° The answer is B)tan61 sin61/sin90-61=tan61 tan 61° is best answer b is the correct answer d is correct answer of this question tan 61' is the right answer sin61/sin29sin61/sin(90-61)=sin61/cos61=tan61 the correct answer ha tan61° Tan61° answer ekdam sahi h tan 61 is the correct answer sin 61/sin 29 : tan 61 tan61 is the right answer Tan61 is right answer hai b tan 61 is the correct answer. tan61 is correct answer option B.tan61° is the correct answer. tan 61° is correct answer 0 answer you question tan61* hai, option B is right answer sin61°/sin(90°-61°)sin61°/cos61°tan61° (b) is the correct option tan 61 is right answer correct answer is option b tan61 is right answer sin61/sin29sin16/sin(90–61)=sin61/cos61=tan61 option b is the correct answer sin(90-61)/sin29=cos29/sin29=cot61 (B) tan61 answer best hai 0 answer your question sin/cos=tan61 right answer option B is the answer option b is right answer sin 61°/sin 29°=sin61°/cos (90°-29°) = tan 61°so, tan 61° is correct answer b) tan 61° is right answer because sin61°/sin29°= sin61°/sin(90-61) = sin61°/cos61° = tan61° (b) tan61 is the right answer tan61° is correct answer the correct answer will be of sin 61/sin 29 is tan 61 (c ) 0 विकल्प सही है b number is correct answer b is right answer Sin answer is tan61°. sin61°/sin29°=sin61°/cos61°= tan61° B) tan 61 is the answeras sin(90-29) = cos 61so,sin 61/cos61 = tan61 tan 61 is correct answer Hence option b is correct answer c is correct answer of this question b option is the right answer tan 61 because sin61/sin(90-61)sin61/cos61tan61 b is correct answer of this question Sin61/sin29=sin61/cos61=tan61(b) cot 61 is right answer this question sin61/sin29sin61/sin(90-61)sin61/cos61tan61 sin61/sin29: tan 61tan61 is correct answer |
|
| 16. |
oexplain the procedure andprecations to prove thepresence of strach inleaves a experiment. |
|
Answer» Procedure: Remove a green leaf from a plant that has been exposed to sunlight for a few hours Half-fill a 250cm3 beaker with water. Heat the water until it boils. Keep the water at boiling point. Use the forceps to place the leaf in the boiling water. Boil for 2 minutes. Turn off the Bunsen Burner. (If you are using a heat source without a naked flame - electric water bath or hot plate - this step is unnecessary.) Place the boiled leaf in a boiling tube containing 90% ethanol. Place the boiling tube in hot water and boil for 10 minutes or until the leaf decolourizes. ( It may be necessary to replace the ethanol) Gently remove the leaf and wash with a fine trickle of cold tap water. Spread the leaf evenly on a white tile. Add a few drops of iodine/potassium iodide solution to the leaf and note any observations |
|
| 17. |
1. Why do organisms differ from each other when they all have cells having similar structuresand organelles ? |
|
Answer» Ans :- Yes, cellular organisation is the basic characteristic of all living organisms. Exceptions :- Viruses and Viroids (Made up of single strand of RNA or DNA, acellular structure. |
|
| 18. |
What is meant by emasculation? |
|
Answer» Emasculation of a human male is the removal of both the penis and the testicles, the external male sex organs. Depending on the context, this may be seen as consensual body modification, or non-consensual genital mutilation. |
|
| 19. |
What is emasculation? Why and when is it done? |
| Answer» | |
| 20. |
Make sketches of animal and plant cells. State three differencesbetween them. |
|
Answer» again? |
|
| 21. |
5. Make sketches of animal and plant cells. State three differencesbetween them. |
| Answer» | |
| 22. |
In diploid organisms, specialised cells called meiocytes samcell)l undeete mother-rgo meiosis. At the end of meiosis, only one set of chromosomes |
|
Answer» A meiocyte is a type of cell that differentiates into a gamete through the process of meiosis. Through meiosis, the diploid meiocyte divides into four genetically different haploid gametes. The control of the meiocyte through the meiotic cell cycle varies between different groups of organisms. |
|
| 23. |
11. Identify each part in a flowering plant and write whether it is haploid(n) or diploid (2n).(a) Ovary(b) Anther(c) Egg(d) Pollen(e) Male gamete(f) Zygote |
| Answer» | |
| 24. |
9. 'Making antiviral medicines is harder than making antibacterial medicines'. Explain this statement |
|
