1.

Ethyl chloride (C2H5Cl) is prepared by reaction of ethylene with hydrogen chloride: C2H4(g)+HCl(g)→C2H5Cl(g)△H=−72.3 kJ/mol What is the value of △U (in kJ), if 98 g of ethylene and 109.5 g of HCl are allowed to react at 300 K?

Answer»

Ethyl chloride (C2H5Cl) is prepared by reaction of ethylene with hydrogen chloride:
C2H4(g)+HCl(g)C2H5Cl(g)H=72.3 kJ/mol
What is the value of U (in kJ), if 98 g of ethylene and 109.5 g of HCl are allowed to react at 300 K?



Discussion

No Comment Found