1.

(a) Write the chemical reaction involved in Etard reaction. (b) Arrange the following in the increasing order of their reactivity towards nucleophilic addition reaction: CH3−CHO, C6H5COCH3, HCHO (c) Why is pKa of Cl−CH2−COOH lower than the that of CH3COOH? (d) Write the product in the following reaction: CH3CH2CH=CH−CH2CN1.(i−Bu)2AIH−−−−−−−−−→2.H2O (e) A and B are two functional isomers of compound C3H6O. On heating with NaOH and I2, isomer A forms yellow precipitate of iodoform whereas isomer B does not form any precipitate. Write the formulae of A and B.

Answer» (a) Write the chemical reaction involved in Etard reaction.

(b) Arrange the following in the increasing order of their reactivity towards nucleophilic addition reaction:

CH3CHO, C6H5COCH3, HCHO

(c) Why is pKa of ClCH2COOH lower than the that of CH3COOH?

(d) Write the product in the following reaction:
CH3CH2CH=CHCH2CN1.(iBu)2AIH−−−−−−−−2.H2O

(e) A and B are two functional isomers of compound C3H6O. On heating with NaOH and I2, isomer A forms yellow precipitate of iodoform whereas isomer B does not form any precipitate. Write the formulae of A and B.


Discussion

No Comment Found