Answer» This is because anti bacterial medicines block the formation of cell wall of the bacteria. When, bacterias dont have cell wall, they dont divide and hence they die. While, viruses dont have their machinery of own. When they enter into our body, they use our cells as their machinery. So, to kill viruses we've to kill some of our cells as well. Hence, making anti-viral drugs is more difficult than making anti-bacterial drugs. Bacterial DNA is likely stable but viral DNA is mutate at faster rate so we can't make antiviral medicine |
|
| 25. |
iven an account ofcalvin cycle |
| Answer» | |
| 26. |
Explain the fluid mosaic model of plasma membrane with neat labeled diagram. |
|
Answer» The fluid mosaic model explains various observations regarding the structure of functional cell membranes. According to this model, there is a lipid bilayer in which the protein molecules are embedded. The lipid bilayer gives fluidity and elasticity to the membrane. |
|
| 27. |
Who demonstrated tobacco mosaic disease tobe infectious? |
|
Answer» The two scientists, the work of which lead to this virus was Ivanovoski and Beijernick |
|
| 28. |
.2 STRUCTURE OF TOBACCO MOSAIC VIRUS (Tacco mosaic virus (TMV) is a positive-sense single strande |
| Answer» | |
| 29. |
8. Who demonstrated tobacco mosaic disease tobe infectious? |
|
Answer» Two scientists contributed to the discovery of the first virus, Tobacco mosaic virus. Ivanoski reported in 1892 that extracts from infected leaves were still infectious after filtration through a Chamberland filter-candle. Bacteria are retained by such filters, a new world was discovered: filterable pathogens. |
|
| 30. |
(2)WhatisthemainauseforthespreatbWhat is the first aid you will provide to a person having frequent bowels and diarrhoea?(3) |
|
Answer» Diarrhoea is the frequent passage of loose, watery, soft stools with or without abdominal bloating, pressure, and cramps. Diarrhoea can be treated at home and it will resolve itself in a few days. Drink plenty of fluids, and follow the "BRAT" diet (bananas, rice, apple sauce and toast) to help ease symptoms. Take care to ensure infants and children stay hydrated. Electrolyte solutions such as Pedialyte can be helpful. |
|
| 31. |
2.a) dicen and animal cell (b) Prokaryotic and eukaryone elsWhat would happens to the cell if nucleus is removed? Give two reasons to suppoyour answer? (AS 1) |
|
Answer» if nucleus will be removed following things can happen:# the cell will not be able to function properly # the cell will not be able to divide # the cell may diethis is because the nucleus is said to be the "brain of cell" if it is removed all the functions will stop the cell will not be able to work Nucleus is the main head of the cell which determines the way and function the cell will carry out. If nucleus is removed then the cell will not able to work, reproduce ,perform chemical reaction etc. . If Nucleus Is Removed:1. No metabolic activities can be carried out in cell.2. Cell will die.3. It will not divide. |
|
| 32. |
hat will happen if there are no platelets in the blood? |
| Answer» | |
| 33. |
B. Causativeagentofredtideisa. Dinoflagellatec. Chrysophyteb. Euglenoidd. Lichen |
|
Answer» a) Dinoflagellate is the answer a)................. is crct it's only my guess.... |
|
| 34. |
3. saliva containsthat help in digestion.(o) digestivejuices(i) nutrients (i) enzymes(ili) enzymes |
|
Answer» Saliva contains the enzyme amylase that breaks some starches down into maltose and dextrin. Thus Saliva contains enzyme that help in digestion |
|
| 35. |
Describe the important properties of enzymes |
| Answer» | |
| 36. |
12. What are enzymes? Discuss their characteristics. |
|
Answer» Enzymes are biological catalysts. They speed up reactions although they are not changed in the reaction. Enzymes areproteins, and therefore are folded chains of amino acids with a specific shape.Enzymes are specific: they have a specific shape, therefore only a certain substrate will fit its active site. There are two theories of enzyme action: Lock and Key and Induced Fit. The lock and key theory states that only a certain substrate will fit a certain active site, just like a key fits a lock. Induced Fit, likewise, states that enzymes wrap around substrates, attracted to each other by opposite charges, forming an enzyme substrate complex. |
|
| 37. |
What do you mean by co-enzymes? |
|
