1.

If a fuel cell, methanol is used as fuel and oxygen gas is used as an oxidiser. The reaction is CH3OH(l)+32O2(g)→CO2(g)+2H2O(g) At 298 K standard Gibb’s energies of formation for CH3OH(l),H2O(l), and CO2(g) are –166.2, –237.2 and −394.4 kJ mol−1, respectively. If the standard enthalpy of combustion of methanol is –726 kJ mol−1, the efficiency of the fuel cell will be:

Answer»

If a fuel cell, methanol is used as fuel and oxygen gas is used as an oxidiser. The reaction is CH3OH(l)+32O2(g)CO2(g)+2H2O(g)

At 298 K standard Gibb’s energies of formation for CH3OH(l),H2O(l), and CO2(g) are 166.2, 237.2 and 394.4 kJ mol1, respectively. If the standard enthalpy of combustion of methanol is 726 kJ mol1, the efficiency of the fuel cell will be:



Discussion

No Comment Found