Answer» Coenzymes aresmall molecules. They cannot by themselves catalyze a reaction but theycanhelp enzymes todoso. In technical terms,coenzymes areorganic nonprotein molecules that bind with the protein molecule (apoenzyme) to form the active enzyme (holoenzyme). |
|
| 38. |
what is bile juice |
|
Answer» Liver se bile juice nikalta hai Bile Juiceis a dark green to yellowish brown fluid, produced by the liver of most vertebrates, that aids the digestion of lipids (fat) in the small intestine. In humans,bileis produced continuously by the liver (liverbile), and stored and concentrated in the gallbladder (gallbladderbile). bile juice is released by liver Privacy & Trust Info Medical Definition of Bile Medical Author:William C. Shiel Jr., MD, FACP, FACR Reviewed on12/4/2018 Bile:Bile is a yellow-green fluid that is made by the liver, stored in the gallbladder and passes through the common bile duct into the duodenum where it helps digest fat. The principal components of bile arecholesterol, bile salts, and the pigment bilirubin. An imbalance between these components of bile leads to the formation ofgallstones. Gallstones can thus be composed of different materials. Cholesterol gallstones form when there is an imbalance between the amounts of cholesterol and the bile salts. Cholesterol is normally kept in liquid form by the dissolving action of the bile salts. An increased amount of cholesterol in the bile overwhelms the dissolving capacity of the bile salts and leads to the formation of cholesterol gallstones. Similarly, a deficiency of bile salts promotes cholesterol gallstone formation. Pigment gallstones are frequently associated with chronic infection in the bile, especially in certain Asian countries where parasitic infection of the bile ducts is common. Patients with blood diseases that cause excessive breakdown of red blood cells can have increased amounts of bilirubin (breakdown product of red cells) in the bile, thus causing bilirubin gallstone formation.  Bile Juiceis a dark green to yellowish brown fluid, produced by the liver of most vertebrates, that aids the digestion of lipids (fat) in the small intestine. In humans,bileis produced continuously by the liver (liverbile), and stored and concentrated in the gallbladder (gallbladderbile). Bile Juiceis a dark green to yellowish brown fluid, produced by the liver of most vertebrates, that aids the digestion of lipids (fat) in the small intestine. In humans,bileis produced continuously by the liver (liverbile), and stored and concentrated in the gallbladder (gallbladderbile). Sincebileincreases the absorption of fats, it is an important part of the absorption of the fat-soluble substances, such as the vitamins A, D, E, and K. Besidesitsdigestivefunction,bileserves also as the route of excretion for bilirubin, a byproduct of red blood cells recycled by the liver. the enzyme secreted by liver bile juice secrets from bile duct in liver it absorbs the fat soluble subtance such as the vitamins A ,D,E,K. |
|
| 39. |
majority of cellular enzymes function best at ___ PH |
|
Answer» The cytoplasm ofmostcells has a pH of about 7.0, so we might expect ourenzymetowork bestthere. However, while ourenzymedidworkfaster at a pH of 7.0 than at pH 5.5, based on thebestfit line, a slightly acidic pH is probably optimal for our turnip peroxidase. ... The low pH probably denatured theenzyme |
|
| 40. |
ues2. Describe morophological forms of bacteria. |
|
Answer» Bacteria are classified by direct examination with thelight microscopeaccording to their morphology and arrangement. The basic forms are spheres (coccus) and round-ended cylinders (bacillus). But there may be others such as helically twisted cylinders (spirochetes), cylinders curved in one plane (Selenomonads) and unusual morphologies (such as the squareArchaeaHaloquadratum). They also conform diplos, tetrads, staphylos, streptos, palizadas etc. |
|
| 41. |
describe bacteria |
|
Answer» Bacteria are microscopic living organisms, usually one-celled, that can be found everywhere. They can be dangerous, such as when they cause infection, or beneficial, as in the process of fermentation (such as in wine) and that of decomposition. |
|
| 42. |
write down the function of blood vessels. |
|
Answer» Blood vessels function to transport blood. In general, arteries and arterioles transport oxygenated blood from the lungs to the body and its organs, and veins and venules transport deoxygenated blood from the body to the lungs. Blood vessels also circulate blood throughout the circulatory system Oxygen (bound to hemoglobin in red blood cells) is the most critical nutrient carried by the blood. In all arteries apart from the pulmonary artery, hemoglobin is highly saturated (95–100%) with oxygen. In all veins apart from the pulmonary vein, the saturation of hemoglobin is about 75%. (The values are reversed in the pulmonary circulation.) In addition to carrying oxygen, blood also carries hormones, waste products and nutrients for cells of the body. Blood vessels do not actively engage in the transport of blood (they have no appreciable peristalsis). Blood is propelled through arteries and arterioles through pressure generated by the heartbeat. |
|
| 43. |
The blood vessels of theabsorb the digested food. |
|
Answer» villi is present if instentine absorb the food |
|
| 44. |
1. The walls of large blood vessels reccive their oxygen and nutrients from blood in vessels are known asa) capillariesc) vasa vasorumb) sinusoidsd) arterioles2. The thickest layer of an artery wall is the tunicaa) extern3c) mediab) internad) intima3. The layer of an artery wall that contains endothelium is thea) tunica internac) tunica extenab) tunica mediad) none of the above4. Vessels that function as a pressure rescrvoir to ensure blood flow while the ventricles are relased are thea) venuelsc) sinusoidsb) clastic arteriesd) arterioles5. Arterioles play a key role in regulating blood pressure because of their role in regulating resistance tollowa) trucb) false6. The only blood vessels whove walls permit exchange between the blood and the surrounding interstitialfluids area) veinsc) venulesb) capillaricd) arterioles7. Blood flow through a capillary is regulated by thea) vasa vasorumc) precapillary sphincterb) capillary plexusd) arterial anastomosis8. The microcirculation consists of the followings excepta) a capillaryc) a venuleb) an arteoled) a vein9. Three different types of capillaries include continuous capillaries, fenestrated capillanes, andsinusoidsb) falsea) True |
|
Answer» 1.capilaries2.tunica media3.tunica interna4.elastic arteries 5.false6.capillaries7.precapilary sphincters8.a capillary9.true |
|
| 45. |
describe the types of virus |
|
Answer» (a) Plant Viruses (Phytophagineae): They cause disease in plants, e.g., Tobacco Mosaic Virus (Fig. 2.2); Potato Mosaic Viruses, Banana Bunchy Top Virus, Tomato Leaf Curl Virus, (b) Animal Viruses (Zoophagineae, Fig. 2.3). They parasitize animals including human beings, e.g., Poliomyelitis Virus, Influenza Virus, Small Pox Virus, Hepatitis Virus, Mumps Virus, Rhino Viruses (common cold viruses), (c) Phagineae: They parasitise lower organisms— bacteriophages (bacterial viruses, e.g., T2, T4, lambda, Fig. 2.4), coliphages (bacteriophages of Escherichia coli), cyanophages (blue-green algal viruses, e.g., LPP-1, SM-1, N-l), phycophages (algal viruses), mycophages (fungal viruses), zymophages (mycophages of yeast). |
|
| 46. |
Translocation of solutes primarily takes place through(A) phloenm27.(B) xylem(C) cortex(D) pith |
|
Answer» Downward translocation takes place through pholem. So, answer is A) phloem. |
|
| 47. |
(c) Which plant isste is n33. (e) Draw a labelled diagram of () a xylem vessel, and (Gi) a sieve tube (or phloem).t of materials in xylem and phloem ? |
| Answer» | |
| 48. |
. Cells of imeristem are nonvacuolated except the meristematic(a) Cambium(c) Phellenm(b) Xylem(d) Phelloderm |
|
Answer» xylem are nonvaculoted |
|
| 49. |
4.Which one of these is not a blood vessel?C)Artery(ii)Vein(ii)Capillary(iv)Xylem |
|
Answer» xylem has not blood vessels plze like xylem has not blood vessels plze like |
|
| 50. |
What is Xylem? Name the four elements of Xylem and write one function of each. |
|
Answer» Xylem is a Vascular and mechanical tissue . In other words , it is a conducting tissue . Xylem is composed of cell ( called elements ) of four different types :1) Tracheids 2) Vessels or tracheae 3) Xylem parenchyma and4) Xylem scleroderma ( or fibre ) . the four elements of xylem aretracheidsvesselsxylem parenchymaxylem fibres Trachieds - they transport water and Minerals vertically. Vessels - they also transport water and mineral vertically. Xylem parenchyma - Stores food and helps in sideway conduction of water. Xylem fibres - they are mostly supportive in functions. Please like the solution |
|